changed everything from filcnaplo to refilc finally

refilc_mobile_ui/lib/screens/error_report_screen.dart

@@ -0,0 +1,217 @@
+import 'dart:io';
+import 'dart:math';
+
+import 'package:refilc/api/client.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'error_report_screen.i18n.dart';
+
+class ErrorReportScreen extends StatelessWidget {
+  final FlutterErrorDetails details;
+
+  const ErrorReportScreen(this.details, {super.key});
+
+  @override
+  Widget build(BuildContext context) {
+    return Scaffold(
+      backgroundColor: Colors.red,
+      body: SafeArea(
+        child: Padding(
+          padding: const EdgeInsets.all(12.0),
+          child: Column(
+            children: [
+              const Align(
+                alignment: Alignment.topLeft,
+                child: BackButton(),
+              ),
+              const Spacer(),
+              const Icon(
+                FeatherIcons.alertTriangle,
+                size: 100,
+              ),
+              const Spacer(),
+              Padding(
+                padding: const EdgeInsets.only(bottom: 4.0),
+                child: Text(
+                  "uhoh".i18n,
+                  style: const TextStyle(
+                    color: Colors.white,
+                    fontSize: 32.0,
+                    fontWeight: FontWeight.w900,
+                  ),
+                ),
+              ),
+              Text(
+                "description".i18n,
+                style: TextStyle(
+                  color: Colors.white.withOpacity(.95),
+                  fontSize: 24.0,
+                  fontWeight: FontWeight.w700,
+                ),
+              ),
+              const Spacer(),
+              Stack(
+                alignment: Alignment.topRight,
+                children: [
+                  Container(
+                    height: 110.0,
+                    width: double.infinity,
+                    padding: const EdgeInsets.all(12.0),
+                    decoration: BoxDecoration(
+                        borderRadius: BorderRadius.circular(12.0),
+                        color: Colors.black.withOpacity(.2)),
+                    child: SingleChildScrollView(
+                      physics: const BouncingScrollPhysics(),
+                      child: Text(
+                        details.exceptionAsString(),
+                        style: const TextStyle(fontFamily: 'SpaceMono'),
+                      ),
+                    ),
+                  ),
+                  IconButton(
+                    icon: const Icon(FeatherIcons.info),
+                    onPressed: () {
+                      showDialog(
+                          context: context,
+                          builder: (context) => StacktracePopup(details));
+                    },
+                  )
+                ],
+              ),
+              const Spacer(),
+              SizedBox(
+                width: double.infinity,
+                child: TextButton(
+                  style: ButtonStyle(
+                    padding: MaterialStateProperty.all(
+                        const EdgeInsets.symmetric(vertical: 14.0)),
+                    backgroundColor: MaterialStateProperty.all(Colors.white),
+                    shape: MaterialStateProperty.all(
+                      RoundedRectangleBorder(
+                          borderRadius: BorderRadius.circular(12.0)),
+                    ),
+                  ),
+                  child: Text(
+                    "submit".i18n,
+                    style: const TextStyle(
+                      color: Colors.black,
+                      fontSize: 17.0,
+                      fontWeight: FontWeight.bold,
+                    ),
+                  ),
+                  onPressed: () => reportProblem(context),
+                ),
+              ),
+              const SizedBox(height: 32.0)
+            ],
+          ),
+        ),
+      ),
+    );
+  }
+
+  Future reportProblem(BuildContext context) async {
+    final report = ErrorReport(
+      os: "${Platform.operatingSystem} ${Platform.operatingSystemVersion}",
+      error: details.exceptionAsString(),
+      version: const String.fromEnvironment("APPVER", defaultValue: "?"),
+      stack: details.stack.toString(),
+    );
+    FilcAPI.sendReport(report);
+    Navigator.pop(context);
+  }
+}
+
+class StacktracePopup extends StatelessWidget {
+  final FlutterErrorDetails details;
+
+  const StacktracePopup(this.details, {super.key});
+
+  @override
+  Widget build(BuildContext context) {
+    String stack = details.stack.toString();
+
+    return Container(
+      margin: const EdgeInsets.all(32.0),
+      child: Scaffold(
+        backgroundColor: Colors.transparent,
+        body: Container(
+          decoration: BoxDecoration(
+            color: Theme.of(context).scaffoldBackgroundColor,
+            borderRadius: BorderRadius.circular(4.0),
+          ),
+          padding: const EdgeInsets.only(top: 15.0, right: 15.0, left: 15.0),
+          child: Column(
+            children: [
+              Expanded(
+                child: ListView(children: [
+                  Padding(
+                    padding: const EdgeInsets.only(bottom: 10.0),
+                    child: Text(
+                      "details".i18n,
+                      style: const TextStyle(fontSize: 20.0),
+                    ),
+                  ),
+                  ErrorDetail(
+                    "error".i18n,
+                    details.exceptionAsString(),
+                  ),
+                  ErrorDetail("os".i18n,
+                      "${Platform.operatingSystem} ${Platform.operatingSystemVersion}"),
+                  ErrorDetail(
+                      "version".i18n,
+                      const String.fromEnvironment("APPVER",
+                          defaultValue: "?")),
+                  ErrorDetail(
+                      "stack".i18n, stack.substring(0, min(stack.length, 5000)))
+                ]),
+              ),
+              TextButton(
+                  child: Text("done".i18n,
+                      style: TextStyle(
+                          color: Theme.of(context).colorScheme.secondary)),
+                  onPressed: () {
+                    Navigator.of(context).pop();
+                  })
+            ],
+          ),
+        ),
+      ),
+    );
+  }
+}
+
+class ErrorDetail extends StatelessWidget {
+  final String title;
+  final String content;
+
+  const ErrorDetail(this.title, this.content, {super.key});
+
+  @override
+  Widget build(BuildContext context) {
+    return Padding(
+      padding: const EdgeInsets.only(bottom: 10.0),
+      child: Column(
+        crossAxisAlignment: CrossAxisAlignment.start,
+        children: [
+          Text(
+            title,
+            style: const TextStyle(fontWeight: FontWeight.bold),
+          ),
+          Container(
+              padding:
+                  const EdgeInsets.symmetric(horizontal: 6.5, vertical: 4.0),
+              margin: const EdgeInsets.only(top: 4.0),
+              decoration: BoxDecoration(
+                  color: Colors.black26,
+                  borderRadius: BorderRadius.circular(4.0)),
+              child: Text(
+                content,
+                style: const TextStyle(
+                    fontFamily: 'SpaceMono', color: Colors.white),
+              ))
+        ],
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/error_report_screen.i18n.dart

@@ -0,0 +1,45 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension SettingsLocalization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          "uhoh": "Uh Oh!",
+          "description": "An error occurred!",
+          "submit": "Submit",
+          "details": "Details",
+          "error": "Error",
+          "os": "Operating System",
+          "version": "App Version",
+          "stack": "Stack Trace",
+          "done": "Done",
+        },
+        "hu_hu": {
+          "uhoh": "Ajajj!",
+          "description": "Hiba történt!",
+          "submit": "Probléma Jelentése",
+          "details": "Részletek",
+          "error": "Hiba",
+          "os": "Operációs Rendszer",
+          "version": "App Verzió",
+          "stack": "Stacktrace",
+          "done": "Kész",
+        },
+        "de_de": {
+          "uhoh": "Uh Oh!",
+          "description": "Ein Fehler ist aufgetreten!",
+          "submit": "Abschicken",
+          "details": "Details",
+          "error": "Fehler",
+          "os": "Betriebssystem",
+          "version": "App Version",
+          "stack": "Stack Trace",
+          "done": "Fertig",
+        },
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}

refilc_mobile_ui/lib/screens/error_screen.dart

@@ -0,0 +1,65 @@
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:flutter/cupertino.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+
+class ErrorScreen extends StatelessWidget {
+  const ErrorScreen(this.details, {super.key});
+
+  final FlutterErrorDetails details;
+
+  @override
+  Widget build(BuildContext context) {
+    return Scaffold(
+      appBar: AppBar(
+        surfaceTintColor: Theme.of(context).scaffoldBackgroundColor,
+        leading: BackButton(color: AppColors.of(context).text),
+        shadowColor: Colors.transparent,
+      ),
+      body: SafeArea(
+        child: Padding(
+          padding: const EdgeInsets.symmetric(vertical: 12.0, horizontal: 24.0),
+          child: Column(
+            children: [
+              Padding(
+                padding: const EdgeInsets.all(12.0),
+                child: Icon(FeatherIcons.alertTriangle,
+                    size: 48.0, color: AppColors.of(context).red),
+              ),
+              const Padding(
+                padding: EdgeInsets.all(12.0),
+                child: Text(
+                  "An error occurred...",
+                  style: TextStyle(fontWeight: FontWeight.w500, fontSize: 16.0),
+                ),
+              ),
+              Expanded(
+                child: Container(
+                  padding: const EdgeInsets.all(12.0),
+                  width: double.infinity,
+                  decoration: BoxDecoration(
+                    borderRadius: BorderRadius.circular(14.0),
+                    color: Theme.of(context).colorScheme.background,
+                  ),
+                  child: CupertinoScrollbar(
+                    child: SingleChildScrollView(
+                      physics: const BouncingScrollPhysics(),
+                      child: SingleChildScrollView(
+                        physics: const BouncingScrollPhysics(),
+                        scrollDirection: Axis.horizontal,
+                        child: SelectableText(
+                          ('${details.exceptionAsString()}\n'),
+                          style: const TextStyle(fontFamily: "monospace"),
+                        ),
+                      ),
+                    ),
+                  ),
+                ),
+              ),
+            ],
+          ),
+        ),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/login/login_button.dart

@@ -0,0 +1,30 @@
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:flutter/material.dart';
+
+class LoginButton extends StatelessWidget {
+  const LoginButton({super.key, required this.onPressed, required this.child});
+
+  final void Function()? onPressed;
+  final Widget? child;
+
+  @override
+  Widget build(BuildContext context) {
+    return MaterialButton(
+      elevation: 0,
+      focusElevation: 0,
+      hoverElevation: 0,
+      highlightElevation: 0,
+      minWidth: double.infinity,
+      onPressed: onPressed,
+      shape: RoundedRectangleBorder(borderRadius: BorderRadius.circular(12.0)),
+      color: AppColors.of(context).buttonBackground,
+      textColor: Colors.white,
+      child: Padding(
+        padding: const EdgeInsets.symmetric(
+          vertical: 6.0,
+        ),
+        child: child,
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/login/login_input.dart

@@ -0,0 +1,129 @@
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+
+enum LoginInputStyle { username, password, school }
+
+class LoginInput extends StatefulWidget {
+  const LoginInput(
+      {super.key,
+      required this.style,
+      this.controller,
+      this.focusNode,
+      this.onClear});
+
+  final Function()? onClear;
+  final LoginInputStyle style;
+  final TextEditingController? controller;
+  final FocusNode? focusNode;
+
+  @override
+  State<LoginInput> createState() => _LoginInputState();
+}
+
+class _LoginInputState extends State<LoginInput> {
+  late bool obscure;
+
+  @override
+  void initState() {
+    super.initState();
+    obscure = widget.style == LoginInputStyle.password;
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    String autofill;
+
+    switch (widget.style) {
+      case LoginInputStyle.username:
+        autofill = AutofillHints.username;
+        break;
+      case LoginInputStyle.password:
+        autofill = AutofillHints.password;
+        break;
+      case LoginInputStyle.school:
+        autofill = AutofillHints.organizationName;
+        break;
+    }
+
+    return TextField(
+      focusNode: widget.focusNode,
+      controller: widget.controller,
+      cursorColor: AppColors.of(context).filc,
+      textInputAction: TextInputAction.next,
+      autofillHints: [autofill],
+      obscureText: obscure,
+      scrollPhysics: const BouncingScrollPhysics(),
+      decoration: InputDecoration(
+        // fillColor: Colors.black.withOpacity(0.15),
+        filled: false,
+        enabledBorder: OutlineInputBorder(
+          borderRadius: BorderRadius.circular(12.0),
+          borderSide: BorderSide(
+            width: 1,
+            color: AppColors.of(context).inputBorder,
+          ),
+        ),
+        // focusedBorder: UnderlineInputBorder(
+        //   borderRadius: BorderRadius.circular(12.0),
+        //   borderSide: const BorderSide(width: 0, color: Colors.transparent),
+        // ),
+        focusedBorder: OutlineInputBorder(
+          borderRadius: BorderRadius.circular(12.0),
+          borderSide: BorderSide(
+            width: 1,
+            color: AppColors.of(context).filc,
+          ),
+        ),
+        errorBorder: OutlineInputBorder(
+          borderRadius: BorderRadius.circular(12.0),
+          borderSide: const BorderSide(
+            width: 1,
+            color: Color(0xFFFF0000),
+          ),
+        ),
+        contentPadding: const EdgeInsets.symmetric(horizontal: 16.0),
+        suffixIconConstraints:
+            const BoxConstraints(maxHeight: 42.0, maxWidth: 48.0),
+        suffixIcon: widget.style == LoginInputStyle.password ||
+                widget.style == LoginInputStyle.school
+            ? ClipOval(
+                child: Material(
+                  type: MaterialType.transparency,
+                  child: IconButton(
+                    splashRadius: 20.0,
+                    padding: EdgeInsets.zero,
+                    onPressed: () {
+                      if (widget.style == LoginInputStyle.password) {
+                        setState(() => obscure = !obscure);
+                      } else {
+                        widget.controller?.clear();
+                        if (widget.onClear != null) widget.onClear!();
+                      }
+                    },
+                    icon: widget.style == LoginInputStyle.password
+                        ? Icon(
+                            obscure ? FeatherIcons.eye : FeatherIcons.eyeOff,
+                            color: AppColors.of(context).text.withOpacity(0.8),
+                            weight: 0.1,
+                            size: 18.0,
+                          )
+                        : Icon(
+                            FeatherIcons.x,
+                            color: AppColors.of(context).text.withOpacity(0.8),
+                            weight: 0.1,
+                            size: 20.0,
+                          ),
+                  ),
+                ),
+              )
+            : null,
+      ),
+      style: TextStyle(
+        fontSize: 14.0,
+        fontWeight: FontWeight.w500,
+        color: AppColors.of(context).text.withOpacity(0.8),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/login/login_route.dart

@@ -0,0 +1,21 @@
+import 'package:flutter/material.dart';
+
+Route loginRoute(Widget widget) {
+  return PageRouteBuilder(
+    pageBuilder: (context, animation, secondaryAnimation) => widget,
+    transitionDuration: const Duration(milliseconds: 650),
+    transitionsBuilder: (context, animation, secondaryAnimation, child) {
+      var curve = Curves.easeInOut;
+      var curveTween = CurveTween(curve: curve);
+      var begin = const Offset(1.0, 0.0);
+      var end = Offset.zero;
+      var tween = Tween(begin: begin, end: end).chain(curveTween);
+      var offsetAnimation = animation.drive(tween);
+
+      return SlideTransition(
+        position: offsetAnimation,
+        child: child,
+      );
+    },
+  );
+}

refilc_mobile_ui/lib/screens/login/login_screen.dart

@@ -0,0 +1,390 @@
+// import 'dart:async';
+
+import 'package:refilc/api/client.dart';
+import 'package:refilc/api/login.dart';
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:refilc_mobile_ui/common/custom_snack_bar.dart';
+import 'package:refilc_mobile_ui/common/system_chrome.dart';
+import 'package:refilc_mobile_ui/screens/login/login_button.dart';
+import 'package:refilc_mobile_ui/screens/login/login_input.dart';
+import 'package:refilc_mobile_ui/screens/login/school_input/school_input.dart';
+import 'package:refilc_mobile_ui/screens/settings/privacy_view.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter/services.dart';
+import 'login_screen.i18n.dart';
+
+class LoginScreen extends StatefulWidget {
+  const LoginScreen({super.key, this.back = false});
+
+  final bool back;
+
+  @override
+  LoginScreenState createState() => LoginScreenState();
+}
+
+class LoginScreenState extends State<LoginScreen> {
+  final usernameController = TextEditingController();
+  final passwordController = TextEditingController();
+  final schoolController = SchoolInputController();
+  final _scrollController = ScrollController();
+
+  LoginState _loginState = LoginState.normal;
+  bool showBack = false;
+
+  // Scaffold Gradient background
+  // final LinearGradient _backgroundGradient = const LinearGradient(
+  //   colors: [
+  //     Color.fromARGB(255, 61, 122, 244),
+  //     Color.fromARGB(255, 23, 77, 185),
+  //     Color.fromARGB(255, 7, 42, 112),
+  //   ],
+  //   begin: Alignment(-0.8, -1.0),
+  //   end: Alignment(0.8, 1.0),
+  //   stops: [-1.0, 0.0, 1.0],
+  // );
+
+  late String tempUsername = '';
+
+  @override
+  void initState() {
+    super.initState();
+    showBack = widget.back;
+
+    SystemChrome.setSystemUIOverlayStyle(const SystemUiOverlayStyle(
+      statusBarColor: Colors.transparent,
+      statusBarIconBrightness: Brightness.light,
+      systemNavigationBarColor: Colors.white,
+      systemNavigationBarIconBrightness: Brightness.dark,
+    ));
+
+    FilcAPI.getSchools().then((schools) {
+      if (schools != null) {
+        schoolController.update(() {
+          schoolController.schools = schools;
+        });
+      } else {
+        ScaffoldMessenger.of(context).showSnackBar(CustomSnackBar(
+          content: Text("schools_error".i18n,
+              style: const TextStyle(color: Colors.white)),
+          backgroundColor: AppColors.of(context).red,
+          context: context,
+        ));
+      }
+    });
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Scaffold(
+      body: Container(
+        decoration: BoxDecoration(color: AppColors.of(context).loginBackground),
+        child: SingleChildScrollView(
+          physics: const ClampingScrollPhysics(),
+          controller: _scrollController,
+          child: Container(
+            decoration:
+                BoxDecoration(color: AppColors.of(context).loginBackground),
+            width: MediaQuery.of(context).size.width,
+            height: MediaQuery.of(context).size.height,
+            child: SafeArea(
+              child: Column(
+                mainAxisAlignment: MainAxisAlignment.center,
+                children: [
+                  Container(
+                    alignment: Alignment.topLeft,
+                    padding: const EdgeInsets.only(left: 16.0, top: 12.0),
+                    child: ClipOval(
+                      child: Material(
+                        type: MaterialType.transparency,
+                        child: showBack
+                            ? BackButton(
+                                color: AppColors.of(context).loginPrimary)
+                            : const SizedBox(height: 48.0),
+                      ),
+                    ),
+                  ),
+                  const SizedBox(
+                    height: 50.0,
+                  ),
+
+                  // app icon
+                  Padding(
+                    padding: EdgeInsets.zero,
+                    child: Image.asset(
+                      'assets/icons/ic_rounded.png',
+                      width: 50.0,
+                    ),
+                  ),
+
+                  // texts
+                  Padding(
+                    padding: const EdgeInsets.symmetric(
+                      horizontal: 10.0,
+                      vertical: 12.0,
+                    ),
+                    child: Text(
+                      'reFilc',
+                      style: TextStyle(
+                        color: AppColors.of(context).loginPrimary,
+                        fontSize: 28.0,
+                        fontWeight: FontWeight.bold,
+                      ),
+                    ),
+                  ),
+                  Padding(
+                    padding: const EdgeInsets.symmetric(
+                      horizontal: 10.0,
+                    ),
+                    child: Text(
+                      'login_w_kreten'.i18n,
+                      textAlign: TextAlign.center,
+                      style: TextStyle(
+                        color: AppColors.of(context).loginPrimary,
+                        fontSize: 18.0,
+                        fontWeight: FontWeight.w500,
+                        height: 1.2,
+                      ),
+                    ),
+                  ),
+
+                  // inputs
+                  Padding(
+                    padding: const EdgeInsets.only(
+                      left: 22.0,
+                      right: 22.0,
+                      top: 150.0,
+                    ),
+                    child: AutofillGroup(
+                      child: Column(
+                        crossAxisAlignment: CrossAxisAlignment.start,
+                        children: [
+                          // username
+                          Padding(
+                            padding: const EdgeInsets.only(bottom: 6.0),
+                            child: Row(
+                              mainAxisAlignment: MainAxisAlignment.spaceBetween,
+                              children: [
+                                Expanded(
+                                  child: Text(
+                                    "username".i18n,
+                                    maxLines: 1,
+                                    style: TextStyle(
+                                      color: AppColors.of(context).loginPrimary,
+                                      fontWeight: FontWeight.w500,
+                                      fontSize: 12.0,
+                                    ),
+                                  ),
+                                ),
+                                Expanded(
+                                  child: Text(
+                                    "usernameHint".i18n,
+                                    maxLines: 1,
+                                    textAlign: TextAlign.right,
+                                    style: TextStyle(
+                                      color:
+                                          AppColors.of(context).loginSecondary,
+                                      fontWeight: FontWeight.w500,
+                                      fontSize: 12.0,
+                                    ),
+                                  ),
+                                ),
+                              ],
+                            ),
+                          ),
+                          Padding(
+                            padding: const EdgeInsets.only(bottom: 12.0),
+                            child: LoginInput(
+                              style: LoginInputStyle.username,
+                              controller: usernameController,
+                            ),
+                          ),
+
+                          // password
+                          Padding(
+                            padding: const EdgeInsets.only(bottom: 6.0),
+                            child: Row(
+                              mainAxisAlignment: MainAxisAlignment.spaceBetween,
+                              children: [
+                                Expanded(
+                                  child: Text(
+                                    "password".i18n,
+                                    maxLines: 1,
+                                    style: TextStyle(
+                                      color: AppColors.of(context).loginPrimary,
+                                      fontWeight: FontWeight.w500,
+                                      fontSize: 12.0,
+                                    ),
+                                  ),
+                                ),
+                                Expanded(
+                                  child: Text(
+                                    "passwordHint".i18n,
+                                    maxLines: 1,
+                                    textAlign: TextAlign.right,
+                                    style: TextStyle(
+                                      color:
+                                          AppColors.of(context).loginSecondary,
+                                      fontWeight: FontWeight.w500,
+                                      fontSize: 12.0,
+                                    ),
+                                  ),
+                                ),
+                              ],
+                            ),
+                          ),
+                          Padding(
+                            padding: const EdgeInsets.only(bottom: 12.0),
+                            child: LoginInput(
+                              style: LoginInputStyle.password,
+                              controller: passwordController,
+                            ),
+                          ),
+
+                          // school
+                          Padding(
+                            padding: const EdgeInsets.only(bottom: 6.0),
+                            child: Text(
+                              "school".i18n,
+                              maxLines: 1,
+                              style: TextStyle(
+                                color: AppColors.of(context).loginPrimary,
+                                fontWeight: FontWeight.w500,
+                                fontSize: 12.0,
+                              ),
+                            ),
+                          ),
+                          SchoolInput(
+                            scroll: _scrollController,
+                            controller: schoolController,
+                          ),
+                        ],
+                      ),
+                    ),
+                  ),
+
+                  // login button
+                  Padding(
+                    padding: const EdgeInsets.only(
+                      top: 35.0,
+                      left: 22.0,
+                      right: 22.0,
+                    ),
+                    child: Visibility(
+                      visible: _loginState != LoginState.inProgress,
+                      replacement: const Padding(
+                        padding: EdgeInsets.symmetric(vertical: 6.0),
+                        child: CircularProgressIndicator(
+                          valueColor:
+                              AlwaysStoppedAnimation<Color>(Colors.white),
+                        ),
+                      ),
+                      child: LoginButton(
+                        child: Text("login".i18n,
+                            maxLines: 1,
+                            style: const TextStyle(
+                              fontWeight: FontWeight.bold,
+                              fontSize: 20.0,
+                            )),
+                        onPressed: () => _loginAPI(context: context),
+                      ),
+                    ),
+                  ),
+
+                  // error messages
+                  if (_loginState == LoginState.missingFields ||
+                      _loginState == LoginState.invalidGrant ||
+                      _loginState == LoginState.failed)
+                    Padding(
+                      padding: const EdgeInsets.only(
+                          top: 8.0, left: 12.0, right: 12.0),
+                      child: Text(
+                        [
+                          "missing_fields",
+                          "invalid_grant",
+                          "error"
+                        ][_loginState.index]
+                            .i18n,
+                        style: const TextStyle(
+                          color: Colors.red,
+                          fontWeight: FontWeight.w500,
+                        ),
+                        textAlign: TextAlign.center,
+                      ),
+                    ),
+                  const SizedBox(height: 22.0),
+
+                  // privacy policy
+                  GestureDetector(
+                    onTap: () => PrivacyView.show(context),
+                    child: Text(
+                      'privacy'.i18n,
+                      style: TextStyle(
+                        color: AppColors.of(context).loginSecondary,
+                        fontWeight: FontWeight.w500,
+                        fontSize: 14.0,
+                      ),
+                    ),
+                  ),
+
+                  const Spacer(),
+                ],
+              ),
+            ),
+          ),
+        ),
+      ),
+    );
+  }
+
+  void _loginAPI({required BuildContext context}) {
+    String username = usernameController.text;
+    String password = passwordController.text;
+
+    tempUsername = username;
+
+    if (username == "" ||
+        password == "" ||
+        schoolController.selectedSchool == null) {
+      return setState(() => _loginState = LoginState.missingFields);
+    }
+
+    // ignore: no_leading_underscores_for_local_identifiers
+    void _callAPI() {
+      loginAPI(
+          username: username,
+          password: password,
+          instituteCode: schoolController.selectedSchool!.instituteCode,
+          context: context,
+          onLogin: (user) {
+            ScaffoldMessenger.of(context).showSnackBar(CustomSnackBar(
+              context: context,
+              brightness: Brightness.light,
+              content: Text("welcome".i18n.fill([user.name]),
+                  overflow: TextOverflow.ellipsis),
+            ));
+          },
+          onSuccess: () {
+            ScaffoldMessenger.of(context).hideCurrentSnackBar();
+            setSystemChrome(context);
+            Navigator.of(context).pushReplacementNamed("login_to_navigation");
+          }).then(
+        (res) => setState(() {
+          // if (res == LoginState.invalidGrant &&
+          //     tempUsername.replaceAll(username, '').length <= 3) {
+          //   tempUsername = username + ' ';
+          //   Timer(
+          //     const Duration(milliseconds: 500),
+          //     () => _loginAPI(context: context),
+          //   );
+          //   // _loginAPI(context: context);
+          // } else {
+          _loginState = res;
+          // }
+        }),
+      );
+    }
+
+    setState(() => _loginState = LoginState.inProgress);
+    _callAPI();
+  }
+}

refilc_mobile_ui/lib/screens/login/login_screen.i18n.dart

@@ -0,0 +1,63 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension Localization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          "username": "Username",
+          "usernameHint": "Student ID number",
+          "password": "Password",
+          "passwordHint": "Date of birth",
+          "school": "School",
+          "login": "Log in",
+          "welcome": "Welcome, %s!",
+          "missing_fields": "Missing Fields!",
+          "invalid_grant":
+              // "Invalid Username/Password! (Try adding spaces after Username)",
+              "Invalid Username/Password!",
+          "error": "Failed to log in.",
+          "schools_error": "Failed to get schools.",
+          "login_w_kreten": "Log in with your e-KRÉTA account to continue!",
+          "privacy": "Privacy Policy",
+        },
+        "hu_hu": {
+          "username": "Felhasználónév",
+          "usernameHint": "Oktatási azonosító",
+          "password": "Jelszó",
+          "passwordHint": "Születési dátum",
+          "school": "Iskola",
+          "login": "Belépés",
+          "welcome": "Üdv, %s!",
+          "missing_fields": "Hiányzó adatok!",
+          "invalid_grant":
+              // "Helytelen Felhasználónév/Jelszó! (Próbálj szóközöket írni a Felhasználónév után)",
+              "Helytelen Felhasználónév/Jelszó!",
+          "error": "Sikertelen bejelentkezés.",
+          "schools_error": "Nem sikerült lekérni az iskolákat.",
+          "login_w_kreten":
+              "Jelentkezz be az e-KRÉTA fiókoddal a folytatáshoz!",
+          "privacy": "Adatkezelési tájékoztató",
+        },
+        "de_de": {
+          "username": "Benutzername",
+          "usernameHint": "Ausbildung ID",
+          "password": "Passwort",
+          "passwordHint": "Geburtsdatum",
+          "school": "Schule",
+          "login": "Einloggen",
+          "welcome": "Wilkommen, %s!",
+          "missing_fields": "Fehlende Felder!",
+          "invalid_grant": "Ungültiger Benutzername/Passwort!",
+          "error": "Anmeldung fehlgeschlagen.",
+          "schools_error": "Keine Schulen gefunden.",
+          "login_w_kreten":
+              "Melden Sie sich mit Ihrem e-KRÉTA-Konto an, um fortzufahren!",
+          "privacy": "Datenschutzrichtlinie",
+        },
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}

refilc_mobile_ui/lib/screens/login/school_input/school_input.dart

@@ -0,0 +1,122 @@
+import 'package:refilc_mobile_ui/screens/login/login_input.dart';
+import 'package:refilc_mobile_ui/screens/login/school_input/school_input_overlay.dart';
+import 'package:refilc_mobile_ui/screens/login/school_input/school_input_tile.dart';
+import 'package:refilc_mobile_ui/screens/login/school_input/school_search.dart';
+import 'package:flutter/material.dart';
+import 'package:refilc_kreta_api/models/school.dart';
+
+class SchoolInput extends StatefulWidget {
+  const SchoolInput(
+      {super.key, required this.controller, required this.scroll});
+
+  final SchoolInputController controller;
+  final ScrollController scroll;
+
+  @override
+  SchoolInputState createState() => SchoolInputState();
+}
+
+class SchoolInputState extends State<SchoolInput> {
+  final _focusNode = FocusNode();
+  final _layerLink = LayerLink();
+  late SchoolInputOverlay overlay;
+
+  @override
+  void initState() {
+    super.initState();
+
+    widget.controller.update = (fn) {
+      if (mounted) setState(fn);
+    };
+
+    overlay = SchoolInputOverlay(layerLink: _layerLink);
+
+    // Show school list when focused
+    _focusNode.addListener(() {
+      if (_focusNode.hasFocus) {
+        WidgetsBinding.instance
+            .addPostFrameCallback((_) => overlay.createOverlayEntry(context));
+        Future.delayed(const Duration(milliseconds: 100)).then((value) {
+          if (mounted && widget.scroll.hasClients) {
+            widget.scroll.animateTo(widget.scroll.offset + 500,
+                duration: const Duration(milliseconds: 500),
+                curve: Curves.ease);
+          }
+        });
+      } else {
+        overlay.entry?.remove();
+      }
+    });
+
+    // LoginInput TextField listener
+    widget.controller.textController.addListener(() {
+      String text = widget.controller.textController.text;
+      if (text.isEmpty) {
+        overlay.children = null;
+        return;
+      }
+
+      List<School> results =
+          searchSchools(widget.controller.schools ?? [], text);
+      setState(() {
+        overlay.children = results
+            .map((School e) => SchoolInputTile(
+                  school: e,
+                  onTap: () => _selectSchool(e),
+                ))
+            .toList();
+      });
+      Overlay.of(context).setState(() {});
+    });
+  }
+
+  void _selectSchool(School school) {
+    FocusScope.of(context).requestFocus(FocusNode());
+
+    setState(() {
+      widget.controller.selectedSchool = school;
+      widget.controller.textController.text = school.name;
+    });
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return CompositedTransformTarget(
+      link: _layerLink,
+      child: widget.controller.schools == null
+          ? Container(
+              width: double.infinity,
+              padding: const EdgeInsets.symmetric(vertical: 10.0),
+              decoration: BoxDecoration(
+                color: Colors.black.withOpacity(0.15),
+                borderRadius: BorderRadius.circular(12.0),
+              ),
+              child: const Center(
+                child: SizedBox(
+                  height: 28.0,
+                  width: 28.0,
+                  child: CircularProgressIndicator(
+                    color: Colors.white,
+                  ),
+                ),
+              ),
+            )
+          : LoginInput(
+              style: LoginInputStyle.school,
+              focusNode: _focusNode,
+              onClear: () {
+                widget.controller.selectedSchool = null;
+                FocusScope.of(context).requestFocus(_focusNode);
+              },
+              controller: widget.controller.textController,
+            ),
+    );
+  }
+}
+
+class SchoolInputController {
+  final textController = TextEditingController();
+  School? selectedSchool;
+  List<School>? schools;
+  late void Function(void Function()) update;
+}

refilc_mobile_ui/lib/screens/login/school_input/school_input_overlay.dart

@@ -0,0 +1,73 @@
+import 'package:flutter/material.dart';
+import 'school_input_overlay.i18n.dart';
+
+class SchoolInputOverlay {
+  OverlayEntry? entry;
+  final LayerLink layerLink;
+  List<Widget>? children;
+
+  SchoolInputOverlay({required this.layerLink});
+
+  void createOverlayEntry(BuildContext context) {
+    entry = OverlayEntry(builder: (_) => buildOverlayEntry(context));
+    Overlay.of(context).insert(entry!);
+  }
+
+  Widget buildOverlayEntry(BuildContext context) {
+    RenderBox renderBox = context.findRenderObject()! as RenderBox;
+    var size = renderBox.size;
+    return SchoolInputOverlayWidget(
+      size: size,
+      layerLink: layerLink,
+      children: children,
+    );
+  }
+}
+
+class SchoolInputOverlayWidget extends StatelessWidget {
+  const SchoolInputOverlayWidget({
+    super.key,
+    required this.children,
+    required this.size,
+    required this.layerLink,
+  });
+
+  final Size size;
+  final List<Widget>? children;
+  final LayerLink layerLink;
+
+  @override
+  Widget build(BuildContext context) {
+    return children != null
+        ? Positioned(
+            width: size.width,
+            height: (children?.length ?? 0) > 0 ? 150.0 : 50.0,
+            child: CompositedTransformFollower(
+              link: layerLink,
+              showWhenUnlinked: false,
+              offset: Offset(0.0, size.height + 5.0),
+              child: Material(
+                color: Theme.of(context).colorScheme.background,
+                shape: RoundedRectangleBorder(
+                    borderRadius: BorderRadius.circular(8.0)),
+                elevation: 4.0,
+                shadowColor: Colors.black,
+                child: (children?.length ?? 0) > 0
+                    ? ListView.builder(
+                        physics: const BouncingScrollPhysics(),
+                        padding: EdgeInsets.zero,
+                        shrinkWrap: true,
+                        itemCount: children?.length ?? 0,
+                        itemBuilder: (context, index) {
+                          return children?[index] ?? Container();
+                        },
+                      )
+                    : Center(
+                        child: Text("noresults".i18n),
+                      ),
+              ),
+            ),
+          )
+        : Container();
+  }
+}

refilc_mobile_ui/lib/screens/login/school_input/school_input_overlay.i18n.dart

@@ -0,0 +1,21 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension Localization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          "noresults": "No results!",
+        },
+        "hu_hu": {
+          "noresults": "Nincs találat!",
+        },
+        "de_de": {
+          "noresults": "Keine Treffer!",
+        },
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}

refilc_mobile_ui/lib/screens/login/school_input/school_input_tile.dart

@@ -0,0 +1,61 @@
+import 'package:refilc_kreta_api/models/school.dart';
+import 'package:flutter/material.dart';
+
+class SchoolInputTile extends StatelessWidget {
+  const SchoolInputTile({super.key, required this.school, this.onTap});
+
+  final School school;
+  final Function()? onTap;
+
+  @override
+  Widget build(BuildContext context) {
+    return Padding(
+      padding: const EdgeInsets.all(4.0),
+      child: InkWell(
+        onTap: () {
+          onTap!();
+        },
+        borderRadius: BorderRadius.circular(6.0),
+        child: Padding(
+          padding: const EdgeInsets.all(6.0),
+          child: Column(
+            crossAxisAlignment: CrossAxisAlignment.start,
+            children: [
+              // School name
+              Padding(
+                padding: const EdgeInsets.only(bottom: 4.0),
+                child: Text(
+                  school.name,
+                  maxLines: 2,
+                  overflow: TextOverflow.ellipsis,
+                  style: const TextStyle(fontWeight: FontWeight.w600),
+                ),
+              ),
+              Row(
+                children: [
+                  // School id
+                  Expanded(
+                    child: Text(
+                      school.instituteCode,
+                      maxLines: 1,
+                      overflow: TextOverflow.ellipsis,
+                    ),
+                  ),
+                  // School city
+                  Expanded(
+                    child: Text(
+                      school.city,
+                      textAlign: TextAlign.right,
+                      maxLines: 1,
+                      overflow: TextOverflow.ellipsis,
+                    ),
+                  ),
+                ],
+              ),
+            ],
+          ),
+        ),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/login/school_input/school_search.dart

@@ -0,0 +1,28 @@
+import 'package:refilc_kreta_api/models/school.dart';
+import 'package:refilc/utils/format.dart';
+
+List<School> searchSchools(List<School> all, String pattern) {
+  pattern = pattern.toLowerCase().specialChars();
+  if (pattern == "") return all;
+
+  List<School> results = [];
+
+  for (var item in all) {
+    int contains = 0;
+
+    pattern.split(" ").forEach((variation) {
+      if (item.name.toLowerCase().specialChars().contains(variation)) {
+        contains++;
+      }
+    });
+
+    if (contains == pattern.split(" ").length) results.add(item);
+
+    if (item.instituteCode.toLowerCase().specialChars().contains(pattern))
+      results.add(item);
+  }
+
+  results.sort((a, b) => a.name.compareTo(b.name));
+
+  return results;
+}

refilc_mobile_ui/lib/screens/navigation/nabar.dart

@@ -0,0 +1,31 @@
+import 'package:refilc_mobile_ui/screens/navigation/navbar_item.dart';
+import 'package:flutter/material.dart';
+
+class Navbar extends StatelessWidget {
+  const Navbar(
+      {super.key,
+      required this.selectedIndex,
+      required this.onSelected,
+      required this.items});
+
+  final int selectedIndex;
+  final void Function(int index) onSelected;
+  final List<NavItem> items;
+
+  @override
+  Widget build(BuildContext context) {
+    final List<Widget> buttons = List.generate(
+      items.length,
+      (index) => NavbarItem(
+        item: items[index],
+        active: index == selectedIndex,
+        onTap: () => onSelected(index),
+      ),
+    );
+
+    return Row(
+      mainAxisAlignment: MainAxisAlignment.center,
+      children: buttons,
+    );
+  }
+}

refilc_mobile_ui/lib/screens/navigation/navbar_item.dart

@@ -0,0 +1,64 @@
+import 'package:flutter/material.dart';
+
+class NavItem {
+  final String title;
+  final Widget icon;
+  final Widget activeIcon;
+
+  const NavItem(
+      {required this.title, required this.icon, required this.activeIcon});
+}
+
+class NavbarItem extends StatelessWidget {
+  const NavbarItem({
+    super.key,
+    required this.item,
+    required this.active,
+    required this.onTap,
+  });
+
+  final NavItem item;
+  final bool active;
+  final void Function() onTap;
+
+  @override
+  Widget build(BuildContext context) {
+    final Widget icon = active ? item.activeIcon : item.icon;
+
+    return SafeArea(
+      child: GestureDetector(
+        onTap: onTap,
+        child: Padding(
+          padding: const EdgeInsets.symmetric(vertical: 12.0, horizontal: 6.0),
+          child: Container(
+            padding: const EdgeInsets.all(12.0),
+            decoration: BoxDecoration(
+              color: active
+                  ? Theme.of(context).colorScheme.secondary.withOpacity(.4)
+                  : null,
+              borderRadius: BorderRadius.circular(14.0),
+            ),
+            child: Stack(
+              children: [
+                IconTheme(
+                  data: IconThemeData(
+                    color: Theme.of(context).colorScheme.secondary,
+                  ),
+                  child: icon,
+                ),
+                IconTheme(
+                  data: IconThemeData(
+                    color: Theme.of(context).brightness == Brightness.light
+                        ? Colors.black.withOpacity(.5)
+                        : Colors.white.withOpacity(.3),
+                  ),
+                  child: icon,
+                ),
+              ],
+            ),
+          ),
+        ),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/navigation/navigation_route.dart

@@ -0,0 +1,25 @@
+class NavigationRoute {
+  late String _name;
+  late int _index;
+
+  final List<String> _internalPageMap = [
+    "home",
+    "grades",
+    "timetable",
+    "messages",
+    "absences",
+  ];
+
+  String get name => _name;
+  int get index => _index;
+
+  set name(String n) {
+    _name = n;
+    _index = _internalPageMap.indexOf(n);
+  }
+
+  set index(int i) {
+    _index = i;
+    _name = _internalPageMap.elementAt(i);
+  }
+}

refilc_mobile_ui/lib/screens/navigation/navigation_route_handler.dart

@@ -0,0 +1,38 @@
+import 'package:refilc_mobile_ui/pages/absences/absences_page.dart';
+import 'package:refilc_mobile_ui/pages/grades/grades_page.dart';
+import 'package:refilc_mobile_ui/pages/home/home_page.dart';
+import 'package:refilc_mobile_ui/pages/messages/messages_page.dart';
+import 'package:refilc_mobile_ui/pages/timetable/timetable_page.dart';
+import 'package:flutter/material.dart';
+import 'package:animations/animations.dart';
+
+Route navigationRouteHandler(RouteSettings settings) {
+  switch (settings.name) {
+    case "home":
+      return navigationPageRoute((context) => const HomePage());
+    case "grades":
+      return navigationPageRoute((context) => const GradesPage());
+    case "timetable":
+      return navigationPageRoute((context) => const TimetablePage());
+    case "messages":
+      return navigationPageRoute((context) => const MessagesPage());
+    case "absences":
+      return navigationPageRoute((context) => const AbsencesPage());
+    default:
+      return navigationPageRoute((context) => const HomePage());
+  }
+}
+
+Route navigationPageRoute(Widget Function(BuildContext) builder) {
+  return PageRouteBuilder(
+    pageBuilder: (context, _, __) => builder(context),
+    transitionsBuilder: (context, animation, secondaryAnimation, child) {
+      return FadeThroughTransition(
+        fillColor: Theme.of(context).scaffoldBackgroundColor,
+        animation: animation,
+        secondaryAnimation: secondaryAnimation,
+        child: child,
+      );
+    },
+  );
+}

refilc_mobile_ui/lib/screens/navigation/navigation_screen.dart

@@ -0,0 +1,342 @@
+import 'package:refilc/api/providers/update_provider.dart';
+import 'package:refilc/helpers/quick_actions.dart';
+import 'package:refilc/models/settings.dart';
+import 'package:refilc/theme/observer.dart';
+import 'package:refilc_kreta_api/client/client.dart';
+import 'package:refilc_kreta_api/providers/grade_provider.dart';
+import 'package:refilc_mobile_ui/common/system_chrome.dart';
+import 'package:refilc_mobile_ui/screens/navigation/nabar.dart';
+import 'package:refilc_mobile_ui/screens/navigation/navbar_item.dart';
+import 'package:refilc_mobile_ui/screens/navigation/navigation_route.dart';
+import 'package:refilc_mobile_ui/screens/navigation/navigation_route_handler.dart';
+import 'package:refilc/icons/filc_icons.dart';
+import 'package:refilc_mobile_ui/screens/navigation/status_bar.dart';
+import 'package:refilc_mobile_ui/screens/news/news_view.dart';
+import 'package:refilc_mobile_ui/screens/settings/settings_screen.dart';
+import 'package:refilc_plus/ui/mobile/goal_planner/goal_complete_modal.dart';
+import 'package:flutter/foundation.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter/services.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'package:refilc_mobile_ui/common/screens.i18n.dart';
+import 'package:refilc/api/providers/news_provider.dart';
+import 'package:refilc/api/providers/sync.dart';
+import 'package:home_widget/home_widget.dart';
+import 'package:wtf_sliding_sheet/wtf_sliding_sheet.dart';
+import 'package:background_fetch/background_fetch.dart';
+import 'package:refilc_plus/providers/goal_provider.dart';
+import 'package:refilc/api/providers/ad_provider.dart';
+
+class NavigationScreen extends StatefulWidget {
+  const NavigationScreen({super.key});
+
+  static NavigationScreenState? of(BuildContext context) =>
+      context.findAncestorStateOfType<NavigationScreenState>();
+
+  @override
+  NavigationScreenState createState() => NavigationScreenState();
+}
+
+class NavigationScreenState extends State<NavigationScreen>
+    with WidgetsBindingObserver {
+  late NavigationRoute selected;
+  List<String> initializers = [];
+  final _navigatorState = GlobalKey<NavigatorState>();
+
+  late SettingsProvider settings;
+  late NewsProvider newsProvider;
+  late GoalProvider goalProvider;
+  late UpdateProvider updateProvider;
+  late GradeProvider gradeProvicer;
+  late AdProvider adProvider;
+
+  NavigatorState? get navigator => _navigatorState.currentState;
+
+  void customRoute(Route route) => navigator?.pushReplacement(route);
+
+  bool init(String id) {
+    if (initializers.contains(id)) return false;
+
+    initializers.add(id);
+
+    return true;
+  }
+
+  void _checkForWidgetLaunch() {
+    HomeWidget.initiallyLaunchedFromHomeWidget().then(_launchedFromWidget);
+  }
+
+  void _launchedFromWidget(Uri? uri) async {
+    if (uri == null) return;
+
+    if (uri.scheme == "timetable" && uri.authority == "refresh") {
+      Navigator.of(context).popUntil((route) => route.isFirst);
+
+      setPage("timetable");
+      _navigatorState.currentState
+          ?.pushNamedAndRemoveUntil("timetable", (_) => false);
+    } else if (uri.scheme == "settings" && uri.authority == "premium") {
+      Navigator.of(context).popUntil((route) => route.isFirst);
+
+      showSlidingBottomSheet(
+        context,
+        useRootNavigator: true,
+        builder: (context) => SlidingSheetDialog(
+          color: Theme.of(context).scaffoldBackgroundColor,
+          duration: const Duration(milliseconds: 400),
+          scrollSpec: const ScrollSpec.bouncingScroll(),
+          snapSpec: const SnapSpec(
+            snap: true,
+            snappings: [1.0],
+            initialSnap: 1.0,
+            positioning: SnapPositioning.relativeToSheetHeight,
+          ),
+          cornerRadius: 16,
+          cornerRadiusOnFullscreen: 0,
+          builder: (context, state) => Material(
+            color: Theme.of(context).scaffoldBackgroundColor,
+            child: const SettingsScreen(),
+          ),
+        ),
+      );
+    }
+  }
+
+  // Platform messages are asynchronous, so we initialize in an async method.
+  Future<void> initPlatformState() async {
+    // Configure BackgroundFetch.
+    int status = await BackgroundFetch.configure(
+        BackgroundFetchConfig(
+            minimumFetchInterval: 15,
+            stopOnTerminate: false,
+            enableHeadless: true,
+            requiresBatteryNotLow: false,
+            requiresCharging: false,
+            requiresStorageNotLow: false,
+            requiresDeviceIdle: false,
+            requiredNetworkType: NetworkType.ANY), (String taskId) async {
+      // <-- Event handler
+      // This is the fetch-event callback.
+      if (kDebugMode) {
+        print("[BackgroundFetch] Event received $taskId");
+      }
+
+      // IMPORTANT:  You must signal completion of your task or the OS can punish your app
+      // for taking too long in the background.
+      BackgroundFetch.finish(taskId);
+    }, (String taskId) async {
+      // <-- Task timeout handler.
+      // This task has exceeded its allowed running-time.  You must stop what you're doing and immediately .finish(taskId)
+      if (kDebugMode) {
+        print("[BackgroundFetch] TASK TIMEOUT taskId: $taskId");
+      }
+      BackgroundFetch.finish(taskId);
+    });
+    if (kDebugMode) {
+      print('[BackgroundFetch] configure success: $status');
+    }
+
+    // If the widget was removed from the tree while the asynchronous platform
+    // message was in flight, we want to discard the reply rather than calling
+    // setState to update our non-existent appearance.
+    if (!mounted) return;
+  }
+
+  @override
+  void initState() {
+    super.initState();
+
+    HomeWidget.setAppGroupId('hu.refilc.naplo.group');
+
+    _checkForWidgetLaunch();
+    HomeWidget.widgetClicked.listen(_launchedFromWidget);
+
+    settings = Provider.of<SettingsProvider>(context, listen: false);
+    selected = NavigationRoute();
+    selected.index = settings.startPage.index; // set page index to start page
+
+    // add brightness observer
+    WidgetsBinding.instance.addObserver(this);
+
+    // set client User-Agent
+    Provider.of<KretaClient>(context, listen: false).userAgent =
+        settings.config.userAgent;
+
+    // get news
+    newsProvider = Provider.of<NewsProvider>(context, listen: false);
+    newsProvider.restore().then((value) => newsProvider.fetch());
+
+    // init grade provider (for goals)
+    gradeProvicer = Provider.of<GradeProvider>(context, listen: false);
+
+    // get goals
+    goalProvider = Provider.of<GoalProvider>(context, listen: false);
+    goalProvider.fetchDone(gradeProvider: gradeProvicer);
+
+    // get releases
+    updateProvider = Provider.of<UpdateProvider>(context, listen: false);
+    updateProvider.fetch();
+
+    // get advertisements
+    adProvider = Provider.of<AdProvider>(context, listen: false);
+    adProvider.fetch();
+
+    // initial sync
+    syncAll(context);
+    setupQuickActions();
+  }
+
+  @override
+  void dispose() {
+    WidgetsBinding.instance.removeObserver(this);
+    super.dispose();
+  }
+
+  @override
+  void didChangePlatformBrightness() {
+    if (settings.theme == ThemeMode.system) {
+      // ignore: deprecated_member_use
+      Brightness? brightness =
+          // ignore: deprecated_member_use
+          WidgetsBinding.instance.window.platformBrightness;
+      Provider.of<ThemeModeObserver>(context, listen: false).changeTheme(
+          brightness == Brightness.light ? ThemeMode.light : ThemeMode.dark);
+    }
+    super.didChangePlatformBrightness();
+  }
+
+  void setPage(String page) => setState(() => selected.name = page);
+
+  @override
+  Widget build(BuildContext context) {
+    setSystemChrome(context);
+    settings = Provider.of<SettingsProvider>(context);
+    newsProvider = Provider.of<NewsProvider>(context);
+    goalProvider = Provider.of<GoalProvider>(context);
+
+    // show news and complete goals
+    WidgetsBinding.instance.addPostFrameCallback((_) {
+      if (newsProvider.show) {
+        NewsView.show(newsProvider.news[0], context: context)
+            .then((value) => newsProvider.release());
+        newsProvider.lock();
+      }
+
+      if (goalProvider.hasDoneGoals) {
+        GoalCompleteModal.show(goalProvider.doneSubject!, context: context);
+        goalProvider.lock();
+      }
+    });
+
+    handleQuickActions(context, (page) {
+      setPage(page);
+      _navigatorState.currentState?.pushReplacementNamed(page);
+    });
+
+    // ignore: deprecated_member_use
+    return WillPopScope(
+      onWillPop: () async {
+        if (_navigatorState.currentState?.canPop() ?? false) {
+          _navigatorState.currentState?.pop();
+          if (!kDebugMode) {
+            return true;
+          }
+          return false;
+        }
+
+        if (selected.index != 0) {
+          setState(() => selected.index = 0);
+          _navigatorState.currentState?.pushReplacementNamed(selected.name);
+        }
+
+        return false;
+      },
+      child: Scaffold(
+        body: Column(
+          children: [
+            Expanded(
+              child: Stack(
+                alignment: Alignment.bottomCenter,
+                children: [
+                  Navigator(
+                    key: _navigatorState,
+                    initialRoute: selected.name,
+                    onGenerateRoute: (settings) =>
+                        navigationRouteHandler(settings),
+                  ),
+                ],
+              ),
+            ),
+
+            // Status bar
+            Material(
+              color: Theme.of(context).colorScheme.background,
+              child: const StatusBar(),
+            ),
+
+            // Bottom Navigaton Bar
+            Material(
+              color: Theme.of(context).scaffoldBackgroundColor,
+              child: MediaQuery.removePadding(
+                context: context,
+                removeTop: true,
+                child: Navbar(
+                  selectedIndex: selected.index,
+                  onSelected: onPageSelected,
+                  items: [
+                    NavItem(
+                      title: "home".i18n,
+                      icon: const Icon(FilcIcons.home),
+                      activeIcon: const Icon(FilcIcons.homefill),
+                    ),
+                    NavItem(
+                      title: "grades".i18n,
+                      icon: const Icon(FeatherIcons.bookmark),
+                      activeIcon: const Icon(FilcIcons.gradesfill),
+                    ),
+                    NavItem(
+                      title: "timetable".i18n,
+                      icon: const Icon(FeatherIcons.calendar),
+                      activeIcon: const Icon(FilcIcons.timetablefill),
+                    ),
+                    NavItem(
+                      title: "messages".i18n,
+                      icon: const Icon(FeatherIcons.messageSquare),
+                      activeIcon: const Icon(FilcIcons.messagesfill),
+                    ),
+                    NavItem(
+                      title: "absences".i18n,
+                      icon: const Icon(FeatherIcons.clock),
+                      activeIcon: const Icon(FilcIcons.absencesfill),
+                    ),
+                  ],
+                ),
+              ),
+            ),
+          ],
+        ),
+      ),
+    );
+  }
+
+  void onPageSelected(int index) {
+    // Vibrate, then set the active screen
+    if (selected.index != index) {
+      switch (settings.vibrate) {
+        case VibrationStrength.light:
+          HapticFeedback.lightImpact();
+          break;
+        case VibrationStrength.medium:
+          HapticFeedback.mediumImpact();
+          break;
+        case VibrationStrength.strong:
+          HapticFeedback.heavyImpact();
+          break;
+        default:
+      }
+      setState(() => selected.index = index);
+      _navigatorState.currentState?.pushReplacementNamed(selected.name);
+    }
+  }
+}

refilc_mobile_ui/lib/screens/navigation/status_bar.dart

@@ -0,0 +1,120 @@
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:refilc/utils/color.dart';
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import 'package:refilc/api/providers/status_provider.dart';
+import 'status_bar.i18n.dart';
+
+class StatusBar extends StatefulWidget {
+  const StatusBar({super.key});
+
+  @override
+  StatusBarState createState() => StatusBarState();
+}
+
+class StatusBarState extends State<StatusBar> {
+  late StatusProvider statusProvider;
+
+  @override
+  Widget build(BuildContext context) {
+    statusProvider = Provider.of<StatusProvider>(context);
+
+    Status? currentStatus = statusProvider.getStatus();
+    Color backgroundColor = _statusColor(currentStatus);
+    Color color = ColorUtils.foregroundColor(backgroundColor);
+
+    return AnimatedContainer(
+      duration: const Duration(milliseconds: 250),
+      curve: Curves.easeInOut,
+      height: currentStatus != null ? 32.0 : 0,
+      width: double.infinity,
+      color: Theme.of(context).scaffoldBackgroundColor,
+      child: Stack(
+        children: [
+          // Background
+          AnimatedContainer(
+            margin: const EdgeInsets.only(left: 6.0, right: 6.0, top: 8.0),
+            duration: const Duration(milliseconds: 250),
+            curve: Curves.easeInOut,
+            height: currentStatus != null ? 28.0 : 0,
+            decoration: BoxDecoration(
+              color: backgroundColor,
+              boxShadow: [
+                BoxShadow(color: Theme.of(context).shadowColor, blurRadius: 8.0)
+              ],
+              borderRadius: BorderRadius.circular(45.0),
+            ),
+          ),
+
+          // Progress bar
+          if (currentStatus == Status.syncing)
+            Container(
+              margin: const EdgeInsets.only(left: 6.0, right: 6.0, top: 8.0),
+              alignment: Alignment.bottomLeft,
+              child: AnimatedContainer(
+                height: currentStatus != null ? 28.0 : 0,
+                duration: const Duration(milliseconds: 250),
+                curve: Curves.easeInOut,
+                width: MediaQuery.of(context).size.width *
+                        statusProvider.progress -
+                    16.0,
+                decoration: BoxDecoration(
+                  color:
+                      Theme.of(context).colorScheme.secondary.withOpacity(0.8),
+                  borderRadius: BorderRadius.circular(45.0),
+                ),
+              ),
+            ),
+
+          // Text
+          Padding(
+            padding: const EdgeInsets.only(top: 8.0),
+            child: Center(
+              child: Text(
+                _statusString(currentStatus),
+                style: TextStyle(color: color, fontWeight: FontWeight.w500),
+              ),
+            ),
+          ),
+        ],
+      ),
+    );
+  }
+
+  String _statusString(Status? status) {
+    switch (status) {
+      case Status.syncing:
+        return "Syncing data".i18n;
+      case Status.maintenance:
+        return "KRETA Maintenance".i18n;
+      case Status.apiError:
+        return "KRETA API error".i18n;
+      case Status.network:
+        return "No connection".i18n;
+      default:
+        return "";
+    }
+  }
+
+  Color _statusColor(Status? status) {
+    switch (status) {
+      case Status.maintenance:
+        return AppColors.of(context).red;
+      case Status.apiError:
+        return AppColors.of(context).red;
+      case Status.network:
+      case Status.syncing:
+      default:
+        HSLColor color =
+            HSLColor.fromColor(Theme.of(context).scaffoldBackgroundColor);
+        if (color.lightness >= 0.5) {
+          color = color.withSaturation(0.3);
+          color = color.withLightness(color.lightness - 0.1);
+        } else {
+          color = color.withSaturation(0);
+          color = color.withLightness(color.lightness + 0.2);
+        }
+        return color.toColor();
+    }
+  }
+}

refilc_mobile_ui/lib/screens/navigation/status_bar.i18n.dart

@@ -0,0 +1,30 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension Localization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          "Syncing data": "Syncing data",
+          "KRETA Maintenance": "KRETA Maintenance",
+          "KRETA API error": "KRETA API Error",
+          "No connection": "No connection",
+        },
+        "hu_hu": {
+          "Syncing data": "Adatok frissítése",
+          "KRETA Maintenance": "KRÉTA Karbantartás",
+          "KRETA API error": "KRÉTA API Hiba",
+          "No connection": "Nincs kapcsolat",
+        },
+        "de_de": {
+          "Syncing data": "Daten aktualisieren",
+          "KRETA Maintenance": "KRETA Wartung",
+          "KRETA API error": "KRETA API Fehler",
+          "No connection": "Keine Verbindung",
+        },
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}

refilc_mobile_ui/lib/screens/news/news_screen.dart

@@ -0,0 +1,66 @@
+import 'dart:math';
+
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:refilc_mobile_ui/common/empty.dart';
+import 'package:refilc_mobile_ui/common/panel/panel.dart';
+import 'package:refilc_mobile_ui/screens/news/news_tile.dart';
+import 'package:refilc/models/news.dart';
+import 'package:refilc_mobile_ui/screens/news/news_view.dart';
+import 'package:refilc_mobile_ui/screens/settings/settings_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import 'package:refilc/api/providers/news_provider.dart';
+
+class NewsScreen extends StatelessWidget {
+  const NewsScreen({super.key});
+
+  @override
+  Widget build(BuildContext context) {
+    var newsProvider = Provider.of<NewsProvider>(context);
+
+    List<News> news = [];
+    news = newsProvider.news.where((e) => e.title != "").toList();
+
+    return Scaffold(
+      appBar: AppBar(
+        surfaceTintColor: Theme.of(context).scaffoldBackgroundColor,
+        leading: BackButton(color: AppColors.of(context).text),
+        title: Text("news".i18n,
+            style: TextStyle(color: AppColors.of(context).text)),
+      ),
+      body: SafeArea(
+        child: RefreshIndicator(
+          onRefresh: () => newsProvider.fetch(),
+          child: ListView.builder(
+            physics: const BouncingScrollPhysics(
+                parent: AlwaysScrollableScrollPhysics()),
+            itemCount: max(news.length, 1),
+            itemBuilder: (context, index) {
+              if (news.isNotEmpty) {
+                return Padding(
+                  padding: const EdgeInsets.symmetric(
+                      horizontal: 24.0, vertical: 12.0),
+                  child: Panel(
+                    child: Material(
+                      type: MaterialType.transparency,
+                      child: NewsTile(
+                        news[index],
+                        onTap: () => NewsView.show(news[index],
+                            context: context, force: true),
+                      ),
+                    ),
+                  ),
+                );
+              } else {
+                return const Padding(
+                  padding: EdgeInsets.only(top: 24.0),
+                  child: Empty(subtitle: "Nothing to see here"),
+                );
+              }
+            },
+          ),
+        ),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/news/news_tile.dart

@@ -0,0 +1,30 @@
+import 'package:flutter/material.dart';
+import 'package:refilc/models/news.dart';
+import 'package:refilc/utils/format.dart';
+
+class NewsTile extends StatelessWidget {
+  const NewsTile(this.news, {super.key, this.onTap});
+
+  final News news;
+  final Function()? onTap;
+
+  @override
+  Widget build(BuildContext context) {
+    return ListTile(
+      title: Text(
+        news.title,
+        maxLines: 1,
+        overflow: TextOverflow.ellipsis,
+        style: const TextStyle(fontWeight: FontWeight.w600),
+      ),
+      subtitle: Text(
+        news.content.escapeHtml().replaceAll("\n", " "),
+        maxLines: 2,
+        overflow: TextOverflow.ellipsis,
+        style: const TextStyle(fontWeight: FontWeight.w500),
+      ),
+      onTap: onTap,
+      shape: RoundedRectangleBorder(borderRadius: BorderRadius.circular(12.0)),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/news/news_view.dart

@@ -0,0 +1,137 @@
+import 'dart:io';
+
+import 'package:refilc/models/settings.dart';
+import 'package:refilc_mobile_ui/common/dialog_button.dart';
+import 'package:flutter/material.dart';
+import 'package:refilc/models/news.dart';
+import 'package:refilc/utils/format.dart';
+import 'package:flutter_custom_tabs/flutter_custom_tabs.dart';
+import 'package:flutter_linkify/flutter_linkify.dart';
+import 'package:provider/provider.dart';
+import 'package:refilc_mobile_ui/screens/settings/settings_screen.i18n.dart';
+
+class NewsView extends StatelessWidget {
+  const NewsView(this.news, {super.key});
+
+  final News news;
+
+  @override
+  Widget build(BuildContext context) {
+    return Padding(
+      padding: const EdgeInsets.symmetric(vertical: 100.0, horizontal: 32.0),
+      child: Material(
+        borderRadius: BorderRadius.circular(12.0),
+        child: Padding(
+          padding: const EdgeInsets.symmetric(horizontal: 12.0, vertical: 4.0),
+          child: Column(
+            children: [
+              // Content
+              Expanded(
+                child: ListView(
+                  physics: const BouncingScrollPhysics(),
+                  children: [
+                    Padding(
+                      padding: const EdgeInsets.only(
+                          left: 8.0, right: 6.0, top: 14.0, bottom: 8.0),
+                      child: Text(
+                        news.title,
+                        maxLines: 3,
+                        style: const TextStyle(
+                            fontWeight: FontWeight.w600, fontSize: 18.0),
+                      ),
+                    ),
+                    SelectableLinkify(
+                      text: news.content.escapeHtml(),
+                      options:
+                          const LinkifyOptions(looseUrl: true, removeWww: true),
+                      onOpen: (link) {
+                        launch(
+                          link.url,
+                          customTabsOption: CustomTabsOption(
+                              showPageTitle: true,
+                              toolbarColor:
+                                  Theme.of(context).scaffoldBackgroundColor),
+                        );
+                      },
+                      style: const TextStyle(
+                          fontWeight: FontWeight.w500, fontSize: 14.0),
+                    ),
+                  ],
+                ),
+              ),
+
+              // Actions
+              Row(
+                mainAxisAlignment: MainAxisAlignment.end,
+                children: [
+                  if (news.link != "")
+                    DialogButton(
+                      label: news.openLabel != ""
+                          ? news.openLabel
+                          : "open".i18n.toUpperCase(),
+                      onTap: () => launch(
+                        news.link,
+                        customTabsOption: CustomTabsOption(
+                            showPageTitle: true,
+                            toolbarColor:
+                                Theme.of(context).scaffoldBackgroundColor),
+                      ),
+                    ),
+                  DialogButton(
+                    label: "done".i18n,
+                    onTap: () => Navigator.of(context).maybePop(),
+                  ),
+                ],
+              ),
+            ],
+          ),
+        ),
+      ),
+    );
+  }
+
+  static Future<T?> show<T>(News news,
+      {required BuildContext context, bool force = false}) {
+    if (news.title == "") return Future<T?>.value(null);
+
+    bool popup = news.platform == 'all' || force;
+
+    if (Provider.of<SettingsProvider>(context, listen: false).newsEnabled ||
+        news.emergency ||
+        force) {
+      switch (news.platform.trim().toLowerCase()) {
+        case "android":
+          if (Platform.isAndroid) popup = true;
+          break;
+        case "ios":
+          if (Platform.isIOS) popup = true;
+          break;
+        case "linux":
+          if (Platform.isLinux) popup = true;
+          break;
+        case "windows":
+          if (Platform.isWindows) popup = true;
+          break;
+        case "macos":
+          if (Platform.isMacOS) popup = true;
+          break;
+        case "all":
+          popup = true;
+          break;
+        default:
+          popup = true;
+      }
+    } else {
+      popup = false;
+    }
+
+    if (popup) {
+      return showDialog<T?>(
+          context: context,
+          builder: (context) => NewsView(news),
+          barrierDismissible: true);
+    } else {
+      return Future<T?>.value(null);
+    }
+  }
+}

refilc_mobile_ui/lib/screens/notes/add_note_screen.dart

@@ -0,0 +1,186 @@
+// ignore_for_file: use_build_context_synchronously
+
+import 'package:refilc/api/providers/database_provider.dart';
+import 'package:refilc/api/providers/self_note_provider.dart';
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc/models/self_note.dart';
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:refilc_kreta_api/providers/homework_provider.dart';
+import 'package:refilc_mobile_ui/screens/notes/notes_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'package:uuid/uuid.dart';
+
+class AddNoteScreen extends StatefulWidget {
+  const AddNoteScreen({super.key, this.initialNote});
+
+  final SelfNote? initialNote;
+
+  @override
+  AddNoteScreenState createState() => AddNoteScreenState();
+}
+
+class AddNoteScreenState extends State<AddNoteScreen> {
+  late UserProvider user;
+  late HomeworkProvider homeworkProvider;
+  late DatabaseProvider databaseProvider;
+  late SelfNoteProvider selfNoteProvider;
+
+  final _contentController = TextEditingController();
+  final _titleController = TextEditingController();
+
+  @override
+  void initState() {
+    _contentController.text = widget.initialNote?.content ?? '';
+    _titleController.text = widget.initialNote?.title ?? '';
+
+    super.initState();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    user = Provider.of<UserProvider>(context);
+    homeworkProvider = Provider.of<HomeworkProvider>(context);
+    databaseProvider = Provider.of<DatabaseProvider>(context);
+    selfNoteProvider = Provider.of<SelfNoteProvider>(context);
+
+    return Scaffold(
+      appBar: AppBar(
+        surfaceTintColor: Theme.of(context).scaffoldBackgroundColor,
+        leading: BackButton(color: AppColors.of(context).text),
+        title: Text(
+          widget.initialNote == null ? 'new_note'.i18n : 'edit_note'.i18n,
+          style: TextStyle(
+            color: AppColors.of(context).text,
+            fontSize: 26.0,
+            fontWeight: FontWeight.bold,
+          ),
+        ),
+        actions: [
+          ClipRRect(
+            borderRadius: BorderRadius.circular(10.1),
+            child: GestureDetector(
+              onTap: () async {
+                // handle tap
+                if (_contentController.text.replaceAll(' ', '') == '') {
+                  return;
+                }
+
+                var notes = selfNoteProvider.notes;
+
+                if (widget.initialNote == null) {
+                  notes.add(SelfNote.fromJson({
+                    'id': const Uuid().v4(),
+                    'title': _titleController.text.replaceAll(' ', '') == ''
+                        ? null
+                        : _titleController.text,
+                    'content': _contentController.text
+                  }));
+                } else {
+                  var i =
+                      notes.indexWhere((e) => e.id == widget.initialNote!.id);
+
+                  notes[i] = SelfNote.fromJson({
+                    'id': notes[i].id,
+                    'title': _titleController.text.replaceAll(' ', '') == ''
+                        ? null
+                        : _titleController.text,
+                    'content': _contentController.text,
+                  });
+                }
+
+                await selfNoteProvider.store(notes);
+
+                Navigator.of(context).pop();
+                if (widget.initialNote != null) {
+                  Navigator.of(context).pop();
+                }
+              },
+              child: Container(
+                color: Theme.of(context).colorScheme.primary.withOpacity(0.4),
+                child: Padding(
+                  padding: const EdgeInsets.all(8.0),
+                  child: Stack(
+                    children: [
+                      IconTheme(
+                        data: IconThemeData(
+                          color: Theme.of(context).colorScheme.secondary,
+                        ),
+                        child: const Icon(
+                          FeatherIcons.check,
+                          size: 20.0,
+                        ),
+                      ),
+                      IconTheme(
+                        data: IconThemeData(
+                          color:
+                              Theme.of(context).brightness == Brightness.light
+                                  ? Colors.black.withOpacity(.5)
+                                  : Colors.white.withOpacity(.3),
+                        ),
+                        child: const Icon(
+                          FeatherIcons.check,
+                          size: 20.0,
+                        ),
+                      ),
+                    ],
+                  ),
+                ),
+              ),
+            ),
+          ),
+          const SizedBox(
+            width: 20,
+          ),
+        ],
+      ),
+      body: SafeArea(
+        child: Padding(
+          padding: const EdgeInsets.symmetric(horizontal: 22.0),
+          child: Column(
+            children: [
+              TextField(
+                controller: _titleController,
+                expands: false,
+                maxLines: 1,
+                decoration: InputDecoration(
+                  border: InputBorder.none,
+                  enabledBorder: InputBorder.none,
+                  focusedBorder: InputBorder.none,
+                  hintText: "hint_t".i18n,
+                  hintStyle: const TextStyle(
+                    fontSize: 22.0,
+                    fontWeight: FontWeight.w600,
+                  ),
+                ),
+                textAlign: TextAlign.start,
+                style: const TextStyle(
+                  fontSize: 22.0,
+                  fontWeight: FontWeight.w600,
+                ),
+              ),
+              Expanded(
+                child: TextField(
+                  controller: _contentController,
+                  expands: true,
+                  minLines: null,
+                  maxLines: null,
+                  decoration: InputDecoration(
+                    border: InputBorder.none,
+                    enabledBorder: InputBorder.none,
+                    focusedBorder: InputBorder.none,
+                    hintText: "hint".i18n,
+                    hintStyle: const TextStyle(fontSize: 16.0),
+                  ),
+                  textAlign: TextAlign.start,
+                  style: const TextStyle(fontSize: 16.0),
+                ),
+              ),
+            ],
+          ),
+        ),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/notes/note_view_screen.dart

@@ -0,0 +1,153 @@
+import 'package:refilc/api/providers/self_note_provider.dart';
+import 'package:refilc/models/self_note.dart';
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:refilc_mobile_ui/screens/notes/add_note_screen.dart';
+import 'package:flutter/cupertino.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+
+class NoteViewScreen extends StatefulWidget {
+  const NoteViewScreen({super.key, required this.note});
+
+  final SelfNote note;
+
+  @override
+  NoteViewScreenState createState() => NoteViewScreenState();
+}
+
+class NoteViewScreenState extends State<NoteViewScreen> {
+  late SelfNoteProvider selfNoteProvider;
+
+  @override
+  Widget build(BuildContext context) {
+    selfNoteProvider = Provider.of<SelfNoteProvider>(context);
+
+    return Scaffold(
+      appBar: AppBar(
+        surfaceTintColor: Theme.of(context).scaffoldBackgroundColor,
+        leading: BackButton(color: AppColors.of(context).text),
+        title: Text(
+          widget.note.title ?? '${widget.note.content.split(' ')[0]}...',
+          style: TextStyle(
+            color: AppColors.of(context).text,
+            fontSize: 26.0,
+            fontWeight: FontWeight.bold,
+          ),
+        ),
+        actions: [
+          ClipRRect(
+            borderRadius: BorderRadius.circular(10.1),
+            child: GestureDetector(
+              onTap: () {
+                // handle tap
+                Navigator.of(context, rootNavigator: true).push(
+                    CupertinoPageRoute(
+                        builder: (context) =>
+                            AddNoteScreen(initialNote: widget.note)));
+              },
+              child: Container(
+                color: Theme.of(context).colorScheme.primary.withOpacity(0.4),
+                child: Padding(
+                  padding: const EdgeInsets.all(8.0),
+                  child: Stack(
+                    children: [
+                      IconTheme(
+                        data: IconThemeData(
+                          color: Theme.of(context).colorScheme.secondary,
+                        ),
+                        child: const Icon(
+                          FeatherIcons.edit,
+                          size: 20.0,
+                        ),
+                      ),
+                      IconTheme(
+                        data: IconThemeData(
+                          color:
+                              Theme.of(context).brightness == Brightness.light
+                                  ? Colors.black.withOpacity(.5)
+                                  : Colors.white.withOpacity(.3),
+                        ),
+                        child: const Icon(
+                          FeatherIcons.edit,
+                          size: 20.0,
+                        ),
+                      ),
+                    ],
+                  ),
+                ),
+              ),
+            ),
+          ),
+          const SizedBox(
+            width: 10,
+          ),
+          ClipRRect(
+            borderRadius: BorderRadius.circular(10.1),
+            child: GestureDetector(
+              onTap: () async {
+                // handle tap
+                var notes = selfNoteProvider.notes;
+                notes.removeWhere((e) => e.id == widget.note.id);
+                await selfNoteProvider.store(notes);
+
+                // ignore: use_build_context_synchronously
+                Navigator.of(context).pop();
+              },
+              child: Container(
+                color: Theme.of(context).colorScheme.primary.withOpacity(0.4),
+                child: Padding(
+                  padding: const EdgeInsets.all(8.0),
+                  child: Stack(
+                    children: [
+                      IconTheme(
+                        data: IconThemeData(
+                          color: Theme.of(context).colorScheme.secondary,
+                        ),
+                        child: const Icon(
+                          FeatherIcons.trash2,
+                          size: 20.0,
+                        ),
+                      ),
+                      IconTheme(
+                        data: IconThemeData(
+                          color:
+                              Theme.of(context).brightness == Brightness.light
+                                  ? Colors.black.withOpacity(.5)
+                                  : Colors.white.withOpacity(.3),
+                        ),
+                        child: const Icon(
+                          FeatherIcons.trash2,
+                          size: 20.0,
+                        ),
+                      ),
+                    ],
+                  ),
+                ),
+              ),
+            ),
+          ),
+          const SizedBox(
+            width: 20,
+          ),
+        ],
+      ),
+      body: SafeArea(
+        child: Padding(
+          padding: const EdgeInsets.symmetric(horizontal: 20.0, vertical: 10.0),
+          child: Column(
+            children: [
+              Expanded(
+                child: Text(
+                  widget.note.content,
+                  textAlign: TextAlign.justify,
+                  style: const TextStyle(fontSize: 18.0),
+                ),
+              ),
+            ],
+          ),
+        ),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/notes/notes_screen.dart

@@ -0,0 +1,282 @@
+import 'dart:math';
+
+import 'package:refilc/api/providers/database_provider.dart';
+import 'package:refilc/api/providers/self_note_provider.dart';
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:refilc/utils/format.dart';
+import 'package:refilc_kreta_api/models/homework.dart';
+import 'package:refilc_kreta_api/providers/homework_provider.dart';
+import 'package:refilc_mobile_ui/common/empty.dart';
+import 'package:refilc_mobile_ui/common/panel/panel.dart';
+import 'package:refilc_mobile_ui/common/soon_alert/soon_alert.dart';
+import 'package:refilc_mobile_ui/common/widgets/tick_tile.dart';
+import 'package:refilc_mobile_ui/screens/notes/add_note_screen.dart';
+import 'package:refilc_mobile_ui/screens/notes/note_view_screen.dart';
+import 'package:refilc_mobile_ui/screens/notes/notes_screen.i18n.dart';
+import 'package:refilc_mobile_ui/screens/notes/self_note_tile.dart';
+import 'package:refilc_plus/providers/premium_provider.dart';
+import 'package:refilc_plus/ui/mobile/premium/premium_inline.dart';
+import 'package:flutter/cupertino.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+
+class NotesScreen extends StatefulWidget {
+  const NotesScreen({super.key, required this.doneItems});
+
+  final Map<String, bool> doneItems;
+
+  @override
+  NotesScreenState createState() => NotesScreenState();
+}
+
+class NotesScreenState extends State<NotesScreen> {
+  late UserProvider user;
+  late HomeworkProvider homeworkProvider;
+  late DatabaseProvider databaseProvider;
+  late SelfNoteProvider selfNoteProvider;
+
+  List<Widget> noteTiles = [];
+
+  @override
+  Widget build(BuildContext context) {
+    user = Provider.of<UserProvider>(context);
+    homeworkProvider = Provider.of<HomeworkProvider>(context);
+    databaseProvider = Provider.of<DatabaseProvider>(context);
+    selfNoteProvider = Provider.of<SelfNoteProvider>(context);
+
+    void generateTiles() {
+      List<Widget> tiles = [];
+
+      List<Homework> hw = homeworkProvider.homework
+          .where((e) => e.deadline.isAfter(DateTime.now()))
+          // e.deadline.isBefore(DateTime(DateTime.now().year,
+          //     DateTime.now().month, DateTime.now().day + 3)))
+          .toList();
+
+      // todo tiles
+      List<Widget> toDoTiles = [];
+
+      if (hw.isNotEmpty) {
+        toDoTiles.addAll(hw.map((e) => TickTile(
+              padding: EdgeInsets.zero,
+              title: 'homework'.i18n,
+              description:
+                  '${(e.subject.isRenamed ? e.subject.renamedTo : e.subject.name) ?? ''}, ${e.content.escapeHtml()}',
+              isTicked: widget.doneItems[e.id] ?? false,
+              onTap: (p0) async {
+                if (!widget.doneItems.containsKey(e.id)) {
+                  widget.doneItems.addAll({e.id: p0});
+                } else {
+                  widget.doneItems[e.id] = p0;
+                }
+                await databaseProvider.userStore
+                    .storeToDoItem(widget.doneItems, userId: user.id!);
+              },
+            )));
+      }
+
+      if (toDoTiles.isNotEmpty) {
+        tiles.add(Panel(
+          title: Text('todo'.i18n),
+          child: Column(
+            children: toDoTiles,
+          ),
+        ));
+      }
+
+      // self notes
+      List<Widget> selfNoteTiles = [];
+
+      if (selfNoteProvider.notes.isNotEmpty) {
+        selfNoteTiles.addAll(selfNoteProvider.notes.map(
+          (e) => SelfNoteTile(
+            title: e.title ?? e.content.split(' ')[0],
+            content: e.content,
+            onTap: () => Navigator.of(context, rootNavigator: true).push(
+                CupertinoPageRoute(
+                    builder: (context) => NoteViewScreen(note: e))),
+          ),
+        ));
+      }
+
+      if (selfNoteTiles.isNotEmpty) {
+        // padding
+        tiles.add(const SizedBox(
+          height: 28.0,
+        ));
+
+        // actual thing
+        tiles.add(Panel(
+          title: Text('your_notes'.i18n),
+          padding: EdgeInsets.zero,
+          isTransparent: true,
+          child: Wrap(
+            spacing: 18.0,
+            runSpacing: 18.0,
+            children: selfNoteTiles,
+          ),
+        ));
+      }
+
+      // insert empty tile
+      if (tiles.isEmpty) {
+        tiles.insert(
+          0,
+          Padding(
+            padding: const EdgeInsets.only(top: 24.0),
+            child: Empty(subtitle: "empty".i18n),
+          ),
+        );
+      }
+
+      tiles.add(Provider.of<PremiumProvider>(context, listen: false).hasPremium
+          ? const SizedBox()
+          : const Padding(
+              padding: EdgeInsets.only(top: 24.0),
+              child: PremiumInline(features: [
+                PremiumInlineFeature.stats,
+              ]),
+            ));
+
+      // padding
+      tiles.add(const SizedBox(height: 32.0));
+
+      noteTiles = List.castFrom(tiles);
+    }
+
+    generateTiles();
+
+    return Scaffold(
+      appBar: AppBar(
+        surfaceTintColor: Theme.of(context).scaffoldBackgroundColor,
+        leading: BackButton(color: AppColors.of(context).text),
+        title: Text(
+          "notes".i18n,
+          style: TextStyle(
+            color: AppColors.of(context).text,
+            fontSize: 26.0,
+            fontWeight: FontWeight.bold,
+          ),
+        ),
+        actions: [
+          ClipRRect(
+            borderRadius: BorderRadius.circular(10.1),
+            child: GestureDetector(
+              onTap: () {
+                // handle tap
+                SoonAlert.show(context: context);
+              },
+              child: Container(
+                color: Theme.of(context).colorScheme.primary.withOpacity(0.4),
+                child: Padding(
+                  padding: const EdgeInsets.all(8.0),
+                  child: Stack(
+                    children: [
+                      IconTheme(
+                        data: IconThemeData(
+                          color: Theme.of(context).colorScheme.secondary,
+                        ),
+                        child: const Icon(
+                          FeatherIcons.search,
+                          size: 20.0,
+                        ),
+                      ),
+                      IconTheme(
+                        data: IconThemeData(
+                          color:
+                              Theme.of(context).brightness == Brightness.light
+                                  ? Colors.black.withOpacity(.5)
+                                  : Colors.white.withOpacity(.3),
+                        ),
+                        child: const Icon(
+                          FeatherIcons.search,
+                          size: 20.0,
+                        ),
+                      ),
+                    ],
+                  ),
+                ),
+              ),
+            ),
+          ),
+          const SizedBox(
+            width: 10,
+          ),
+          ClipRRect(
+            borderRadius: BorderRadius.circular(10.1),
+            child: GestureDetector(
+              onTap: () {
+                // handle tap
+                Navigator.of(context, rootNavigator: true).push(
+                    CupertinoPageRoute(
+                        builder: (context) => const AddNoteScreen()));
+              },
+              child: Container(
+                color: Theme.of(context).colorScheme.primary.withOpacity(0.4),
+                child: Padding(
+                  padding: const EdgeInsets.all(8.0),
+                  child: Stack(
+                    children: [
+                      IconTheme(
+                        data: IconThemeData(
+                          color: Theme.of(context).colorScheme.secondary,
+                        ),
+                        child: const Icon(
+                          FeatherIcons.plus,
+                          size: 20.0,
+                        ),
+                      ),
+                      IconTheme(
+                        data: IconThemeData(
+                          color:
+                              Theme.of(context).brightness == Brightness.light
+                                  ? Colors.black.withOpacity(.5)
+                                  : Colors.white.withOpacity(.3),
+                        ),
+                        child: const Icon(
+                          FeatherIcons.plus,
+                          size: 20.0,
+                        ),
+                      ),
+                    ],
+                  ),
+                ),
+              ),
+            ),
+          ),
+          const SizedBox(
+            width: 20,
+          ),
+        ],
+      ),
+      body: SafeArea(
+        child: RefreshIndicator(
+          onRefresh: () {
+            Provider.of<HomeworkProvider>(context, listen: false)
+                .fetch(from: DateTime.now().subtract(const Duration(days: 30)));
+            Provider.of<SelfNoteProvider>(context, listen: false).restore();
+
+            return Future(() => null);
+          },
+          child: ListView.builder(
+            padding: EdgeInsets.zero,
+            physics: const BouncingScrollPhysics(),
+            itemCount: max(noteTiles.length, 1),
+            itemBuilder: (context, index) {
+              if (noteTiles.isNotEmpty) {
+                EdgeInsetsGeometry panelPadding =
+                    const EdgeInsets.symmetric(horizontal: 24.0);
+
+                return Padding(padding: panelPadding, child: noteTiles[index]);
+              } else {
+                return Container();
+              }
+            },
+          ),
+        ),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/notes/notes_screen.i18n.dart

@@ -0,0 +1,45 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension SettingsLocalization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          "notes": "Notes",
+          "empty": "You don't have any notes",
+          "todo": "Tasks",
+          "homework": "Homework",
+          "new_note": "New Note",
+          "edit_note": "Edit Note",
+          "hint": "Note content...",
+          "hint_t": "Note title...",
+          "your_notes": "Your Notes",
+        },
+        "hu_hu": {
+          "notes": "Füzet",
+          "empty": "Nincsenek jegyzeteid",
+          "todo": "Feladatok",
+          "homework": "Házi feladat",
+          "new_note": "Új jegyzet",
+          "edit_note": "Jegyzet szerkesztése",
+          "hint": "Jegyzet tartalma...",
+          "hint_t": "Jegyzet címe...",
+          "your_notes": "Jegyzeteid",
+        },
+        "de_de": {
+          "notes": "Broschüre",
+          "empty": "Sie haben keine Notizen",
+          "todo": "Aufgaben",
+          "homework": "Hausaufgaben",
+          "new_note": "Neue Notiz",
+          "edit_note": "Notiz bearbeiten",
+          "hint": "Inhalt beachten...",
+          "hint_t": "Titel notieren...",
+          "your_notes": "Deine Noten",
+        },
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}

refilc_mobile_ui/lib/screens/notes/self_note_tile.dart

@@ -0,0 +1,64 @@
+import 'package:refilc/models/settings.dart';
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+
+class SelfNoteTile extends StatelessWidget {
+  const SelfNoteTile(
+      {super.key, required this.title, required this.content, this.onTap});
+
+  final String title;
+  final String content;
+  final Function()? onTap;
+
+  @override
+  Widget build(BuildContext context) {
+    return GestureDetector(
+      onTap: onTap,
+      child: Column(
+        children: [
+          Container(
+            height: 172.0,
+            width: 172.0,
+            padding: const EdgeInsets.all(10.0),
+            decoration: BoxDecoration(
+              borderRadius: BorderRadius.circular(16.0),
+              color: Theme.of(context).colorScheme.background,
+              boxShadow: [
+                if (Provider.of<SettingsProvider>(context, listen: false)
+                    .shadowEffect)
+                  BoxShadow(
+                    offset: const Offset(0, 21),
+                    blurRadius: 23.0,
+                    color: Theme.of(context).shadowColor,
+                  ),
+              ],
+            ),
+            child: Text(
+              content.replaceAll('\n', ' '),
+              overflow: TextOverflow.ellipsis,
+              textAlign: TextAlign.start,
+              maxLines: 6,
+              style: const TextStyle(fontSize: 17.0),
+            ),
+          ),
+          const SizedBox(
+            height: 5.0,
+          ),
+          SizedBox(
+            width: 152.0,
+            child: Text(
+              title,
+              textAlign: TextAlign.center,
+              overflow: TextOverflow.ellipsis,
+              maxLines: 1,
+              style: const TextStyle(
+                fontWeight: FontWeight.w500,
+                fontSize: 14.0,
+              ),
+            ),
+          ),
+        ],
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/settings/accounts/account_tile.dart

@@ -0,0 +1,47 @@
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+
+class AccountTile extends StatelessWidget {
+  const AccountTile(
+      {super.key,
+      this.onTap,
+      this.onTapMenu,
+      this.profileImage,
+      this.name,
+      this.username});
+
+  final void Function()? onTap;
+  final void Function()? onTapMenu;
+  final Widget? profileImage;
+  final Widget? name;
+  final Widget? username;
+
+  @override
+  Widget build(BuildContext context) {
+    return Material(
+      color: Colors.transparent,
+      child: ListTile(
+        visualDensity: VisualDensity.compact,
+        contentPadding: const EdgeInsets.only(left: 12.0),
+        shape: RoundedRectangleBorder(borderRadius: BorderRadius.circular(8.0)),
+        onTap: onTap,
+        onLongPress: onTapMenu,
+        leading: profileImage,
+        title: name,
+        subtitle: username,
+        trailing: onTapMenu != null
+            ? Material(
+                color: Colors.transparent,
+                child: IconButton(
+                  splashRadius: 24.0,
+                  onPressed: onTapMenu,
+                  icon: Icon(FeatherIcons.moreVertical,
+                      color: AppColors.of(context).text.withOpacity(0.8)),
+                ),
+              )
+            : null,
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/settings/accounts/account_view.dart

@@ -0,0 +1,63 @@
+// ignore_for_file: no_leading_underscores_for_local_identifiers
+
+import 'package:refilc/models/user.dart';
+import 'package:refilc_mobile_ui/common/bottom_card.dart';
+import 'package:refilc_mobile_ui/common/detail.dart';
+import 'package:refilc_mobile_ui/common/profile_image/profile_image.dart';
+import 'package:refilc_mobile_ui/screens/settings/accounts/account_tile.dart';
+import 'package:flutter/material.dart';
+import 'package:intl/intl.dart';
+import 'account_view.i18n.dart';
+
+class AccountView extends StatelessWidget {
+  const AccountView(this.user, {super.key});
+
+  final User user;
+
+  static void show(User user, {required BuildContext context}) =>
+      showBottomCard(context: context, child: AccountView(user));
+
+  @override
+  Widget build(BuildContext context) {
+    List<String> _nameParts = user.name.split(" ");
+    String _firstName = _nameParts.length > 1 ? _nameParts[1] : _nameParts[0];
+
+    return Padding(
+      padding: const EdgeInsets.only(bottom: 12.0),
+      child: Column(
+        crossAxisAlignment: CrossAxisAlignment.start,
+        children: [
+          AccountTile(
+            profileImage: ProfileImage(
+              name: _firstName,
+              backgroundColor: Theme.of(context).colorScheme.primary,
+              role: user.role,
+            ),
+            name: SelectableText(
+              user.name,
+              style: const TextStyle(fontWeight: FontWeight.w500),
+              maxLines: 2,
+              minLines: 1,
+            ),
+            username: SelectableText(user.username),
+          ),
+
+          // User details
+          Detail(
+              title: "birthdate".i18n,
+              description:
+                  DateFormat("yyyy. MM. dd.").format(user.student.birth)),
+          Detail(title: "school".i18n, description: user.student.school.name),
+          if (user.student.className != null)
+            Detail(title: "class".i18n, description: user.student.className!),
+          if (user.student.address != null)
+            Detail(title: "address".i18n, description: user.student.address!),
+          if (user.student.parents.isNotEmpty)
+            Detail(
+                title: "parents".plural(user.student.parents.length),
+                description: user.student.parents.join(", ")),
+        ],
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/settings/accounts/account_view.i18n.dart

@@ -0,0 +1,33 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension Localization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          "birthdate": "Birth date",
+          "school": "School",
+          "class": "Class",
+          "address": "Home address",
+          "parents": "Parents".one("Parent"),
+        },
+        "hu_hu": {
+          "birthdate": "Születési dátum",
+          "school": "Iskola",
+          "class": "Osztály",
+          "address": "Lakcím",
+          "parents": "Szülők".one("Szülő"),
+        },
+        "de_de": {
+          "birthdate": "Geburtsdatum",
+          "school": "Schule",
+          "class": "Klasse",
+          "address": "Wohnanschrift",
+          "parents": "Eltern",
+        },
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}

refilc_mobile_ui/lib/screens/settings/debug/subject_icon_gallery.dart

@@ -0,0 +1,84 @@
+import 'package:refilc/helpers/subject.dart';
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:flutter/material.dart';
+
+class SubjectIconGallery extends StatelessWidget {
+  const SubjectIconGallery({super.key});
+
+  @override
+  Widget build(BuildContext context) {
+    return Scaffold(
+      appBar: AppBar(
+        surfaceTintColor: Theme.of(context).scaffoldBackgroundColor,
+        leading: BackButton(color: AppColors.of(context).text),
+        title: Text(
+          "Subject Icon Gallery",
+          style: TextStyle(color: AppColors.of(context).text),
+        ),
+      ),
+      body: ListView(
+        children: const [
+          SubjectIconItem("Matematika"),
+          SubjectIconItem("Magyar Nyelv"),
+          SubjectIconItem("Nyelvtan"),
+          SubjectIconItem("Irodalom"),
+          SubjectIconItem("Történelem"),
+          SubjectIconItem("Földrajz"),
+          SubjectIconItem("Rajz"),
+          SubjectIconItem("Vizuális kultúra"),
+          SubjectIconItem("Fizika"),
+          SubjectIconItem("Ének"),
+          SubjectIconItem("Testnevelés"),
+          SubjectIconItem("Kémia"),
+          SubjectIconItem("Biológia"),
+          SubjectIconItem("Természetismeret"),
+          SubjectIconItem("Erkölcstan"),
+          SubjectIconItem("Pénzügy"),
+          SubjectIconItem("Informatika"),
+          SubjectIconItem("Digitális kultúra"),
+          SubjectIconItem("Programozás"),
+          SubjectIconItem("Hálózat"),
+          SubjectIconItem("Színház technika"),
+          SubjectIconItem("Média"),
+          SubjectIconItem("Elektronika"),
+          SubjectIconItem("Gépészet"),
+          SubjectIconItem("Technika"),
+          SubjectIconItem("Tánc"),
+          SubjectIconItem("Filozófia"),
+          SubjectIconItem("Osztályfőnöki"),
+          SubjectIconItem("Gazdaság"),
+          SubjectIconItem("Szorgalom"),
+          SubjectIconItem("Magatartás"),
+          SubjectIconItem("Angol nyelv"),
+          SubjectIconItem("Linux"),
+          SubjectIconItem("Adatbázis"),
+          SubjectIconItem("Asztali alkalmazások"),
+          SubjectIconItem("Projekt"),
+        ],
+      ),
+    );
+  }
+}
+
+class SubjectIconItem extends StatelessWidget {
+  const SubjectIconItem(this.name, {super.key});
+
+  final String name;
+
+  @override
+  Widget build(BuildContext context) {
+    return ListTile(
+      leading: Icon(
+        SubjectIcon.resolveVariant(subjectName: name, context: context),
+        color: AppColors.of(context).text,
+      ),
+      title: Text(
+        name,
+        style: TextStyle(
+          color: AppColors.of(context).text,
+          fontWeight: FontWeight.w500,
+        ),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/settings/desktop_settings.dart

@@ -0,0 +1,94 @@
+import 'package:refilc/api/providers/database_provider.dart';
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc/models/settings.dart';
+import 'package:refilc/theme/colors/colors.dart';
+// import 'package:refilc/utils/format.dart';
+// import 'package:refilc_kreta_api/models/teacher.dart';
+import 'package:refilc_mobile_ui/common/panel/panel_button.dart';
+// import 'package:refilc_plus/models/premium_scopes.dart';
+// import 'package:refilc_plus/providers/premium_provider.dart';
+// import 'package:refilc_plus/ui/mobile/premium/upsell.dart';
+import 'package:flutter/cupertino.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'package:refilc_mobile_ui/screens/settings/settings_screen.i18n.dart';
+import 'package:refilc_mobile_ui/common/beta_chip.dart';
+
+class MenuDesktopSettings extends StatelessWidget {
+  const MenuDesktopSettings({super.key, required this.settings});
+
+  final SettingsProvider settings;
+
+  @override
+  Widget build(BuildContext context) {
+    return PanelButton(
+      padding: const EdgeInsets.only(left: 14.0),
+      onPressed: () {
+        Navigator.of(context, rootNavigator: true).push(
+          CupertinoPageRoute(
+              builder: (context) => const ModifyDesktopSettings()),
+        );
+      },
+      title: Row(
+        children: [
+          Text(
+            "desktop_settings".i18n,
+            style: TextStyle(color: AppColors.of(context).text),
+          ),
+          const Spacer(),
+          const BetaChip(),
+          const Spacer()
+        ],
+      ),
+      leading: Icon(FeatherIcons.monitor,
+          color: Theme.of(context).colorScheme.secondary),
+    );
+  }
+}
+
+class ModifyDesktopSettings extends StatefulWidget {
+  const ModifyDesktopSettings({super.key});
+
+  @override
+  State<ModifyDesktopSettings> createState() => _ModifyDesktopSettingsState();
+}
+
+class _ModifyDesktopSettingsState extends State<ModifyDesktopSettings> {
+  final GlobalKey<ScaffoldState> _scaffoldKey = GlobalKey<ScaffoldState>();
+
+  late UserProvider user;
+  late DatabaseProvider dbProvider;
+  late SettingsProvider settings;
+
+  @override
+  void initState() {
+    super.initState();
+    user = Provider.of<UserProvider>(context, listen: false);
+    dbProvider = Provider.of<DatabaseProvider>(context, listen: false);
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    settings = Provider.of<SettingsProvider>(context);
+    return Scaffold(
+        key: _scaffoldKey,
+        appBar: AppBar(
+          surfaceTintColor: Theme.of(context).scaffoldBackgroundColor,
+          leading: BackButton(color: AppColors.of(context).text),
+          title: Text(
+            "desktop_settings".i18n,
+            style: TextStyle(color: AppColors.of(context).text),
+          ),
+        ),
+        body: const Padding(
+          padding: EdgeInsets.symmetric(vertical: 16.0, horizontal: 24.0),
+          child: SingleChildScrollView(
+            child: Column(
+              crossAxisAlignment: CrossAxisAlignment.start,
+              children: [],
+            ),
+          ),
+        ));
+  }
+}

refilc_mobile_ui/lib/screens/settings/modify_names.i18n.dart

@@ -0,0 +1,72 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension SettingsLocalization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          // subject rename
+          "renamed_subjects": "Renamed Subjects",
+          "rename_subjects": "Rename Subjects",
+          "rename_subject": "Rename Subject",
+          "select_subject": "Select Subject",
+          "modified_name": "Modified Name",
+          "modify_subjects": "Modify Subjects",
+          "cancel": "Cancel",
+          "done": "Done",
+          "rename_new_subject": "Rename New Subject",
+          "italics_toggle": "Italic Font",
+          // teacher rename
+          "renamed_teachers": "Renamed Teachers",
+          "rename_teachers": "Rename Teachers",
+          "rename_teacher": "Rename Teacher",
+          "select_teacher": "Select Teacher",
+          "modify_teachers": "Modify Teachers",
+          "rename_new_teacher": "Rename New Teacher",
+        },
+        "hu_hu": {
+          // subject rename
+          "renamed_subjects": "Átnevezett Tantárgyaid",
+          "rename_subjects": "Tantárgyak átnevezése",
+          "rename_subject": "Tantárgy átnevezése",
+          "select_subject": "Válassz tantárgyat",
+          "modified_name": "Módosított név",
+          "modify_subjects": "Tantárgyak módosítása",
+          "cancel": "Mégse",
+          "done": "Kész",
+          "rename_new_subject": "Új tantárgy átnevezése",
+          "italics_toggle": "Dőlt betűs megjelenítés",
+          // teacher rename
+          "renamed_teachers": "Átnevezett tanáraid",
+          "rename_teachers": "Tanárok átnevezése",
+          "rename_teacher": "Tanár átnevezése",
+          "select_teacher": "Válassz tanárt",
+          "modify_teachers": "Tanárok módosítása",
+          "rename_new_teacher": "Új tanár átnevezése",
+        },
+        "de_de": {
+          // subject rename
+          "renamed_subjects": "Umbenannte Fächer",
+          "rename_subjects": "Fächer umbenennen",
+          "rename_subject": "Fach umbenennen",
+          "select_subject": "Fach auswählen",
+          "modified_name": "Geänderter Name",
+          "modify_subjects": "Fächer ändern",
+          "cancel": "Abbrechen",
+          "done": "Erledigt",
+          "rename_new_subject": "Neues Fach umbenennen",
+          "italics_toggle": "Kursivschrift umschalten",
+          // teacher rename
+          "renamed_teachers": "Renamed Teachers",
+          "rename_teachers": "Rename Teachers",
+          "rename_teacher": "Rename Teacher",
+          "select_teacher": "Select Teacher",
+          "modify_teachers": "Modify Teachers",
+          "rename_new_teacher": "Rename New Teacher",
+        },
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}

refilc_mobile_ui/lib/screens/settings/modify_subject_names.dart

@@ -0,0 +1,439 @@
+// ignore_for_file: use_build_context_synchronously
+
+import 'package:dropdown_button2/dropdown_button2.dart';
+import 'package:refilc/api/providers/database_provider.dart';
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc/helpers/subject.dart';
+import 'package:refilc/models/settings.dart';
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:refilc/utils/format.dart';
+import 'package:refilc_kreta_api/models/subject.dart';
+import 'package:refilc_kreta_api/providers/absence_provider.dart';
+import 'package:refilc_kreta_api/providers/grade_provider.dart';
+import 'package:refilc_kreta_api/providers/timetable_provider.dart';
+import 'package:refilc_mobile_ui/common/panel/panel.dart';
+import 'package:refilc_mobile_ui/common/panel/panel_button.dart';
+// import 'package:refilc_plus/models/premium_scopes.dart';
+// import 'package:refilc_plus/providers/premium_provider.dart';
+// import 'package:refilc_plus/ui/mobile/premium/upsell.dart';
+import 'package:flutter/cupertino.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+
+import 'modify_names.i18n.dart';
+
+class MenuRenamedSubjects extends StatelessWidget {
+  const MenuRenamedSubjects({super.key, required this.settings});
+
+  final SettingsProvider settings;
+
+  @override
+  Widget build(BuildContext context) {
+    return PanelButton(
+      padding: const EdgeInsets.only(left: 14.0),
+      onPressed: () {
+        // if (!Provider.of<PremiumProvider>(context, listen: false)
+        //     .hasScope(PremiumScopes.renameSubjects)) {
+        //   PremiumLockedFeatureUpsell.show(
+        //       context: context, feature: PremiumFeature.subjectrename);
+        //   return;
+        // }
+
+        Navigator.of(context, rootNavigator: true).push(
+          CupertinoPageRoute(builder: (context) => const ModifySubjectNames()),
+        );
+      },
+      title: Text(
+        "rename_subjects".i18n,
+        style: TextStyle(
+            color: AppColors.of(context)
+                .text
+                .withOpacity(settings.renamedSubjectsEnabled ? 1.0 : .5)),
+      ),
+      leading: settings.renamedSubjectsEnabled
+          ? const Icon(FeatherIcons.penTool)
+          : Icon(FeatherIcons.penTool,
+              color: AppColors.of(context).text.withOpacity(.25)),
+      trailingDivider: true,
+      trailing: Switch(
+        onChanged: (v) async {
+          // if (!Provider.of<PremiumProvider>(context, listen: false)
+          //     .hasScope(PremiumScopes.renameSubjects)) {
+          //   PremiumLockedFeatureUpsell.show(
+          //       context: context, feature: PremiumFeature.subjectrename);
+          //   return;
+          // }
+
+          settings.update(renamedSubjectsEnabled: v);
+          await Provider.of<GradeProvider>(context, listen: false)
+              .convertBySettings();
+          await Provider.of<TimetableProvider>(context, listen: false)
+              .convertBySettings();
+          await Provider.of<AbsenceProvider>(context, listen: false)
+              .convertBySettings();
+        },
+        value: settings.renamedSubjectsEnabled,
+        activeColor: Theme.of(context).colorScheme.secondary,
+      ),
+    );
+  }
+}
+
+class ModifySubjectNames extends StatefulWidget {
+  const ModifySubjectNames({super.key});
+
+  @override
+  State<ModifySubjectNames> createState() => _ModifySubjectNamesState();
+}
+
+class _ModifySubjectNamesState extends State<ModifySubjectNames> {
+  final GlobalKey<ScaffoldState> _scaffoldKey = GlobalKey<ScaffoldState>();
+  final _subjectName = TextEditingController();
+  String? selectedSubjectId;
+
+  late List<GradeSubject> subjects;
+  late UserProvider user;
+  late DatabaseProvider dbProvider;
+  late SettingsProvider settings;
+
+  @override
+  void initState() {
+    super.initState();
+    subjects = Provider.of<GradeProvider>(context, listen: false)
+        .grades
+        .map((e) => e.subject)
+        .toSet()
+        .toList()
+      ..sort((a, b) => a.name.compareTo(b.name));
+    user = Provider.of<UserProvider>(context, listen: false);
+    dbProvider = Provider.of<DatabaseProvider>(context, listen: false);
+  }
+
+  Future<Map<String, String>> fetchRenamedSubjects() async {
+    return await dbProvider.userQuery.renamedSubjects(userId: user.id!);
+  }
+
+  void showRenameDialog() {
+    showDialog(
+      context: context,
+      builder: (context) => StatefulBuilder(builder: (context, setS) {
+        return AlertDialog(
+          shape: const RoundedRectangleBorder(
+              borderRadius: BorderRadius.all(Radius.circular(14.0))),
+          title: Text("rename_subject".i18n),
+          content: Column(
+            mainAxisSize: MainAxisSize.min,
+            children: [
+              DropdownButton2(
+                items: subjects
+                    .map((item) => DropdownMenuItem<String>(
+                          value: item.id,
+                          child: Text(
+                            item.name,
+                            style: TextStyle(
+                              fontSize: 14,
+                              fontWeight: FontWeight.bold,
+                              color: AppColors.of(context).text,
+                            ),
+                            overflow: TextOverflow.ellipsis,
+                          ),
+                        ))
+                    .toList(),
+                onChanged: (String? v) async {
+                  final renamedSubs = await fetchRenamedSubjects();
+
+                  setS(() {
+                    selectedSubjectId = v;
+
+                    if (renamedSubs.containsKey(selectedSubjectId)) {
+                      _subjectName.text = renamedSubs[selectedSubjectId]!;
+                    } else {
+                      _subjectName.text = "";
+                    }
+                  });
+                },
+                iconSize: 14,
+                iconEnabledColor: AppColors.of(context).text,
+                iconDisabledColor: AppColors.of(context).text,
+                underline: const SizedBox(),
+                itemHeight: 40,
+                itemPadding: const EdgeInsets.only(left: 14, right: 14),
+                buttonWidth: 50,
+                dropdownWidth: 300,
+                dropdownPadding: null,
+                buttonDecoration: BoxDecoration(
+                  borderRadius: BorderRadius.circular(8),
+                ),
+                dropdownDecoration: BoxDecoration(
+                  borderRadius: BorderRadius.circular(14),
+                ),
+                dropdownElevation: 8,
+                scrollbarRadius: const Radius.circular(40),
+                scrollbarThickness: 6,
+                scrollbarAlwaysShow: true,
+                offset: const Offset(-10, -10),
+                buttonSplashColor: Colors.transparent,
+                customButton: Container(
+                  width: double.infinity,
+                  decoration: BoxDecoration(
+                    border: Border.all(color: Colors.grey, width: 2),
+                    borderRadius: BorderRadius.circular(12.0),
+                  ),
+                  padding: const EdgeInsets.symmetric(
+                      vertical: 12.0, horizontal: 8.0),
+                  child: Text(
+                    selectedSubjectId == null
+                        ? "select_subject".i18n
+                        : subjects
+                            .firstWhere(
+                                (element) => element.id == selectedSubjectId)
+                            .name,
+                    style: Theme.of(context).textTheme.titleSmall!.copyWith(
+                        fontWeight: FontWeight.w700,
+                        color: AppColors.of(context).text.withOpacity(0.75)),
+                    overflow: TextOverflow.ellipsis,
+                    maxLines: 2,
+                    textAlign: TextAlign.center,
+                  ),
+                ),
+              ),
+              const Padding(
+                padding: EdgeInsets.symmetric(vertical: 8.0),
+                child: Icon(FeatherIcons.arrowDown, size: 32),
+              ),
+              TextField(
+                controller: _subjectName,
+                decoration: InputDecoration(
+                  border: OutlineInputBorder(
+                    borderSide:
+                        const BorderSide(color: Colors.grey, width: 1.5),
+                    borderRadius: BorderRadius.circular(12.0),
+                  ),
+                  focusedBorder: OutlineInputBorder(
+                    borderSide:
+                        const BorderSide(color: Colors.grey, width: 1.5),
+                    borderRadius: BorderRadius.circular(12.0),
+                  ),
+                  contentPadding: const EdgeInsets.symmetric(horizontal: 12.0),
+                  hintText: "modified_name".i18n,
+                  suffixIcon: IconButton(
+                    icon: const Icon(
+                      FeatherIcons.x,
+                      color: Colors.grey,
+                    ),
+                    onPressed: () {
+                      setState(() {
+                        _subjectName.text = "";
+                      });
+                    },
+                  ),
+                ),
+              ),
+            ],
+          ),
+          actions: [
+            TextButton(
+              child: Text(
+                "cancel".i18n,
+                style: const TextStyle(fontWeight: FontWeight.w500),
+              ),
+              onPressed: () {
+                Navigator.of(context).maybePop();
+              },
+            ),
+            TextButton(
+              child: Text(
+                "done".i18n,
+                style: const TextStyle(fontWeight: FontWeight.w500),
+              ),
+              onPressed: () async {
+                if (selectedSubjectId != null) {
+                  final renamedSubs = await fetchRenamedSubjects();
+
+                  renamedSubs[selectedSubjectId!] = _subjectName.text;
+                  await dbProvider.userStore
+                      .storeRenamedSubjects(renamedSubs, userId: user.id!);
+                  await Provider.of<GradeProvider>(context, listen: false)
+                      .convertBySettings();
+                  await Provider.of<TimetableProvider>(context, listen: false)
+                      .convertBySettings();
+                  await Provider.of<AbsenceProvider>(context, listen: false)
+                      .convertBySettings();
+                }
+                Navigator.of(context).pop(true);
+                setState(() {});
+              },
+            ),
+          ],
+        );
+      }),
+    ).then((val) {
+      _subjectName.text = "";
+      selectedSubjectId = null;
+    });
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    settings = Provider.of<SettingsProvider>(context);
+    return Scaffold(
+        key: _scaffoldKey,
+        appBar: AppBar(
+          surfaceTintColor: Theme.of(context).scaffoldBackgroundColor,
+          leading: BackButton(color: AppColors.of(context).text),
+          title: Text(
+            "modify_subjects".i18n,
+            style: TextStyle(color: AppColors.of(context).text),
+          ),
+        ),
+        body: Padding(
+          padding: const EdgeInsets.symmetric(vertical: 16.0, horizontal: 24.0),
+          child: SingleChildScrollView(
+            child: Column(
+              crossAxisAlignment: CrossAxisAlignment.start,
+              children: [
+                Panel(
+                  child: SwitchListTile(
+                    title: Text("italics_toggle".i18n),
+                    onChanged: (value) =>
+                        settings.update(renamedSubjectsItalics: value),
+                    value: settings.renamedSubjectsItalics,
+                  ),
+                ),
+                const SizedBox(
+                  height: 20,
+                ),
+                InkWell(
+                  onTap: showRenameDialog,
+                  borderRadius: BorderRadius.circular(12.0),
+                  child: Container(
+                    width: double.infinity,
+                    decoration: BoxDecoration(
+                      border: Border.all(color: Colors.grey, width: 2),
+                      borderRadius: BorderRadius.circular(12.0),
+                    ),
+                    padding: const EdgeInsets.symmetric(
+                        vertical: 18.0, horizontal: 12.0),
+                    child: Center(
+                      child: Text(
+                        "rename_new_subject".i18n,
+                        style: TextStyle(
+                          fontWeight: FontWeight.w600,
+                          fontSize: 18,
+                          color: AppColors.of(context).text.withOpacity(.85),
+                        ),
+                      ),
+                    ),
+                  ),
+                ),
+                const SizedBox(
+                  height: 30,
+                ),
+                FutureBuilder<Map<String, String>>(
+                  future: fetchRenamedSubjects(),
+                  builder: (context, snapshot) {
+                    if (!snapshot.hasData || snapshot.data!.isEmpty) {
+                      return Container();
+                    }
+
+                    return Panel(
+                      title: Text("renamed_subjects".i18n),
+                      child: Column(
+                        children: snapshot.data!.keys.map(
+                          (key) {
+                            GradeSubject? subject = subjects
+                                .firstWhere((element) => key == element.id);
+                            String renameTo = snapshot.data![key]!;
+                            return RenamedSubjectItem(
+                              subject: subject,
+                              renamedTo: renameTo,
+                              modifyCallback: () {
+                                setState(() {
+                                  selectedSubjectId = subject.id;
+                                  _subjectName.text = renameTo;
+                                });
+                                showRenameDialog();
+                              },
+                              removeCallback: () {
+                                setState(() {
+                                  Map<String, String> subs =
+                                      Map.from(snapshot.data!);
+                                  subs.remove(key);
+                                  dbProvider.userStore.storeRenamedSubjects(
+                                      subs,
+                                      userId: user.id!);
+                                });
+                              },
+                            );
+                          },
+                        ).toList(),
+                      ),
+                    );
+                  },
+                ),
+              ],
+            ),
+          ),
+        ));
+  }
+}
+
+class RenamedSubjectItem extends StatelessWidget {
+  const RenamedSubjectItem({
+    super.key,
+    required this.subject,
+    required this.renamedTo,
+    required this.modifyCallback,
+    required this.removeCallback,
+  });
+
+  final GradeSubject subject;
+  final String renamedTo;
+  final void Function() modifyCallback;
+  final void Function() removeCallback;
+
+  @override
+  Widget build(BuildContext context) {
+    return ListTile(
+      minLeadingWidth: 32.0,
+      dense: true,
+      contentPadding:
+          const EdgeInsets.symmetric(horizontal: 16.0, vertical: 6.0),
+      shape: RoundedRectangleBorder(borderRadius: BorderRadius.circular(8.0)),
+      visualDensity: VisualDensity.compact,
+      onTap: () {},
+      leading: Icon(
+          SubjectIcon.resolveVariant(subject: subject, context: context),
+          color: AppColors.of(context).text.withOpacity(.75)),
+      title: InkWell(
+        onTap: modifyCallback,
+        child: Column(
+          crossAxisAlignment: CrossAxisAlignment.start,
+          children: [
+            Text(
+              subject.name.capital(),
+              style: TextStyle(
+                  fontWeight: FontWeight.w500,
+                  fontSize: 14,
+                  color: AppColors.of(context).text.withOpacity(.75)),
+              maxLines: 1,
+              overflow: TextOverflow.ellipsis,
+            ),
+            Text(
+              renamedTo,
+              style: const TextStyle(fontWeight: FontWeight.w500, fontSize: 16),
+              maxLines: 2,
+              overflow: TextOverflow.ellipsis,
+            ),
+          ],
+        ),
+      ),
+      trailing: InkWell(
+        onTap: removeCallback,
+        child: Icon(FeatherIcons.trash,
+            color: AppColors.of(context).red.withOpacity(.75)),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/settings/notifications_screen.dart

@@ -0,0 +1,222 @@
+import 'package:refilc/models/settings.dart';
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:refilc_mobile_ui/common/beta_chip.dart';
+import 'package:refilc_mobile_ui/common/panel/panel.dart';
+import 'package:refilc_mobile_ui/common/panel/panel_button.dart';
+import 'package:flutter/cupertino.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'notifications_screen.i18n.dart';
+
+class MenuNotifications extends StatelessWidget {
+  const MenuNotifications({
+    super.key,
+    this.borderRadius = const BorderRadius.vertical(
+        top: Radius.circular(4.0), bottom: Radius.circular(4.0)),
+  });
+
+  final BorderRadius borderRadius;
+
+  @override
+  Widget build(BuildContext context) {
+    return PanelButton(
+      onPressed: () => Navigator.of(context, rootNavigator: true).push(
+        CupertinoPageRoute(builder: (context) => const NotificationsScreen()),
+      ),
+      title: Row(
+        children: [
+          Text(
+            "notifications_screen".i18n,
+          ),
+          const SizedBox(width: 5.0),
+          const BetaChip(
+            disabled: false,
+          ),
+        ],
+      ),
+      leading: Icon(
+        FeatherIcons.messageCircle,
+        size: 22.0,
+        color: AppColors.of(context).text.withOpacity(0.95),
+      ),
+      trailing: Icon(
+        FeatherIcons.chevronRight,
+        size: 22.0,
+        color: AppColors.of(context).text.withOpacity(0.95),
+      ),
+      borderRadius: borderRadius,
+    );
+  }
+}
+
+class NotificationsScreen extends StatelessWidget {
+  const NotificationsScreen({super.key});
+
+  @override
+  Widget build(BuildContext context) {
+    SettingsProvider settings = Provider.of<SettingsProvider>(context);
+
+    return Scaffold(
+      appBar: AppBar(
+        surfaceTintColor: Theme.of(context).scaffoldBackgroundColor,
+        leading: BackButton(color: AppColors.of(context).text),
+        title: Text(
+          "notifications_screen".i18n,
+          style: TextStyle(color: AppColors.of(context).text),
+        ),
+      ),
+      body: SingleChildScrollView(
+        child: Padding(
+          padding: const EdgeInsets.symmetric(vertical: 16.0, horizontal: 24.0),
+          child: Panel(
+            child: Column(
+              children: [
+                Material(
+                  type: MaterialType.transparency,
+                  child: SwitchListTile(
+                    shape: RoundedRectangleBorder(
+                        borderRadius: BorderRadius.circular(12.0)),
+                    value: settings.notificationsGradesEnabled,
+                    onChanged: (v) =>
+                        settings.update(notificationsGradesEnabled: v),
+                    title: Row(
+                      children: [
+                        Icon(
+                          FeatherIcons.bookmark,
+                          color: settings.notificationsGradesEnabled
+                              ? Theme.of(context).colorScheme.secondary
+                              : AppColors.of(context).text.withOpacity(.25),
+                        ),
+                        const SizedBox(width: 14.0),
+                        Expanded(
+                          child: Text(
+                            "grades".i18n,
+                            style: TextStyle(
+                              fontWeight: FontWeight.w600,
+                              fontSize: 16.0,
+                              color: AppColors.of(context).text.withOpacity(
+                                    settings.notificationsGradesEnabled
+                                        ? 1.0
+                                        : .5,
+                                  ),
+                            ),
+                          ),
+                        ),
+                      ],
+                    ),
+                  ),
+                ),
+                Material(
+                  type: MaterialType.transparency,
+                  child: SwitchListTile(
+                    shape: RoundedRectangleBorder(
+                        borderRadius: BorderRadius.circular(12.0)),
+                    value: settings.notificationsAbsencesEnabled,
+                    onChanged: (v) =>
+                        settings.update(notificationsAbsencesEnabled: v),
+                    title: Row(
+                      children: [
+                        Icon(
+                          FeatherIcons.clock,
+                          color: settings.notificationsAbsencesEnabled
+                              ? Theme.of(context).colorScheme.secondary
+                              : AppColors.of(context).text.withOpacity(.25),
+                        ),
+                        const SizedBox(width: 14.0),
+                        Expanded(
+                          child: Text(
+                            "absences".i18n,
+                            style: TextStyle(
+                              fontWeight: FontWeight.w600,
+                              fontSize: 16.0,
+                              color: AppColors.of(context).text.withOpacity(
+                                    settings.notificationsAbsencesEnabled
+                                        ? 1.0
+                                        : .5,
+                                  ),
+                            ),
+                          ),
+                        ),
+                      ],
+                    ),
+                  ),
+                ),
+                Material(
+                  type: MaterialType.transparency,
+                  child: SwitchListTile(
+                    shape: RoundedRectangleBorder(
+                        borderRadius: BorderRadius.circular(12.0)),
+                    value: settings.notificationsMessagesEnabled,
+                    onChanged: (v) =>
+                        settings.update(notificationsMessagesEnabled: v),
+                    title: Row(
+                      children: [
+                        Icon(
+                          FeatherIcons.messageSquare,
+                          color: settings.notificationsMessagesEnabled
+                              ? Theme.of(context).colorScheme.secondary
+                              : AppColors.of(context).text.withOpacity(.25),
+                        ),
+                        const SizedBox(width: 14.0),
+                        Expanded(
+                          child: Text(
+                            "messages".i18n,
+                            style: TextStyle(
+                              fontWeight: FontWeight.w600,
+                              fontSize: 16.0,
+                              color: AppColors.of(context).text.withOpacity(
+                                    settings.notificationsMessagesEnabled
+                                        ? 1.0
+                                        : .5,
+                                  ),
+                            ),
+                          ),
+                        ),
+                      ],
+                    ),
+                  ),
+                ),
+                Material(
+                  type: MaterialType.transparency,
+                  child: SwitchListTile(
+                    shape: RoundedRectangleBorder(
+                        borderRadius: BorderRadius.circular(12.0)),
+                    value: settings.notificationsLessonsEnabled,
+                    onChanged: (v) =>
+                        settings.update(notificationsLessonsEnabled: v),
+                    title: Row(
+                      children: [
+                        Icon(
+                          FeatherIcons.calendar,
+                          color: settings.notificationsLessonsEnabled
+                              ? Theme.of(context).colorScheme.secondary
+                              : AppColors.of(context).text.withOpacity(.25),
+                        ),
+                        const SizedBox(width: 14.0),
+                        Expanded(
+                          child: Text(
+                            "lessons".i18n,
+                            style: TextStyle(
+                              fontWeight: FontWeight.w600,
+                              fontSize: 16.0,
+                              color: AppColors.of(context).text.withOpacity(
+                                    settings.notificationsLessonsEnabled
+                                        ? 1.0
+                                        : .5,
+                                  ),
+                            ),
+                          ),
+                        ),
+                      ],
+                    ),
+                  ),
+                ),
+              ],
+            ),
+          ),
+        ),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/settings/notifications_screen.i18n.dart

@@ -0,0 +1,34 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension SettingsLocalization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          "notifications_screen": "Notifications",
+          "grades": "Grades",
+          "absences": "Absences",
+          "messages": "Messages",
+          "lessons": "Lessons"
+          
+        },
+        "hu_hu": {
+          "notifications_screen": "Értesítések",
+          "grades": "Jegyek",
+          "absences": "Hiányzások",
+          "messages": "Üzenetek",
+          "lessons": "Órák"
+        },
+        "de_de": {
+          "notifications_screen": "Mitteilung",
+          "grades": "Noten",
+          "absences": "Fehlen",
+          "messages": "Nachrichten",
+          "lessons": "Unterricht"
+        },
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}

refilc_mobile_ui/lib/screens/settings/privacy_view.dart

@@ -0,0 +1,59 @@
+import 'package:flutter/material.dart';
+import 'package:flutter_custom_tabs/flutter_custom_tabs.dart';
+import 'package:flutter_linkify/flutter_linkify.dart';
+import 'settings_screen.i18n.dart';
+
+class PrivacyView extends StatelessWidget {
+  const PrivacyView({super.key});
+
+  static void show(BuildContext context) => showDialog(
+      context: context,
+      builder: (context) => const PrivacyView(),
+      barrierDismissible: true);
+
+  @override
+  Widget build(BuildContext context) {
+    return Padding(
+      padding: const EdgeInsets.symmetric(vertical: 100.0, horizontal: 32.0),
+      child: Material(
+        borderRadius: BorderRadius.circular(12.0),
+        child: Padding(
+          padding: const EdgeInsets.all(12.0),
+          child: ListView(
+            physics: const BouncingScrollPhysics(),
+            children: [
+              Padding(
+                padding: const EdgeInsets.all(8.0),
+                child: Text("privacy".i18n),
+              ),
+              SelectableLinkify(
+                text: """
+  • A reFilc (továbbiakban alkalmazás) egy mobilos, asztali és webes kliensalkalmazás, segítségével az e-Kréta rendszeréből letöltheted és felhasználóbarát módon megjelenítheted az adataidat. Tanulmányi adataid csak közvetlenül az alkalmazás és a Kréta-szerverek között közlekednek, titkosított kapcsolaton keresztül.
+
+  • A reFilc fejlesztői és/vagy üzemeltetői, valamint az alkalmazás a tanulmányi és személyes adataidat semmilyen célból és semmilyen körülmények között nem másolják, nem tárolják és harmadik félnek nem továbbítják. Ezeket így az Educational Development Informatikai Zrt. kezeli, az Ő adatkezeléssel kapcsolatos tájékoztatójukat itt találod: https://tudasbazis.ekreta.hu/pages/viewpage.action?pageId=4065038
+
+  • Azok törlésével vagy módosítával kapcsolatban keresd az osztályfőnöködet vagy az iskolád rendszergazdáját.
+
+  • Az alkalmazás névtelen használati statisztikákat gyűjt, ezek alapján tudjuk meghatározni a felhasználók és a telepítések számát, valamint az eszközük platformját. Ezt a beállításokban kikapcsolhatod. Kérünk, hogy ha csak teheted, hagyd ezt a funkciót bekapcsolva, hogy pontosabb információnk legyen a felhasználóink platform-megoszlásáról.
+
+  • Amikor az alkalmazás hibába ütközik, lehetőség van hibajelentés küldésére. Ez személyes- és/vagy tanulmányi adatokat nem tartalmaz, viszont részletes információval szolgál a hibáról, annak okáról és eszközödről. A küldés előtt megjelenő képernyőn a te felelősséged átnézni a továbbításra kerülő adatsort. A hibajelentéseket a reFilc fejlesztői felületén és egy privát Discord szobában tároljuk, ezekhez csak az app fejlesztői férnek hozzá.
+
+  • Az alkalmazás (az alábbi platformokon: Android, Linux, Windows) minden egyes indításakor a reFilc API, valamint a Github API segítségével ellenőrzi, hogy elérhető-e új verzió, és kérésre innen letölti és telepíti a frissítést.
+
+  • Amennyiben az adataiddal kapcsolatban bármilyen kérdésed van (megtekintés, törlés, módosítás, adathordozás), keress minket a social@refilc.hu e-mail címen, vagy Discord szerverünkön!
+  
+  • A kliensalkalmazás bármely eszközön és platformon történő használatával tudomásul vetted és elfogadod a jelen adatkezelési tájékoztatót. A reFilc csapata fenntartja a jogot a tájékoztató módosítására és a módosításokról nem köteles értesíteni a felhasználóit!
+""",
+                onOpen: (link) => launch(link.url,
+                    customTabsOption: CustomTabsOption(
+                      toolbarColor: Theme.of(context).scaffoldBackgroundColor,
+                      showPageTitle: true,
+                    )),
+              ),
+            ],
+          ),
+        ),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/settings/settings_helper.dart

@@ -0,0 +1,983 @@
+// ignore_for_file: prefer_function_declarations_over_variables, library_private_types_in_public_api, use_build_context_synchronously
+
+import 'dart:io';
+
+import 'package:refilc/api/providers/database_provider.dart';
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc/helpers/quick_actions.dart';
+import 'package:refilc/icons/filc_icons.dart';
+import 'package:refilc/models/settings.dart';
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:refilc/theme/observer.dart';
+import 'package:refilc_kreta_api/models/grade.dart';
+import 'package:refilc_kreta_api/models/subject.dart';
+import 'package:refilc_kreta_api/models/week.dart';
+import 'package:refilc_kreta_api/providers/absence_provider.dart';
+import 'package:refilc_kreta_api/providers/grade_provider.dart';
+import 'package:refilc_kreta_api/providers/timetable_provider.dart';
+import 'package:refilc_mobile_ui/common/bottom_sheet_menu/bottom_sheet_menu.dart';
+import 'package:refilc_mobile_ui/common/bottom_sheet_menu/bottom_sheet_menu_item.dart';
+import 'package:refilc_mobile_ui/common/bottom_sheet_menu/rounded_bottom_sheet.dart';
+import 'package:refilc_mobile_ui/common/filter_bar.dart';
+import 'package:refilc_mobile_ui/common/material_action_button.dart';
+import 'package:refilc/ui/widgets/grade/grade_tile.dart';
+import 'package:refilc_mobile_ui/common/panel/panel_button.dart';
+import 'package:refilc_mobile_ui/common/system_chrome.dart';
+import 'package:flutter/cupertino.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter/services.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:google_fonts/google_fonts.dart';
+import 'package:i18n_extension/i18n_widget.dart';
+import 'package:provider/provider.dart';
+import 'package:refilc_mobile_ui/common/screens.i18n.dart';
+import 'package:refilc_mobile_ui/screens/settings/settings_screen.i18n.dart';
+import 'package:flutter_material_color_picker/flutter_material_color_picker.dart';
+import 'package:refilc/models/icon_pack.dart';
+import 'package:refilc/utils/format.dart';
+import 'package:refilc_mobile_ui/screens/settings/theme_screen.dart';
+import 'package:refilc_plus/models/premium_scopes.dart';
+import 'package:refilc_plus/providers/premium_provider.dart';
+import 'package:refilc_plus/ui/mobile/premium/upsell.dart';
+
+class SettingsHelper {
+  static const Map<String, String> langMap = {
+    "en": "🇬🇧  English",
+    "hu": "🇭🇺  Magyar",
+    "de": "🇩🇪  Deutsch"
+  };
+
+  static const List<String> fontList = [
+    "Montserrat",
+    "Merienda",
+    "M PLUS Code Latin",
+    "Figtree",
+    "Fira Code",
+    "Vollkorn",
+  ];
+
+  static const Map<Pages, String> pageTitle = {
+    Pages.home: "home",
+    Pages.grades: "grades",
+    Pages.timetable: "timetable",
+    Pages.messages: "messages",
+    Pages.absences: "absences",
+  };
+
+  static Map<VibrationStrength, String> vibrationTitle = {
+    VibrationStrength.off: "voff",
+    VibrationStrength.light: "vlight",
+    VibrationStrength.medium: "vmedium",
+    VibrationStrength.strong: "vstrong",
+  };
+
+  static Map<Pages, String> localizedPageTitles() => pageTitle
+      .map((key, value) => MapEntry(key, ScreensLocalization(value).i18n));
+  static Map<VibrationStrength, String> localizedVibrationTitles() =>
+      vibrationTitle
+          .map((key, value) => MapEntry(key, SettingsLocalization(value).i18n));
+
+  static void language(BuildContext context) {
+    showBottomSheetMenu(
+      context,
+      items: List.generate(langMap.length, (index) {
+        String lang = langMap.keys.toList()[index];
+        return BottomSheetMenuItem(
+          onPressed: () {
+            Provider.of<SettingsProvider>(context, listen: false)
+                .update(language: lang);
+            I18n.of(context).locale = Locale(lang, lang.toUpperCase());
+            Navigator.of(context).maybePop();
+            if (Platform.isAndroid || Platform.isIOS) {
+              setupQuickActions();
+            }
+          },
+          title: Row(
+            mainAxisAlignment: MainAxisAlignment.spaceBetween,
+            children: [
+              Text(langMap.values.toList()[index]),
+              if (lang == I18n.of(context).locale.languageCode)
+                Icon(
+                  Icons.check_circle,
+                  color: Theme.of(context).colorScheme.secondary,
+                ),
+            ],
+          ),
+        );
+      }),
+    );
+  }
+
+  // static void uwuMode(BuildContext context, value) {
+  //   final settings = Provider.of<SettingsProvider>(context, listen: false);
+  //   if (value) {
+  //     I18n.of(context).locale = const Locale('uw', 'UW');
+  //   } else {
+  //     I18n.of(context).locale =
+  //         Locale(settings.language, settings.language.toUpperCase());
+  //   }
+  //   if (Platform.isAndroid || Platform.isIOS) {
+  //     setupQuickActions();
+  //   }
+  // }
+
+  static void fontFamily(BuildContext context) {
+    SettingsProvider settings =
+        Provider.of<SettingsProvider>(context, listen: false);
+
+    showBottomSheetMenu(
+      context,
+      items: List.generate(fontList.length, (index) {
+        String font = fontList[index];
+        return BottomSheetMenuItem(
+          onPressed: () {
+            settings.update(fontFamily: font == 'Montserrat' ? '' : font);
+            Provider.of<ThemeModeObserver>(context, listen: false)
+                .changeTheme(settings.theme, updateNavbarColor: false);
+
+            Navigator.of(context).maybePop();
+          },
+          title: Row(
+            mainAxisAlignment: MainAxisAlignment.spaceBetween,
+            children: [
+              Text(
+                font,
+                style: GoogleFonts.getFont(font),
+              ),
+              if (font == settings.fontFamily ||
+                  font.replaceAll('Montserrat', '') == settings.fontFamily)
+                Icon(
+                  Icons.check_circle,
+                  color: Theme.of(context).colorScheme.secondary,
+                ),
+            ],
+          ),
+        );
+      }),
+    );
+  }
+
+  static void iconPack(BuildContext context) {
+    final settings = Provider.of<SettingsProvider>(context, listen: false);
+    showBottomSheetMenu(
+      context,
+      items: List.generate(IconPack.values.length, (index) {
+        IconPack current = IconPack.values[index];
+        return BottomSheetMenuItem(
+          onPressed: () {
+            settings.update(iconPack: current);
+            Navigator.of(context).maybePop();
+          },
+          title: Row(
+            mainAxisAlignment: MainAxisAlignment.spaceBetween,
+            children: [
+              Text(current.name.capital()),
+              if (current == settings.iconPack)
+                Icon(
+                  Icons.check_circle,
+                  color: Theme.of(context).colorScheme.secondary,
+                ),
+            ],
+          ),
+        );
+      }),
+    );
+  }
+
+  static void startPage(BuildContext context) {
+    Map<Pages, IconData> pageIcons = {
+      Pages.home: FilcIcons.home,
+      Pages.grades: FeatherIcons.bookmark,
+      Pages.timetable: FeatherIcons.calendar,
+      Pages.messages: FeatherIcons.messageSquare,
+      Pages.absences: FeatherIcons.clock,
+    };
+
+    showBottomSheetMenu(
+      context,
+      items: List.generate(Pages.values.length, (index) {
+        return BottomSheetMenuItem(
+          onPressed: () {
+            Provider.of<SettingsProvider>(context, listen: false)
+                .update(startPage: Pages.values[index]);
+            Navigator.of(context).maybePop();
+          },
+          title: Row(
+            children: [
+              Icon(pageIcons[Pages.values[index]],
+                  size: 20.0, color: Theme.of(context).colorScheme.secondary),
+              const SizedBox(width: 16.0),
+              Text(localizedPageTitles()[Pages.values[index]] ?? ""),
+              const Spacer(),
+              if (Pages.values[index] ==
+                  Provider.of<SettingsProvider>(context, listen: false)
+                      .startPage)
+                Icon(
+                  Icons.check_circle,
+                  color: Theme.of(context).colorScheme.secondary,
+                ),
+            ],
+          ),
+        );
+      }),
+    );
+  }
+
+  static void rounding(BuildContext context) {
+    showRoundedModalBottomSheet(
+      context,
+      child: const RoundingSetting(),
+    );
+  }
+
+  // new v5 roundings
+  static void newRoundings(BuildContext context, GradeSubject subject) {
+    showRoundedModalBottomSheet(
+      context,
+      child: RoundingSetting(
+        rounding: subject.customRounding,
+        subjectId: subject.id,
+      ),
+    );
+  }
+  // end
+
+  static void theme(BuildContext context) {
+    var settings = Provider.of<SettingsProvider>(context, listen: false);
+    void Function(ThemeMode) setTheme = (mode) {
+      settings.update(theme: mode);
+      Provider.of<ThemeModeObserver>(context, listen: false).changeTheme(mode);
+      Navigator.of(context).maybePop();
+    };
+
+    showBottomSheetMenu(context, items: [
+      BottomSheetMenuItem(
+        onPressed: () => setTheme(ThemeMode.system),
+        title: Row(
+          children: [
+            Padding(
+              padding: const EdgeInsets.only(right: 16.0),
+              child: Icon(FeatherIcons.smartphone,
+                  size: 20.0, color: Theme.of(context).colorScheme.secondary),
+            ),
+            Text(SettingsLocalization("system").i18n),
+            const Spacer(),
+            if (settings.theme == ThemeMode.system)
+              Icon(
+                Icons.check_circle,
+                color: Theme.of(context).colorScheme.secondary,
+              ),
+          ],
+        ),
+      ),
+      BottomSheetMenuItem(
+        onPressed: () => setTheme(ThemeMode.light),
+        title: Row(
+          children: [
+            Padding(
+              padding: const EdgeInsets.only(right: 16.0),
+              child: Icon(FeatherIcons.sun,
+                  size: 20.0, color: Theme.of(context).colorScheme.secondary),
+            ),
+            Text(SettingsLocalization("light").i18n),
+            const Spacer(),
+            if (settings.theme == ThemeMode.light)
+              Icon(
+                Icons.check_circle,
+                color: Theme.of(context).colorScheme.secondary,
+              ),
+          ],
+        ),
+      ),
+      BottomSheetMenuItem(
+        onPressed: () => setTheme(ThemeMode.dark),
+        title: Row(
+          children: [
+            Padding(
+              padding: const EdgeInsets.only(right: 16.0),
+              child: Icon(FeatherIcons.moon,
+                  size: 20.0, color: Theme.of(context).colorScheme.secondary),
+            ),
+            Text(SettingsLocalization("dark").i18n),
+            const Spacer(),
+            if (settings.theme == ThemeMode.dark)
+              Icon(
+                Icons.check_circle,
+                color: Theme.of(context).colorScheme.secondary,
+              ),
+          ],
+        ),
+      )
+    ]);
+  }
+
+  static void accentColor(BuildContext context) {
+    Navigator.of(context, rootNavigator: true).push(
+      PageRouteBuilder(
+        pageBuilder: (context, _, __) =>
+            const PremiumCustomAccentColorSetting(),
+        transitionDuration: Duration.zero,
+        reverseTransitionDuration: Duration.zero,
+      ),
+    );
+  }
+
+  static void gradeColors(BuildContext context) {
+    showRoundedModalBottomSheet(
+      context,
+      child: const GradeColorsSetting(),
+    );
+  }
+
+  static void liveActivityColor(BuildContext context) {
+    showRoundedModalBottomSheet(
+      context,
+      child: const LiveActivityColorSetting(),
+    );
+  }
+
+  static void vibrate(BuildContext context) {
+    showBottomSheetMenu(
+      context,
+      items: List.generate(VibrationStrength.values.length, (index) {
+        VibrationStrength value = VibrationStrength.values[index];
+
+        return BottomSheetMenuItem(
+          onPressed: () {
+            Provider.of<SettingsProvider>(context, listen: false)
+                .update(vibrate: value);
+            Navigator.of(context).maybePop();
+          },
+          title: Row(
+            children: [
+              Container(
+                width: 12.0,
+                height: 12.0,
+                decoration: BoxDecoration(
+                  color: Theme.of(context)
+                      .colorScheme
+                      .secondary
+                      .withOpacity((index + 1) / (vibrationTitle.length + 1)),
+                  shape: BoxShape.circle,
+                ),
+              ),
+              const SizedBox(width: 16.0),
+              Text(localizedVibrationTitles()[value] ?? "?"),
+              const Spacer(),
+              if (value ==
+                  Provider.of<SettingsProvider>(context, listen: false).vibrate)
+                Icon(
+                  Icons.check_circle,
+                  color: Theme.of(context).colorScheme.secondary,
+                ),
+            ],
+          ),
+        );
+      }),
+    );
+  }
+
+  static void bellDelay(BuildContext context) {
+    showRoundedModalBottomSheet(
+      context,
+      child: const BellDelaySetting(),
+    );
+  }
+
+  // v5 user changer
+  static void changeCurrentUser(BuildContext context, List<Widget> accountTiles,
+      int len, String addUsrLocTxt) {
+    showBottomSheetMenu(
+      context,
+      items: List.generate(len, (index) {
+        if (index == accountTiles.length) {
+          return const SizedBox(
+            height: 10.0,
+          );
+          // return Center(
+          //   child: Container(
+          //     margin: const EdgeInsets.only(top: 12.0, bottom: 4.0),
+          //     height: 3.0,
+          //     width: 175.0,
+          //     decoration: BoxDecoration(
+          //       borderRadius: BorderRadius.circular(12.0),
+          //       color: AppColors.of(context).text.withOpacity(.25),
+          //     ),
+          //   ),
+          // );
+        } else if (index == accountTiles.length + 1) {
+          return PanelButton(
+            onPressed: () {
+              if (!Provider.of<PremiumProvider>(context, listen: false)
+                  .hasScope(PremiumScopes.maxTwoAccounts)) {
+                PremiumLockedFeatureUpsell.show(
+                    context: context, feature: PremiumFeature.moreAccounts);
+                return;
+              }
+
+              Navigator.of(context).pushNamed("login_back").then((value) {
+                setSystemChrome(context);
+              });
+            },
+            title: Text(addUsrLocTxt),
+            leading: const Padding(
+              padding: EdgeInsets.only(left: 8.22, right: 6.9),
+              child: Icon(FeatherIcons.userPlus),
+            ),
+          );
+        } else {
+          return accountTiles[index];
+        }
+      }),
+    );
+  }
+
+  // v5 grade rarity texts
+  static void surpriseGradeRarityText(
+    BuildContext context, {
+    required String title,
+    required String cancel,
+    required String done,
+    required List<String> rarities,
+  }) {
+    showRoundedModalBottomSheet(
+      context,
+      child: GradeRarityTextSetting(
+        title: title,
+        cancel: cancel,
+        done: done,
+        defaultRarities: rarities,
+      ),
+    );
+  }
+}
+
+// Rounding modal
+class RoundingSetting extends StatefulWidget {
+  const RoundingSetting({super.key, this.rounding, this.subjectId});
+
+  final double? rounding;
+  final String? subjectId;
+
+  @override
+  _RoundingSettingState createState() => _RoundingSettingState();
+}
+
+class _RoundingSettingState extends State<RoundingSetting> {
+  late double rounding;
+
+  @override
+  void initState() {
+    super.initState();
+
+    rounding = (widget.rounding ??
+            Provider.of<SettingsProvider>(context, listen: false).rounding) /
+        10;
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    UserProvider userProvider =
+        Provider.of<UserProvider>(context, listen: false);
+    DatabaseProvider databaseProvider =
+        Provider.of<DatabaseProvider>(context, listen: false);
+
+    int roundingResult;
+
+    if (4.5 >= 4.5.floor() + rounding) {
+      roundingResult = 5;
+    } else {
+      roundingResult = 4;
+    }
+
+    return Column(children: [
+      Row(
+        mainAxisAlignment: MainAxisAlignment.spaceBetween,
+        children: [
+          Expanded(
+            child: Slider(
+              value: rounding,
+              min: 0.1,
+              max: 0.9,
+              divisions: 8,
+              label: rounding.toStringAsFixed(1),
+              activeColor: Theme.of(context).colorScheme.secondary,
+              thumbColor: Theme.of(context).colorScheme.secondary,
+              onChanged: (v) => setState(() => rounding = v),
+            ),
+          ),
+          Container(
+            width: 50.0,
+            padding: const EdgeInsets.only(right: 16.0),
+            child: Center(
+              child: Text(rounding.toStringAsFixed(1),
+                  style: const TextStyle(
+                    fontWeight: FontWeight.w600,
+                    fontSize: 18.0,
+                  )),
+            ),
+          ),
+        ],
+      ),
+      Row(
+        mainAxisAlignment: MainAxisAlignment.center,
+        children: [
+          const Text("4.5",
+              style: TextStyle(fontSize: 26.0, fontWeight: FontWeight.w500)),
+          const Padding(
+            padding: EdgeInsets.symmetric(horizontal: 24.0),
+            child: Icon(FeatherIcons.arrowRight, color: Colors.grey),
+          ),
+          GradeValueWidget(GradeValue(roundingResult, "", "", 100),
+              fill: true, size: 32.0),
+        ],
+      ),
+      Padding(
+        padding: const EdgeInsets.only(bottom: 12.0, top: 6.0),
+        child: MaterialActionButton(
+          child: Text(SettingsLocalization("done").i18n),
+          onPressed: () async {
+            if (widget.rounding == null) {
+              Provider.of<SettingsProvider>(context, listen: false)
+                  .update(rounding: (rounding * 10).toInt());
+            } else {
+              Map<String, String> roundings = await databaseProvider.userQuery
+                  .getRoundings(userId: userProvider.id!);
+
+              roundings[widget.subjectId!] = (rounding * 10).toStringAsFixed(2);
+
+              await databaseProvider.userStore
+                  .storeRoundings(roundings, userId: userProvider.id!);
+
+              await Provider.of<GradeProvider>(context, listen: false)
+                  .convertBySettings();
+              await Provider.of<TimetableProvider>(context, listen: false)
+                  .convertBySettings();
+              await Provider.of<AbsenceProvider>(context, listen: false)
+                  .convertBySettings();
+            }
+
+            // ik i'm like a kreta dev, but setstate isn't working, so please don't kill me bye :3
+            // actually it also looks good and it's kinda useful
+            Navigator.of(context).pop();
+            Navigator.of(context).pop();
+            // setState(() {});
+          },
+        ),
+      ),
+    ]);
+  }
+}
+
+// Bell Delay Modal
+
+class BellDelaySetting extends StatefulWidget {
+  const BellDelaySetting({super.key});
+
+  @override
+  State<BellDelaySetting> createState() => _BellDelaySettingState();
+}
+
+class _BellDelaySettingState extends State<BellDelaySetting>
+    with SingleTickerProviderStateMixin {
+  late TabController _tabController;
+  late Duration currentDelay;
+
+  @override
+  void initState() {
+    super.initState();
+    _tabController = TabController(
+        length: 2,
+        vsync: this,
+        initialIndex:
+            Provider.of<SettingsProvider>(context, listen: false).bellDelay > 0
+                ? 1
+                : 0);
+    currentDelay = Duration(
+        seconds:
+            Provider.of<SettingsProvider>(context, listen: false).bellDelay);
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(
+      children: [
+        FilterBar(
+          scrollable: true,
+          tabAlignment: TabAlignment.center,
+          items: [
+            Tab(text: SettingsLocalization("delay").i18n),
+            Tab(text: SettingsLocalization("hurry").i18n),
+          ],
+          controller: _tabController,
+          onTap: (i) async {
+            // swap current page with target page
+            setState(() {
+              currentDelay = i == 0 ? -currentDelay.abs() : currentDelay.abs();
+            });
+          },
+        ),
+        SizedBox(
+          height: 200,
+          child: CupertinoTheme(
+            data: CupertinoThemeData(
+              brightness: Theme.of(context).brightness,
+            ),
+            child: CupertinoTimerPicker(
+              key: UniqueKey(),
+              mode: CupertinoTimerPickerMode.ms,
+              initialTimerDuration: currentDelay.abs(),
+              onTimerDurationChanged: (Duration d) {
+                HapticFeedback.selectionClick();
+
+                currentDelay = _tabController.index == 0 ? -d : d;
+              },
+            ),
+          ),
+        ),
+        Text(SettingsLocalization("sync_help").i18n,
+            textAlign: TextAlign.center,
+            style: TextStyle(
+                fontSize: 12.0,
+                fontWeight: FontWeight.w500,
+                color: AppColors.of(context).text.withOpacity(.75))),
+        Padding(
+          padding: const EdgeInsets.only(bottom: 12.0, top: 6.0),
+          child: Column(
+            children: [
+              MaterialActionButton(
+                backgroundColor: Theme.of(context).colorScheme.primary,
+                child: Text(SettingsLocalization("sync").i18n),
+                onPressed: () {
+                  final lessonProvider =
+                      Provider.of<TimetableProvider>(context, listen: false);
+
+                  Duration? closest;
+                  DateTime now = DateTime.now();
+                  for (var lesson
+                      in lessonProvider.getWeek(Week.current()) ?? []) {
+                    Duration sdiff = lesson.start.difference(now);
+                    Duration ediff = lesson.end.difference(now);
+
+                    if (closest == null || sdiff.abs() < closest.abs()) {
+                      closest = sdiff;
+                    }
+                    if (ediff.abs() < closest.abs()) closest = ediff;
+                  }
+                  if (closest != null) {
+                    if (closest.inHours.abs() >= 1) return;
+                    currentDelay = closest;
+                    Provider.of<SettingsProvider>(context, listen: false)
+                        .update(bellDelay: currentDelay.inSeconds);
+                    _tabController.index = currentDelay.inSeconds > 0 ? 1 : 0;
+                    setState(() {});
+                  }
+                },
+              ),
+              MaterialActionButton(
+                child: Text(SettingsLocalization("done").i18n),
+                onPressed: () {
+                  //Provider.of<SettingsProvider>(context, listen: false).update(context, rounding: (r * 10).toInt());
+                  Provider.of<SettingsProvider>(context, listen: false)
+                      .update(bellDelay: currentDelay.inSeconds);
+                  Navigator.of(context).maybePop();
+                },
+              ),
+            ],
+          ),
+        ),
+      ],
+    );
+  }
+}
+
+class GradeColorsSetting extends StatefulWidget {
+  const GradeColorsSetting({super.key});
+
+  @override
+  _GradeColorsSettingState createState() => _GradeColorsSettingState();
+}
+
+class _GradeColorsSettingState extends State<GradeColorsSetting> {
+  Color currentColor = const Color(0x00000000);
+  late SettingsProvider settings;
+
+  @override
+  void initState() {
+    super.initState();
+    settings = Provider.of<SettingsProvider>(context, listen: false);
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(children: [
+      Padding(
+        padding: const EdgeInsets.all(8.0),
+        child: Row(
+          mainAxisAlignment: MainAxisAlignment.spaceEvenly,
+          children: List.generate(5, (index) {
+            return ClipOval(
+              child: Material(
+                type: MaterialType.transparency,
+                child: InkWell(
+                  onTap: () {
+                    currentColor = settings.gradeColors[index];
+                    showRoundedModalBottomSheet(
+                      context,
+                      child: Column(children: [
+                        MaterialColorPicker(
+                          selectedColor: settings.gradeColors[index],
+                          onColorChange: (v) {
+                            setState(() {
+                              currentColor = v;
+                            });
+                          },
+                          allowShades: true,
+                          elevation: 0,
+                          physics: const NeverScrollableScrollPhysics(),
+                        ),
+                        Padding(
+                          padding: const EdgeInsets.only(bottom: 8.0),
+                          child: Row(
+                            mainAxisAlignment: MainAxisAlignment.spaceEvenly,
+                            children: [
+                              MaterialActionButton(
+                                onPressed: () {
+                                  List<Color> colors =
+                                      List.castFrom(settings.gradeColors);
+                                  var defaultColors =
+                                      SettingsProvider.defaultSettings()
+                                          .gradeColors;
+                                  colors[index] = defaultColors[index];
+                                  settings.update(gradeColors: colors);
+                                  Navigator.of(context).maybePop();
+                                },
+                                child: Text(SettingsLocalization("reset").i18n),
+                              ),
+                              MaterialActionButton(
+                                onPressed: () {
+                                  List<Color> colors =
+                                      List.castFrom(settings.gradeColors);
+                                  colors[index] = currentColor.withAlpha(255);
+                                  settings.update(
+                                      gradeColors: settings.gradeColors);
+                                  Navigator.of(context).maybePop();
+                                },
+                                child: Text(SettingsLocalization("done").i18n),
+                              ),
+                            ],
+                          ),
+                        ),
+                      ]),
+                    ).then((value) => setState(() {}));
+                  },
+                  child: GradeValueWidget(GradeValue(index + 1, "", "", 0),
+                      fill: true, size: 36.0),
+                ),
+              ),
+            );
+          }),
+        ),
+      ),
+    ]);
+  }
+}
+
+class GradeRarityTextSetting extends StatefulWidget {
+  const GradeRarityTextSetting({
+    super.key,
+    required this.title,
+    required this.cancel,
+    required this.done,
+    required this.defaultRarities,
+  });
+
+  final String title;
+  final String cancel;
+  final String done;
+  final List<String> defaultRarities;
+
+  @override
+  _GradeRarityTextSettingState createState() => _GradeRarityTextSettingState();
+}
+
+class _GradeRarityTextSettingState extends State<GradeRarityTextSetting> {
+  late SettingsProvider settings;
+  late DatabaseProvider db;
+  late UserProvider user;
+
+  final _rarityText = TextEditingController();
+
+  @override
+  void initState() {
+    super.initState();
+    settings = Provider.of<SettingsProvider>(context, listen: false);
+    db = Provider.of<DatabaseProvider>(context, listen: false);
+    user = Provider.of<UserProvider>(context, listen: false);
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(children: [
+      Padding(
+        padding: const EdgeInsets.all(8.0),
+        child: Row(
+          mainAxisAlignment: MainAxisAlignment.spaceEvenly,
+          children: List.generate(5, (index) {
+            return ClipOval(
+              child: Material(
+                type: MaterialType.transparency,
+                child: InkWell(
+                  onTap: () async {
+                    showRenameDialog(
+                      title: widget.title,
+                      cancel: widget.cancel,
+                      done: widget.done,
+                      rarities:
+                          await db.userQuery.getGradeRarities(userId: user.id!),
+                      gradeIndex: (index + 1).toString(),
+                      defaultRarities: widget.defaultRarities,
+                    );
+                  },
+                  child: GradeValueWidget(GradeValue(index + 1, "", "", 0),
+                      fill: true, size: 36.0),
+                ),
+              ),
+            );
+          }),
+        ),
+      ),
+    ]);
+  }
+
+  void showRenameDialog(
+      {required String title,
+      required String cancel,
+      required String done,
+      required Map<String, String> rarities,
+      required String gradeIndex,
+      required List<String> defaultRarities,
+      required}) {
+    showDialog(
+      context: context,
+      builder: (context) => StatefulBuilder(builder: (context, setS) {
+        String? rr = rarities[gradeIndex];
+        rr ??= '';
+
+        _rarityText.text = rr;
+
+        return AlertDialog(
+          title: Text(title),
+          content: TextField(
+            controller: _rarityText,
+            autofocus: true,
+            decoration: InputDecoration(
+              border: const OutlineInputBorder(),
+              label: Text(defaultRarities[int.parse(gradeIndex) - 1]),
+              suffixIcon: IconButton(
+                icon: const Icon(FeatherIcons.x),
+                onPressed: () {
+                  setState(() {
+                    _rarityText.clear();
+                  });
+                },
+              ),
+            ),
+          ),
+          actions: [
+            TextButton(
+              child: Text(
+                cancel,
+                style: const TextStyle(fontWeight: FontWeight.w500),
+              ),
+              onPressed: () {
+                Navigator.of(context).maybePop();
+              },
+            ),
+            TextButton(
+              child: Text(
+                done,
+                style: const TextStyle(fontWeight: FontWeight.w500),
+              ),
+              onPressed: () {
+                rarities[gradeIndex] = _rarityText.text;
+
+                Provider.of<DatabaseProvider>(context, listen: false)
+                    .userStore
+                    .storeGradeRarities(rarities, userId: user.id!);
+
+                Navigator.of(context).pop(true);
+              },
+            ),
+          ],
+        );
+      }),
+    ).then((val) {
+      _rarityText.clear();
+    });
+  }
+}
+
+class LiveActivityColorSetting extends StatefulWidget {
+  const LiveActivityColorSetting({super.key});
+
+  @override
+  _LiveActivityColorSettingState createState() =>
+      _LiveActivityColorSettingState();
+}
+
+class _LiveActivityColorSettingState extends State<LiveActivityColorSetting> {
+  late SettingsProvider settings;
+  Color currentColor = const Color(0x00000000);
+
+  @override
+  void initState() {
+    super.initState();
+    settings = Provider.of<SettingsProvider>(context, listen: false);
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(children: [
+      Padding(
+        padding: const EdgeInsets.all(8.0),
+        child: Material(
+          type: MaterialType.transparency,
+          child: Column(children: [
+            MaterialColorPicker(
+              allowShades: false,
+              selectedColor: settings.liveActivityColor,
+              onMainColorChange: (k) {
+                setState(() {
+                  currentColor = k as Color;
+                  settings.update(
+                      liveActivityColor: currentColor.withAlpha(255));
+                  Navigator.of(context).maybePop();
+                });
+              },
+              elevation: 0,
+              physics: const NeverScrollableScrollPhysics(),
+            ),
+            Padding(
+              padding: const EdgeInsets.only(bottom: 8.0, top: 40.0),
+              child: Row(
+                mainAxisAlignment: MainAxisAlignment.spaceEvenly,
+                children: [
+                  MaterialActionButton(
+                    onPressed: () {
+                      var defaultColors =
+                          SettingsProvider.defaultSettings().liveActivityColor;
+                      settings.update(liveActivityColor: defaultColors);
+                      Navigator.of(context).maybePop();
+                    },
+                    child: Text(SettingsLocalization("reset").i18n),
+                  ),
+                ],
+              ),
+            ),
+          ]),
+        ),
+      ),
+    ]);
+  }
+}

refilc_mobile_ui/lib/screens/settings/settings_route.dart

@@ -0,0 +1,21 @@
+import 'package:flutter/material.dart';
+
+Route settingsRoute(Widget widget) {
+  return PageRouteBuilder(
+    pageBuilder: (context, animation, secondaryAnimation) => widget,
+    transitionDuration: const Duration(milliseconds: 500),
+    transitionsBuilder: (context, animation, secondaryAnimation, child) {
+      var curve = Curves.ease;
+      var curveTween = CurveTween(curve: curve);
+      var begin = const Offset(0.0, 1.0);
+      var end = Offset.zero;
+      var tween = Tween(begin: begin, end: end).chain(curveTween);
+      var offsetAnimation = animation.drive(tween);
+
+      return SlideTransition(
+        position: offsetAnimation,
+        child: child,
+      );
+    },
+  );
+}

refilc_mobile_ui/lib/screens/settings/settings_screen.i18n.dart

@@ -0,0 +1,303 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension SettingsLocalization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          "personal_details": "Personal Details",
+          "open_dkt": "Open DCS",
+          "edit_nickname": "Edit Nickname",
+          "edit_profile_picture": "Edit Profile Picture",
+          "remove_profile_picture": "Remove Profile Picture",
+          "select_profile_picture": "to select a picture",
+          "click_here": "Click here",
+          "light": "Light",
+          "dark": "Dark",
+          "system": "System",
+          "add_user": "Add User",
+          "log_out": "Log Out",
+          "update_available": "Update Available",
+          "general": "General",
+          "language": "Language",
+          "startpage": "Startpage",
+          "rounding": "Rounding",
+          "appearance": "Appearance",
+          "theme": "Theme",
+          "color": "Color",
+          "grade_colors": "Grade Colors",
+          "live_activity_color": "Live Activity Color",
+          "notifications": "Notifications",
+          "popups": "Pop-up Alerts",
+          "news": "News",
+          "extras": "Extras",
+          "about": "About",
+          "supporters": "Supporters",
+          "privacy": "Privacy Policy",
+          "licenses": "Licenses",
+          "vibrate": "Vibration",
+          "voff": "Off",
+          "vlight": "Light",
+          "vmedium": "Medium",
+          "vstrong": "Strong",
+          "cancel": "Cancel",
+          "done": "Done",
+          "reset": "Reset",
+          "open": "Open",
+          "data_collected":
+              "Data collected: Platform (eg. iOS), App version (eg. 5.0.0), Unique Install Identifier",
+          "Analytics": "Analytics",
+          "Anonymous Usage Analytics": "Anonymous Usage Analytics",
+          "graph_class_avg": "Class average on graph",
+          "goodstudent": "Good student mode",
+          "attention": "Attention!",
+          "goodstudent_disclaimer":
+              "reFilc can not be held liable for the usage of this feature.\n\n(if your mother beats you up because you showed her fake grades, you can only blame yourself for it)",
+          "understand": "I understand",
+          "secret": "Secret Settings",
+          "bell_delay": "Bell Delay",
+          "delay": "Delay",
+          "hurry": "Hurry",
+          "sync": "Synchronize",
+          "sync_help": "Press the Synchronize button when the bell rings.",
+          "surprise_grades": "Surprise Grades",
+          "icon_pack": "Icon Pack",
+          "change_username": "Set a nickname",
+          "Accent Color": "Accent Color",
+          "Background Color": "Background Color",
+          "Highlight Color": "Highlight Color",
+          "Adaptive Theme": "Adaptive Theme",
+          "presentation": "Presentation mode",
+          "uwufymode": "UwU-fied mode (hungarian)",
+          "devmoretaps": "You are %s taps away from Developer Mode.",
+          "devactivated": "Developer Mode successfully activated.",
+          "devsettings": "Developer Settings",
+          "devmode": "Developer Mode",
+          "copy_jwt": "Copy JWT",
+          "welcome_msg": "Welcome Message",
+          "default": "Dynamic",
+          "edit_welcome_msg": "Edit welcome message",
+          "shadow_effect": "Shadow Effect",
+          "app_icon": "App Icon",
+          "settings": "Settings",
+          "personalization": "Personalization",
+          "edit": "Edit",
+          "switch_account": "Switch Account",
+          "subjects": "Subjects",
+          "select_subject": "Select Subject",
+          "own_paints": "Own Paints",
+          "dl_paint": "Redeemed",
+          "public_paint": "Public Paints",
+          "no_pub_paint": "No Public Paints",
+          "enter_id": "Enter Paint ID",
+          "paint_id": "Paint ID...",
+          "set_as_current": "Set as current",
+          "share_subj_theme": "Share Theme",
+          "no_name": "Untitled Paint",
+          "current_paint": "Current Paint",
+          "rename_subjects": "Rename Subjects",
+          "rename_teachers": "Rename Teachers",
+          "show_breaks": "Show Breaks",
+          "fonts": "Fonts",
+          "font_family": "Font Family",
+        },
+        "hu_hu": {
+          "personal_details": "Személyes információk",
+          "open_dkt": "DKT megnyitása",
+          "edit_nickname": "Becenév szerkesztése",
+          "edit_profile_picture": "Profil-kép szerkesztése",
+          "remove_profile_picture": "Profil-kép törlése",
+          "select_profile_picture": "a kép kiválasztásához",
+          "click_here": "Kattints ide",
+          "light": "Világos",
+          "dark": "Sötét",
+          "system": "Rendszer",
+          "add_user": "Felhasználó hozzáadása",
+          "log_out": "Kijelentkezés",
+          "update_available": "Frissítés elérhető",
+          "general": "Általános",
+          "language": "Nyelv",
+          "startpage": "Kezdőlap",
+          "rounding": "Kerekítés",
+          "appearance": "Kinézet",
+          "theme": "Téma",
+          "color": "Színek",
+          "grade_colors": "Jegyek színei",
+          "live_activity_color": "Live Activity színe",
+          "notifications": "Értesítések",
+          "popups": "Pop-up értesítések",
+          "news": "Hírek",
+          "extras": "Extrák",
+          "about": "Névjegy",
+          "supporters": "Támogatók",
+          "privacy": "Adatvédelmi irányelvek",
+          "licenses": "Licencek",
+          "vibrate": "Rezgés",
+          "voff": "Kikapcsolás",
+          "vlight": "Alacsony",
+          "vmedium": "Közepes",
+          "vstrong": "Erős",
+          "cancel": "Mégsem",
+          "done": "Kész",
+          "reset": "Visszaállítás",
+          "open": "Megnyitás",
+          "data_collected":
+              "Gyűjtött adat: platform (pl.: iOS), app verzió (pl.: 5.0.0), egyedi telepítési azonosító",
+          "Analytics": "Analitika",
+          "Anonymous Usage Analytics": "Névtelen használati analitika",
+          "graph_class_avg": "Osztályátlag a grafikonon",
+          "goodstudent": "Jó tanuló mód",
+          "attention": "Figyelem!",
+          "goodstudent_disclaimer":
+              "A reFilc minden felelősséget elhárít a funkció használatával kapcsolatban.\n\n(Értsd: ha az anyád megver, mert megtévesztő ábrákat mutattál neki, azért csakis magadat hibáztathatod.)",
+          "understand": "Értem",
+          "secret": "Titkos Beállítások",
+          "bell_delay": "Csengő eltolódása",
+          "delay": "Késleltetés",
+          "hurry": "Siettetés",
+          "sync": "Szinkronizálás",
+          "sync_help": "Csengetéskor nyomd meg a Szinkronizálás gombot.",
+          "surprise_grades": "Meglepetés jegyek",
+          "icon_pack": "Ikon séma",
+          "change_username": "Becenév beállítása",
+          "Accent Color": "Egyedi szín",
+          "Background Color": "Háttér színe",
+          "Highlight Color": "Panelek színe",
+          "Adaptive Theme": "Adaptív téma",
+          "presentation": "Bemutató mód",
+          "uwufymode": "UwU mód (magyar)",
+          "devmoretaps": "Még %s koppintásra vagy a Fejlesztői módtól.",
+          "devactivated": "Fejlesztői mód sikeresen aktiválva.",
+          "devsettings": "Fejlesztői Beállítások",
+          "devmode": "Fejlesztői mód",
+          "copy_jwt": "JWT másolása",
+          "welcome_msg": "Üdvözlő üzenet",
+          "default": "Dinamikus",
+          "edit_welcome_msg": "Üdvözlő üzenet szerkesztése",
+          "shadow_effect": "Árnyékhatás",
+          "app_icon": "Alkalmazásikon",
+          "settings": "Beállítások",
+          "personalization": "Személyre szabás",
+          "edit": "Szerkesztés",
+          "switch_account": "Fiókváltás",
+          "subjects": "Tantárgyak",
+          "select_subject": "Válassz tantárgyat",
+          "own_paints": "Saját témák",
+          "dl_paint": "Beszerzett",
+          "public_paint": "Nyilvános témák",
+          "no_pub_paint": "Nincsenek nyilvános festékek",
+          "enter_id": "Azonosító megadása",
+          "paint_id": "Téma azonosító...",
+          "set_as_current": "Beállítás jelenleginek",
+          "share_subj_theme": "Téma Megosztás",
+          "no_name": "Névtelen téma",
+          "current_paint": "Jelenlegi téma",
+          "rename_subjects": "Tantárgyak átnevezése",
+          "rename_teachers": "Tanárok átnevezése",
+          "show_breaks": "Szünetek megjelenítése",
+          "fonts": "Betűk",
+          "font_family": "Betűtípus",
+        },
+        "de_de": {
+          "personal_details": "Persönliche Angaben",
+          "open_dkt": "Öffnen RDZ",
+          "edit_nickname": "Spitznamen bearbeiten",
+          "edit_profile_picture": "Profilbild bearbeiten",
+          "remove_profile_picture": "Profilbild entfernen",
+          "select_profile_picture": "um ein Bild auszuwählen",
+          "click_here": "Klick hier",
+          "light": "Licht",
+          "dark": "Dunkel",
+          "system": "System",
+          "add_user": "Benutzer hinzufügen",
+          "log_out": "Abmelden",
+          "update_available": "Update verfügbar",
+          "general": "Allgemein",
+          "language": "Sprache",
+          "startpage": "Startseite",
+          "rounding": "Rundung",
+          "appearance": "Erscheinungsbild",
+          "theme": "Thema",
+          "color": "Farbe",
+          "grade_colors": "Grad Farben",
+          "live_activity_color": "Live Activity Farben",
+          "notifications": "Mitteilung",
+          "popups": "Popup-Nachrichten",
+          "news": "Nachrichten",
+          "extras": "Extras",
+          "about": "Informationen",
+          "supporters": "Unterstützer",
+          "privacy": "Datenschutzbestimmungen",
+          "licenses": "Lizenzen",
+          "vibrate": "Vibration",
+          "voff": "Aus",
+          "vlight": "Leicht",
+          "vmedium": "Mittel",
+          "vstrong": "Stark",
+          "cancel": "Abbrechen",
+          "done": "Fertig",
+          "reset": "Zurücksetzen",
+          "open": "Öffnen",
+          "data_collected":
+              "Erhobene Daten: Plattform (z.B. iOS), App version (z.B. 5.0.0), Eindeutige Installationskennung",
+          "Analytics": "Analytik",
+          "Anonymous Usage Analytics": "Anonyme Nutzungsanalyse",
+          "graph_class_avg": "Klassendurchschnitt in der Grafik",
+          "goodstudent": "Guter Student Modus",
+          "attention": "Achtung!",
+          "goodstudent_disclaimer":
+              "reFilc kann nicht für die Nutzung dieser Funktion haftbar gemacht werden.\n\n(Wenn deine Mutter dich verprügelt, weil du ihr falsche Noten gezeigt hast, kannst du dir nur die Schuld dafür geben)",
+          "understand": "Ich verstehe",
+          "secret": "Geheime Einstellungen",
+          "bell_delay": "Klingelverzögerung",
+          "delay": "Verzögern",
+          "hurry": "Eile",
+          "sync": "Synchronisieren",
+          "sync_help": "Drücken Sie die Sync-Taste, wenn die Glocke läutet.",
+          "surprise_grades": "Überraschungsnoten",
+          "icon_pack": "Icon-Pack",
+          "change_username": "Einen Spitznamen festlegen",
+          "Accent Color": "Accent Color",
+          "Background Color": "Background Color",
+          "Highlight Color": "Highlight Color",
+          "Adaptive Theme": "Adaptive Theme",
+          "presentation": "Präsentationsmodus",
+          "uwufymode": "UwU-Modus (ungarisch)",
+          "devmoretaps": "Sie sind %s Taps vom Entwicklermodus entfernt.",
+          "devactivated": "Entwicklermodus erfolgreich aktiviert.",
+          "devsettings": "Entwickleroptionen",
+          "devmode": "Entwicklermodus",
+          "copy_jwt": "JWT kopieren",
+          "welcome_msg": "Willkommensnachricht",
+          "default": "Dynamisch",
+          "edit_welcome_msg": "Begrüßungsnachricht bearbeiten",
+          "shadow_effect": "Schatteneffekt",
+          "app_icon": "App-Symbol",
+          "settings": "Einstellungen",
+          "personalization": "Personalisierung",
+          "edit": "Bearbeiten",
+          "switch_account": "Benutzer wechseln",
+          "subjects": "Themen",
+          "select_subject": "Fach auswählen",
+          "own_paints": "Meine Themen",
+          "dl_paint": "Eingelöst",
+          "public_paint": "Öffentliche Themen",
+          "no_pub_paint": "Keine öffentlichen Anstriche",
+          "enter_id": "Themen-ID eingeben",
+          "paint_id": "Themen-ID...",
+          "set_as_current": "Als aktuell einstellen",
+          "share_subj_theme": "Thema Teilen",
+          "no_name": "Anonymes Thema",
+          "current_paint": "Aktuelles Thema",
+          "rename_subjects": "Fächer umbenennen",
+          "rename_teachers": "Lehrer umbenennen",
+          "show_breaks": "Pausen anzeigen",
+          "fonts": "Schriftarten",
+          "font_family": "Schriftfamilie",
+        },
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}

refilc_mobile_ui/lib/screens/settings/submenu/edit_subject.dart

@@ -0,0 +1,398 @@
+// ignore_for_file: use_build_context_synchronously
+
+import 'package:refilc/api/providers/database_provider.dart';
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc/models/settings.dart';
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:refilc/utils/format.dart';
+import 'package:refilc_kreta_api/models/subject.dart';
+import 'package:refilc_kreta_api/models/teacher.dart';
+import 'package:refilc_kreta_api/providers/absence_provider.dart';
+import 'package:refilc_kreta_api/providers/grade_provider.dart';
+import 'package:refilc_kreta_api/providers/timetable_provider.dart';
+import 'package:refilc_mobile_ui/common/panel/panel_button.dart';
+import 'package:refilc_mobile_ui/common/splitted_panel/splitted_panel.dart';
+// import 'package:refilc_mobile_ui/screens/settings/settings_helper.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+
+import 'edit_subject.i18n.dart';
+
+class EditSubjectScreen extends StatefulWidget {
+  const EditSubjectScreen({
+    super.key,
+    required this.subject,
+    required this.teacher,
+  });
+
+  final GradeSubject subject;
+  final Teacher teacher;
+
+  @override
+  EditSubjectScreenState createState() => EditSubjectScreenState();
+}
+
+class EditSubjectScreenState extends State<EditSubjectScreen> {
+  late SettingsProvider settingsProvider;
+  late DatabaseProvider databaseProvider;
+  late UserProvider user;
+
+  final _subjectName = TextEditingController();
+  final _teacherName = TextEditingController();
+
+  @override
+  Widget build(BuildContext context) {
+    settingsProvider = Provider.of<SettingsProvider>(context);
+    databaseProvider = Provider.of<DatabaseProvider>(context);
+    user = Provider.of<UserProvider>(context);
+
+    return Scaffold(
+      appBar: AppBar(
+        surfaceTintColor: Theme.of(context).scaffoldBackgroundColor,
+        leading: BackButton(color: AppColors.of(context).text),
+        title: Text(
+          (widget.subject.isRenamed && settingsProvider.renamedSubjectsEnabled
+                  ? widget.subject.renamedTo
+                  : widget.subject.name.capital()) ??
+              '',
+          style: TextStyle(
+            color: AppColors.of(context).text,
+            fontStyle: settingsProvider.renamedSubjectsItalics
+                ? FontStyle.italic
+                : FontStyle.normal,
+          ),
+        ),
+        actions: [
+          IconButton(
+            onPressed: () async {
+              Map<String, String> subs = await databaseProvider.userQuery
+                  .renamedSubjects(userId: user.id!);
+              subs.remove(widget.subject.id);
+              await databaseProvider.userStore
+                  .storeRenamedSubjects(subs, userId: user.id!);
+
+              Map<String, String> teach = await databaseProvider.userQuery
+                  .renamedTeachers(userId: user.id!);
+              teach.remove(widget.teacher.id);
+              await databaseProvider.userStore
+                  .storeRenamedTeachers(teach, userId: user.id!);
+
+              updateProviders();
+
+              // im crying rn
+              Navigator.of(context).pop();
+              Navigator.of(context).pop();
+              setState(() {});
+            },
+            icon: const Icon(FeatherIcons.trash2),
+          ),
+          const SizedBox(
+            width: 8.0,
+          ),
+        ],
+      ),
+      body: SingleChildScrollView(
+        child: Padding(
+          padding: const EdgeInsets.symmetric(vertical: 16.0, horizontal: 24.0),
+          child: Column(
+            children: [
+              // rename subject
+              SplittedPanel(
+                padding: const EdgeInsets.only(top: 8.0),
+                cardPadding: const EdgeInsets.all(4.0),
+                isSeparated: true,
+                children: [
+                  PanelButton(
+                    onPressed: () {
+                      showSubjectRenameDialog();
+                    },
+                    title: Text("rename_it".i18n),
+                    leading: Icon(
+                      FeatherIcons.penTool,
+                      size: 22.0,
+                      color: AppColors.of(context).text.withOpacity(0.95),
+                    ),
+                    borderRadius: const BorderRadius.vertical(
+                      top: Radius.circular(12.0),
+                      bottom: Radius.circular(12.0),
+                    ),
+                  ),
+                ],
+              ),
+              // rename teacher
+              SplittedPanel(
+                padding: const EdgeInsets.only(top: 9.0),
+                cardPadding: const EdgeInsets.all(4.0),
+                isSeparated: true,
+                children: [
+                  PanelButton(
+                    onPressed: () {
+                      showTeacherRenameDialog();
+                    },
+                    title: Text("rename_te".i18n),
+                    leading: Icon(
+                      FeatherIcons.user,
+                      size: 22.0,
+                      color: AppColors.of(context).text.withOpacity(0.95),
+                    ),
+                    borderRadius: const BorderRadius.vertical(
+                      top: Radius.circular(12.0),
+                      bottom: Radius.circular(12.0),
+                    ),
+                  ),
+                ],
+              ),
+              // edit rounding
+              // SplittedPanel(
+              //   padding: const EdgeInsets.only(top: 9.0),
+              //   cardPadding: const EdgeInsets.all(4.0),
+              //   isSeparated: true,
+              //   children: [
+              //     PanelButton(
+              //       onPressed: () {
+              //         SettingsHelper.newRoundings(context, widget.subject);
+              //         setState(() {});
+              //       },
+              //       title: Text(
+              //         "rounding".i18n,
+              //         style: TextStyle(
+              //           color: AppColors.of(context).text.withOpacity(.95),
+              //         ),
+              //       ),
+              //       leading: Icon(
+              //         FeatherIcons.gitCommit,
+              //         size: 22.0,
+              //         color: AppColors.of(context).text.withOpacity(.95),
+              //       ),
+              //       trailing: Text(
+              //         ((widget.subject.customRounding ??
+              //                     settingsProvider.rounding) /
+              //                 10)
+              //             .toStringAsFixed(1),
+              //         style: const TextStyle(fontSize: 14.0),
+              //       ),
+              //       borderRadius: const BorderRadius.vertical(
+              //         top: Radius.circular(12.0),
+              //         bottom: Radius.circular(12.0),
+              //       ),
+              //     ),
+              //   ],
+              // ),
+            ],
+          ),
+        ),
+      ),
+    );
+  }
+
+  // rename dialogs
+  void showSubjectRenameDialog() {
+    _subjectName.text = widget.subject.renamedTo ?? '';
+
+    showDialog(
+      context: context,
+      builder: (context) => StatefulBuilder(builder: (context, setS) {
+        return AlertDialog(
+          shape: const RoundedRectangleBorder(
+              borderRadius: BorderRadius.all(Radius.circular(14.0))),
+          title: Text("rename_it".i18n),
+          content: Column(
+            mainAxisSize: MainAxisSize.min,
+            children: [
+              Container(
+                decoration: BoxDecoration(
+                    color: Theme.of(context).colorScheme.background,
+                    borderRadius:
+                        const BorderRadius.all(Radius.circular(12.0))),
+                padding: const EdgeInsets.symmetric(vertical: 10.0),
+                child: Center(
+                  child: Text(
+                    widget.subject.name,
+                    style: const TextStyle(
+                        fontWeight: FontWeight.w500, fontSize: 16.0),
+                  ),
+                ),
+              ),
+              const Padding(
+                padding: EdgeInsets.symmetric(vertical: 8.0),
+                child: Icon(FeatherIcons.arrowDown, size: 32),
+              ),
+              TextField(
+                controller: _subjectName,
+                decoration: InputDecoration(
+                  border: OutlineInputBorder(
+                    borderSide:
+                        const BorderSide(color: Colors.grey, width: 1.5),
+                    borderRadius: BorderRadius.circular(12.0),
+                  ),
+                  focusedBorder: OutlineInputBorder(
+                    borderSide:
+                        const BorderSide(color: Colors.grey, width: 1.5),
+                    borderRadius: BorderRadius.circular(12.0),
+                  ),
+                  contentPadding: const EdgeInsets.symmetric(horizontal: 12.0),
+                  hintText: "modified_name".i18n,
+                  suffixIcon: IconButton(
+                    icon: const Icon(
+                      FeatherIcons.x,
+                      color: Colors.grey,
+                    ),
+                    onPressed: () {
+                      setState(() {
+                        _subjectName.text = "";
+                      });
+                    },
+                  ),
+                ),
+              ),
+            ],
+          ),
+          actions: [
+            TextButton(
+              child: Text(
+                "cancel".i18n,
+                style: const TextStyle(fontWeight: FontWeight.w500),
+              ),
+              onPressed: () {
+                Navigator.of(context).maybePop();
+              },
+            ),
+            TextButton(
+              child: Text(
+                "done".i18n,
+                style: const TextStyle(fontWeight: FontWeight.w500),
+              ),
+              onPressed: () async {
+                Map<String, String> renamedSubjs = await databaseProvider
+                    .userQuery
+                    .renamedSubjects(userId: user.id!);
+
+                renamedSubjs[widget.subject.id] = _subjectName.text;
+
+                await databaseProvider.userStore
+                    .storeRenamedSubjects(renamedSubjs, userId: user.id!);
+
+                updateProviders();
+
+                Navigator.of(context).pop();
+                setState(() {});
+              },
+            ),
+          ],
+        );
+      }),
+    ).then((val) {
+      _subjectName.text = "";
+    });
+  }
+
+  void showTeacherRenameDialog() {
+    _teacherName.text = widget.teacher.renamedTo ?? '';
+
+    showDialog(
+      context: context,
+      builder: (context) => StatefulBuilder(builder: (context, setS) {
+        return AlertDialog(
+          shape: const RoundedRectangleBorder(
+              borderRadius: BorderRadius.all(Radius.circular(14.0))),
+          title: Text("rename_te".i18n),
+          content: Column(
+            mainAxisSize: MainAxisSize.min,
+            children: [
+              Container(
+                decoration: BoxDecoration(
+                    color: Theme.of(context).colorScheme.background,
+                    borderRadius:
+                        const BorderRadius.all(Radius.circular(12.0))),
+                padding: const EdgeInsets.symmetric(vertical: 10.0),
+                child: Center(
+                  child: Text(
+                    widget.teacher.name,
+                    style: const TextStyle(
+                        fontWeight: FontWeight.w500, fontSize: 16.0),
+                  ),
+                ),
+              ),
+              const Padding(
+                padding: EdgeInsets.symmetric(vertical: 8.0),
+                child: Icon(FeatherIcons.arrowDown, size: 32),
+              ),
+              TextField(
+                controller: _teacherName,
+                decoration: InputDecoration(
+                  border: OutlineInputBorder(
+                    borderSide:
+                        const BorderSide(color: Colors.grey, width: 1.5),
+                    borderRadius: BorderRadius.circular(12.0),
+                  ),
+                  focusedBorder: OutlineInputBorder(
+                    borderSide:
+                        const BorderSide(color: Colors.grey, width: 1.5),
+                    borderRadius: BorderRadius.circular(12.0),
+                  ),
+                  contentPadding: const EdgeInsets.symmetric(horizontal: 12.0),
+                  hintText: "modified_name".i18n,
+                  suffixIcon: IconButton(
+                    icon: const Icon(
+                      FeatherIcons.x,
+                      color: Colors.grey,
+                    ),
+                    onPressed: () {
+                      setState(() {
+                        _teacherName.text = "";
+                      });
+                    },
+                  ),
+                ),
+              ),
+            ],
+          ),
+          actions: [
+            TextButton(
+              child: Text(
+                "cancel".i18n,
+                style: const TextStyle(fontWeight: FontWeight.w500),
+              ),
+              onPressed: () {
+                Navigator.of(context).maybePop();
+              },
+            ),
+            TextButton(
+              child: Text(
+                "done".i18n,
+                style: const TextStyle(fontWeight: FontWeight.w500),
+              ),
+              onPressed: () async {
+                Map<String, String> renamedTeach = await databaseProvider
+                    .userQuery
+                    .renamedTeachers(userId: user.id!);
+
+                renamedTeach[widget.teacher.id] = _teacherName.text;
+
+                await databaseProvider.userStore
+                    .storeRenamedTeachers(renamedTeach, userId: user.id!);
+
+                updateProviders();
+
+                Navigator.of(context).pop();
+                setState(() {});
+              },
+            ),
+          ],
+        );
+      }),
+    ).then((val) {
+      _teacherName.text = "";
+    });
+  }
+
+  void updateProviders() async {
+    await Provider.of<GradeProvider>(context, listen: false)
+        .convertBySettings();
+    await Provider.of<TimetableProvider>(context, listen: false)
+        .convertBySettings();
+    await Provider.of<AbsenceProvider>(context, listen: false)
+        .convertBySettings();
+  }
+}

refilc_mobile_ui/lib/screens/settings/submenu/edit_subject.i18n.dart

@@ -0,0 +1,42 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension SettingsLocalization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          "rename_it": "Rename Subject",
+          "rename_te": "Rename Teacher",
+          "rounding": "Rounding",
+          "gs_mode": "Good Student Mode",
+          "rename_subject": "Rename Subject",
+          "modified_name": "Modified Name",
+          "cancel": "Cancel",
+          "done": "Done",
+        },
+        "hu_hu": {
+          "rename_it": "Tantárgy átnevezése",
+          "rename_te": "Tanár átnevezése",
+          "rounding": "Kerekítés",
+          "gs_mode": "Jó tanuló mód",
+          "rename_subject": "Tantárgy átnevezése",
+          "modified_name": "Módosított név",
+          "cancel": "Mégse",
+          "done": "Kész",
+        },
+        "de_de": {
+          "rename_it": "Betreff umbenennen",
+          "rename_te": "Lehrer umbenennen",
+          "rounding": "Rundung",
+          "gs_mode": "Guter Student Modus",
+          "rename_subject": "Fach umbenennen",
+          "modified_name": "Geänderter Name",
+          "cancel": "Abbrechen",
+          "done": "Erledigt",
+        },
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}

refilc_mobile_ui/lib/screens/settings/submenu/extras_screen.dart

@@ -0,0 +1,156 @@
+// import 'package:refilc/models/settings.dart';
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc/models/settings.dart';
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:refilc_mobile_ui/common/panel/panel_button.dart';
+import 'package:refilc_mobile_ui/common/splitted_panel/splitted_panel.dart';
+import 'package:refilc_mobile_ui/screens/settings/settings_helper.dart';
+import 'package:flutter/cupertino.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'package:refilc_plus/models/premium_scopes.dart';
+import 'package:refilc_plus/providers/premium_provider.dart';
+import 'package:refilc_plus/ui/mobile/premium/upsell.dart';
+import 'package:refilc_plus/ui/mobile/settings/welcome_message.dart';
+// import 'package:provider/provider.dart';
+import 'submenu_screen.i18n.dart';
+
+class MenuExtrasSettings extends StatelessWidget {
+  const MenuExtrasSettings({
+    super.key,
+    this.borderRadius = const BorderRadius.vertical(
+        top: Radius.circular(4.0), bottom: Radius.circular(4.0)),
+  });
+
+  final BorderRadius borderRadius;
+
+  @override
+  Widget build(BuildContext context) {
+    return PanelButton(
+      onPressed: () => Navigator.of(context, rootNavigator: true).push(
+        CupertinoPageRoute(builder: (context) => const ExtrasSettingsScreen()),
+      ),
+      title: Text("extras".i18n),
+      leading: Icon(
+        FeatherIcons.edit,
+        size: 22.0,
+        color: AppColors.of(context).text.withOpacity(0.95),
+      ),
+      trailing: Icon(
+        FeatherIcons.chevronRight,
+        size: 22.0,
+        color: AppColors.of(context).text.withOpacity(0.95),
+      ),
+      borderRadius: borderRadius,
+    );
+  }
+}
+
+class ExtrasSettingsScreen extends StatefulWidget {
+  const ExtrasSettingsScreen({super.key});
+
+  @override
+  ExtrasSettingsScreenState createState() => ExtrasSettingsScreenState();
+}
+
+class ExtrasSettingsScreenState extends State<ExtrasSettingsScreen> {
+  late SettingsProvider settingsProvider;
+  late UserProvider user;
+
+  @override
+  Widget build(BuildContext context) {
+    SettingsProvider settingsProvider = Provider.of<SettingsProvider>(context);
+    UserProvider user = Provider.of<UserProvider>(context);
+
+    return Scaffold(
+      appBar: AppBar(
+        surfaceTintColor: Theme.of(context).scaffoldBackgroundColor,
+        leading: BackButton(color: AppColors.of(context).text),
+        title: Text(
+          "extras".i18n,
+          style: TextStyle(color: AppColors.of(context).text),
+        ),
+      ),
+      body: SingleChildScrollView(
+        child: Padding(
+          padding: const EdgeInsets.symmetric(vertical: 16.0, horizontal: 24.0),
+          child: Column(
+            children: [
+              SplittedPanel(
+                padding: const EdgeInsets.only(top: 8.0),
+                cardPadding: const EdgeInsets.all(4.0),
+                isSeparated: true,
+                children: [
+                  PanelButton(
+                    padding: const EdgeInsets.only(left: 14.0, right: 6.0),
+                    onPressed: () async {
+                      if (!Provider.of<PremiumProvider>(context, listen: false)
+                          .hasScope(PremiumScopes.customGradeRarities)) {
+                        return PremiumLockedFeatureUpsell.show(
+                            context: context,
+                            feature: PremiumFeature.gradeRarities);
+                      }
+
+                      // settingsProvider.update(
+                      //     gradeOpeningFun: !settingsProvider.gradeOpeningFun);
+                      SettingsHelper.surpriseGradeRarityText(
+                        context,
+                        title: 'rarity_title'.i18n,
+                        cancel: 'cancel'.i18n,
+                        done: 'done'.i18n,
+                        rarities: [
+                          "common".i18n,
+                          "uncommon".i18n,
+                          "rare".i18n,
+                          "epic".i18n,
+                          "legendary".i18n,
+                        ],
+                      );
+                      setState(() {});
+                    },
+                    trailingDivider: true,
+                    title: Text(
+                      "surprise_grades".i18n,
+                      style: TextStyle(
+                        color: AppColors.of(context).text.withOpacity(
+                            settingsProvider.gradeOpeningFun ? .95 : .25),
+                      ),
+                    ),
+                    leading: Icon(
+                      FeatherIcons.gift,
+                      size: 22.0,
+                      color: AppColors.of(context).text.withOpacity(
+                          settingsProvider.gradeOpeningFun ? .95 : .25),
+                    ),
+                    trailing: Switch(
+                      onChanged: (v) async {
+                        settingsProvider.update(gradeOpeningFun: v);
+
+                        setState(() {});
+                      },
+                      value: settingsProvider.gradeOpeningFun,
+                      activeColor: Theme.of(context).colorScheme.secondary,
+                    ),
+                    borderRadius: const BorderRadius.vertical(
+                      top: Radius.circular(12.0),
+                      bottom: Radius.circular(12.0),
+                    ),
+                  ),
+                ],
+              ),
+              SplittedPanel(
+                padding: const EdgeInsets.only(top: 9.0),
+                cardPadding: const EdgeInsets.all(4.0),
+                isSeparated: true,
+                children: [
+                  WelcomeMessagePanelButton(settingsProvider, user),
+                ],
+              ),
+            ],
+          ),
+        ),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/settings/submenu/general_screen.dart

@@ -0,0 +1,371 @@
+import 'package:refilc/models/settings.dart';
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:refilc/utils/format.dart';
+import 'package:refilc_mobile_ui/common/panel/panel_button.dart';
+import 'package:refilc_mobile_ui/common/splitted_panel/splitted_panel.dart';
+import 'package:refilc_mobile_ui/screens/settings/settings_helper.dart';
+import 'package:flutter/cupertino.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'package:refilc_mobile_ui/screens/settings/settings_screen.i18n.dart';
+
+class MenuGeneralSettings extends StatelessWidget {
+  const MenuGeneralSettings({
+    super.key,
+    this.borderRadius = const BorderRadius.vertical(
+        top: Radius.circular(4.0), bottom: Radius.circular(4.0)),
+  });
+
+  final BorderRadius borderRadius;
+
+  @override
+  Widget build(BuildContext context) {
+    return PanelButton(
+      onPressed: () => Navigator.of(context, rootNavigator: true).push(
+        CupertinoPageRoute(builder: (context) => const GeneralSettingsScreen()),
+      ),
+      title: Text("general".i18n),
+      leading: Icon(
+        FeatherIcons.settings,
+        size: 22.0,
+        color: AppColors.of(context).text.withOpacity(0.95),
+      ),
+      trailing: Icon(
+        FeatherIcons.chevronRight,
+        size: 22.0,
+        color: AppColors.of(context).text.withOpacity(0.95),
+      ),
+      borderRadius: borderRadius,
+    );
+  }
+}
+
+class GeneralSettingsScreen extends StatefulWidget {
+  const GeneralSettingsScreen({super.key});
+
+  @override
+  GeneralSettingsScreenState createState() => GeneralSettingsScreenState();
+}
+
+class GeneralSettingsScreenState extends State<GeneralSettingsScreen> {
+  @override
+  Widget build(BuildContext context) {
+    SettingsProvider settingsProvider = Provider.of<SettingsProvider>(context);
+
+    String startPageTitle =
+        SettingsHelper.localizedPageTitles()[settingsProvider.startPage] ?? "?";
+    String languageText =
+        SettingsHelper.langMap[settingsProvider.language] ?? "?";
+    String vibrateTitle = {
+          VibrationStrength.off: "voff".i18n,
+          VibrationStrength.light: "vlight".i18n,
+          VibrationStrength.medium: "vmedium".i18n,
+          VibrationStrength.strong: "vstrong".i18n,
+        }[settingsProvider.vibrate] ??
+        "?";
+
+    return Scaffold(
+      appBar: AppBar(
+        surfaceTintColor: Theme.of(context).scaffoldBackgroundColor,
+        leading: BackButton(color: AppColors.of(context).text),
+        title: Text(
+          "general".i18n,
+          style: TextStyle(color: AppColors.of(context).text),
+        ),
+      ),
+      body: SingleChildScrollView(
+        child: Padding(
+          padding: const EdgeInsets.symmetric(vertical: 16.0, horizontal: 24.0),
+          child: Column(
+            children: [
+              SplittedPanel(
+                padding: const EdgeInsets.only(top: 8.0),
+                cardPadding: const EdgeInsets.all(4.0),
+                isSeparated: true,
+                children: [
+                  PanelButton(
+                    padding: const EdgeInsets.only(left: 14.0, right: 6.0),
+                    onPressed: () {
+                      SettingsHelper.bellDelay(context);
+                      setState(() {});
+                    },
+                    title: Text(
+                      "bell_delay".i18n,
+                      style: TextStyle(
+                        color: AppColors.of(context).text.withOpacity(
+                            settingsProvider.bellDelayEnabled ? .95 : .25),
+                      ),
+                    ),
+                    leading: Icon(
+                      settingsProvider.bellDelayEnabled
+                          ? FeatherIcons.bell
+                          : FeatherIcons.bellOff,
+                      size: 22.0,
+                      color: AppColors.of(context).text.withOpacity(
+                          settingsProvider.bellDelayEnabled ? .95 : .25),
+                    ),
+                    trailingDivider: true,
+                    trailing: Switch(
+                      onChanged: (v) =>
+                          settingsProvider.update(bellDelayEnabled: v),
+                      value: settingsProvider.bellDelayEnabled,
+                      activeColor: Theme.of(context).colorScheme.secondary,
+                    ),
+                    borderRadius: const BorderRadius.vertical(
+                      top: Radius.circular(12.0),
+                      bottom: Radius.circular(12.0),
+                    ),
+                  ),
+                ],
+              ),
+              SplittedPanel(
+                padding: const EdgeInsets.only(top: 9.0),
+                cardPadding: const EdgeInsets.all(4.0),
+                isSeparated: true,
+                children: [
+                  PanelButton(
+                    onPressed: () {
+                      SettingsHelper.rounding(context);
+                      setState(() {});
+                    },
+                    title: Text(
+                      "rounding".i18n,
+                      style: TextStyle(
+                        color: AppColors.of(context).text.withOpacity(.95),
+                      ),
+                    ),
+                    leading: Icon(
+                      FeatherIcons.gitCommit,
+                      size: 22.0,
+                      color: AppColors.of(context).text.withOpacity(.95),
+                    ),
+                    trailing: Text(
+                      (settingsProvider.rounding / 10).toStringAsFixed(1),
+                      style: const TextStyle(fontSize: 14.0),
+                    ),
+                    borderRadius: const BorderRadius.vertical(
+                      top: Radius.circular(12.0),
+                      bottom: Radius.circular(12.0),
+                    ),
+                  ),
+                ],
+              ),
+              SplittedPanel(
+                padding: const EdgeInsets.only(top: 9.0),
+                cardPadding: const EdgeInsets.all(4.0),
+                isSeparated: true,
+                children: [
+                  PanelButton(
+                    padding: const EdgeInsets.only(left: 14.0, right: 6.0),
+                    onPressed: () {
+                      settingsProvider.update(
+                          graphClassAvg: !settingsProvider.graphClassAvg);
+                      setState(() {});
+                    },
+                    title: Text(
+                      "graph_class_avg".i18n,
+                      style: TextStyle(
+                        color: AppColors.of(context).text.withOpacity(
+                            settingsProvider.graphClassAvg ? .95 : .25),
+                      ),
+                    ),
+                    leading: Icon(
+                      FeatherIcons.barChart,
+                      size: 22.0,
+                      color: AppColors.of(context).text.withOpacity(
+                          settingsProvider.graphClassAvg ? .95 : .25),
+                    ),
+                    trailing: Switch(
+                      onChanged: (v) =>
+                          settingsProvider.update(graphClassAvg: v),
+                      value: settingsProvider.graphClassAvg,
+                      activeColor: Theme.of(context).colorScheme.secondary,
+                    ),
+                    borderRadius: const BorderRadius.vertical(
+                      top: Radius.circular(12.0),
+                      bottom: Radius.circular(12.0),
+                    ),
+                  ),
+                ],
+              ),
+              SplittedPanel(
+                padding: const EdgeInsets.only(top: 9.0),
+                cardPadding: const EdgeInsets.all(4.0),
+                isSeparated: true,
+                children: [
+                  PanelButton(
+                    onPressed: () {
+                      SettingsHelper.startPage(context);
+                      setState(() {});
+                    },
+                    title: Text(
+                      "startpage".i18n,
+                      style: TextStyle(
+                        color: AppColors.of(context).text.withOpacity(.95),
+                      ),
+                    ),
+                    leading: Icon(
+                      FeatherIcons.play,
+                      size: 22.0,
+                      color: AppColors.of(context).text.withOpacity(.95),
+                    ),
+                    trailing: Text(
+                      startPageTitle.capital(),
+                      style: const TextStyle(fontSize: 14.0),
+                    ),
+                    borderRadius: const BorderRadius.vertical(
+                      top: Radius.circular(12.0),
+                      bottom: Radius.circular(12.0),
+                    ),
+                  ),
+                ],
+              ),
+              SplittedPanel(
+                padding: const EdgeInsets.only(top: 9.0),
+                cardPadding: const EdgeInsets.all(4.0),
+                isSeparated: true,
+                children: [
+                  PanelButton(
+                    onPressed: () {
+                      SettingsHelper.language(context);
+                      setState(() {});
+                    },
+                    title: Text(
+                      "language".i18n,
+                      style: TextStyle(
+                        color: AppColors.of(context).text.withOpacity(.95),
+                      ),
+                    ),
+                    leading: Icon(
+                      FeatherIcons.globe,
+                      size: 22.0,
+                      color: AppColors.of(context).text.withOpacity(.95),
+                    ),
+                    trailing: Text(
+                      languageText,
+                      style: const TextStyle(fontSize: 14.0),
+                    ),
+                    borderRadius: const BorderRadius.vertical(
+                      top: Radius.circular(12.0),
+                      bottom: Radius.circular(12.0),
+                    ),
+                  ),
+                ],
+              ),
+              SplittedPanel(
+                padding: const EdgeInsets.only(top: 9.0),
+                cardPadding: const EdgeInsets.all(4.0),
+                isSeparated: true,
+                children: [
+                  PanelButton(
+                    onPressed: () {
+                      SettingsHelper.vibrate(context);
+                      setState(() {});
+                    },
+                    title: Text(
+                      "vibrate".i18n,
+                      style: TextStyle(
+                        color: AppColors.of(context).text.withOpacity(.95),
+                      ),
+                    ),
+                    leading: Icon(
+                      FeatherIcons.radio,
+                      size: 22.0,
+                      color: AppColors.of(context).text.withOpacity(.95),
+                    ),
+                    trailing: Text(
+                      vibrateTitle,
+                      style: const TextStyle(fontSize: 14.0),
+                    ),
+                    borderRadius: const BorderRadius.vertical(
+                      top: Radius.circular(12.0),
+                      bottom: Radius.circular(12.0),
+                    ),
+                  ),
+                ],
+              ),
+              SplittedPanel(
+                padding: const EdgeInsets.only(top: 9.0),
+                cardPadding: const EdgeInsets.all(4.0),
+                isSeparated: true,
+                children: [
+                  PanelButton(
+                    padding: const EdgeInsets.only(left: 14.0, right: 6.0),
+                    onPressed: () {
+                      settingsProvider.update(
+                          showBreaks: !settingsProvider.showBreaks);
+                      setState(() {});
+                    },
+                    title: Text(
+                      "show_breaks".i18n,
+                      style: TextStyle(
+                        color: AppColors.of(context).text.withOpacity(
+                            settingsProvider.showBreaks ? .95 : .25),
+                      ),
+                    ),
+                    leading: Icon(
+                      settingsProvider.showBreaks
+                          ? FeatherIcons.eye
+                          : FeatherIcons.eyeOff,
+                      size: 22.0,
+                      color: AppColors.of(context)
+                          .text
+                          .withOpacity(settingsProvider.showBreaks ? .95 : .25),
+                    ),
+                    trailing: Switch(
+                      onChanged: (v) => settingsProvider.update(showBreaks: v),
+                      value: settingsProvider.showBreaks,
+                      activeColor: Theme.of(context).colorScheme.secondary,
+                    ),
+                    borderRadius: const BorderRadius.vertical(
+                      top: Radius.circular(12.0),
+                      bottom: Radius.circular(12.0),
+                    ),
+                  ),
+                ],
+              ),
+              SplittedPanel(
+                padding: const EdgeInsets.only(top: 9.0),
+                cardPadding: const EdgeInsets.all(4.0),
+                isSeparated: true,
+                children: [
+                  PanelButton(
+                    padding: const EdgeInsets.only(left: 14.0, right: 6.0),
+                    onPressed: () {
+                      settingsProvider.update(
+                          newsEnabled: !settingsProvider.newsEnabled);
+                      setState(() {});
+                    },
+                    title: Text(
+                      "news".i18n,
+                      style: TextStyle(
+                        color: AppColors.of(context).text.withOpacity(
+                            settingsProvider.newsEnabled ? .95 : .25),
+                      ),
+                    ),
+                    leading: Icon(
+                      Icons.newspaper_outlined,
+                      size: 22.0,
+                      color: AppColors.of(context).text.withOpacity(
+                          settingsProvider.newsEnabled ? .95 : .25),
+                    ),
+                    trailing: Switch(
+                      onChanged: (v) => settingsProvider.update(newsEnabled: v),
+                      value: settingsProvider.newsEnabled,
+                      activeColor: Theme.of(context).colorScheme.secondary,
+                    ),
+                    borderRadius: const BorderRadius.vertical(
+                      top: Radius.circular(12.0),
+                      bottom: Radius.circular(12.0),
+                    ),
+                  ),
+                ],
+              ),
+            ],
+          ),
+        ),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/settings/submenu/paint_list.dart

@@ -0,0 +1,572 @@
+// ignore_for_file: use_build_context_synchronously
+
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc/models/settings.dart';
+import 'package:refilc/models/shared_theme.dart';
+import 'package:refilc/theme/colors/accent.dart';
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:refilc/theme/observer.dart';
+import 'package:refilc_kreta_api/providers/share_provider.dart';
+import 'package:refilc_mobile_ui/common/custom_snack_bar.dart';
+import 'package:refilc_mobile_ui/common/empty.dart';
+import 'package:refilc_mobile_ui/common/panel/panel_button.dart';
+import 'package:refilc_mobile_ui/common/splitted_panel/splitted_panel.dart';
+import 'package:flutter/cupertino.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'package:refilc_mobile_ui/screens/settings/settings_screen.i18n.dart';
+import 'package:share_plus/share_plus.dart';
+
+class MenuPaintList extends StatelessWidget {
+  const MenuPaintList({
+    super.key,
+    this.borderRadius = const BorderRadius.vertical(
+        top: Radius.circular(4.0), bottom: Radius.circular(4.0)),
+  });
+
+  final BorderRadius borderRadius;
+
+  @override
+  Widget build(BuildContext context) {
+    return PanelButton(
+      onPressed: () async {
+        List<SharedTheme> publicThemes =
+            await Provider.of<ShareProvider>(context, listen: false)
+                .getAllPublicThemes(context);
+
+        Navigator.of(context, rootNavigator: true).push(CupertinoPageRoute(
+            builder: (context) => PaintListScreen(publicThemes: publicThemes)));
+      },
+      title: Text(
+        "own_paints".i18n,
+        style: TextStyle(
+          color: AppColors.of(context).text.withOpacity(.95),
+        ),
+      ),
+      leading: Icon(
+        FeatherIcons.list,
+        size: 22.0,
+        color: AppColors.of(context).text.withOpacity(.95),
+      ),
+      trailing: Icon(
+        FeatherIcons.chevronRight,
+        size: 22.0,
+        color: AppColors.of(context).text.withOpacity(0.95),
+      ),
+      borderRadius: borderRadius,
+    );
+  }
+}
+
+class PaintListScreen extends StatefulWidget {
+  const PaintListScreen({super.key, required this.publicThemes});
+
+  final List<SharedTheme> publicThemes;
+
+  @override
+  PaintListScreenState createState() => PaintListScreenState();
+}
+
+class PaintListScreenState extends State<PaintListScreen>
+    with SingleTickerProviderStateMixin {
+  late SettingsProvider settingsProvider;
+  late UserProvider user;
+  late ShareProvider shareProvider;
+
+  late AnimationController _hideContainersController;
+
+  late List<Widget> tiles;
+
+  final _paintId = TextEditingController();
+
+  SharedTheme? newThemeByID;
+
+  @override
+  void initState() {
+    super.initState();
+
+    shareProvider = Provider.of<ShareProvider>(context, listen: false);
+
+    _hideContainersController = AnimationController(
+        vsync: this, duration: const Duration(milliseconds: 200));
+  }
+
+  void buildPublicPaintTiles() async {
+    List<Widget> subjectTiles = [];
+
+    var added = [];
+    var i = 0;
+
+    for (var t in widget.publicThemes) {
+      if (added.contains(t.id)) continue;
+
+      Widget w = PanelButton(
+        onPressed: () => {
+          // TODO: set theme
+        },
+        title: Column(
+          children: [
+            Text(
+              t.displayName,
+              style: TextStyle(
+                color: AppColors.of(context).text.withOpacity(.95),
+              ),
+            ),
+            Text(
+              t.nickname,
+              style: TextStyle(
+                color: AppColors.of(context).text.withOpacity(.75),
+              ),
+            ),
+          ],
+        ),
+        trailing: Row(
+          mainAxisSize: MainAxisSize.min,
+          children: [
+            Container(
+              margin: const EdgeInsets.only(left: 2.0),
+              width: 12.0,
+              height: 12.0,
+              decoration: BoxDecoration(
+                shape: BoxShape.circle,
+                color: t.backgroundColor,
+              ),
+            ),
+            Container(
+              margin: const EdgeInsets.only(left: 2.0),
+              width: 12.0,
+              height: 12.0,
+              decoration: BoxDecoration(
+                shape: BoxShape.circle,
+                color: t.panelsColor,
+              ),
+            ),
+            Container(
+              margin: const EdgeInsets.only(left: 2.0),
+              width: 12.0,
+              height: 12.0,
+              decoration: BoxDecoration(
+                shape: BoxShape.circle,
+                color: t.accentColor,
+              ),
+            ),
+          ],
+        ),
+        borderRadius: BorderRadius.vertical(
+          top: Radius.circular(i == 0 ? 12.0 : 4.0),
+          bottom:
+              Radius.circular(i + 1 == widget.publicThemes.length ? 12.0 : 4.0),
+        ),
+      );
+
+      i += 1;
+      subjectTiles.add(w);
+      added.add(t.id);
+    }
+
+    if (widget.publicThemes.isEmpty) {
+      subjectTiles.add(Empty(
+        subtitle: 'no_pub_paint'.i18n,
+      ));
+    }
+
+    tiles = subjectTiles;
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    settingsProvider = Provider.of<SettingsProvider>(context);
+    user = Provider.of<UserProvider>(context);
+
+    buildPublicPaintTiles();
+
+    return AnimatedBuilder(
+      animation: _hideContainersController,
+      builder: (context, child) => Opacity(
+        opacity: 1 - _hideContainersController.value,
+        child: Scaffold(
+          appBar: AppBar(
+            surfaceTintColor: Theme.of(context).scaffoldBackgroundColor,
+            leading: BackButton(color: AppColors.of(context).text),
+            title: Text(
+              "own_paints".i18n,
+              style: TextStyle(color: AppColors.of(context).text),
+            ),
+          ),
+          body: SingleChildScrollView(
+            child: Padding(
+              padding:
+                  const EdgeInsets.symmetric(vertical: 16.0, horizontal: 24.0),
+              child: Column(
+                children: [
+                  // enter id
+                  SplittedPanel(
+                    padding: EdgeInsets.zero,
+                    cardPadding: const EdgeInsets.all(3.0),
+                    hasBorder: true,
+                    isTransparent: true,
+                    children: [
+                      PanelButton(
+                        onPressed: () => showEnterIDDialog(),
+                        title: Text(
+                          "enter_id".i18n,
+                          style: TextStyle(
+                            color: AppColors.of(context).text.withOpacity(.95),
+                          ),
+                        ),
+                        leading: Icon(
+                          FeatherIcons.plus,
+                          size: 22.0,
+                          color: AppColors.of(context).text.withOpacity(.95),
+                        ),
+                        borderRadius: const BorderRadius.vertical(
+                          top: Radius.circular(12.0),
+                          bottom: Radius.circular(12.0),
+                        ),
+                      ),
+                    ],
+                  ),
+
+                  const SizedBox(
+                    height: 18.0,
+                  ),
+                  // current paint
+                  SplittedPanel(
+                    title: Text('current_paint'.i18n),
+                    padding: EdgeInsets.zero,
+                    cardPadding: const EdgeInsets.all(4.0),
+                    children: [
+                      PanelButton(
+                        onPressed: () async {
+                          if (settingsProvider.currentThemeId != '') {
+                            Share.share(
+                              settingsProvider.currentThemeId,
+                              subject: 'share_subj_theme'.i18n,
+                            );
+                          } else {
+                            SharedGradeColors gradeColors = await shareProvider
+                                .shareCurrentGradeColors(context);
+                            SharedTheme theme =
+                                await shareProvider.shareCurrentTheme(
+                              context,
+                              gradeColors: gradeColors,
+                            );
+
+                            Share.share(
+                              theme.id,
+                              subject: 'share_subj_theme'.i18n,
+                            );
+                          }
+                        },
+                        longPressInstead: true,
+                        title: Column(
+                          crossAxisAlignment: CrossAxisAlignment.start,
+                          children: [
+                            Text(
+                              settingsProvider.currentThemeDisplayName != ''
+                                  ? settingsProvider.currentThemeDisplayName
+                                  : 'no_name'.i18n,
+                              style: TextStyle(
+                                color:
+                                    AppColors.of(context).text.withOpacity(.95),
+                              ),
+                            ),
+                            Text(
+                              settingsProvider.currentThemeCreator != ''
+                                  ? settingsProvider.currentThemeCreator
+                                  : 'Anonymous',
+                              style: TextStyle(
+                                color:
+                                    AppColors.of(context).text.withOpacity(.65),
+                                fontSize: 15.0,
+                                fontWeight: FontWeight.w500,
+                              ),
+                            ),
+                          ],
+                        ),
+                        trailing: Transform.translate(
+                          offset: const Offset(8.0, 0.0),
+                          child: Row(
+                            mainAxisSize: MainAxisSize.min,
+                            children: [
+                              Container(
+                                margin: const EdgeInsets.only(left: 2.0),
+                                width: 14.0,
+                                height: 14.0,
+                                decoration: BoxDecoration(
+                                  shape: BoxShape.circle,
+                                  color:
+                                      (settingsProvider.customBackgroundColor ??
+                                          SettingsProvider.defaultSettings()
+                                              .customBackgroundColor),
+                                  boxShadow: [
+                                    BoxShadow(
+                                      color: AppColors.of(context)
+                                          .text
+                                          .withOpacity(0.15),
+                                      offset: const Offset(1, 2),
+                                      blurRadius: 3,
+                                    ),
+                                  ],
+                                ),
+                              ),
+                              Transform.translate(
+                                offset: const Offset(-4.0, 0.0),
+                                child: Container(
+                                  margin: const EdgeInsets.only(left: 2.0),
+                                  width: 14.0,
+                                  height: 14.0,
+                                  decoration: BoxDecoration(
+                                    shape: BoxShape.circle,
+                                    color: (settingsProvider
+                                            .customHighlightColor ??
+                                        SettingsProvider.defaultSettings()
+                                            .customHighlightColor),
+                                    boxShadow: [
+                                      BoxShadow(
+                                        color: AppColors.of(context)
+                                            .text
+                                            .withOpacity(0.15),
+                                        offset: const Offset(1, 2),
+                                        blurRadius: 3,
+                                      ),
+                                    ],
+                                  ),
+                                ),
+                              ),
+                              Transform.translate(
+                                offset: const Offset(-8.0, 0.0),
+                                child: Container(
+                                  margin: const EdgeInsets.only(left: 2.0),
+                                  width: 14.0,
+                                  height: 14.0,
+                                  decoration: BoxDecoration(
+                                    shape: BoxShape.circle,
+                                    color: settingsProvider.customAccentColor ??
+                                        accentColorMap[
+                                            settingsProvider.accentColor],
+                                    boxShadow: [
+                                      BoxShadow(
+                                        color: AppColors.of(context)
+                                            .text
+                                            .withOpacity(0.15),
+                                        offset: const Offset(1, 2),
+                                        blurRadius: 3,
+                                      ),
+                                    ],
+                                  ),
+                                ),
+                              ),
+                            ],
+                          ),
+                        ),
+                        borderRadius: const BorderRadius.vertical(
+                          top: Radius.circular(12),
+                          bottom: Radius.circular(12),
+                        ),
+                      ),
+                    ],
+                  ),
+
+                  const SizedBox(
+                    height: 18.0,
+                  ),
+                  // own paints
+                  SplittedPanel(
+                    title: Text('public_paint'.i18n),
+                    padding: EdgeInsets.zero,
+                    cardPadding: const EdgeInsets.all(4.0),
+                    children: tiles,
+                  ),
+                ],
+              ),
+            ),
+          ),
+        ),
+      ),
+    );
+  }
+
+  // enter id dialog
+  void showEnterIDDialog() {
+    _paintId.text = '';
+
+    showDialog(
+      context: context,
+      builder: (context) => StatefulBuilder(builder: (context, setS) {
+        return AlertDialog(
+          shape: const RoundedRectangleBorder(
+              borderRadius: BorderRadius.all(Radius.circular(14.0))),
+          title: Text("enter_id".i18n),
+          content: Column(
+            mainAxisSize: MainAxisSize.min,
+            children: [
+              TextField(
+                controller: _paintId,
+                onEditingComplete: () async {
+                  // SharedTheme? theme = await shareProvider.getThemeById(
+                  //   context,
+                  //   id: _paintId.text.replaceAll(' ', ''),
+                  // );
+
+                  // if (theme != null) {
+                  //   // set theme variable
+                  //   newThemeByID = theme;
+
+                  //   _paintId.clear();
+                  // } else {
+                  //   ScaffoldMessenger.of(context).showSnackBar(
+                  //     CustomSnackBar(
+                  //       content: Text("theme_not_found".i18n,
+                  //           style: const TextStyle(color: Colors.white)),
+                  //       backgroundColor: AppColors.of(context).red,
+                  //       context: context,
+                  //     ),
+                  //   );
+                  // }
+                },
+                decoration: InputDecoration(
+                  border: OutlineInputBorder(
+                    borderSide:
+                        const BorderSide(color: Colors.grey, width: 1.5),
+                    borderRadius: BorderRadius.circular(12.0),
+                  ),
+                  focusedBorder: OutlineInputBorder(
+                    borderSide:
+                        const BorderSide(color: Colors.grey, width: 1.5),
+                    borderRadius: BorderRadius.circular(12.0),
+                  ),
+                  contentPadding: const EdgeInsets.symmetric(horizontal: 12.0),
+                  hintText: 'paint_id'.i18n,
+                  suffixIcon: IconButton(
+                    icon: const Icon(
+                      FeatherIcons.x,
+                      color: Colors.grey,
+                    ),
+                    onPressed: () {
+                      setState(() {
+                        _paintId.text = '';
+                      });
+                    },
+                  ),
+                ),
+              ),
+              const Padding(
+                padding: EdgeInsets.symmetric(vertical: 8.0),
+                child: Icon(FeatherIcons.arrowDown, size: 32),
+              ),
+              Container(
+                decoration: BoxDecoration(
+                    color: Theme.of(context).colorScheme.background,
+                    borderRadius:
+                        const BorderRadius.all(Radius.circular(12.0))),
+                padding: const EdgeInsets.symmetric(vertical: 10.0),
+                child: Center(
+                  child: Text(
+                    'set_as_current'.i18n,
+                    style: const TextStyle(
+                        fontWeight: FontWeight.w500, fontSize: 16.0),
+                  ),
+                ),
+              ),
+            ],
+          ),
+          actions: [
+            TextButton(
+              child: Text(
+                "cancel".i18n,
+                style: const TextStyle(fontWeight: FontWeight.w500),
+              ),
+              onPressed: () {
+                Navigator.of(context).maybePop();
+              },
+            ),
+            TextButton(
+              child: Text(
+                "done".i18n,
+                style: const TextStyle(fontWeight: FontWeight.w500),
+              ),
+              onPressed: () async {
+                // get sex
+
+                SharedTheme? theme = await shareProvider.getThemeById(
+                  context,
+                  id: _paintId.text.replaceAll(' ', ''),
+                );
+
+                if (theme != null) {
+                  // set theme variable
+                  newThemeByID = theme;
+
+                  _paintId.clear();
+                } else {
+                  ScaffoldMessenger.of(context).showSnackBar(
+                    CustomSnackBar(
+                      content: Text("theme_not_found".i18n,
+                          style: const TextStyle(color: Colors.white)),
+                      backgroundColor: AppColors.of(context).red,
+                      context: context,
+                    ),
+                  );
+                }
+
+                // slay
+
+                setPaint();
+
+                setState(() {});
+                Navigator.of(context).pop();
+              },
+            ),
+          ],
+        );
+      }),
+    ).then((val) {
+      _paintId.clear();
+    });
+  }
+
+  void setPaint() async {
+    if (newThemeByID == null) return;
+
+    // changing grade colors
+    List<Color> colors = [
+      newThemeByID!.gradeColors.oneColor,
+      newThemeByID!.gradeColors.twoColor,
+      newThemeByID!.gradeColors.threeColor,
+      newThemeByID!.gradeColors.fourColor,
+      newThemeByID!.gradeColors.fiveColor,
+    ];
+    settingsProvider.update(gradeColors: colors, store: true);
+
+    // changing shadow effect
+    settingsProvider.update(
+        shadowEffect: newThemeByID!.shadowEffect, store: true);
+
+    // changing theme mode
+    settingsProvider.update(theme: newThemeByID!.themeMode, store: true);
+
+    // changing theme
+    settingsProvider.update(
+      customBackgroundColor: newThemeByID!.backgroundColor,
+      customHighlightColor: newThemeByID!.panelsColor,
+      customAccentColor: newThemeByID!.accentColor,
+      customIconColor: newThemeByID!.iconColor,
+      // new things
+      currentThemeId: newThemeByID!.id,
+      currentThemeDisplayName: newThemeByID!.displayName,
+      currentThemeCreator: newThemeByID!.nickname,
+      // we should store it
+      store: true,
+    );
+
+    // changing font family
+    settingsProvider.update(fontFamily: newThemeByID!.fontFamily, store: true);
+
+    // seems weird but it works, trust me (idk why)
+    // await settingsProvider.update(theme: settingsProvider.theme, store: true);
+    Provider.of<ThemeModeObserver>(context, listen: false)
+        .changeTheme(settingsProvider.theme, updateNavbarColor: true);
+  }
+}

refilc_mobile_ui/lib/screens/settings/submenu/personalize_screen.dart

@@ -0,0 +1,834 @@
+// ignore_for_file: use_build_context_synchronously
+
+import 'dart:io';
+
+import 'package:dropdown_button2/dropdown_button2.dart';
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc/helpers/subject.dart';
+import 'package:refilc/models/settings.dart';
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:refilc/utils/format.dart';
+import 'package:refilc_kreta_api/models/grade.dart';
+import 'package:refilc_kreta_api/providers/absence_provider.dart';
+import 'package:refilc_kreta_api/providers/grade_provider.dart';
+import 'package:refilc_kreta_api/providers/timetable_provider.dart';
+import 'package:refilc_mobile_ui/common/panel/panel_button.dart';
+import 'package:refilc_mobile_ui/common/splitted_panel/splitted_panel.dart';
+import 'package:refilc_mobile_ui/screens/settings/settings_helper.dart';
+import 'package:refilc_mobile_ui/screens/settings/submenu/edit_subject.dart';
+import 'package:refilc_mobile_ui/screens/settings/submenu/paint_list.dart';
+import 'package:flutter/cupertino.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'package:refilc_mobile_ui/screens/settings/settings_screen.i18n.dart';
+import 'package:refilc_plus/models/premium_scopes.dart';
+import 'package:refilc_plus/providers/premium_provider.dart';
+import 'package:refilc_plus/ui/mobile/premium/upsell.dart';
+import 'package:google_fonts/google_fonts.dart';
+
+class MenuPersonalizeSettings extends StatelessWidget {
+  const MenuPersonalizeSettings({
+    super.key,
+    this.borderRadius = const BorderRadius.vertical(
+        top: Radius.circular(4.0), bottom: Radius.circular(4.0)),
+  });
+
+  final BorderRadius borderRadius;
+
+  @override
+  Widget build(BuildContext context) {
+    return PanelButton(
+      onPressed: () => Navigator.of(context, rootNavigator: true).push(
+        CupertinoPageRoute(
+            builder: (context) => const PersonalizeSettingsScreen()),
+      ),
+      title: Text("personalization".i18n),
+      leading: Icon(
+        Icons.palette_outlined,
+        size: 22.0,
+        color: AppColors.of(context).text.withOpacity(0.95),
+      ),
+      trailing: Icon(
+        FeatherIcons.chevronRight,
+        size: 22.0,
+        color: AppColors.of(context).text.withOpacity(0.95),
+      ),
+      borderRadius: borderRadius,
+    );
+  }
+}
+
+class PersonalizeSettingsScreen extends StatefulWidget {
+  const PersonalizeSettingsScreen({super.key});
+
+  @override
+  PersonalizeSettingsScreenState createState() =>
+      PersonalizeSettingsScreenState();
+}
+
+class PersonalizeSettingsScreenState extends State<PersonalizeSettingsScreen>
+    with SingleTickerProviderStateMixin {
+  late SettingsProvider settingsProvider;
+  late UserProvider user;
+
+  late AnimationController _hideContainersController;
+
+  late List<Grade> editedShit;
+  late List<Grade> otherShit;
+
+  late List<Widget> tiles;
+  // late List<Widget> fontTiles;
+
+  @override
+  void initState() {
+    super.initState();
+
+    // editedShit = Provider.of<GradeProvider>(context, listen: false)
+    //     .grades
+    //     .where((e) => e.teacher.isRenamed || e.subject.isRenamed)
+    //     // .map((e) => e.subject)
+    //     .toSet()
+    //     .toList()
+    //   ..sort((a, b) => a.subject.name.compareTo(b.subject.name));
+
+    List<Grade> other = Provider.of<GradeProvider>(context, listen: false)
+        .grades
+        .where((e) => !e.teacher.isRenamed && !e.subject.isRenamed)
+        .toSet()
+        .toList()
+      ..sort((a, b) => a.subject.name.compareTo(b.subject.name));
+
+    otherShit = [];
+    var addedOthers = [];
+
+    for (var e in other) {
+      if (addedOthers.contains(e.subject.id)) continue;
+      addedOthers.add(e.subject.id);
+
+      otherShit.add(e);
+    }
+
+    otherShit = otherShit
+      ..sort((a, b) =>
+          a.subject.name.compareTo(b.subject.name)); // just cuz why not
+
+    // editedTeachers = Provider.of<GradeProvider>(context, listen: false)
+    //     .grades
+    //     .where((e) => e.teacher.isRenamed || e.subject.isRenamed)
+    //     .map((e) => e.teacher)
+    //     .toSet()
+    //     .toList();
+    // // ..sort((a, b) => a.name.compareTo(b.name));
+    // otherTeachers = Provider.of<GradeProvider>(context, listen: false)
+    //     .grades
+    //     .where((e) => !e.teacher.isRenamed && !e.subject.isRenamed)
+    //     .map((e) => e.teacher)
+    //     .toSet()
+    //     .toList();
+    // ..sort((a, b) => a.name.compareTo(b.name));
+
+    _hideContainersController = AnimationController(
+        vsync: this, duration: const Duration(milliseconds: 200));
+  }
+
+  void buildSubjectTiles() {
+    List<Widget> subjectTiles = [];
+
+    var added = [];
+    var i = 0;
+
+    List<Grade> need = [];
+    for (var s in editedShit) {
+      if (added.contains(s.subject.id)) continue;
+      need.add(s);
+      added.add(s.subject.id);
+    }
+
+    for (var s in need) {
+      Widget widget = PanelButton(
+        onPressed: () async {
+          Navigator.of(context, rootNavigator: true).push(
+            CupertinoPageRoute(
+              builder: (context) => EditSubjectScreen(
+                subject: s.subject,
+                teacher: s.teacher, // not sure why, but it works tho
+              ),
+            ),
+          );
+
+          setState(() {});
+        },
+        title: Column(
+          crossAxisAlignment: CrossAxisAlignment.start,
+          children: [
+            Text(
+              (s.subject.isRenamed && settingsProvider.renamedSubjectsEnabled
+                      ? s.subject.renamedTo
+                      : s.subject.name.capital()) ??
+                  '',
+              style: TextStyle(
+                color: AppColors.of(context).text.withOpacity(.95),
+                fontStyle: settingsProvider.renamedSubjectsItalics
+                    ? FontStyle.italic
+                    : FontStyle.normal,
+              ),
+            ),
+            Text(
+              (s.teacher.isRenamed && settingsProvider.renamedTeachersEnabled
+                      ? s.teacher.renamedTo
+                      : s.teacher.name.capital()) ??
+                  '',
+              style: TextStyle(
+                color: AppColors.of(context).text.withOpacity(.85),
+                fontWeight: FontWeight.w400,
+                fontSize: 15.0,
+                height: 1.2,
+              ),
+            ),
+          ],
+        ),
+        leading: Icon(
+          SubjectIcon.resolveVariant(context: context, subject: s.subject),
+          size: 22.0,
+          color: AppColors.of(context).text.withOpacity(.95),
+        ),
+        trailing: Icon(
+          FeatherIcons.chevronRight,
+          size: 22.0,
+          color: AppColors.of(context).text.withOpacity(0.95),
+        ),
+        borderRadius: BorderRadius.vertical(
+          top: Radius.circular(i == 0 ? 12.0 : 4.0),
+          bottom: Radius.circular(i + 1 == need.length ? 12.0 : 4.0),
+        ),
+      );
+
+      i += 1;
+      subjectTiles.add(widget);
+    }
+
+    tiles = subjectTiles;
+  }
+
+  // void buildFontTiles() {
+  //   List<String> fonts = [
+  //     "Merienda",
+  //     "M PLUS Code Latin",
+  //     "Figtree",
+  //     "Fira Code",
+  //     "Vollkorn",
+  //   ];
+
+  //   List<Widget> fTiles = [];
+  //   var added = [];
+
+  //   for (var f in fonts) {
+  //     if (added.contains(f)) continue;
+
+  //     Widget widget = PanelButton(
+  //       onPressed: () async {
+  //         settingsProvider.update(fontFamily: f);
+  //         setState(() {});
+  //       },
+  //       title: Text(
+  //         f,
+  //         style: GoogleFonts.getFont(
+  //           f,
+  //           color: AppColors.of(context).text.withOpacity(.95),
+  //           fontStyle: settingsProvider.renamedSubjectsItalics
+  //               ? FontStyle.italic
+  //               : FontStyle.normal,
+  //         ),
+  //       ),
+  //       trailing: settingsProvider.fontFamily == f
+  //           ? Icon(
+  //               FeatherIcons.chevronRight,
+  //               size: 22.0,
+  //               color: AppColors.of(context).text.withOpacity(0.95),
+  //             )
+  //           : null,
+  //       borderRadius: BorderRadius.circular(12.0),
+  //     );
+
+  //     fTiles.add(widget);
+  //     added.add(f);
+  //   }
+
+  //   fontTiles = fTiles;
+  // }
+
+  @override
+  Widget build(BuildContext context) {
+    settingsProvider = Provider.of<SettingsProvider>(context);
+    user = Provider.of<UserProvider>(context);
+
+    // get edited shit
+    editedShit = Provider.of<GradeProvider>(context, listen: false)
+        .grades
+        .where((e) => e.teacher.isRenamed || e.subject.isRenamed)
+        // .map((e) => e.subject)
+        .toSet()
+        .toList()
+      ..sort((a, b) => a.subject.name.compareTo(b.subject.name));
+
+    String themeModeText = {
+          ThemeMode.light: "light".i18n,
+          ThemeMode.dark: "dark".i18n,
+          ThemeMode.system: "system".i18n
+        }[settingsProvider.theme] ??
+        "?";
+
+    // build da tilés
+    buildSubjectTiles();
+    // buildFontTiles();
+
+    return AnimatedBuilder(
+      animation: _hideContainersController,
+      builder: (context, child) => Opacity(
+        opacity: 1 - _hideContainersController.value,
+        child: Scaffold(
+          appBar: AppBar(
+            surfaceTintColor: Theme.of(context).scaffoldBackgroundColor,
+            leading: BackButton(color: AppColors.of(context).text),
+            title: Text(
+              "personalization".i18n,
+              style: TextStyle(color: AppColors.of(context).text),
+            ),
+          ),
+          body: SingleChildScrollView(
+            child: Padding(
+              padding:
+                  const EdgeInsets.symmetric(vertical: 16.0, horizontal: 24.0),
+              child: Column(
+                children: [
+                  // app theme
+                  SplittedPanel(
+                    padding: const EdgeInsets.only(top: 8.0),
+                    cardPadding: const EdgeInsets.all(4.0),
+                    isSeparated: true,
+                    children: [
+                      PanelButton(
+                        onPressed: () {
+                          SettingsHelper.theme(context);
+                          setState(() {});
+                        },
+                        title: Text("theme".i18n),
+                        leading: Icon(
+                          FeatherIcons.sun,
+                          size: 22.0,
+                          color: AppColors.of(context).text.withOpacity(0.95),
+                        ),
+                        trailing: Text(
+                          themeModeText,
+                          style: const TextStyle(fontSize: 14.0),
+                        ),
+                        borderRadius: const BorderRadius.vertical(
+                          top: Radius.circular(12.0),
+                          bottom: Radius.circular(12.0),
+                        ),
+                      ),
+                    ],
+                  ),
+                  // color magic shit
+                  SplittedPanel(
+                    padding: const EdgeInsets.only(top: 9.0),
+                    cardPadding: const EdgeInsets.all(4.0),
+                    isSeparated: false,
+                    children: [
+                      PanelButton(
+                        padding: const EdgeInsets.only(left: 14.0, right: 14.0),
+                        onPressed: () async {
+                          await _hideContainersController.forward();
+                          SettingsHelper.accentColor(context);
+                          setState(() {});
+                          _hideContainersController.reset();
+                        },
+                        title: Text(
+                          "color".i18n,
+                          style: TextStyle(
+                            color: AppColors.of(context).text.withOpacity(.95),
+                          ),
+                        ),
+                        leading: Icon(
+                          FeatherIcons.droplet,
+                          size: 22.0,
+                          color: AppColors.of(context).text.withOpacity(.95),
+                        ),
+                        trailing: Container(
+                          width: 12.0,
+                          height: 12.0,
+                          decoration: BoxDecoration(
+                            color: Theme.of(context).colorScheme.secondary,
+                            shape: BoxShape.circle,
+                          ),
+                        ),
+                        borderRadius: const BorderRadius.vertical(
+                          top: Radius.circular(12.0),
+                          bottom: Radius.circular(4.0),
+                        ),
+                      ),
+                      const MenuPaintList(
+                        borderRadius: BorderRadius.vertical(
+                          top: Radius.circular(4.0),
+                          bottom: Radius.circular(12.0),
+                        ),
+                      ),
+                    ],
+                  ),
+                  // shadow toggle
+                  SplittedPanel(
+                    padding: const EdgeInsets.only(top: 9.0),
+                    cardPadding: const EdgeInsets.all(4.0),
+                    isSeparated: true,
+                    children: [
+                      PanelButton(
+                        padding: const EdgeInsets.only(left: 14.0, right: 6.0),
+                        onPressed: () async {
+                          settingsProvider.update(
+                              shadowEffect: !settingsProvider.shadowEffect);
+
+                          setState(() {});
+                        },
+                        title: Text(
+                          "shadow_effect".i18n,
+                          style: TextStyle(
+                            color: AppColors.of(context).text.withOpacity(
+                                settingsProvider.shadowEffect ? .95 : .25),
+                          ),
+                        ),
+                        leading: Icon(
+                          FeatherIcons.moon,
+                          size: 22.0,
+                          color: AppColors.of(context).text.withOpacity(
+                              settingsProvider.shadowEffect ? .95 : .25),
+                        ),
+                        trailing: Switch(
+                          onChanged: (v) async {
+                            settingsProvider.update(shadowEffect: v);
+
+                            setState(() {});
+                          },
+                          value: settingsProvider.shadowEffect,
+                          activeColor: Theme.of(context).colorScheme.secondary,
+                        ),
+                        borderRadius: const BorderRadius.vertical(
+                          top: Radius.circular(12.0),
+                          bottom: Radius.circular(12.0),
+                        ),
+                      ),
+                    ],
+                  ),
+                  // change subject icons
+                  SplittedPanel(
+                    padding: const EdgeInsets.only(top: 9.0),
+                    cardPadding: const EdgeInsets.all(4.0),
+                    isSeparated: true,
+                    children: [
+                      PanelButton(
+                        onPressed: () {
+                          SettingsHelper.iconPack(context);
+                        },
+                        title: Text(
+                          "icon_pack".i18n,
+                          style: TextStyle(
+                            color: AppColors.of(context).text.withOpacity(.95),
+                          ),
+                        ),
+                        leading: Icon(
+                          FeatherIcons.grid,
+                          size: 22.0,
+                          color: AppColors.of(context).text.withOpacity(.95),
+                        ),
+                        trailing: Text(
+                          settingsProvider.iconPack.name.capital(),
+                          style: const TextStyle(fontSize: 14.0),
+                        ),
+                        borderRadius: const BorderRadius.vertical(
+                          top: Radius.circular(12.0),
+                          bottom: Radius.circular(12.0),
+                        ),
+                      ),
+                    ],
+                  ),
+                  // grade colors
+                  SplittedPanel(
+                    padding: const EdgeInsets.only(top: 9.0),
+                    cardPadding: const EdgeInsets.all(4.0),
+                    isSeparated: true,
+                    children: [
+                      PanelButton(
+                        onPressed: () {
+                          SettingsHelper.gradeColors(context);
+                          setState(() {});
+                        },
+                        title: Text(
+                          "grade_colors".i18n,
+                          style: TextStyle(
+                            color: AppColors.of(context).text.withOpacity(.95),
+                          ),
+                        ),
+                        leading: Icon(
+                          FeatherIcons.star,
+                          size: 22.0,
+                          color: AppColors.of(context).text.withOpacity(.95),
+                        ),
+                        trailing: Row(
+                          mainAxisSize: MainAxisSize.min,
+                          children: List.generate(
+                            5,
+                            (i) => Container(
+                              margin: const EdgeInsets.only(left: 2.0),
+                              width: 12.0,
+                              height: 12.0,
+                              decoration: BoxDecoration(
+                                shape: BoxShape.circle,
+                                color: settingsProvider.gradeColors[i],
+                              ),
+                            ),
+                          ),
+                        ),
+                        borderRadius: const BorderRadius.vertical(
+                          top: Radius.circular(12.0),
+                          bottom: Radius.circular(12.0),
+                        ),
+                      ),
+                    ],
+                  ),
+                  // rename things
+                  SplittedPanel(
+                    padding: const EdgeInsets.only(top: 9.0),
+                    cardPadding: const EdgeInsets.all(4.0),
+                    isSeparated: false,
+                    children: [
+                      // rename subjects
+                      PanelButton(
+                        padding: const EdgeInsets.only(left: 14.0, right: 6.0),
+                        onPressed: () async {
+                          settingsProvider.update(
+                              renamedSubjectsEnabled:
+                                  !settingsProvider.renamedSubjectsEnabled);
+                          await Provider.of<GradeProvider>(context,
+                                  listen: false)
+                              .convertBySettings();
+                          await Provider.of<TimetableProvider>(context,
+                                  listen: false)
+                              .convertBySettings();
+                          await Provider.of<AbsenceProvider>(context,
+                                  listen: false)
+                              .convertBySettings();
+
+                          setState(() {});
+                        },
+                        title: Text(
+                          "rename_subjects".i18n,
+                          style: TextStyle(
+                            color: AppColors.of(context).text.withOpacity(
+                                settingsProvider.renamedSubjectsEnabled
+                                    ? .95
+                                    : .25),
+                          ),
+                        ),
+                        leading: Icon(
+                          Icons.school_outlined,
+                          size: 22.0,
+                          color: AppColors.of(context).text.withOpacity(
+                              settingsProvider.renamedSubjectsEnabled
+                                  ? .95
+                                  : .25),
+                        ),
+                        trailing: Switch(
+                          onChanged: (v) async {
+                            settingsProvider.update(renamedSubjectsEnabled: v);
+                            await Provider.of<GradeProvider>(context,
+                                    listen: false)
+                                .convertBySettings();
+                            await Provider.of<TimetableProvider>(context,
+                                    listen: false)
+                                .convertBySettings();
+                            await Provider.of<AbsenceProvider>(context,
+                                    listen: false)
+                                .convertBySettings();
+
+                            setState(() {});
+                          },
+                          value: settingsProvider.renamedSubjectsEnabled,
+                          activeColor: Theme.of(context).colorScheme.secondary,
+                        ),
+                        borderRadius: const BorderRadius.vertical(
+                          top: Radius.circular(12.0),
+                          bottom: Radius.circular(4.0),
+                        ),
+                      ),
+                      // rename teachers
+                      PanelButton(
+                        padding: const EdgeInsets.only(left: 14.0, right: 6.0),
+                        onPressed: () async {
+                          settingsProvider.update(
+                              renamedTeachersEnabled:
+                                  !settingsProvider.renamedTeachersEnabled);
+                          await Provider.of<GradeProvider>(context,
+                                  listen: false)
+                              .convertBySettings();
+                          await Provider.of<TimetableProvider>(context,
+                                  listen: false)
+                              .convertBySettings();
+                          await Provider.of<AbsenceProvider>(context,
+                                  listen: false)
+                              .convertBySettings();
+
+                          setState(() {});
+                        },
+                        title: Text(
+                          "rename_teachers".i18n,
+                          style: TextStyle(
+                            color: AppColors.of(context).text.withOpacity(
+                                settingsProvider.renamedTeachersEnabled
+                                    ? .95
+                                    : .25),
+                          ),
+                        ),
+                        leading: Icon(
+                          FeatherIcons.user,
+                          size: 22.0,
+                          color: AppColors.of(context).text.withOpacity(
+                              settingsProvider.renamedTeachersEnabled
+                                  ? .95
+                                  : .25),
+                        ),
+                        trailing: Switch(
+                          onChanged: (v) async {
+                            settingsProvider.update(renamedTeachersEnabled: v);
+                            await Provider.of<GradeProvider>(context,
+                                    listen: false)
+                                .convertBySettings();
+                            await Provider.of<TimetableProvider>(context,
+                                    listen: false)
+                                .convertBySettings();
+                            await Provider.of<AbsenceProvider>(context,
+                                    listen: false)
+                                .convertBySettings();
+
+                            setState(() {});
+                          },
+                          value: settingsProvider.renamedTeachersEnabled,
+                          activeColor: Theme.of(context).colorScheme.secondary,
+                        ),
+                        borderRadius: const BorderRadius.vertical(
+                          top: Radius.circular(4.0),
+                          bottom: Radius.circular(12.0),
+                        ),
+                      ),
+                    ],
+                  ),
+                  // live activity color
+                  if (Platform.isIOS)
+                    SplittedPanel(
+                      padding: const EdgeInsets.only(top: 9.0),
+                      cardPadding: const EdgeInsets.all(4.0),
+                      isSeparated: true,
+                      children: [
+                        PanelButton(
+                          onPressed: () {
+                            if (!Provider.of<PremiumProvider>(context,
+                                    listen: false)
+                                .hasScope(PremiumScopes.liveActivityColor)) {
+                              PremiumLockedFeatureUpsell.show(
+                                context: context,
+                                feature: PremiumFeature.liveActivity,
+                              );
+                              return;
+                            }
+
+                            SettingsHelper.liveActivityColor(context);
+                            setState(() {});
+                          },
+                          title: Text(
+                            "live_activity_color".i18n,
+                            style: TextStyle(
+                              color:
+                                  AppColors.of(context).text.withOpacity(.95),
+                            ),
+                          ),
+                          leading: Icon(
+                            FeatherIcons.activity,
+                            size: 22.0,
+                            color: AppColors.of(context).text.withOpacity(.95),
+                          ),
+                          trailing: Container(
+                            margin: const EdgeInsets.only(left: 2.0),
+                            width: 12.0,
+                            height: 12.0,
+                            decoration: BoxDecoration(
+                              shape: BoxShape.circle,
+                              color: settingsProvider.liveActivityColor,
+                            ),
+                          ),
+                          borderRadius: const BorderRadius.vertical(
+                            top: Radius.circular(12.0),
+                            bottom: Radius.circular(12.0),
+                          ),
+                        ),
+                      ],
+                    ),
+
+                  // SplittedPanel(
+                  //   padding: const EdgeInsets.only(top: 9.0),
+                  //   cardPadding: const EdgeInsets.all(4.0),
+                  //   isSeparated: true,
+                  //   children: [],
+                  // ),
+                  if (settingsProvider.renamedSubjectsEnabled ||
+                      settingsProvider.renamedTeachersEnabled)
+                    Column(
+                      children: [
+                        const SizedBox(
+                          height: 18.0,
+                        ),
+                        SplittedPanel(
+                          title: Text('subjects'.i18n),
+                          padding: EdgeInsets.zero,
+                          cardPadding: const EdgeInsets.all(4.0),
+                          children: tiles,
+                        ),
+                        const SizedBox(
+                          height: 9.0,
+                        ),
+                        SplittedPanel(
+                          padding: EdgeInsets.zero,
+                          cardPadding: const EdgeInsets.all(3.0),
+                          hasBorder: true,
+                          isTransparent: true,
+                          children: [
+                            DropdownButton2(
+                              items: otherShit
+                                  .map((item) => DropdownMenuItem<String>(
+                                        value: item.subject.id,
+                                        child: Text(
+                                          item.subject.name,
+                                          style: TextStyle(
+                                            fontSize: 14,
+                                            fontWeight: FontWeight.bold,
+                                            color: AppColors.of(context).text,
+                                          ),
+                                          overflow: TextOverflow.ellipsis,
+                                        ),
+                                      ))
+                                  .toList(),
+                              onChanged: (String? v) async {
+                                Navigator.of(context, rootNavigator: true).push(
+                                  CupertinoPageRoute(
+                                    builder: (context) => EditSubjectScreen(
+                                      subject: otherShit
+                                          .firstWhere((e) => e.subject.id == v)
+                                          .subject,
+                                      teacher: otherShit
+                                          .firstWhere((e) => e.subject.id == v)
+                                          .teacher,
+                                    ),
+                                  ),
+                                );
+
+                                setState(() {});
+                                // _subjectName.text = "";
+                              },
+                              iconSize: 14,
+                              iconEnabledColor: AppColors.of(context).text,
+                              iconDisabledColor: AppColors.of(context).text,
+                              underline: const SizedBox(),
+                              itemHeight: 40,
+                              itemPadding:
+                                  const EdgeInsets.only(left: 14, right: 14),
+                              buttonWidth: 50,
+                              dropdownWidth: 300,
+                              dropdownPadding: null,
+                              buttonDecoration: BoxDecoration(
+                                borderRadius: BorderRadius.circular(12.0),
+                              ),
+                              dropdownDecoration: BoxDecoration(
+                                borderRadius: BorderRadius.circular(14),
+                              ),
+                              dropdownElevation: 8,
+                              scrollbarRadius: const Radius.circular(40),
+                              scrollbarThickness: 6,
+                              scrollbarAlwaysShow: true,
+                              offset: const Offset(-10, -10),
+                              buttonSplashColor: Colors.transparent,
+                              customButton: PanelButton(
+                                title: Text(
+                                  "select_subject".i18n,
+                                  style: TextStyle(
+                                    color: AppColors.of(context)
+                                        .text
+                                        .withOpacity(.95),
+                                  ),
+                                ),
+                                leading: Icon(
+                                  FeatherIcons.plus,
+                                  size: 22.0,
+                                  color: AppColors.of(context)
+                                      .text
+                                      .withOpacity(.95),
+                                ),
+                                borderRadius: const BorderRadius.vertical(
+                                  top: Radius.circular(12.0),
+                                  bottom: Radius.circular(12.0),
+                                ),
+                              ),
+                            ),
+                          ],
+                        ),
+                      ],
+                    ),
+                  // custom fonts
+                  const SizedBox(
+                    height: 18.0,
+                  ),
+                  SplittedPanel(
+                    title: Text('fonts'.i18n),
+                    padding: EdgeInsets.zero,
+                    cardPadding: const EdgeInsets.all(4.0),
+                    isSeparated: true,
+                    children: [
+                      PanelButton(
+                        onPressed: () {
+                          SettingsHelper.fontFamily(context);
+                          setState(() {});
+                        },
+                        title: Text(
+                          "font_family".i18n,
+                          style: TextStyle(
+                            color: AppColors.of(context).text.withOpacity(.95),
+                          ),
+                        ),
+                        leading: Icon(
+                          FeatherIcons.type,
+                          size: 22.0,
+                          color: AppColors.of(context).text.withOpacity(.95),
+                        ),
+                        trailing: Text(
+                          settingsProvider.fontFamily != ''
+                              ? settingsProvider.fontFamily
+                              : 'Montserrat',
+                          style: GoogleFonts.getFont(
+                              settingsProvider.fontFamily != ''
+                                  ? settingsProvider.fontFamily
+                                  : 'Montserrat',
+                              fontSize: 14.0),
+                        ),
+                        borderRadius: const BorderRadius.vertical(
+                          top: Radius.circular(12.0),
+                          bottom: Radius.circular(12.0),
+                        ),
+                      ),
+                    ],
+                  ),
+                ],
+              ),
+            ),
+          ),
+        ),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/settings/submenu/submenu_screen.i18n.dart

@@ -0,0 +1,57 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension SettingsLocalization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          "general": "General",
+          "personalization": "Personalization",
+          "extras": "Extras",
+          "surprise_grades": "Surprise Grades",
+          "cancel": "Cancel",
+          "done": "Done",
+          "rarity_title": "Rarity Text",
+          // default rarities
+          "common": "Common",
+          "uncommon": "Uncommon",
+          "rare": "Rare",
+          "epic": "Epic",
+          "legendary": "Legendary",
+        },
+        "hu_hu": {
+          "general": "Általános",
+          "personalization": "Személyre szabás",
+          "extras": "Extrák",
+          "surprise_grades": "Meglepetés jegyek",
+          "cancel": "Mégse",
+          "done": "Kész",
+          "rarity_title": "Ritkaság szövege",
+          // default rarities
+          "common": "Gyakori",
+          "uncommon": "Nem gyakori",
+          "rare": "Ritka",
+          "epic": "Epikus",
+          "legendary": "Legendás",
+        },
+        "de_de": {
+          "general": "Allgemeine",
+          "personalization": "Personalisierung",
+          "extras": "Extras",
+          "surprise_grades": "Überraschende Noten",
+          "cancel": "Abbrechen",
+          "done": "Bereit",
+          "rarity_title": "Text zur Seltenheit",
+          // default rarities
+          "common": "Gemeinsam",
+          "uncommon": "Gelegentlich",
+          "rare": "Selten",
+          "epic": "Episch",
+          "legendary": "Legendär",
+        },
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}

refilc_mobile_ui/lib/screens/settings/theme_screen.dart

@@ -0,0 +1,996 @@
+// ignore_for_file: use_build_context_synchronously, deprecated_member_use
+
+import 'package:refilc/models/settings.dart';
+import 'package:refilc/models/shared_theme.dart';
+import 'package:refilc/theme/colors/accent.dart';
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:refilc/theme/observer.dart';
+import 'package:refilc/ui/widgets/grade/grade_tile.dart';
+import 'package:refilc/ui/widgets/message/message_tile.dart';
+import 'package:refilc_kreta_api/models/grade.dart';
+import 'package:refilc_kreta_api/models/homework.dart';
+import 'package:refilc_kreta_api/models/message.dart';
+import 'package:refilc_mobile_ui/common/action_button.dart';
+import 'package:refilc_mobile_ui/common/filter_bar.dart';
+import 'package:refilc_mobile_ui/common/panel/panel.dart';
+import 'package:refilc_mobile_ui/common/widgets/grade/new_grades.dart';
+import 'package:refilc_mobile_ui/common/widgets/homework/homework_tile.dart';
+// import 'package:refilc_plus/models/premium_scopes.dart';
+// import 'package:refilc_plus/providers/premium_provider.dart';
+import 'package:refilc_kreta_api/providers/share_provider.dart';
+import 'package:refilc/ui/flutter_colorpicker/colorpicker.dart';
+// import 'package:refilc_plus/ui/mobile/premium/upsell.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter/services.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'theme_screen.i18n.dart';
+import 'package:share_plus/share_plus.dart';
+
+class PremiumCustomAccentColorSetting extends StatefulWidget {
+  const PremiumCustomAccentColorSetting({super.key});
+
+  @override
+  State<PremiumCustomAccentColorSetting> createState() =>
+      _PremiumCustomAccentColorSettingState();
+}
+
+enum CustomColorMode {
+  theme,
+  saved,
+  accent,
+  background,
+  highlight,
+  icon,
+  enterId,
+}
+
+class _PremiumCustomAccentColorSettingState
+    extends State<PremiumCustomAccentColorSetting>
+    with TickerProviderStateMixin {
+  late final SettingsProvider settings;
+  late final ShareProvider shareProvider;
+  bool colorSelection = false;
+  bool customColorMenu = false;
+  CustomColorMode colorMode = CustomColorMode.theme;
+  final customColorInput = TextEditingController();
+  final unknownColor = Colors.black;
+
+  late TabController _testTabController;
+  late TabController _colorsTabController;
+  late AnimationController _openAnimController;
+
+  late final Animation<double> backgroundAnimation =
+      Tween<double>(begin: 0, end: 1).animate(
+    CurvedAnimation(
+      parent: _openAnimController,
+      curve: const Interval(0.2, 1.0, curve: Curves.easeInOut),
+    ),
+  );
+
+  late final Animation<double> fullPageAnimation =
+      Tween<double>(begin: 0, end: 1).animate(
+    CurvedAnimation(
+      parent: _openAnimController,
+      curve: const Interval(0.0, 0.6, curve: Curves.easeInOut),
+    ),
+  );
+
+  late final Animation<double> backContainerAnimation =
+      Tween<double>(begin: 100, end: 0).animate(
+    CurvedAnimation(
+      parent: _openAnimController,
+      curve: const Interval(0.0, 0.9, curve: Curves.easeInOut),
+    ),
+  );
+
+  late final Animation<double> backContentAnimation =
+      Tween<double>(begin: 100, end: 0).animate(
+    CurvedAnimation(
+      parent: _openAnimController,
+      curve: const Interval(0.2, 1.0, curve: Curves.easeInOut),
+    ),
+  );
+
+  late final Animation<double> backContentScaleAnimation =
+      Tween<double>(begin: 0.8, end: 0.9).animate(
+    CurvedAnimation(
+      parent: _openAnimController,
+      curve: const Interval(0.45, 1.0, curve: Curves.easeInOut),
+    ),
+  );
+
+  late final Animation<double> pickerContainerAnimation =
+      Tween<double>(begin: 0, end: 1).animate(
+    CurvedAnimation(
+      parent: _openAnimController,
+      curve: const Interval(0.25, 0.8, curve: Curves.easeInOut),
+    ),
+  );
+
+  @override
+  void initState() {
+    super.initState();
+    _colorsTabController = TabController(length: 4, vsync: this);
+    _testTabController = TabController(length: 4, vsync: this);
+    settings = Provider.of<SettingsProvider>(context, listen: false);
+    shareProvider = Provider.of<ShareProvider>(context, listen: false);
+
+    _openAnimController = AnimationController(
+        vsync: this, duration: const Duration(milliseconds: 750));
+    _openAnimController.forward();
+  }
+
+  @override
+  void dispose() {
+    _openAnimController.dispose();
+    super.dispose();
+  }
+
+  void setTheme(ThemeMode mode, bool store) async {
+    await settings.update(theme: mode, store: store);
+    Provider.of<ThemeModeObserver>(context, listen: false)
+        .changeTheme(mode, updateNavbarColor: false);
+  }
+
+  dynamic getCustomColor() {
+    switch (colorMode) {
+      case CustomColorMode.theme:
+        return accentColorMap[settings.accentColor];
+      case CustomColorMode.saved:
+        return [
+          settings.customBackgroundColor,
+          settings.customHighlightColor,
+          settings.customAccentColor
+        ];
+      case CustomColorMode.background:
+        return settings.customBackgroundColor;
+      case CustomColorMode.highlight:
+        return settings.customHighlightColor;
+      case CustomColorMode.accent:
+        return settings.customAccentColor;
+      case CustomColorMode.icon:
+        return settings.customIconColor;
+      case CustomColorMode.enterId:
+        // do nothing here lol
+        break;
+    }
+  }
+
+  void updateCustomColor(dynamic v, bool store,
+      {Color? accent, Color? background, Color? panels, Color? icon}) {
+    // reset custom theme id
+    settings.update(
+      currentThemeId: '',
+      currentThemeDisplayName: '',
+      currentThemeCreator: '',
+      store: store,
+    );
+
+    if (colorMode != CustomColorMode.theme) {
+      settings.update(accentColor: AccentColor.custom, store: store);
+    }
+    switch (colorMode) {
+      case CustomColorMode.theme:
+        settings.update(
+            accentColor: accentColorMap.keys.firstWhere(
+                (element) => accentColorMap[element] == v,
+                orElse: () => AccentColor.filc),
+            store: store);
+        settings.update(
+            customBackgroundColor: AppColors.of(context).background,
+            store: store);
+        settings.update(
+            customHighlightColor: AppColors.of(context).highlight,
+            store: store);
+        settings.update(customAccentColor: v, store: store);
+        break;
+      case CustomColorMode.saved:
+        settings.update(customBackgroundColor: v[0], store: store);
+        settings.update(customHighlightColor: v[1], store: store);
+        settings.update(customAccentColor: v[3], store: store);
+        break;
+      case CustomColorMode.background:
+        settings.update(customBackgroundColor: v, store: store);
+        break;
+      case CustomColorMode.highlight:
+        settings.update(customHighlightColor: v, store: store);
+        break;
+      case CustomColorMode.accent:
+        settings.update(customAccentColor: v, store: store);
+        break;
+      case CustomColorMode.icon:
+        settings.update(customIconColor: v, store: store);
+        break;
+      case CustomColorMode.enterId:
+        settings.update(customBackgroundColor: background, store: store);
+        settings.update(customHighlightColor: panels, store: store);
+        settings.update(customAccentColor: accent, store: store);
+        settings.update(customIconColor: icon, store: store);
+        break;
+    }
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    // bool hasAccess = Provider.of<PremiumProvider>(context)
+    //     .hasScope(PremiumScopes.customColors);
+    bool hasAccess = true;
+    bool isBackgroundDifferent = Theme.of(context).colorScheme.background !=
+        AppColors.of(context).background;
+
+    ThemeMode currentTheme = Theme.of(context).brightness == Brightness.light
+        ? ThemeMode.light
+        : ThemeMode.dark;
+
+    return WillPopScope(
+      onWillPop: () async {
+        Provider.of<ThemeModeObserver>(context, listen: false)
+            .changeTheme(settings.theme, updateNavbarColor: true);
+        return true;
+      },
+      child: AnimatedBuilder(
+        animation: _openAnimController,
+        builder: (context, child) {
+          final backgroundGradientBottomColor = isBackgroundDifferent
+              ? Theme.of(context).colorScheme.background
+              : HSVColor.fromColor(Theme.of(context).colorScheme.background)
+                  .withValue(currentTheme == ThemeMode.dark
+                      ? 0.1 * _openAnimController.value
+                      : 1.0 - (0.1 * _openAnimController.value))
+                  .withAlpha(1.0)
+                  .toColor();
+
+          SystemChrome.setSystemUIOverlayStyle(SystemUiOverlayStyle(
+            systemNavigationBarColor: backgroundGradientBottomColor,
+          ));
+
+          return Container(
+            decoration: BoxDecoration(
+              gradient: LinearGradient(
+                begin: Alignment.topCenter,
+                end: Alignment.bottomCenter,
+                stops: const [0.0, 0.75],
+                colors: isBackgroundDifferent
+                    ? [
+                        Theme.of(context).colorScheme.background.withOpacity(1 -
+                            ((currentTheme == ThemeMode.dark ? 0.65 : 0.25) *
+                                backgroundAnimation.value)),
+                        backgroundGradientBottomColor,
+                      ]
+                    : [
+                        backgroundGradientBottomColor,
+                        backgroundGradientBottomColor
+                      ],
+              ),
+            ),
+            child: Opacity(
+              opacity: fullPageAnimation.value,
+              child: Scaffold(
+                backgroundColor: Colors.transparent,
+                appBar: AppBar(
+                  surfaceTintColor: Theme.of(context).scaffoldBackgroundColor,
+                  leading: BackButton(color: AppColors.of(context).text),
+                  actions: [
+                    Padding(
+                      padding: const EdgeInsets.only(right: 10.0),
+                      child: IconButton(
+                        focusColor: Colors.transparent,
+                        highlightColor: Colors.transparent,
+                        splashColor: Colors.transparent,
+                        onPressed: () async {
+                          // ScaffoldMessenger.of(context).showSnackBar(
+                          //   const SnackBar(
+                          //     duration: Duration(milliseconds: 1000),
+                          //     content: Text(
+                          //       "Hamarosan...",
+                          //     ),
+                          //   ),
+                          // );
+                          showDialog(
+                            context: context,
+                            builder: (context) => WillPopScope(
+                              onWillPop: () async => false,
+                              child: AlertDialog(
+                                shape: RoundedRectangleBorder(
+                                    borderRadius: BorderRadius.circular(12.0)),
+                                title: Text("attention".i18n),
+                                content: Text("share_disclaimer".i18n),
+                                actions: [
+                                  ActionButton(
+                                    label: "understand".i18n,
+                                    onTap: () async {
+                                      Navigator.of(context).pop();
+
+                                      SharedGradeColors gradeColors =
+                                          await shareProvider
+                                              .shareCurrentGradeColors(context);
+                                      SharedTheme theme =
+                                          await shareProvider.shareCurrentTheme(
+                                        context,
+                                        gradeColors: gradeColors,
+                                      );
+
+                                      Share.share(
+                                        theme.id,
+                                        subject: 'share_subj_theme'.i18n,
+                                      );
+                                    },
+                                  ),
+                                ],
+                              ),
+                            ),
+                          );
+                        },
+                        icon: const Icon(
+                          FeatherIcons.share2,
+                          size: 22.0,
+                        ),
+                      ),
+                    ),
+                  ],
+                  title: Text(
+                    "theme_prev".i18n,
+                    style: TextStyle(color: AppColors.of(context).text),
+                  ),
+                  backgroundColor: Colors.transparent,
+                  elevation: 0,
+                ),
+                body: Stack(
+                  children: [
+                    Opacity(
+                      opacity: 1 - backContainerAnimation.value * (1 / 100),
+                      child: Transform.translate(
+                        offset: Offset(0, backContainerAnimation.value),
+                        child: Container(
+                          height: double.infinity,
+                          width: double.infinity,
+                          decoration: BoxDecoration(
+                            borderRadius: BorderRadius.circular(24),
+                            gradient: LinearGradient(
+                                // https://discord.com/channels/1111649116020285532/1153619667848548452
+                                begin: Alignment.topCenter,
+                                end: Alignment.bottomCenter,
+                                stops: const [
+                                  0.35,
+                                  0.75
+                                ],
+                                colors: [
+                                  settings.customBackgroundColor ??
+                                      Theme.of(context).colorScheme.background,
+                                  isBackgroundDifferent
+                                      ? HSVColor.fromColor(Theme.of(context)
+                                              .colorScheme
+                                              .background)
+                                          .withSaturation((HSVColor.fromColor(
+                                                          Theme.of(context)
+                                                              .colorScheme
+                                                              .background)
+                                                      .saturation -
+                                                  0.15)
+                                              .clamp(0.0, 1.0))
+                                          .toColor()
+                                      : backgroundGradientBottomColor,
+                                ]),
+                          ),
+                          margin: const EdgeInsets.symmetric(
+                              vertical: 30, horizontal: 20),
+                        ),
+                      ),
+                    ),
+                    Padding(
+                      padding: const EdgeInsets.only(top: 8.0),
+                      child: SizedBox(
+                        width: double.infinity,
+                        child: Padding(
+                          padding: const EdgeInsets.only(top: 24.0),
+                          child: Opacity(
+                            opacity: 1 - backContentAnimation.value * (1 / 100),
+                            child: SingleChildScrollView(
+                              physics: const BouncingScrollPhysics(),
+                              child: Transform.translate(
+                                offset:
+                                    Offset(0, -24 + backContentAnimation.value),
+                                child: Transform.scale(
+                                  scale: backContentScaleAnimation.value,
+                                  child: Column(
+                                    children: [
+                                      Padding(
+                                        padding: const EdgeInsets.only(
+                                          left: 32.0,
+                                          right: 32.0,
+                                          top: 16.0,
+                                          bottom: 6.0,
+                                        ),
+                                        child: FilterBar(
+                                          items: const [
+                                            Tab(text: "All"),
+                                            Tab(text: "Grades"),
+                                            Tab(text: "Messages"),
+                                            Tab(text: "Absences"),
+                                          ],
+                                          controller: _testTabController,
+                                          padding: EdgeInsets.zero,
+                                          censored: true,
+                                          disableFading: true,
+                                        ),
+                                      ),
+                                      Padding(
+                                        padding: const EdgeInsets.symmetric(
+                                            horizontal: 18.0, vertical: 8.0),
+                                        child: NewGradesSurprise(
+                                          [
+                                            Grade.fromJson(
+                                              {
+                                                "Uid": "0,Ertekeles",
+                                                "RogzitesDatuma":
+                                                    "2022-01-01T23:00:00Z",
+                                                "KeszitesDatuma":
+                                                    "2022-01-01T23:00:00Z",
+                                                "LattamozasDatuma": null,
+                                                "Tantargy": {
+                                                  "Uid": "0",
+                                                  "Nev": "reFilc szakirodalom",
+                                                  "Kategoria": {
+                                                    "Uid": "0,_",
+                                                    "Nev": "_",
+                                                    "Leiras": "Nem mondom meg"
+                                                  },
+                                                  "SortIndex": 2
+                                                },
+                                                "Tema":
+                                                    "Kupak csomag vásárlás vizsga",
+                                                "Tipus": {
+                                                  "Uid": "0,_",
+                                                  "Nev": "_",
+                                                  "Leiras":
+                                                      "Évközi jegy/értékelés",
+                                                },
+                                                "Mod": {
+                                                  "Uid": "0,_",
+                                                  "Nev": "_",
+                                                  "Leiras": "_ feladat",
+                                                },
+                                                "ErtekFajta": {
+                                                  "Uid": "1,Osztalyzat",
+                                                  "Nev": "Osztalyzat",
+                                                  "Leiras":
+                                                      "Elégtelen (1) és Jeles (5) között az öt alapértelmezett érték"
+                                                },
+                                                "ErtekeloTanarNeve": "Premium",
+                                                "Jelleg": "Ertekeles",
+                                                "SzamErtek": 5,
+                                                "SzovegesErtek": "Jeles(5)",
+                                                "SulySzazalekErteke": 100,
+                                                "SzovegesErtekelesRovidNev":
+                                                    null,
+                                                "OsztalyCsoport": {"Uid": "0"},
+                                                "SortIndex": 2
+                                              },
+                                            ),
+                                          ],
+                                          censored: true,
+                                        ),
+                                      ),
+                                      Padding(
+                                        padding: const EdgeInsets.symmetric(
+                                            horizontal: 24.0, vertical: 6.0),
+                                        child: Panel(
+                                          child: GradeTile(
+                                            Grade.fromJson(
+                                              {
+                                                "Uid": "0,Ertekeles",
+                                                "RogzitesDatuma":
+                                                    "2022-01-01T23:00:00Z",
+                                                "KeszitesDatuma":
+                                                    "2022-01-01T23:00:00Z",
+                                                "LattamozasDatuma": null,
+                                                "Tantargy": {
+                                                  "Uid": "0",
+                                                  "Nev": "reFilc szakosztály",
+                                                  "Kategoria": {
+                                                    "Uid": "0,_",
+                                                    "Nev": "_",
+                                                    "Leiras": "Nem mondom meg"
+                                                  },
+                                                  "SortIndex": 2
+                                                },
+                                                "Tema":
+                                                    "Kupak csomag vásárlás vizsga",
+                                                "Tipus": {
+                                                  "Uid": "0,_",
+                                                  "Nev": "_",
+                                                  "Leiras":
+                                                      "Évközi jegy/értékelés",
+                                                },
+                                                "Mod": {
+                                                  "Uid": "0,_",
+                                                  "Nev": "_",
+                                                  "Leiras": "_ feladat",
+                                                },
+                                                "ErtekFajta": {
+                                                  "Uid": "1,Osztalyzat",
+                                                  "Nev": "Osztalyzat",
+                                                  "Leiras":
+                                                      "Elégtelen (1) és Jeles (5) között az öt alapértelmezett érték"
+                                                },
+                                                "ErtekeloTanarNeve": "Premium",
+                                                "Jelleg": "Ertekeles",
+                                                "SzamErtek": 5,
+                                                "SzovegesErtek": "Jeles(5)",
+                                                "SulySzazalekErteke": 100,
+                                                "SzovegesErtekelesRovidNev":
+                                                    null,
+                                                "OsztalyCsoport": {"Uid": "0"},
+                                                "SortIndex": 2
+                                              },
+                                            ),
+                                            padding: EdgeInsets.zero,
+                                            censored: true,
+                                          ),
+                                        ),
+                                      ),
+                                      Padding(
+                                        padding: const EdgeInsets.symmetric(
+                                            horizontal: 24.0, vertical: 6.0),
+                                        child: Panel(
+                                          child: HomeworkTile(
+                                            Homework.fromJson(
+                                              {
+                                                "Uid": "0",
+                                                "Tantargy": {
+                                                  "Uid": "0",
+                                                  "Nev":
+                                                      "reFilc premium előnyei",
+                                                  "Kategoria": {
+                                                    "Uid": "0,_",
+                                                    "Nev": "_",
+                                                    "Leiras":
+                                                        "reFilc premium előnyei",
+                                                  },
+                                                  "SortIndex": 0
+                                                },
+                                                "TantargyNeve":
+                                                    "reFilc premium előnyei",
+                                                "RogzitoTanarNeve":
+                                                    "Kupak János",
+                                                "Szoveg":
+                                                    "45 perc filctollal való rajzolás",
+                                                "FeladasDatuma":
+                                                    "2022-01-01T23:00:00Z",
+                                                "HataridoDatuma":
+                                                    "2022-01-01T23:00:00Z",
+                                                "RogzitesIdopontja":
+                                                    "2022-01-01T23:00:00Z",
+                                                "IsTanarRogzitette": true,
+                                                "IsTanuloHaziFeladatEnabled":
+                                                    false,
+                                                "IsMegoldva": false,
+                                                "IsBeadhato": false,
+                                                "OsztalyCsoport": {"Uid": "0"},
+                                                "IsCsatolasEngedelyezes": false
+                                              },
+                                            ),
+                                            padding: EdgeInsets.zero,
+                                            censored: true,
+                                          ),
+                                        ),
+                                      ),
+                                      Padding(
+                                        padding: const EdgeInsets.symmetric(
+                                            horizontal: 24.0, vertical: 6.0),
+                                        child: Panel(
+                                          child: MessageTile(
+                                            Message.fromJson(
+                                              {
+                                                "azonosito": 0,
+                                                "isElolvasva": true,
+                                                "isToroltElem": false,
+                                                "tipus": {
+                                                  "azonosito": 1,
+                                                  "kod": "BEERKEZETT",
+                                                  "rovidNev":
+                                                      "Beérkezett üzenet",
+                                                  "nev": "Beérkezett üzenet",
+                                                  "leiras": "Beérkezett üzenet"
+                                                },
+                                                "uzenet": {
+                                                  "azonosito": 0,
+                                                  "kuldesDatum":
+                                                      "2022-01-01T23:00:00",
+                                                  "feladoNev": "reFilc",
+                                                  "feladoTitulus":
+                                                      "Nagyon magas szintű személy",
+                                                  "szoveg":
+                                                      "<p>Kedves Felhasználó!</p><p><br></p><p>A prémium vásárlásakor kapott filctollal 90%-al több esély van jó jegyek szerzésére.</p>",
+                                                  "targy":
+                                                      "Filctoll használati útmutató",
+                                                  "statusz": {
+                                                    "azonosito": 2,
+                                                    "kod": "KIKULDVE",
+                                                    "rovidNev": "Kiküldve",
+                                                    "nev": "Kiküldve",
+                                                    "leiras": "Kiküldve"
+                                                  },
+                                                  "cimzettLista": [
+                                                    {
+                                                      "azonosito": 0,
+                                                      "kretaAzonosito": 0,
+                                                      "nev": "Tinta Józsi",
+                                                      "tipus": {
+                                                        "azonosito": 0,
+                                                        "kod": "TANULO",
+                                                        "rovidNev": "Tanuló",
+                                                        "nev": "Tanuló",
+                                                        "leiras": "Tanuló"
+                                                      }
+                                                    },
+                                                  ],
+                                                  "csatolmanyok": [
+                                                    {
+                                                      "azonosito": 0,
+                                                      "fajlNev": "Filctoll.doc"
+                                                    }
+                                                  ]
+                                                }
+                                              },
+                                            ),
+                                            censored: true,
+                                            padding: const EdgeInsets.only(
+                                              right: 6.0,
+                                            ),
+                                          ),
+                                        ),
+                                      ),
+                                    ],
+                                  ),
+                                ),
+                              ),
+                            ),
+                          ),
+                        ),
+                      ),
+                    ),
+                    Align(
+                      alignment: Alignment.bottomCenter,
+                      child: Wrap(
+                        children: [
+                          Opacity(
+                            opacity: pickerContainerAnimation.value,
+                            child: SizedBox(
+                              width: double.infinity,
+                              child: Container(
+                                padding: const EdgeInsets.only(bottom: 12.0),
+                                decoration: BoxDecoration(
+                                  boxShadow: [
+                                    BoxShadow(
+                                      color: backgroundGradientBottomColor,
+                                      offset: const Offset(0, -8),
+                                      blurRadius: 16,
+                                      spreadRadius: 18,
+                                    ),
+                                  ],
+                                  gradient: LinearGradient(
+                                      begin: Alignment.topCenter,
+                                      end: Alignment.bottomCenter,
+                                      stops: const [
+                                        0.0,
+                                        0.175
+                                      ],
+                                      colors: [
+                                        backgroundGradientBottomColor,
+                                        backgroundGradientBottomColor,
+                                      ]),
+                                ),
+                                child: Column(
+                                  children: [
+                                    Padding(
+                                      padding: const EdgeInsets.symmetric(
+                                          horizontal: 8.0),
+                                      child: FilterBar(
+                                        items: [
+                                          ColorTab(
+                                              color: accentColorMap[
+                                                      settings.accentColor] ??
+                                                  unknownColor,
+                                              tab: Tab(
+                                                  text: "colorpicker_presets"
+                                                      .i18n)),
+                                          // ColorTab(
+                                          //     color: unknownColor,
+                                          //     tab: Tab(text: "enter_id".i18n)),
+                                          /*ColorTab(
+                                              color:
+                                                  settings.customAccentColor ??
+                                                      unknownColor,
+                                              tab: Tab(
+                                                  text: "colorpicker_saved"
+                                                      .i18n)),*/
+                                          ColorTab(
+                                              unlocked: hasAccess,
+                                              color: settings
+                                                      .customBackgroundColor ??
+                                                  unknownColor,
+                                              tab: Tab(
+                                                  text: "colorpicker_background"
+                                                      .i18n)),
+                                          ColorTab(
+                                              unlocked: hasAccess,
+                                              color: settings
+                                                      .customHighlightColor ??
+                                                  unknownColor,
+                                              tab: Tab(
+                                                  text: "colorpicker_panels"
+                                                      .i18n)),
+                                          ColorTab(
+                                              unlocked: hasAccess,
+                                              color:
+                                                  settings.customAccentColor ??
+                                                      unknownColor,
+                                              tab: Tab(
+                                                  text: "colorpicker_accent"
+                                                      .i18n)),
+                                          // ColorTab(
+                                          //     unlocked: hasAccess,
+                                          //     color: settings.customIconColor ??
+                                          //         unknownColor,
+                                          //     tab: Tab(
+                                          //         text:
+                                          //             "colorpicker_icon".i18n)),
+                                        ],
+                                        onTap: (index) {
+                                          // if (!hasAccess) {
+                                          //   index = 0;
+                                          //   _colorsTabController.animateTo(0,
+                                          //       duration: Duration.zero);
+
+                                          //   PremiumLockedFeatureUpsell.show(
+                                          //       context: context,
+                                          //       feature: PremiumFeature
+                                          //           .customcolors);
+                                          // }
+
+                                          switch (index) {
+                                            case 0:
+                                              setState(() {
+                                                colorMode =
+                                                    CustomColorMode.theme;
+                                              });
+                                              break;
+                                            // case 1:
+                                            //   setState(() {
+                                            //     colorMode =
+                                            //         CustomColorMode.enterId;
+                                            //   });
+                                            //   break;
+                                            /*case 1:
+                                              setState(() {
+                                                colorMode =
+                                                    CustomColorMode.saved;
+                                              });
+                                              break;*/
+                                            case 1:
+                                              setState(() {
+                                                colorMode =
+                                                    CustomColorMode.background;
+                                              });
+                                              break;
+                                            case 2:
+                                              setState(() {
+                                                colorMode =
+                                                    CustomColorMode.highlight;
+                                              });
+                                              break;
+                                            case 3:
+                                              setState(() {
+                                                colorMode =
+                                                    CustomColorMode.accent;
+                                              });
+                                              break;
+                                            case 4:
+                                              setState(() {
+                                                colorMode =
+                                                    CustomColorMode.icon;
+                                              });
+                                              break;
+                                          }
+                                        },
+                                        controller: _colorsTabController,
+                                        padding: EdgeInsets.zero,
+                                      ),
+                                    ),
+                                    Padding(
+                                      padding: const EdgeInsets.symmetric(
+                                          horizontal: 12.0),
+                                      child: SafeArea(
+                                        child: FilcColorPicker(
+                                          colorMode: colorMode,
+                                          pickerColor: colorMode ==
+                                                  CustomColorMode.accent
+                                              ? settings.customAccentColor ??
+                                                  unknownColor
+                                              : colorMode ==
+                                                      CustomColorMode.background
+                                                  ? settings
+                                                          .customBackgroundColor ??
+                                                      unknownColor
+                                                  : colorMode ==
+                                                          CustomColorMode.theme
+                                                      ? (accentColorMap[settings
+                                                              .accentColor] ??
+                                                          AppColors.of(context)
+                                                              .text) // idk what else
+                                                      : colorMode ==
+                                                              CustomColorMode
+                                                                  .highlight
+                                                          ? settings
+                                                                  .customHighlightColor ??
+                                                              unknownColor
+                                                          : settings
+                                                                  .customIconColor ??
+                                                              unknownColor,
+                                          onColorChanged: (c) {
+                                            setState(() {
+                                              updateCustomColor(c, false);
+                                            });
+                                            setTheme(settings.theme, false);
+                                          },
+                                          onColorChangeEnd: (c, {adaptive}) {
+                                            setState(() {
+                                              if (adaptive == true) {
+                                                settings.update(
+                                                    accentColor:
+                                                        AccentColor.adaptive);
+                                                settings.update(
+                                                    customBackgroundColor:
+                                                        AppColors.of(context)
+                                                            .background,
+                                                    store: true);
+                                                settings.update(
+                                                    customHighlightColor:
+                                                        AppColors.of(context)
+                                                            .highlight,
+                                                    store: true);
+                                                settings.update(
+                                                    customIconColor:
+                                                        const Color(0x00000000),
+                                                    store: true);
+                                              } else {
+                                                updateCustomColor(c, true);
+                                              }
+                                            });
+                                            setTheme(settings.theme, true);
+                                          },
+                                          onThemeIdProvided: (theme) {
+                                            // changing grade colors
+                                            List<Color> colors = [
+                                              theme.gradeColors.oneColor,
+                                              theme.gradeColors.twoColor,
+                                              theme.gradeColors.threeColor,
+                                              theme.gradeColors.fourColor,
+                                              theme.gradeColors.fiveColor,
+                                            ];
+                                            settings.update(
+                                                gradeColors: colors);
+
+                                            // changing shadow effect
+                                            settings.update(
+                                                shadowEffect:
+                                                    theme.shadowEffect);
+
+                                            // changing theme
+                                            setState(() {
+                                              updateCustomColor(
+                                                null,
+                                                true,
+                                                accent: theme.accentColor,
+                                                background:
+                                                    theme.backgroundColor,
+                                                panels: theme.panelsColor,
+                                                icon: theme.iconColor,
+                                              );
+                                            });
+                                            setTheme(settings.theme, true);
+                                          },
+                                        ),
+                                      ),
+                                    ),
+                                  ],
+                                ),
+                              ),
+                            ),
+                          ),
+                        ],
+                      ),
+                    ),
+                  ],
+                ),
+              ),
+            ),
+          );
+        },
+      ),
+    );
+  }
+}
+
+class ColorTab extends StatelessWidget {
+  const ColorTab(
+      {super.key,
+      required this.tab,
+      required this.color,
+      this.unlocked = true});
+
+  final Tab tab;
+  final Color color;
+  final bool unlocked;
+
+  @override
+  Widget build(BuildContext context) {
+    return Row(
+      crossAxisAlignment: CrossAxisAlignment.center,
+      children: [
+        Transform.translate(
+          offset: const Offset(-3, 1),
+          child: unlocked
+              ? Container(
+                  width: 15,
+                  height: 15,
+                  decoration: BoxDecoration(
+                    shape: BoxShape.circle,
+                    color: color,
+                    border: Border.all(color: Colors.black, width: 2.0),
+                  ),
+                )
+              : const Padding(
+                  padding: EdgeInsets.symmetric(horizontal: 2),
+                  child: Icon(Icons.lock,
+                      color: Color.fromARGB(255, 82, 82, 82), size: 18),
+                ),
+        ),
+        tab
+      ],
+    );
+  }
+}
+
+class PremiumColorPickerItem extends StatelessWidget {
+  const PremiumColorPickerItem(
+      {super.key, required this.label, this.onTap, required this.color});
+
+  final String label;
+  final void Function()? onTap;
+  final Color color;
+
+  @override
+  Widget build(BuildContext context) {
+    return Material(
+      type: MaterialType.transparency,
+      child: InkWell(
+        onTap: onTap,
+        child: Padding(
+          padding: const EdgeInsets.symmetric(vertical: 12.0, horizontal: 24.0),
+          child: Row(
+            mainAxisAlignment: MainAxisAlignment.spaceBetween,
+            children: [
+              Expanded(
+                child: Text(
+                  label,
+                  style: TextStyle(
+                      color: AppColors.of(context).text,
+                      fontWeight: FontWeight.w500),
+                ),
+              ),
+              Container(
+                width: 30,
+                height: 30,
+                decoration: BoxDecoration(
+                    color: color, shape: BoxShape.circle, border: Border.all()),
+              ),
+            ],
+          ),
+        ),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/settings/theme_screen.i18n.dart

@@ -0,0 +1,67 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension SettingsLocalization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          "theme_prev": "Preview",
+          "colorpicker_presets": "Presets",
+          "colorpicker_background": "Background",
+          "colorpicker_panels": "Panels",
+          "colorpicker_accent": "Accent",
+          "colorpicker_icon": "Icon",
+          "need_sub": "You need Kupak subscription to use modify this.",
+          "advanced": "Advanced",
+          "enter_id": "Enter ID",
+          "theme_id": "Theme ID...",
+          "theme_not_found": "Theme not found!",
+          "attention": "Attention!",
+          "share_disclaimer":
+              "By sharing the theme, you agree that the nickname you set and all settings of the theme will be shared publicly.",
+          "understand": "I understand",
+          "share_subj_theme": "Share Theme",
+        },
+        "hu_hu": {
+          "theme_prev": "Előnézet",
+          "colorpicker_presets": "Téma",
+          "colorpicker_background": "Háttér",
+          "colorpicker_panels": "Panelek",
+          "colorpicker_accent": "Színtónus",
+          "colorpicker_icon": "Ikon",
+          "need_sub": "A módosításhoz Kupak szintű támogatás szükséges.",
+          "advanced": "Haladó",
+          "enter_id": "ID megadása",
+          "theme_id": "Téma azonosító...",
+          "theme_not_found": "A téma nem található!",
+          "attention": "Figyelem!",
+          "share_disclaimer":
+              "A téma megosztásával elfogadod, hogy az általad beállított becenév és a téma minden beállítása nyilvánosan megosztásra kerüljön.",
+          "understand": "Értem",
+          "share_subj_theme": "Téma Megosztás",
+        },
+        "de_de": {
+          "theme_prev": "Vorschau",
+          "colorpicker_presets": "Farben",
+          "colorpicker_background": "Hintergrund",
+          "colorpicker_panels": "Tafeln",
+          "colorpicker_accent": "Akzent",
+          "colorpicker_icon": "Ikone",
+          "need_sub":
+              "Sie benötigen ein Kupak-Abonnement, um diese Funktion zu ändern.",
+          "advanced": "Fortschrittlich",
+          "enter_id": "Geben Sie die ID ein",
+          "theme_id": "Themen-ID...",
+          "theme_not_found": "Thema nicht gefunden!",
+          "attention": "Achtung!",
+          "share_disclaimer":
+              "Durch das Teilen des Themes erklären Sie sich damit einverstanden, dass der von Ihnen festgelegte Spitzname und alle Einstellungen des Themes öffentlich geteilt werden.",
+          "understand": "Ich verstehe",
+          "share_subj_theme": "Thema Teilen",
+        },
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}

refilc_mobile_ui/lib/screens/settings/user/nickname.dart

@@ -0,0 +1,105 @@
+import 'package:refilc/api/providers/database_provider.dart';
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc/models/user.dart';
+import 'package:refilc_mobile_ui/common/bottom_sheet_menu/bottom_sheet_menu_item.dart';
+// import 'package:refilc_plus/models/premium_scopes.dart';
+// import 'package:refilc_plus/providers/premium_provider.dart';
+// import 'package:refilc_plus/ui/mobile/premium/upsell.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:refilc_mobile_ui/screens/settings/settings_screen.i18n.dart';
+import 'package:provider/provider.dart';
+
+// ignore: must_be_immutable
+class UserMenuNickname extends StatelessWidget {
+  late User u;
+
+  UserMenuNickname(this.u, {super.key});
+
+  @override
+  Widget build(BuildContext context) {
+    return BottomSheetMenuItem(
+      onPressed: () {
+        // if (!Provider.of<PremiumProvider>(context, listen: false)
+        //     .hasScope(PremiumScopes.nickname)) {
+        //   PremiumLockedFeatureUpsell.show(
+        //       context: context, feature: PremiumFeature.profile);
+        //   return;
+        // }
+        showDialog(
+            context: context, builder: (context) => UserNicknameEditor(u));
+      },
+      icon: const Icon(FeatherIcons.edit2),
+      title: Text("edit_nickname".i18n),
+    );
+  }
+}
+
+// ignore: must_be_immutable
+class UserNicknameEditor extends StatefulWidget {
+  late User u;
+
+  UserNicknameEditor(this.u, {super.key});
+
+  @override
+  State<UserNicknameEditor> createState() => _UserNicknameEditorState();
+}
+
+class _UserNicknameEditorState extends State<UserNicknameEditor> {
+  final _userName = TextEditingController();
+  late final UserProvider user;
+
+  @override
+  void initState() {
+    super.initState();
+    user = Provider.of<UserProvider>(context, listen: false);
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return AlertDialog(
+      title: Text("change_username".i18n),
+      content: TextField(
+        controller: _userName,
+        autofocus: true,
+        decoration: InputDecoration(
+          border: const OutlineInputBorder(),
+          label: Text(widget.u.name),
+          suffixIcon: IconButton(
+            icon: const Icon(FeatherIcons.x),
+            onPressed: () {
+              setState(() {
+                _userName.text = "";
+              });
+            },
+          ),
+        ),
+      ),
+      actions: [
+        TextButton(
+          child: Text(
+            "cancel".i18n,
+            style: const TextStyle(fontWeight: FontWeight.w500),
+          ),
+          onPressed: () {
+            Navigator.of(context).maybePop();
+          },
+        ),
+        TextButton(
+          child: Text(
+            "done".i18n,
+            style: const TextStyle(fontWeight: FontWeight.w500),
+          ),
+          onPressed: () {
+            widget.u.nickname = _userName.text.trim();
+            Provider.of<DatabaseProvider>(context, listen: false)
+                .store
+                .storeUser(widget.u);
+            Provider.of<UserProvider>(context, listen: false).refresh();
+            Navigator.of(context).pop(true);
+          },
+        ),
+      ],
+    );
+  }
+}

refilc_mobile_ui/lib/screens/settings/user/profile_pic.dart

@@ -0,0 +1,236 @@
+// ignore_for_file: use_build_context_synchronously
+
+import 'dart:convert';
+import 'dart:developer';
+import 'dart:io';
+
+import 'package:refilc/api/providers/database_provider.dart';
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc/models/user.dart';
+import 'package:refilc_mobile_ui/common/bottom_sheet_menu/bottom_sheet_menu_item.dart';
+// import 'package:refilc_plus/models/premium_scopes.dart';
+// import 'package:refilc_plus/providers/premium_provider.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter/services.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:refilc_mobile_ui/screens/settings/settings_screen.i18n.dart';
+import 'package:provider/provider.dart';
+import 'package:image_picker/image_picker.dart';
+import 'package:image_crop/image_crop.dart';
+
+// ignore: must_be_immutable
+class UserMenuProfilePic extends StatelessWidget {
+  late User u;
+
+  UserMenuProfilePic(this.u, {super.key});
+
+  @override
+  Widget build(BuildContext context) {
+    // if (!Provider.of<PremiumProvider>(context)
+    //     .hasScope(PremiumScopes.nickname)) {
+    //   return const SizedBox();
+    // }
+
+    return BottomSheetMenuItem(
+      onPressed: () {
+        showDialog(
+            context: context, builder: (context) => UserProfilePicEditor(u));
+      },
+      icon: const Icon(FeatherIcons.camera),
+      title: Text("edit_profile_picture".i18n),
+    );
+  }
+}
+
+// ignore: must_be_immutable
+class UserProfilePicEditor extends StatefulWidget {
+  late User u;
+
+  UserProfilePicEditor(this.u, {super.key});
+
+  @override
+  State<UserProfilePicEditor> createState() => _UserProfilePicEditorState();
+}
+
+class _UserProfilePicEditorState extends State<UserProfilePicEditor> {
+  late final UserProvider user;
+
+  final cropKey = GlobalKey<CropState>();
+  File? _file;
+  File? _sample;
+  File? _lastCropped;
+
+  File? image;
+  Future pickImage() async {
+    try {
+      final image = await ImagePicker().pickImage(source: ImageSource.gallery);
+      if (image == null) return;
+      File imageFile = File(image.path);
+
+      final sample = await ImageCrop.sampleImage(
+        file: imageFile,
+        preferredSize: context.size!.longestSide.ceil(),
+      );
+
+      _sample?.delete();
+      _file?.delete();
+
+      setState(() {
+        _sample = sample;
+        _file = imageFile;
+      });
+    } on PlatformException catch (e) {
+      log('Failed to pick image: $e');
+    }
+  }
+
+  Widget cropImageWidget() {
+    return SizedBox(
+      height: 300,
+      child: Crop.file(
+        _sample!,
+        key: cropKey,
+        aspectRatio: 1.0,
+      ),
+    );
+  }
+
+  Widget openImageWidget() {
+    return InkWell(
+      customBorder: RoundedRectangleBorder(
+        borderRadius: BorderRadius.circular(14.0),
+      ),
+      onTap: () => pickImage(),
+      child: Container(
+        decoration: BoxDecoration(
+          border: Border.all(color: Colors.grey),
+          borderRadius: BorderRadius.circular(14.0),
+        ),
+        width: double.infinity,
+        padding: const EdgeInsets.symmetric(vertical: 32.0, horizontal: 8.0),
+        child: Column(
+          children: [
+            Text(
+              "click_here".i18n,
+              style: const TextStyle(
+                fontSize: 22.0,
+                fontWeight: FontWeight.w600,
+              ),
+            ),
+            Text(
+              "select_profile_picture".i18n,
+              style: const TextStyle(
+                fontSize: 14.0,
+                fontWeight: FontWeight.w500,
+              ),
+            )
+          ],
+        ),
+      ),
+    );
+  }
+
+  Future<void> _cropImage() async {
+    final scale = cropKey.currentState!.scale;
+    final area = cropKey.currentState!.area;
+    if (area == null || _file == null) {
+      return;
+    }
+
+    final sample = await ImageCrop.sampleImage(
+      file: _file!,
+      preferredSize: (2000 / scale).round(),
+    );
+
+    final file = await ImageCrop.cropImage(
+      file: sample,
+      area: area,
+    );
+
+    sample.delete();
+
+    _lastCropped?.delete();
+    _lastCropped = file;
+
+    List<int> imageBytes = await _lastCropped!.readAsBytes();
+    String base64Image = base64Encode(imageBytes);
+    widget.u.picture = base64Image;
+    Provider.of<DatabaseProvider>(context, listen: false)
+        .store
+        .storeUser(widget.u);
+    Provider.of<UserProvider>(context, listen: false).refresh();
+
+    debugPrint('$file');
+  }
+
+  @override
+  void initState() {
+    super.initState();
+    user = Provider.of<UserProvider>(context, listen: false);
+  }
+
+  @override
+  void dispose() {
+    super.dispose();
+    _file?.delete();
+    _sample?.delete();
+    _lastCropped?.delete();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return AlertDialog(
+      shape: const RoundedRectangleBorder(
+          borderRadius: BorderRadius.all(Radius.circular(14.0))),
+      contentPadding: const EdgeInsets.only(top: 10.0),
+      title: Text("edit_profile_picture".i18n),
+      content: Column(
+        mainAxisSize: MainAxisSize.min,
+        children: [
+          Padding(
+            padding:
+                const EdgeInsets.symmetric(vertical: 12.0, horizontal: 24.0),
+            child: _sample == null ? openImageWidget() : cropImageWidget(),
+          ),
+          if (widget.u.picture != "")
+            TextButton(
+              child: Text(
+                "remove_profile_picture".i18n,
+                style: const TextStyle(
+                    fontWeight: FontWeight.w500, color: Colors.red),
+              ),
+              onPressed: () {
+                widget.u.picture = "";
+                Provider.of<DatabaseProvider>(context, listen: false)
+                    .store
+                    .storeUser(widget.u);
+                Provider.of<UserProvider>(context, listen: false).refresh();
+                Navigator.of(context).pop(true);
+              },
+            ),
+        ],
+      ),
+      actions: [
+        TextButton(
+          child: Text(
+            "cancel".i18n,
+            style: const TextStyle(fontWeight: FontWeight.w500),
+          ),
+          onPressed: () {
+            Navigator.of(context).maybePop();
+          },
+        ),
+        TextButton(
+          child: Text(
+            "done".i18n,
+            style: const TextStyle(fontWeight: FontWeight.w500),
+          ),
+          onPressed: () async {
+            await _cropImage();
+            Navigator.of(context).pop(true);
+          },
+        ),
+      ],
+    );
+  }
+}

refilc_mobile_ui/lib/screens/summary/pages/allsum_page.dart

@@ -0,0 +1,231 @@
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc_kreta_api/models/absence.dart';
+import 'package:refilc_kreta_api/models/grade.dart';
+import 'package:refilc_kreta_api/models/subject.dart';
+import 'package:refilc_kreta_api/providers/absence_provider.dart';
+import 'package:refilc_kreta_api/providers/grade_provider.dart';
+import 'package:refilc_kreta_api/providers/homework_provider.dart';
+import 'package:refilc_mobile_ui/screens/summary/summary_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+
+class AllSumBody extends StatefulWidget {
+  const AllSumBody({super.key});
+
+  @override
+  AllSumBodyState createState() => AllSumBodyState();
+}
+
+class AllSumBodyState extends State<AllSumBody> {
+  late UserProvider user;
+  late GradeProvider gradeProvider;
+  late HomeworkProvider homeworkProvider;
+  late AbsenceProvider absenceProvider;
+  //late TimetableProvider timetableProvider;
+
+  late Map<String, Map<String, dynamic>> things = {};
+  late List<Widget> firstSixTiles = [];
+  late List<Widget> lastSixTiles = [];
+
+  int avgDropValue = 0;
+  bool animation = false;
+
+  List<Grade> getSubjectGrades(GradeSubject subject, {int days = 0}) =>
+      gradeProvider.grades
+          .where((e) =>
+              e.subject == subject &&
+              e.type == GradeType.midYear &&
+              (days == 0 ||
+                  e.date
+                      .isBefore(DateTime.now().subtract(Duration(days: days)))))
+          .toList();
+
+  @override
+  void initState() {
+    super.initState();
+
+    gradeProvider = Provider.of<GradeProvider>(context, listen: false);
+    homeworkProvider = Provider.of<HomeworkProvider>(context, listen: false);
+    absenceProvider = Provider.of<AbsenceProvider>(context, listen: false);
+    //timetableProvider = Provider.of<TimetableProvider>(context, listen: false);
+
+    WidgetsBinding.instance.addPostFrameCallback((timeStamp) {
+      setState(() {
+        animation = true;
+      });
+    });
+  }
+
+  void getGrades() {
+    var allGrades = gradeProvider.grades;
+    var testsGrades = gradeProvider.grades.where((a) => a.value.weight == 100);
+    var closingTestsGrades =
+        gradeProvider.grades.where((a) => a.value.weight >= 200);
+
+    things.addAll({
+      'tests': {'name': 'test'.i18n, 'value': testsGrades.length},
+      'closingTests': {
+        'name': 'closingtest'.i18n,
+        'value': closingTestsGrades.length
+      },
+      'grades': {'name': 'grade'.i18n, 'value': allGrades.length}
+    });
+  }
+
+  void getHomework() {
+    var allHomework = homeworkProvider.homework;
+
+    things.addAll({
+      'homework': {'name': 'hw'.i18n, 'value': allHomework.length}
+    });
+  }
+
+  void getSubjects() {
+    var allSubjects = gradeProvider.grades
+        .map((e) => e.subject)
+        .toSet()
+        .toList()
+      ..sort((a, b) => a.name.compareTo(b.name));
+    //var totalLessons;
+    var totalLessons = 0;
+
+    things.addAll({
+      'subjects': {'name': 'subject'.i18n, 'value': allSubjects.length},
+      'lessons': {'name': 'lesson'.i18n, 'value': totalLessons}
+    });
+  }
+
+  void getAbsences() {
+    var allAbsences = absenceProvider.absences.where((a) => a.delay == 0);
+    var excusedAbsences = absenceProvider.absences
+        .where((a) => a.state == Justification.excused && a.delay == 0);
+    var unexcusedAbsences = absenceProvider.absences.where((a) =>
+        (a.state == Justification.unexcused ||
+            a.state == Justification.pending) &&
+        a.delay == 0);
+
+    things.addAll({
+      'absences': {'name': 'absence_sum'.i18n, 'value': allAbsences.length},
+      'excusedAbsences': {
+        'name': 'excused'.i18n,
+        'value': excusedAbsences.length
+      },
+      'unexcusedAbsences': {
+        'name': 'unexcused'.i18n,
+        'value': unexcusedAbsences.length
+      }
+    });
+  }
+
+  void getDelays() {
+    var allDelays = absenceProvider.absences.where((a) => a.delay > 0);
+    var delayTimeList = (allDelays.map((a) {
+      return a.delay;
+    }).toList());
+    var totalDelayTime = 0;
+    if (delayTimeList.isNotEmpty) {
+      totalDelayTime = delayTimeList.reduce((a, b) => a + b);
+    }
+    var unexcusedDelays = absenceProvider.absences
+        .where((a) => a.state == Justification.unexcused && a.delay > 0);
+
+    things.addAll({
+      'delays': {'name': 'delay_sum'.i18n, 'value': allDelays.length},
+      'totalDelay': {'name': 'min'.i18n, 'value': totalDelayTime},
+      'unexcusedDelays': {
+        'name': 'unexcused'.i18n,
+        'value': unexcusedDelays.length
+      }
+    });
+  }
+
+  void getEverything() {
+    getGrades();
+    getHomework();
+    getSubjects();
+    getAbsences();
+    getDelays();
+  }
+
+  void generateTiles() {
+    for (var i in things.values) {
+      Widget w = Column(
+        mainAxisAlignment: MainAxisAlignment.center,
+        crossAxisAlignment: CrossAxisAlignment.center,
+        children: [
+          Text(
+            i.values.toList()[1].toString(),
+            textAlign: TextAlign.center,
+            style: const TextStyle(
+              fontWeight: FontWeight.w800,
+              fontSize: 36.0,
+              color: Colors.white,
+            ),
+          ),
+          Text(
+            i.values.toList()[0],
+            textAlign: TextAlign.center,
+            style: const TextStyle(
+              fontSize: 18.0,
+              color: Colors.white,
+            ),
+          ),
+        ],
+      );
+
+      // TO-DO: az orakat es a hazikat szarul keri le, de majd meg lesz csinalva
+      if (firstSixTiles.length < 6) {
+        firstSixTiles.add(w);
+      } else if (lastSixTiles.length < 6) {
+        lastSixTiles.add(w);
+      } else {
+        break;
+      }
+    }
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    getEverything();
+    generateTiles();
+
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.center,
+      mainAxisAlignment: MainAxisAlignment.center,
+      children: [
+        const SizedBox(
+          height: 45,
+        ),
+        AnimatedContainer(
+          curve: Curves.easeInOut,
+          duration: const Duration(milliseconds: 420),
+          transform: Matrix4.translationValues(
+              animation ? 0 : MediaQuery.of(context).size.width, 0, 0),
+          height: 250,
+          child: GridView.count(
+            crossAxisCount: 3,
+            mainAxisSpacing: 0,
+            crossAxisSpacing: 5,
+            children: firstSixTiles,
+          ),
+        ),
+        const SizedBox(
+          height: 30,
+        ),
+        AnimatedContainer(
+          curve: Curves.easeInOut,
+          duration: const Duration(milliseconds: 420),
+          transform: Matrix4.translationValues(
+              animation ? 0 : -MediaQuery.of(context).size.width, 0, 0),
+          height: 250,
+          child: GridView.count(
+            crossAxisCount: 3,
+            mainAxisSpacing: 0,
+            crossAxisSpacing: 5,
+            children: lastSixTiles,
+          ),
+        ),
+      ],
+    );
+  }
+}

refilc_mobile_ui/lib/screens/summary/pages/grades_page.dart

@@ -0,0 +1,363 @@
+import 'dart:math';
+
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc/helpers/average_helper.dart';
+import 'package:refilc/models/settings.dart';
+import 'package:refilc/ui/widgets/grade/grade_tile.dart';
+import 'package:refilc/utils/format.dart';
+import 'package:refilc_kreta_api/models/grade.dart';
+import 'package:refilc_kreta_api/models/subject.dart';
+import 'package:refilc_kreta_api/providers/grade_provider.dart';
+import 'package:refilc_mobile_ui/screens/summary/summary_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import 'package:auto_size_text/auto_size_text.dart';
+import 'package:i18n_extension/i18n_widget.dart';
+
+List<String> faces = [
+  "(·.·)",
+  "(≥o≤)",
+  "(·_·)",
+  "(˚Δ˚)b",
+  "(^-^*)",
+  "(='X'=)",
+  "(>_<)",
+  "(;-;)",
+  "\\(^Д^)/",
+  "\\(o_o)/",
+];
+
+class GradesBody extends StatefulWidget {
+  const GradesBody({super.key});
+
+  @override
+  GradesBodyState createState() => GradesBodyState();
+}
+
+class GradesBodyState extends State<GradesBody> {
+  late UserProvider user;
+  late GradeProvider gradeProvider;
+  late SettingsProvider settings;
+
+  late double subjectAvg;
+  late double endYearAvg;
+  late String endYearAvgText;
+
+  List<Widget> subjectTiles5 = [];
+  List<Widget> subjectTiles3 = [];
+  List<Widget> subjectTiles1 = [];
+
+  int avgDropValue = 0;
+  bool animation = false;
+
+  List<Grade> getSubjectGrades(GradeSubject subject, {int days = 0}) =>
+      gradeProvider.grades
+          .where((e) =>
+              e.subject == subject &&
+              e.type == GradeType.midYear &&
+              (days == 0 ||
+                  e.date
+                      .isBefore(DateTime.now().subtract(Duration(days: days)))))
+          .toList();
+
+  @override
+  void initState() {
+    super.initState();
+
+    gradeProvider = Provider.of<GradeProvider>(context, listen: false);
+    settings = Provider.of<SettingsProvider>(context, listen: false);
+
+    WidgetsBinding.instance.addPostFrameCallback((timeStamp) {
+      setState(() {
+        animation = true;
+      });
+    });
+  }
+
+  void generateTiles({required int filter}) {
+    List<GradeSubject> subjects = gradeProvider.grades
+        .map((e) => e.subject)
+        .toSet()
+        .toList()
+      ..sort((a, b) => a.name.compareTo(b.name));
+    List<Widget> tiles = [];
+
+    Map<GradeSubject, double> subjectAvgs = {};
+
+    var count = 1;
+
+    for (GradeSubject subject in subjects) {
+      List<Grade> subjectGrades = getSubjectGrades(subject);
+
+      double avg = AverageHelper.averageEvals(subjectGrades);
+      if (avg != 0) subjectAvgs[subject] = avg;
+
+      Widget widget = AnimatedContainer(
+        curve: Curves.easeInOut,
+        duration: Duration(milliseconds: 300 + (count * 120)),
+        transform: Matrix4.translationValues(
+            animation ? 0 : MediaQuery.of(context).size.width, 0, 0),
+        child: Row(
+          children: [
+            GradeValueWidget(
+              GradeValue(avg.round(), '', '', 100),
+              fill: true,
+              size: 28.0,
+            ),
+            const SizedBox(width: 8),
+            Text(
+              subject.renamedTo ?? subject.name.capital(),
+              maxLines: 2,
+              overflow: TextOverflow.ellipsis,
+              style: TextStyle(
+                fontWeight: FontWeight.bold,
+                fontSize: 20.0,
+                color: Colors.white.withOpacity(0.98),
+                fontStyle: settings.renamedSubjectsItalics && subject.isRenamed
+                    ? FontStyle.italic
+                    : null,
+              ),
+            )
+          ],
+        ),
+      );
+
+      if (avg.round() == filter) {
+        tiles.add(widget);
+        count++;
+      }
+    }
+
+    if (tiles.isEmpty) {
+      int index = Random(DateTime.now().minute).nextInt(faces.length);
+      Widget faceWidget = Center(
+        child: Text.rich(
+          TextSpan(
+            text: faces[index],
+            style: const TextStyle(
+              fontSize: 32.0,
+              fontWeight: FontWeight.w500,
+              color: Colors.white,
+            ),
+            children: [
+              TextSpan(
+                text: "\n${'no_grades'.i18n}",
+                style: TextStyle(
+                    fontSize: 18.0,
+                    height: 2.0,
+                    color: Colors.white.withOpacity(0.5)),
+              ),
+            ],
+          ),
+          textAlign: TextAlign.center,
+        ),
+      );
+      tiles.insert(0, faceWidget);
+    }
+
+    subjectAvg = subjectAvgs.isNotEmpty
+        ? subjectAvgs.values.fold(0.0, (double a, double b) => a + b) /
+            subjectAvgs.length
+        : 0.0;
+
+    List<Grade> endYearGrades = gradeProvider.grades
+        .where((grade) => grade.type == GradeType.endYear)
+        .toList();
+    endYearAvg = AverageHelper.averageEvals(endYearGrades, finalAvg: true);
+    endYearAvgText = endYearAvg.toStringAsFixed(1);
+    if (I18n.of(context).locale.languageCode != "en") {
+      endYearAvgText = endYearAvgText.replaceAll(".", ",");
+    }
+
+    if (filter == 5) {
+      subjectTiles5 = List.castFrom(tiles);
+      if (subjectTiles5.length > 4) {
+        subjectTiles5.length = 4;
+      }
+    } else if (filter == 3) {
+      subjectTiles3 = List.castFrom(tiles);
+      if (subjectTiles3.length > 3) {
+        subjectTiles3.length = 3;
+      }
+    } else if (filter == 1) {
+      subjectTiles1 = List.castFrom(tiles);
+      if (subjectTiles1.length > 2) {
+        subjectTiles1.length = 2;
+      }
+    }
+  }
+
+  void getGrades() {
+    generateTiles(filter: 5);
+    generateTiles(filter: 3);
+    generateTiles(filter: 1);
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    user = Provider.of<UserProvider>(context);
+    settings = Provider.of<SettingsProvider>(context);
+
+    getGrades();
+
+    return Expanded(
+      child: ListView(
+        children: [
+          SizedBox(
+            height: ((100 * subjectTiles5.length) /
+                    (subjectTiles5[0].runtimeType == AnimatedContainer
+                        ? 1.95
+                        : 1.2))
+                .toDouble(),
+            child: ListView.builder(
+              padding: const EdgeInsets.only(left: 5),
+              physics: const BouncingScrollPhysics(),
+              itemCount: max(subjectTiles5.length, 1),
+              itemBuilder: (context, index) {
+                if (subjectTiles5.isNotEmpty) {
+                  EdgeInsetsGeometry panelPadding =
+                      const EdgeInsets.symmetric(horizontal: 24.0);
+
+                  if (subjectTiles5[index].runtimeType == AnimatedContainer) {
+                    return Padding(
+                        padding: const EdgeInsets.only(top: 8),
+                        child: subjectTiles5[index]);
+                  } else {
+                    return Padding(
+                        padding: panelPadding, child: subjectTiles5[index]);
+                  }
+                } else {
+                  return Container();
+                }
+              },
+            ),
+          ),
+          const SizedBox(height: 12.0),
+          Text(
+            'tryagain'.i18n,
+            style: const TextStyle(
+              fontWeight: FontWeight.bold,
+              fontSize: 22.0,
+              color: Colors.white,
+            ),
+          ),
+          const SizedBox(height: 12.0),
+          SizedBox(
+            height: ((100 * subjectTiles3.length) /
+                    (subjectTiles3[0].runtimeType == AnimatedContainer
+                        ? 1.95
+                        : 1.2))
+                .toDouble(),
+            child: ListView.builder(
+              padding: const EdgeInsets.only(left: 5),
+              physics: const BouncingScrollPhysics(),
+              itemCount: max(subjectTiles3.length, 1),
+              itemBuilder: (context, index) {
+                if (subjectTiles3.isNotEmpty) {
+                  EdgeInsetsGeometry panelPadding =
+                      const EdgeInsets.symmetric(horizontal: 24.0);
+
+                  if (subjectTiles3[index].runtimeType == AnimatedContainer) {
+                    return Padding(
+                        padding: const EdgeInsets.only(top: 8),
+                        child: subjectTiles3[index]);
+                  } else {
+                    return Padding(
+                        padding: panelPadding, child: subjectTiles3[index]);
+                  }
+                } else {
+                  return Container();
+                }
+              },
+            ),
+          ),
+          const SizedBox(height: 12.0),
+          Text(
+            'oops'.i18n,
+            style: const TextStyle(
+              fontWeight: FontWeight.bold,
+              fontSize: 22.0,
+              color: Colors.white,
+            ),
+          ),
+          const SizedBox(height: 12.0),
+          SizedBox(
+            height: ((100 * subjectTiles1.length) /
+                    (subjectTiles1[0].runtimeType == AnimatedContainer
+                        ? 1.95
+                        : 1.2))
+                .toDouble(),
+            child: ListView.builder(
+              padding: const EdgeInsets.only(left: 5),
+              physics: const BouncingScrollPhysics(),
+              itemCount: max(subjectTiles1.length, 1),
+              itemBuilder: (context, index) {
+                if (subjectTiles1.isNotEmpty) {
+                  EdgeInsetsGeometry panelPadding =
+                      const EdgeInsets.symmetric(horizontal: 24.0);
+
+                  if (subjectTiles1[index].runtimeType == AnimatedContainer) {
+                    return Padding(
+                        padding: const EdgeInsets.only(top: 8),
+                        child: subjectTiles1[index]);
+                  } else {
+                    return Padding(
+                        padding: panelPadding, child: subjectTiles1[index]);
+                  }
+                } else {
+                  return Container();
+                }
+              },
+            ),
+          ),
+          const SizedBox(height: 30.0),
+          Center(
+            child: Column(
+              mainAxisAlignment: MainAxisAlignment.center,
+              crossAxisAlignment: CrossAxisAlignment.center,
+              children: [
+                Text(
+                  'endyear_avg'.i18n,
+                  textAlign: TextAlign.center,
+                  style: const TextStyle(
+                    fontWeight: FontWeight.bold,
+                    fontSize: 22.0,
+                    color: Colors.white,
+                  ),
+                ),
+                Container(
+                  margin: const EdgeInsets.only(top: 10.0),
+                  padding: const EdgeInsets.symmetric(
+                      horizontal: 16.0, vertical: 4.0),
+                  decoration: BoxDecoration(
+                    color: gradeColor(context: context, value: endYearAvg)
+                        .withOpacity(.2),
+                    border: Border.all(
+                      color: (gradeColor(context: context, value: endYearAvg))
+                          .withOpacity(0.0),
+                      width: 2.0,
+                    ),
+                    borderRadius: BorderRadius.circular(45.0),
+                  ),
+                  child: AutoSizeText.rich(
+                    TextSpan(
+                      text: endYearAvgText,
+                    ),
+                    maxLines: 1,
+                    minFontSize: 5,
+                    textAlign: TextAlign.center,
+                    style: TextStyle(
+                      color: gradeColor(context: context, value: endYearAvg),
+                      fontWeight: FontWeight.w800,
+                      fontSize: 32.0,
+                    ),
+                  ),
+                ),
+              ],
+            ),
+          ),
+        ],
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/summary/pages/lessons_page.dart

@@ -0,0 +1,321 @@
+// ignore_for_file: no_leading_underscores_for_local_identifiers
+
+import 'dart:math';
+
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc/helpers/subject.dart';
+import 'package:refilc/models/settings.dart';
+import 'package:refilc/utils/format.dart';
+import 'package:refilc_kreta_api/models/absence.dart';
+import 'package:refilc_kreta_api/models/lesson.dart';
+import 'package:refilc_kreta_api/models/subject.dart';
+import 'package:refilc_kreta_api/models/week.dart';
+import 'package:refilc_kreta_api/providers/absence_provider.dart';
+import 'package:refilc_kreta_api/providers/timetable_provider.dart';
+import 'package:refilc_mobile_ui/screens/summary/summary_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+
+List<String> faces = [
+  "(·.·)",
+  "(≥o≤)",
+  "(·_·)",
+  "(˚Δ˚)b",
+  "(^-^*)",
+  "(='X'=)",
+  "(>_<)",
+  "(;-;)",
+  "\\(^Д^)/",
+  "\\(o_o)/",
+];
+
+class SubjectAbsence {
+  GradeSubject subject;
+  List<Absence> absences;
+  double percentage;
+
+  SubjectAbsence(
+      {required this.subject, this.absences = const [], this.percentage = 0.0});
+}
+
+class LessonsBody extends StatefulWidget {
+  const LessonsBody({super.key});
+
+  @override
+  LessonsBodyState createState() => LessonsBodyState();
+}
+
+class LessonsBodyState extends State<LessonsBody> {
+  late UserProvider user;
+  late AbsenceProvider absenceProvider;
+  late SettingsProvider settingsProvider;
+  late TimetableProvider timetableProvider;
+
+  late List<SubjectAbsence> absences = [];
+  late List<Widget> lessons = [];
+  late List<Absence> delays = [];
+  final Map<GradeSubject, Lesson> _lessonCount = {};
+
+  @override
+  void initState() {
+    super.initState();
+
+    absenceProvider = Provider.of<AbsenceProvider>(context, listen: false);
+    settingsProvider = Provider.of<SettingsProvider>(context, listen: false);
+    timetableProvider = Provider.of<TimetableProvider>(context, listen: false);
+
+    WidgetsBinding.instance.addPostFrameCallback((timeStamp) async {
+      for (final lesson in timetableProvider.getWeek(Week.current()) ?? []) {
+        if (!lesson.isEmpty &&
+            lesson.subject.id != '' &&
+            lesson.lessonYearIndex != null) {
+          _lessonCount.update(
+            lesson.subject,
+            (value) {
+              if (lesson.lessonYearIndex! > value.lessonYearIndex!) {
+                return lesson;
+              } else {
+                return value;
+              }
+            },
+            ifAbsent: () => lesson,
+          );
+        }
+      }
+      setState(() {});
+    });
+  }
+
+  void buildSubjectAbsences() {
+    Map<GradeSubject, SubjectAbsence> _absences = {};
+
+    for (final absence in absenceProvider.absences) {
+      if (absence.delay != 0) continue;
+
+      if (!_absences.containsKey(absence.subject)) {
+        _absences[absence.subject] =
+            SubjectAbsence(subject: absence.subject, absences: [absence]);
+      } else {
+        _absences[absence.subject]?.absences.add(absence);
+      }
+    }
+
+    _absences.forEach((subject, absence) {
+      final absentLessonsOfSubject = absenceProvider.absences
+          .where((e) => e.subject == subject && e.delay == 0)
+          .length;
+      final totalLessonsOfSubject = _lessonCount[subject]?.lessonYearIndex ?? 0;
+
+      double absentLessonsOfSubjectPercentage;
+
+      if (absentLessonsOfSubject <= totalLessonsOfSubject) {
+        absentLessonsOfSubjectPercentage =
+            absentLessonsOfSubject / totalLessonsOfSubject * 100;
+      } else {
+        absentLessonsOfSubjectPercentage = -1;
+      }
+
+      _absences[subject]?.percentage =
+          absentLessonsOfSubjectPercentage.clamp(-1, 100.0);
+    });
+
+    absences = _absences.values.toList();
+    absences.sort((a, b) => -a.percentage.compareTo(b.percentage));
+  }
+
+  void getAndSortDelays() {
+    delays = absenceProvider.absences;
+    delays.sort((a, b) => -a.delay.compareTo(b.delay));
+  }
+
+  void generateTiles() {
+    Widget leastAbsent = Center(
+      child: Column(
+        mainAxisAlignment: MainAxisAlignment.center,
+        crossAxisAlignment: CrossAxisAlignment.center,
+        children: [
+          Icon(
+            SubjectIcon.resolveVariant(
+                subject: absences.last.subject, context: context),
+            color: Colors.white,
+            size: 64,
+          ),
+          Text(
+            absences.last.subject.renamedTo ??
+                absences.last.subject.name.capital(),
+            maxLines: 2,
+            overflow: TextOverflow.ellipsis,
+            style: TextStyle(
+              fontWeight: FontWeight.w800,
+              fontSize: 36.0,
+              fontStyle: absences.last.subject.isRenamed &&
+                      settingsProvider.renamedSubjectsItalics
+                  ? FontStyle.italic
+                  : null,
+              color: Colors.white,
+            ),
+          ),
+          Text(
+            'absence'.i18n.fill([absences.last.absences.length]),
+            style: const TextStyle(
+              fontSize: 18.0,
+              color: Colors.white,
+            ),
+          )
+        ],
+      ),
+    );
+    if (absences.last.absences.isNotEmpty) {
+      lessons.add(leastAbsent);
+    } else {
+      lessons.add(buildFaceWidget());
+    }
+
+    Widget mostAbsent = Center(
+      child: Column(
+        mainAxisAlignment: MainAxisAlignment.center,
+        crossAxisAlignment: CrossAxisAlignment.center,
+        children: [
+          Icon(
+            SubjectIcon.resolveVariant(
+                subject: absences.first.subject, context: context),
+            color: Colors.white,
+            size: 64,
+          ),
+          Text(
+            absences.first.subject.renamedTo ??
+                absences.first.subject.name.capital(),
+            maxLines: 2,
+            overflow: TextOverflow.ellipsis,
+            style: TextStyle(
+              fontWeight: FontWeight.w800,
+              fontSize: 36.0,
+              fontStyle: absences.first.subject.isRenamed &&
+                      settingsProvider.renamedSubjectsItalics
+                  ? FontStyle.italic
+                  : null,
+              color: Colors.white,
+            ),
+          ),
+          Text(
+            'absence'.i18n.fill([absences.first.absences.length]),
+            style: const TextStyle(
+              fontSize: 18.0,
+              color: Colors.white,
+            ),
+          )
+        ],
+      ),
+    );
+    if (absences.first.absences.isNotEmpty) {
+      lessons.add(mostAbsent);
+    } else {
+      lessons.add(buildFaceWidget());
+    }
+
+    Widget mostDelays = Center(
+      child: Column(
+        mainAxisAlignment: MainAxisAlignment.center,
+        crossAxisAlignment: CrossAxisAlignment.center,
+        children: [
+          Icon(
+            SubjectIcon.resolveVariant(
+                subject: delays.first.subject, context: context),
+            color: Colors.white,
+            size: 64,
+          ),
+          Text(
+            delays.first.subject.renamedTo ??
+                delays.first.subject.name.capital(),
+            maxLines: 2,
+            overflow: TextOverflow.ellipsis,
+            style: TextStyle(
+              fontWeight: FontWeight.w800,
+              fontSize: 36.0,
+              fontStyle: delays.first.subject.isRenamed &&
+                      settingsProvider.renamedSubjectsItalics
+                  ? FontStyle.italic
+                  : null,
+              color: Colors.white,
+            ),
+          ),
+          Text(
+            'delay'.i18n.fill([delays.first.delay]),
+            style: const TextStyle(
+              fontSize: 18.0,
+              color: Colors.white,
+            ),
+          )
+        ],
+      ),
+    );
+    if (delays.first.delay != 0) {
+      lessons.add(mostDelays);
+    } else {
+      lessons.add(buildFaceWidget());
+    }
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    buildSubjectAbsences();
+    getAndSortDelays();
+    generateTiles();
+
+    return Expanded(
+      child: ListView(
+        children: [
+          lessons[0],
+          const SizedBox(height: 18.0),
+          Text(
+            'dontfelt'.i18n,
+            style: const TextStyle(
+              fontWeight: FontWeight.bold,
+              fontSize: 22.0,
+              color: Colors.white,
+            ),
+          ),
+          const SizedBox(height: 18.0),
+          lessons[1],
+          const SizedBox(height: 18.0),
+          Text(
+            'youlate'.i18n,
+            style: const TextStyle(
+              fontWeight: FontWeight.bold,
+              fontSize: 22.0,
+              color: Colors.white,
+            ),
+          ),
+          const SizedBox(height: 18.0),
+          lessons[2],
+        ],
+      ),
+    );
+  }
+
+  Widget buildFaceWidget() {
+    int index = Random(DateTime.now().minute).nextInt(faces.length);
+    return Center(
+      child: Text.rich(
+        TextSpan(
+          text: faces[index],
+          style: const TextStyle(
+            fontSize: 32.0,
+            fontWeight: FontWeight.w500,
+            color: Colors.white,
+          ),
+          children: [
+            TextSpan(
+              text: "\n${'no_lesson'.i18n}",
+              style: TextStyle(
+                  fontSize: 18.0,
+                  height: 2.0,
+                  color: Colors.white.withOpacity(0.5)),
+            ),
+          ],
+        ),
+        textAlign: TextAlign.center,
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/summary/pages/personality_page.dart

@@ -0,0 +1,128 @@
+import 'dart:io';
+
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc_mobile_ui/common/personality_card/empty_card.dart';
+import 'package:refilc_mobile_ui/common/personality_card/personality_card.dart';
+import 'package:refilc_mobile_ui/screens/summary/summary_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'package:screenshot/screenshot.dart';
+import 'package:share_plus/share_plus.dart';
+import 'package:path_provider/path_provider.dart';
+import 'package:image_gallery_saver/image_gallery_saver.dart';
+
+class PersonalityBody extends StatefulWidget {
+  const PersonalityBody({super.key});
+
+  @override
+  PersonalityBodyState createState() => PersonalityBodyState();
+}
+
+class PersonalityBodyState extends State<PersonalityBody> {
+  late UserProvider user;
+
+  bool isRevealed = false;
+
+  ScreenshotController screenshotController = ScreenshotController();
+
+  sharePersonality() async {
+    await screenshotController.capture().then((image) async {
+      if (image != null) {
+        final directory = await getApplicationDocumentsDirectory();
+        if (await File('${directory.path}/refilc_personality.png').exists()) {
+          await File('${directory.path}/refilc_personality.png').delete();
+        }
+        final imagePath =
+            await File('${directory.path}/refilc_personality.png').create();
+        await imagePath.writeAsBytes(image);
+
+        await Share.shareXFiles([XFile(imagePath.path)]);
+      }
+    }).catchError((err) {
+      throw err;
+    });
+  }
+
+  savePersonality() async {
+    await screenshotController.capture().then((image) async {
+      if (image != null) {
+        await ImageGallerySaver.saveImage(image, name: 'refilc_personality');
+      }
+    }).catchError((err) {
+      throw err;
+    });
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    user = Provider.of<UserProvider>(context);
+
+    return Expanded(
+      child: ListView(
+        children: [
+          const SizedBox(height: 30),
+          AnimatedCrossFade(
+            duration: const Duration(milliseconds: 1000),
+            sizeCurve: Curves.easeInToLinear,
+            firstChild: Screenshot(
+              controller: screenshotController,
+              child: PersonalityCard(user: user),
+            ),
+            secondChild: GestureDetector(
+              onTap: () => setState(() {
+                isRevealed = true;
+              }),
+              child: EmptyCard(text: 'click_reveal'.i18n),
+            ),
+            crossFadeState: isRevealed
+                ? CrossFadeState.showFirst
+                : CrossFadeState.showSecond,
+          ),
+          const SizedBox(height: 30),
+          if (isRevealed)
+            Center(
+              child: Row(
+                mainAxisAlignment: MainAxisAlignment.center,
+                crossAxisAlignment: CrossAxisAlignment.center,
+                children: [
+                  IconButton(
+                    onPressed: () async {
+                      await sharePersonality();
+                    },
+                    icon: const Icon(
+                      FeatherIcons.share,
+                      color: Colors.white,
+                      size: 30,
+                    ),
+                    style: ButtonStyle(
+                      backgroundColor: MaterialStateProperty.all(
+                          Colors.white.withOpacity(0.2)),
+                    ),
+                  ),
+                  const SizedBox(
+                    width: 10,
+                  ),
+                  IconButton(
+                    onPressed: () async {
+                      await savePersonality();
+                    },
+                    icon: const Icon(
+                      FeatherIcons.bookmark,
+                      color: Colors.white,
+                      size: 30,
+                    ),
+                    style: ButtonStyle(
+                      backgroundColor: MaterialStateProperty.all(
+                          Colors.white.withOpacity(0.2)),
+                    ),
+                  ),
+                ],
+              ),
+            ),
+          const SizedBox(height: 60),
+        ],
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/summary/pages/start_page.dart

@@ -0,0 +1,98 @@
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc/models/settings.dart';
+import 'package:refilc_kreta_api/providers/grade_provider.dart';
+import 'package:refilc_mobile_ui/screens/summary/summary_screen.dart';
+import 'package:refilc_mobile_ui/screens/summary/summary_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'package:wtf_sliding_sheet/wtf_sliding_sheet.dart';
+
+class StartBody extends StatefulWidget {
+  const StartBody({super.key});
+
+  @override
+  StartBodyState createState() => StartBodyState();
+}
+
+class StartBodyState extends State<StartBody> {
+  late UserProvider user;
+  late GradeProvider gradeProvider;
+  late SettingsProvider settings;
+
+  late String firstName;
+
+  @override
+  void initState() {
+    super.initState();
+
+    gradeProvider = Provider.of<GradeProvider>(context, listen: false);
+    settings = Provider.of<SettingsProvider>(context, listen: false);
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.center,
+      mainAxisAlignment: MainAxisAlignment.spaceBetween,
+      children: [
+        const SizedBox(height: 40.0),
+        GestureDetector(
+          onTap: () {
+            Navigator.of(context).pop();
+            showSlidingBottomSheet(
+              context,
+              useRootNavigator: true,
+              builder: (context) => SlidingSheetDialog(
+                color: Colors.black.withOpacity(0.99),
+                duration: const Duration(milliseconds: 400),
+                scrollSpec: const ScrollSpec.bouncingScroll(),
+                snapSpec: const SnapSpec(
+                  snap: true,
+                  snappings: [1.0],
+                  initialSnap: 1.0,
+                  positioning: SnapPositioning.relativeToAvailableSpace,
+                ),
+                minHeight: MediaQuery.of(context).size.height,
+                cornerRadius: 16,
+                cornerRadiusOnFullscreen: 0,
+                builder: (context, state) => const Material(
+                  color: Colors.black,
+                  child: SummaryScreen(
+                    currentPage: 'grades',
+                    isBottomSheet: true,
+                  ),
+                ),
+              ),
+            );
+          },
+          child: Center(
+            child: Column(
+              mainAxisAlignment: MainAxisAlignment.center,
+              crossAxisAlignment: CrossAxisAlignment.center,
+              children: [
+                const Icon(
+                  FeatherIcons.arrowRight,
+                  size: 145,
+                  color: Colors.white,
+                  grade: 0.001,
+                  weight: 0.001,
+                ),
+                Text(
+                  'start'.i18n,
+                  textAlign: TextAlign.center,
+                  style: TextStyle(
+                    fontWeight: FontWeight.w500,
+                    fontSize: 16.0,
+                    color: Colors.white.withOpacity(0.7),
+                  ),
+                ),
+              ],
+            ),
+          ),
+        ),
+        const SizedBox(height: 169.69),
+      ],
+    );
+  }
+}

refilc_mobile_ui/lib/screens/summary/summary_screen.dart

@@ -0,0 +1,222 @@
+import 'package:confetti/confetti.dart';
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc/models/settings.dart';
+import 'package:flutter/cupertino.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'package:wtf_sliding_sheet/wtf_sliding_sheet.dart';
+import 'summary_screen.i18n.dart';
+
+import 'pages/allsum_page.dart';
+import 'pages/start_page.dart';
+import 'pages/grades_page.dart';
+import 'pages/lessons_page.dart';
+import 'pages/personality_page.dart';
+
+class SummaryScreen extends StatefulWidget {
+  final String currentPage;
+  final bool isBottomSheet;
+
+  const SummaryScreen({
+    super.key,
+    this.currentPage = 'personality',
+    this.isBottomSheet = false,
+  });
+
+  @override
+  SummaryScreenState createState() => SummaryScreenState();
+
+  static show(
+          {required BuildContext context,
+          String currentPage = 'personality'}) =>
+      Navigator.of(context, rootNavigator: true).push(CupertinoPageRoute(
+          builder: (context) => SummaryScreen(currentPage: currentPage)));
+}
+
+class SummaryScreenState extends State<SummaryScreen>
+    with SingleTickerProviderStateMixin {
+  late UserProvider user;
+  late SettingsProvider settings;
+
+  ConfettiController? _confettiController;
+
+  late String firstName;
+
+  final LinearGradient _backgroundGradient = const LinearGradient(
+    colors: [
+      Color(0xff1d56ac),
+      Color(0xff170a3d),
+    ],
+    begin: Alignment(-0.8, -1.0),
+    end: Alignment(0.8, 1.0),
+    stops: [-1.0, 1.0],
+  );
+
+  @override
+  void initState() {
+    super.initState();
+  }
+
+  @override
+  void dispose() {
+    _confettiController?.dispose();
+
+    super.dispose();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    user = Provider.of<UserProvider>(context);
+    settings = Provider.of<SettingsProvider>(context);
+
+    List<String> nameParts = user.displayName?.split(" ") ?? ["?"];
+    if (!settings.presentationMode) {
+      firstName = nameParts.length > 1 ? nameParts[1] : nameParts[0];
+    } else {
+      firstName = "János";
+    }
+
+    return widget.isBottomSheet
+        ? buildContainer()
+        : Scaffold(
+            body: buildContainer(),
+          );
+  }
+
+  Widget buildContainer() {
+    return Container(
+      decoration: BoxDecoration(gradient: _backgroundGradient),
+      child: Container(
+        decoration: BoxDecoration(gradient: _backgroundGradient),
+        width: MediaQuery.of(context).size.width,
+        height: MediaQuery.of(context).size.height,
+        child: SafeArea(
+          child: Padding(
+            padding: const EdgeInsets.only(
+              left: 24.0,
+              right: 24.0,
+              top: 15.0,
+              bottom: 40.0,
+            ),
+            child: Column(
+              crossAxisAlignment: widget.currentPage == 'start'
+                  ? CrossAxisAlignment.center
+                  : CrossAxisAlignment.start,
+              mainAxisAlignment: widget.currentPage == 'start'
+                  ? MainAxisAlignment.spaceBetween
+                  : MainAxisAlignment.start,
+              children: [
+                Row(
+                  mainAxisAlignment: MainAxisAlignment.spaceBetween,
+                  crossAxisAlignment: CrossAxisAlignment.center,
+                  children: [
+                    Expanded(
+                      child: Column(
+                        crossAxisAlignment: CrossAxisAlignment.start,
+                        children: [
+                          Text(
+                            'greeting'.i18n.fill([firstName]),
+                            textAlign: TextAlign.left,
+                            maxLines: 2,
+                            overflow: TextOverflow.ellipsis,
+                            softWrap: true,
+                            style: const TextStyle(
+                              fontWeight: FontWeight.w900,
+                              fontSize: 26.0,
+                              color: Colors.white,
+                            ),
+                          ),
+                          Text(
+                            widget.currentPage == 'start'
+                                ? 'title_start'.i18n
+                                : widget.currentPage == 'grades'
+                                    ? 'title_grades'.i18n
+                                    : widget.currentPage == 'lessons'
+                                        ? 'title_lessons'.i18n
+                                        : widget.currentPage == 'personality'
+                                            ? 'title_personality'.i18n
+                                            : '',
+                            maxLines: 1,
+                            overflow: TextOverflow.fade,
+                            softWrap: false,
+                            style: const TextStyle(
+                              fontWeight: FontWeight.bold,
+                              fontSize: 22.0,
+                              color: Colors.white,
+                            ),
+                          ),
+                        ],
+                      ),
+                    ),
+                    widget.currentPage != 'start'
+                        ? IconButton(
+                            onPressed: () async {
+                              Navigator.of(context).pop();
+                              if (widget.currentPage == 'grades') {
+                                openNewPage(page: 'lessons');
+                              } else if (widget.currentPage == 'lessons') {
+                                openNewPage(page: 'allsum');
+                              } else if (widget.currentPage == 'allsum') {
+                                openNewPage(page: 'personality');
+                              } else {
+                                Navigator.of(context).maybePop();
+                              }
+                            },
+                            icon: Icon(
+                              widget.currentPage == 'personality'
+                                  ? FeatherIcons.x
+                                  : FeatherIcons.arrowRight,
+                              color: Colors.white,
+                            ),
+                          )
+                        : Container()
+                  ],
+                ),
+                const SizedBox(height: 12.0),
+                widget.currentPage == 'start'
+                    ? const StartBody()
+                    : widget.currentPage == 'grades'
+                        ? const GradesBody()
+                        : widget.currentPage == 'lessons'
+                            ? const LessonsBody()
+                            : widget.currentPage == 'allsum'
+                                ? const AllSumBody()
+                                : const PersonalityBody(),
+              ],
+            ),
+          ),
+        ),
+      ),
+    );
+  }
+
+  void openNewPage({String page = 'personality'}) {
+    showSlidingBottomSheet(
+      context,
+      useRootNavigator: true,
+      builder: (context) => SlidingSheetDialog(
+        color: Colors.black.withOpacity(0.99),
+        duration: const Duration(milliseconds: 400),
+        scrollSpec: const ScrollSpec.bouncingScroll(),
+        snapSpec: const SnapSpec(
+          snap: true,
+          snappings: [1.0],
+          initialSnap: 1.0,
+          positioning: SnapPositioning.relativeToAvailableSpace,
+        ),
+        minHeight: MediaQuery.of(context).size.height,
+        cornerRadius: 16,
+        cornerRadiusOnFullscreen: 0,
+        builder: (context, state) => Material(
+          color: Colors.black,
+          child: SummaryScreen(
+            currentPage: page,
+            isBottomSheet: true,
+          ),
+        ),
+      ),
+    );
+    //SummaryScreen.show(context: context, currentPage: page);
+  }
+}

refilc_mobile_ui/lib/screens/summary/summary_screen.i18n.dart

@@ -0,0 +1,117 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension SettingsLocalization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          // main thingies
+          "no_grades": "No grades found",
+          "no_lesson": "No lessons found",
+          "greeting": "You had a good year, %s!",
+          "title_start": "So let's summarize...",
+          "title_grades": "Let's look at your marks... 📖",
+          "title_lessons": "Your favorite lesson 💓",
+          "title_personality": "Your personality is...",
+          // start page
+          "start": "Start",
+          // grades page
+          "tryagain": "He puts the master to the test! 🔃",
+          "oops": "Ouch... 🥴",
+          "endyear_avg": "Year-end average",
+          // lessons page
+          "absence": "%s absence(s)",
+          "delay": "A total of %s minute(s) late",
+          "dontfelt": "You didn't like it...",
+          "youlate": "You're late!",
+          // allsum page
+          "test": "test(s)",
+          "closingtest": "module test(s)",
+          "grade": "grades",
+          "hw": "homework",
+          "subject": "subjects",
+          "lesson": "lessons",
+          "absence_sum": "absence(s)",
+          "excused": "excused",
+          "unexcused": "unexcused",
+          "delay_sum": "delay(s)",
+          "min": "minute(s)",
+          // personality page
+          "click_reveal": "Click to reveal...",
+        },
+        "hu_hu": {
+          // main thingies
+          "no_grades": "Nincsenek jegyek",
+          "no_lesson": "Nincsenek tanórák",
+          "greeting": "Jó éved volt, %s!",
+          "title_start": "Összegezzünk hát...",
+          "title_grades": "Nézzük a jegyeidet... 📖",
+          "title_lessons": "A kedvenc órád 💓",
+          "title_personality": "A te személyiséged...",
+          // start page
+          "start": "Kezdés",
+          // grades page
+          "tryagain": "Próba teszi a mestert! 🔃",
+          "oops": "Ajjaj... 🥴",
+          "endyear_avg": "Év végi átlagod",
+          // lessons page
+          "absence": "%s hiányzás",
+          "delay": "Összesen %s perc késés",
+          "dontfelt": "Nem volt kedved hozzá...",
+          "youlate": "Késtél!",
+          // allsum page
+          "test": "dolgozat",
+          "closingtest": "témazáró",
+          "grade": "jegy",
+          "hw": "házi",
+          "subject": "tantárgy",
+          "lesson": "óra",
+          "absence_sum": "hiányzás",
+          "excused": "igazolt",
+          "unexcused": "igazolatlan",
+          "delay_sum": "késés",
+          "min": "perc",
+          // personality page
+          "click_reveal": "Kattints a felfedéshez...",
+        },
+        "de_de": {
+          // main thingies
+          "no_grades": "Keine Grade gefunden",
+          "no_lesson": "Keine Lektionen gefunden",
+          "greeting": "Du hattest ein gutes Jahr, %s!",
+          "title_start": "Fassen wir also zusammen...",
+          "title_grades": "Schauen wir uns eure Tickets an... 📖",
+          "title_lessons": "Deine Lieblingsuhr 💓",
+          "title_personality": "Deine Persönlichkeit...",
+          // start page
+          "start": "Anfang",
+          // grades page
+          "tryagain": "Er stellt den Meister auf die Probe! 🔃",
+          "oops": "Autsch... 🥴",
+          "endyear_avg": "Ihr Jahresenddurchschnitt",
+          // lessons page
+          "absence": "%s Abwesenheit(en)",
+          "delay": "Insgesamt %s Minute(n) zu spät",
+          "dontfelt": "Es hat dir nicht gefallen...",
+          "youlate": "Du bist spät!",
+          // allsum page
+          "test": "These(n)",
+          "closingtest": "Modultest",
+          "grade": "Grad",
+          "hw": "Hausaufgaben",
+          "subject": "Themen",
+          "lesson": "Lektionen",
+          "absence_sum": "Abwesenheit(en)",
+          "excused": "bescheinigte",
+          "unexcused": "unentschuldigte",
+          "delay_sum": "Verzögerung(en)",
+          "min": "Minute(n)",
+          // personality page
+          "click_reveal": "Klicken Sie hier, um es anzuzeigen...",
+        },
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}