Rename everything filcnaplo-related to refilc

refilc_mobile_ui/lib/screens/error_report_screen.dart

@@ -0,0 +1,220 @@
+import 'dart:io';
+import 'dart:math';
+
+import 'package:refilc/api/client.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'error_report_screen.i18n.dart';
+
+class ErrorReportScreen extends StatelessWidget {
+  final FlutterErrorDetails details;
+
+  const ErrorReportScreen(this.details, {Key? key}) : super(key: key);
+
+  @override
+  Widget build(BuildContext context) {
+    return Scaffold(
+      backgroundColor: Colors.red,
+      body: SafeArea(
+        child: Padding(
+          padding: const EdgeInsets.all(12.0),
+          child: Column(
+            children: [
+              const Align(
+                child: BackButton(),
+                alignment: Alignment.topLeft,
+              ),
+              const Spacer(),
+              const Icon(
+                FeatherIcons.alertTriangle,
+                size: 100,
+              ),
+              const Spacer(),
+              Padding(
+                padding: const EdgeInsets.only(bottom: 4.0),
+                child: Text(
+                  "uhoh".i18n,
+                  style: const TextStyle(
+                    color: Colors.white,
+                    fontSize: 32.0,
+                    fontWeight: FontWeight.w900,
+                  ),
+                ),
+              ),
+              Text(
+                "description".i18n,
+                style: TextStyle(
+                  color: Colors.white.withOpacity(.95),
+                  fontSize: 24.0,
+                  fontWeight: FontWeight.w700,
+                ),
+              ),
+              const Spacer(),
+              Stack(
+                alignment: Alignment.topRight,
+                children: [
+                  Container(
+                    height: 110.0,
+                    width: double.infinity,
+                    padding: const EdgeInsets.all(12.0),
+                    decoration: BoxDecoration(
+                        borderRadius: BorderRadius.circular(12.0),
+                        color: Colors.black.withOpacity(.2)),
+                    child: SingleChildScrollView(
+                      physics: const BouncingScrollPhysics(),
+                      child: Text(
+                        details.exceptionAsString(),
+                        style: const TextStyle(fontFamily: 'SpaceMono'),
+                      ),
+                    ),
+                  ),
+                  IconButton(
+                    icon: const Icon(FeatherIcons.info),
+                    onPressed: () {
+                      showDialog(
+                          context: context,
+                          builder: (context) => StacktracePopup(details));
+                    },
+                  )
+                ],
+              ),
+              const Spacer(),
+              SizedBox(
+                width: double.infinity,
+                child: TextButton(
+                  style: ButtonStyle(
+                    padding: MaterialStateProperty.all(
+                        const EdgeInsets.symmetric(vertical: 14.0)),
+                    backgroundColor: MaterialStateProperty.all(Colors.white),
+                    shape: MaterialStateProperty.all(
+                      RoundedRectangleBorder(
+                          borderRadius: BorderRadius.circular(12.0)),
+                    ),
+                  ),
+                  child: Text(
+                    "submit".i18n,
+                    style: const TextStyle(
+                      color: Colors.black,
+                      fontSize: 17.0,
+                      fontWeight: FontWeight.bold,
+                    ),
+                  ),
+                  onPressed: () => reportProblem(context),
+                ),
+              ),
+              const SizedBox(height: 32.0)
+            ],
+          ),
+        ),
+      ),
+    );
+  }
+
+  Future reportProblem(BuildContext context) async {
+    final report = ErrorReport(
+      os: Platform.operatingSystem + " " + Platform.operatingSystemVersion,
+      error: details.exceptionAsString(),
+      version: const String.fromEnvironment("APPVER", defaultValue: "?"),
+      stack: details.stack.toString(),
+    );
+    FilcAPI.sendReport(report);
+    Navigator.pop(context);
+  }
+}
+
+class StacktracePopup extends StatelessWidget {
+  final FlutterErrorDetails details;
+
+  const StacktracePopup(this.details, {Key? key}) : super(key: key);
+
+  @override
+  Widget build(BuildContext context) {
+    String stack = details.stack.toString();
+
+    return Container(
+      margin: const EdgeInsets.all(32.0),
+      child: Scaffold(
+        backgroundColor: Colors.transparent,
+        body: Container(
+          decoration: BoxDecoration(
+            color: Theme.of(context).scaffoldBackgroundColor,
+            borderRadius: BorderRadius.circular(4.0),
+          ),
+          padding: const EdgeInsets.only(top: 15.0, right: 15.0, left: 15.0),
+          child: Column(
+            children: [
+              Expanded(
+                child: ListView(children: [
+                  Padding(
+                    padding: const EdgeInsets.only(bottom: 10.0),
+                    child: Text(
+                      "details".i18n,
+                      style: const TextStyle(fontSize: 20.0),
+                    ),
+                  ),
+                  ErrorDetail(
+                    "error".i18n,
+                    details.exceptionAsString(),
+                  ),
+                  ErrorDetail(
+                      "os".i18n,
+                      Platform.operatingSystem +
+                          " " +
+                          Platform.operatingSystemVersion),
+                  ErrorDetail(
+                      "version".i18n,
+                      const String.fromEnvironment("APPVER",
+                          defaultValue: "?")),
+                  ErrorDetail(
+                      "stack".i18n, stack.substring(0, min(stack.length, 5000)))
+                ]),
+              ),
+              TextButton(
+                  child: Text("done".i18n,
+                      style: TextStyle(
+                          color: Theme.of(context).colorScheme.secondary)),
+                  onPressed: () {
+                    Navigator.of(context).pop();
+                  })
+            ],
+          ),
+        ),
+      ),
+    );
+  }
+}
+
+class ErrorDetail extends StatelessWidget {
+  final String title;
+  final String content;
+
+  const ErrorDetail(this.title, this.content, {Key? key}) : super(key: key);
+
+  @override
+  Widget build(BuildContext context) {
+    return Padding(
+      padding: const EdgeInsets.only(bottom: 10.0),
+      child: Column(
+        crossAxisAlignment: CrossAxisAlignment.start,
+        children: [
+          Text(
+            title,
+            style: const TextStyle(fontWeight: FontWeight.bold),
+          ),
+          Container(
+              child: Text(
+                content,
+                style: const TextStyle(
+                    fontFamily: 'SpaceMono', color: Colors.white),
+              ),
+              padding:
+                  const EdgeInsets.symmetric(horizontal: 6.5, vertical: 4.0),
+              margin: const EdgeInsets.only(top: 4.0),
+              decoration: BoxDecoration(
+                  color: Colors.black26,
+                  borderRadius: BorderRadius.circular(4.0)))
+        ],
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/error_report_screen.i18n.dart

@@ -0,0 +1,45 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension SettingsLocalization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          "uhoh": "Uh Oh!",
+          "description": "An error occurred!",
+          "submit": "Submit",
+          "details": "Details",
+          "error": "Error",
+          "os": "Operating System",
+          "version": "App Version",
+          "stack": "Stack Trace",
+          "done": "Done",
+        },
+        "hu_hu": {
+          "uhoh": "Ajajj!",
+          "description": "Hiba történt!",
+          "submit": "Probléma Jelentése",
+          "details": "Részletek",
+          "error": "Hiba",
+          "os": "Operációs Rendszer",
+          "version": "App Verzió",
+          "stack": "Stacktrace",
+          "done": "Kész",
+        },
+        "de_de": {
+          "uhoh": "Uh Oh!",
+          "description": "Ein Fehler ist aufgetreten!",
+          "submit": "Abschicken",
+          "details": "Details",
+          "error": "Fehler",
+          "os": "Betriebssystem",
+          "version": "App Version",
+          "stack": "Stack Trace",
+          "done": "Fertig",
+        },
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}

refilc_mobile_ui/lib/screens/error_screen.dart

@@ -0,0 +1,65 @@
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:flutter/cupertino.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+
+class ErrorScreen extends StatelessWidget {
+  const ErrorScreen(this.details, {Key? key}) : super(key: key);
+
+  final FlutterErrorDetails details;
+
+  @override
+  Widget build(BuildContext context) {
+    return Scaffold(
+      appBar: AppBar(
+        surfaceTintColor: Theme.of(context).scaffoldBackgroundColor,
+        leading: BackButton(color: AppColors.of(context).text),
+        shadowColor: Colors.transparent,
+      ),
+      body: SafeArea(
+        child: Padding(
+          padding: const EdgeInsets.symmetric(vertical: 12.0, horizontal: 24.0),
+          child: Column(
+            children: [
+              Padding(
+                padding: const EdgeInsets.all(12.0),
+                child: Icon(FeatherIcons.alertTriangle,
+                    size: 48.0, color: AppColors.of(context).red),
+              ),
+              const Padding(
+                padding: EdgeInsets.all(12.0),
+                child: Text(
+                  "An error occurred...",
+                  style: TextStyle(fontWeight: FontWeight.w500, fontSize: 16.0),
+                ),
+              ),
+              Expanded(
+                child: Container(
+                  padding: const EdgeInsets.all(12.0),
+                  width: double.infinity,
+                  decoration: BoxDecoration(
+                    borderRadius: BorderRadius.circular(14.0),
+                    color: Theme.of(context).colorScheme.background,
+                  ),
+                  child: CupertinoScrollbar(
+                    child: SingleChildScrollView(
+                      physics: const BouncingScrollPhysics(),
+                      child: SingleChildScrollView(
+                        physics: const BouncingScrollPhysics(),
+                        scrollDirection: Axis.horizontal,
+                        child: SelectableText(
+                          (details.exceptionAsString() + '\n'),
+                          style: const TextStyle(fontFamily: "monospace"),
+                        ),
+                      ),
+                    ),
+                  ),
+                ),
+              ),
+            ],
+          ),
+        ),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/login/login_button.dart

@@ -0,0 +1,29 @@
+import 'package:flutter/material.dart';
+
+class LoginButton extends StatelessWidget {
+  const LoginButton({Key? key, required this.onPressed, required this.child}) : super(key: key);
+
+  final void Function()? onPressed;
+  final Widget? child;
+
+  @override
+  Widget build(BuildContext context) {
+    return MaterialButton(
+      child: Padding(
+        padding: const EdgeInsets.symmetric(
+          vertical: 15.0,
+        ),
+        child: child,
+      ),
+      elevation: 0,
+      focusElevation: 0,
+      hoverElevation: 0,
+      highlightElevation: 0,
+      minWidth: MediaQuery.of(context).size.width - 64.0,
+      onPressed: onPressed,
+      shape: RoundedRectangleBorder(borderRadius: BorderRadius.circular(12.0)),
+      color: Colors.white,
+      textColor: Colors.black,
+    );
+  }
+}

refilc_mobile_ui/lib/screens/login/login_input.dart

@@ -0,0 +1,105 @@
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+
+enum LoginInputStyle { username, password, school }
+
+class LoginInput extends StatefulWidget {
+  const LoginInput(
+      {Key? key,
+      required this.style,
+      this.controller,
+      this.focusNode,
+      this.onClear})
+      : super(key: key);
+
+  final Function()? onClear;
+  final LoginInputStyle style;
+  final TextEditingController? controller;
+  final FocusNode? focusNode;
+
+  @override
+  State<LoginInput> createState() => _LoginInputState();
+}
+
+class _LoginInputState extends State<LoginInput> {
+  late bool obscure;
+
+  @override
+  void initState() {
+    super.initState();
+    obscure = widget.style == LoginInputStyle.password;
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    String autofill;
+
+    switch (widget.style) {
+      case LoginInputStyle.username:
+        autofill = AutofillHints.username;
+        break;
+      case LoginInputStyle.password:
+        autofill = AutofillHints.password;
+        break;
+      case LoginInputStyle.school:
+        autofill = AutofillHints.organizationName;
+        break;
+    }
+
+    return TextField(
+      focusNode: widget.focusNode,
+      controller: widget.controller,
+      cursorColor: const Color(0xff20AC9B),
+      textInputAction: TextInputAction.next,
+      autofillHints: [autofill],
+      obscureText: obscure,
+      scrollPhysics: const BouncingScrollPhysics(),
+      decoration: InputDecoration(
+        fillColor: Colors.black.withOpacity(0.15),
+        filled: true,
+        enabledBorder: UnderlineInputBorder(
+          borderRadius: BorderRadius.circular(12.0),
+          borderSide: const BorderSide(width: 0, color: Colors.transparent),
+        ),
+        focusedBorder: UnderlineInputBorder(
+          borderRadius: BorderRadius.circular(12.0),
+          borderSide: const BorderSide(width: 0, color: Colors.transparent),
+        ),
+        suffixIconConstraints:
+            const BoxConstraints(maxHeight: 42.0, maxWidth: 48.0),
+        suffixIcon: widget.style == LoginInputStyle.password ||
+                widget.style == LoginInputStyle.school
+            ? ClipOval(
+                child: Material(
+                  type: MaterialType.transparency,
+                  child: IconButton(
+                    splashRadius: 20.0,
+                    padding: EdgeInsets.zero,
+                    onPressed: () {
+                      if (widget.style == LoginInputStyle.password) {
+                        setState(() => obscure = !obscure);
+                      } else {
+                        widget.controller?.clear();
+                        if (widget.onClear != null) widget.onClear!();
+                      }
+                    },
+                    icon: Icon(
+                        widget.style == LoginInputStyle.password
+                            ? obscure
+                                ? FeatherIcons.eye
+                                : FeatherIcons.eyeOff
+                            : FeatherIcons.x,
+                        color: Colors.white),
+                  ),
+                ),
+              )
+            : null,
+      ),
+      style: const TextStyle(
+        fontSize: 14.0,
+        fontWeight: FontWeight.w500,
+        color: Colors.white,
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/login/login_route.dart

@@ -0,0 +1,21 @@
+import 'package:flutter/material.dart';
+
+Route loginRoute(Widget widget) {
+  return PageRouteBuilder(
+    pageBuilder: (context, animation, secondaryAnimation) => widget,
+    transitionDuration: const Duration(milliseconds: 650),
+    transitionsBuilder: (context, animation, secondaryAnimation, child) {
+      var curve = Curves.easeInOut;
+      var curveTween = CurveTween(curve: curve);
+      var begin = const Offset(1.0, 0.0);
+      var end = Offset.zero;
+      var tween = Tween(begin: begin, end: end).chain(curveTween);
+      var offsetAnimation = animation.drive(tween);
+
+      return SlideTransition(
+        position: offsetAnimation,
+        child: child,
+      );
+    },
+  );
+}

refilc_mobile_ui/lib/screens/login/login_screen.dart

@@ -0,0 +1,347 @@
+// import 'dart:async';
+import 'dart:ui';
+
+import 'package:refilc/api/client.dart';
+import 'package:refilc/api/login.dart';
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:refilc_mobile_ui/common/custom_snack_bar.dart';
+import 'package:refilc_mobile_ui/common/system_chrome.dart';
+import 'package:refilc_mobile_ui/screens/login/login_button.dart';
+import 'package:refilc_mobile_ui/screens/login/login_input.dart';
+import 'package:refilc_mobile_ui/screens/login/school_input/school_input.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter/services.dart';
+import 'login_screen.i18n.dart';
+
+class LoginScreen extends StatefulWidget {
+  const LoginScreen({Key? key, this.back = false}) : super(key: key);
+
+  final bool back;
+
+  @override
+  _LoginScreenState createState() => _LoginScreenState();
+}
+
+class _LoginScreenState extends State<LoginScreen> {
+  final usernameController = TextEditingController();
+  final passwordController = TextEditingController();
+  final schoolController = SchoolInputController();
+  final _scrollController = ScrollController();
+
+  LoginState _loginState = LoginState.normal;
+  bool showBack = false;
+
+  // Scaffold Gradient background
+  final LinearGradient _backgroundGradient = const LinearGradient(
+    colors: [
+      Color.fromARGB(255, 61, 122, 244),
+      Color.fromARGB(255, 23, 77, 185),
+      Color.fromARGB(255, 7, 42, 112),
+    ],
+    begin: Alignment(-0.8, -1.0),
+    end: Alignment(0.8, 1.0),
+    stops: [-1.0, 0.0, 1.0],
+  );
+
+  late String tempUsername = '';
+
+  @override
+  void initState() {
+    super.initState();
+    showBack = widget.back;
+
+    SystemChrome.setSystemUIOverlayStyle(const SystemUiOverlayStyle(
+      statusBarColor: Colors.transparent,
+      statusBarIconBrightness: Brightness.light,
+      systemNavigationBarColor: Colors.white,
+      systemNavigationBarIconBrightness: Brightness.dark,
+    ));
+
+    FilcAPI.getSchools().then((schools) {
+      if (schools != null) {
+        schoolController.update(() {
+          schoolController.schools = schools;
+        });
+      } else {
+        ScaffoldMessenger.of(context).showSnackBar(CustomSnackBar(
+          content: Text("schools_error".i18n,
+              style: const TextStyle(color: Colors.white)),
+          backgroundColor: AppColors.of(context).red,
+          context: context,
+        ));
+      }
+    });
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Scaffold(
+      body: Container(
+        decoration: BoxDecoration(gradient: _backgroundGradient),
+        child: SingleChildScrollView(
+          physics: const ClampingScrollPhysics(),
+          controller: _scrollController,
+          child: Container(
+            decoration: BoxDecoration(gradient: _backgroundGradient),
+            width: MediaQuery.of(context).size.width,
+            height: MediaQuery.of(context).size.height,
+            child: SafeArea(
+              child: Column(
+                mainAxisAlignment: MainAxisAlignment.center,
+                children: [
+                  if (showBack)
+                    Container(
+                      alignment: Alignment.topLeft,
+                      padding: const EdgeInsets.only(left: 16.0, top: 12.0),
+                      child: const ClipOval(
+                        child: Material(
+                          type: MaterialType.transparency,
+                          child: BackButton(color: Colors.white),
+                        ),
+                      ),
+                    ),
+
+                  const Spacer(),
+
+                  // App logo
+                  Padding(
+                    padding: const EdgeInsets.only(bottom: 24.0),
+                    child: ClipRect(
+                      child: Container(
+                        // Png shadow *hack*
+                        child: Stack(
+                          children: [
+                            Padding(
+                              padding: const EdgeInsets.only(top: 8.0),
+                              child: Opacity(
+                                  child: Image.asset(
+                                      "assets/icons/ic_splash.png",
+                                      color: Colors.black),
+                                  opacity: 0.3),
+                            ),
+                            BackdropFilter(
+                              filter:
+                                  ImageFilter.blur(sigmaX: 6.0, sigmaY: 6.0),
+                              child: Image.asset("assets/icons/ic_splash.png"),
+                            )
+                          ],
+                        ),
+                        width: MediaQuery.of(context).size.width / 4,
+                        margin: const EdgeInsets.only(
+                            left: 12.0, right: 12.0, bottom: 12.0),
+                      ),
+                    ),
+                  ),
+
+                  // Inputs
+                  Padding(
+                    padding: const EdgeInsets.symmetric(horizontal: 32.0),
+                    child: AutofillGroup(
+                      child: Column(
+                        crossAxisAlignment: CrossAxisAlignment.start,
+                        children: [
+                          // Username
+                          Padding(
+                            padding: const EdgeInsets.only(bottom: 6.0),
+                            child: Row(
+                              mainAxisAlignment: MainAxisAlignment.spaceBetween,
+                              children: [
+                                Expanded(
+                                  child: Text(
+                                    "username".i18n,
+                                    maxLines: 1,
+                                    style: const TextStyle(
+                                      color: Colors.white,
+                                      fontWeight: FontWeight.w600,
+                                      fontSize: 14.0,
+                                    ),
+                                  ),
+                                ),
+                                Expanded(
+                                  child: Text(
+                                    "usernameHint".i18n,
+                                    maxLines: 1,
+                                    textAlign: TextAlign.right,
+                                    style: const TextStyle(
+                                      color: Colors.white54,
+                                      fontWeight: FontWeight.w500,
+                                      fontSize: 12.0,
+                                    ),
+                                  ),
+                                ),
+                              ],
+                            ),
+                          ),
+                          Padding(
+                            padding: const EdgeInsets.only(bottom: 12.0),
+                            child: LoginInput(
+                              style: LoginInputStyle.username,
+                              controller: usernameController,
+                            ),
+                          ),
+
+                          // Password
+                          Padding(
+                            padding: const EdgeInsets.only(bottom: 6.0),
+                            child: Row(
+                              mainAxisAlignment: MainAxisAlignment.spaceBetween,
+                              children: [
+                                Expanded(
+                                  child: Text(
+                                    "password".i18n,
+                                    maxLines: 1,
+                                    style: const TextStyle(
+                                      color: Colors.white,
+                                      fontWeight: FontWeight.w600,
+                                      fontSize: 14.0,
+                                    ),
+                                  ),
+                                ),
+                                Expanded(
+                                  child: Text(
+                                    "passwordHint".i18n,
+                                    maxLines: 1,
+                                    textAlign: TextAlign.right,
+                                    style: const TextStyle(
+                                      color: Colors.white54,
+                                      fontWeight: FontWeight.w500,
+                                      fontSize: 12.0,
+                                    ),
+                                  ),
+                                ),
+                              ],
+                            ),
+                          ),
+                          Padding(
+                            padding: const EdgeInsets.only(bottom: 12.0),
+                            child: LoginInput(
+                              style: LoginInputStyle.password,
+                              controller: passwordController,
+                            ),
+                          ),
+
+                          // School
+                          Padding(
+                            padding: const EdgeInsets.only(bottom: 6.0),
+                            child: Text(
+                              "school".i18n,
+                              maxLines: 1,
+                              style: const TextStyle(
+                                color: Colors.white,
+                                fontWeight: FontWeight.w600,
+                                fontSize: 14.0,
+                              ),
+                            ),
+                          ),
+                          SchoolInput(
+                            scroll: _scrollController,
+                            controller: schoolController,
+                          ),
+                        ],
+                      ),
+                    ),
+                  ),
+
+                  // Log in button
+                  Padding(
+                    padding: const EdgeInsets.only(top: 42.0),
+                    child: Visibility(
+                      child: LoginButton(
+                        child: Text("login".i18n,
+                            maxLines: 1,
+                            style: const TextStyle(
+                              fontWeight: FontWeight.w600,
+                              fontSize: 15.0,
+                            )),
+                        onPressed: () => _loginAPI(context: context),
+                      ),
+                      visible: _loginState != LoginState.inProgress,
+                      replacement: const Padding(
+                        padding: EdgeInsets.symmetric(vertical: 6.0),
+                        child: CircularProgressIndicator(
+                          valueColor:
+                              AlwaysStoppedAnimation<Color>(Colors.white),
+                        ),
+                      ),
+                    ),
+                  ),
+                  if (_loginState == LoginState.missingFields ||
+                      _loginState == LoginState.invalidGrant ||
+                      _loginState == LoginState.failed)
+                    Padding(
+                      padding: const EdgeInsets.only(top: 8.0),
+                      child: Text(
+                        [
+                          "missing_fields",
+                          "invalid_grant",
+                          "error"
+                        ][_loginState.index]
+                            .i18n,
+                        style: const TextStyle(
+                          color: Colors.red,
+                          fontWeight: FontWeight.w500,
+                        ),
+                        textAlign: TextAlign.center,
+                      ),
+                    ),
+                  const Spacer()
+                ],
+              ),
+            ),
+          ),
+        ),
+      ),
+    );
+  }
+
+  void _loginAPI({required BuildContext context}) {
+    String username = usernameController.text;
+    String password = passwordController.text;
+
+    tempUsername = username;
+
+    if (username == "" ||
+        password == "" ||
+        schoolController.selectedSchool == null) {
+      return setState(() => _loginState = LoginState.missingFields);
+    }
+
+    void _callAPI() {
+      loginAPI(
+          username: username,
+          password: password,
+          instituteCode: schoolController.selectedSchool!.instituteCode,
+          context: context,
+          onLogin: (user) {
+            ScaffoldMessenger.of(context).showSnackBar(CustomSnackBar(
+              context: context,
+              brightness: Brightness.light,
+              content: Text("welcome".i18n.fill([user.name]),
+                  overflow: TextOverflow.ellipsis),
+            ));
+          },
+          onSuccess: () {
+            ScaffoldMessenger.of(context).hideCurrentSnackBar();
+            setSystemChrome(context);
+            Navigator.of(context).pushReplacementNamed("login_to_navigation");
+          }).then(
+        (res) => setState(() {
+          // if (res == LoginState.invalidGrant &&
+          //     tempUsername.replaceAll(username, '').length <= 3) {
+          //   tempUsername = username + ' ';
+          //   Timer(
+          //     const Duration(milliseconds: 500),
+          //     () => _loginAPI(context: context),
+          //   );
+          //   // _loginAPI(context: context);
+          // } else {
+          _loginState = res;
+          // }
+        }),
+      );
+    }
+
+    setState(() => _loginState = LoginState.inProgress);
+    _callAPI();
+  }
+}

refilc_mobile_ui/lib/screens/login/login_screen.i18n.dart

@@ -0,0 +1,53 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension Localization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          "username": "Username",
+          "usernameHint": "Student ID number",
+          "password": "Password",
+          "passwordHint": "Date of birth",
+          "school": "School",
+          "login": "Log in",
+          "welcome": "Welcome, %s!",
+          "missing_fields": "Missing Fields!",
+          "invalid_grant":
+              "Invalid Username/Password! (Try adding spaces after Username)",
+          "error": "Failed to log in.",
+          "schools_error": "Failed to get schools."
+        },
+        "hu_hu": {
+          "username": "Felhasználónév",
+          "usernameHint": "Oktatási azonosító",
+          "password": "Jelszó",
+          "passwordHint": "Születési dátum",
+          "school": "Iskola",
+          "login": "Belépés",
+          "welcome": "Üdv, %s!",
+          "missing_fields": "Hiányzó adatok!",
+          "invalid_grant":
+              "Helytelen Felhasználónév/Jelszó! (Próbálj szóközöket írni a Felhasználónév után)",
+          "error": "Sikertelen bejelentkezés.",
+          "schools_error": "Nem sikerült lekérni az iskolákat."
+        },
+        "de_de": {
+          "username": "Benutzername",
+          "usernameHint": "Ausbildung ID",
+          "password": "Passwort",
+          "passwordHint": "Geburtsdatum",
+          "school": "Schule",
+          "login": "Einloggen",
+          "welcome": "Wilkommen, %s!",
+          "missing_fields": "Fehlende Felder!",
+          "invalid_grant": "Ungültiger Benutzername/Passwort!",
+          "error": "Anmeldung fehlgeschlagen.",
+          "schools_error": "Keine Schulen gefunden."
+        },
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}

refilc_mobile_ui/lib/screens/login/school_input/school_input.dart

@@ -0,0 +1,122 @@
+import 'package:refilc_mobile_ui/screens/login/login_input.dart';
+import 'package:refilc_mobile_ui/screens/login/school_input/school_input_overlay.dart';
+import 'package:refilc_mobile_ui/screens/login/school_input/school_input_tile.dart';
+import 'package:refilc_mobile_ui/screens/login/school_input/school_search.dart';
+import 'package:flutter/material.dart';
+import 'package:refilc_kreta_api/models/school.dart';
+
+class SchoolInput extends StatefulWidget {
+  const SchoolInput({Key? key, required this.controller, required this.scroll})
+      : super(key: key);
+
+  final SchoolInputController controller;
+  final ScrollController scroll;
+
+  @override
+  _SchoolInputState createState() => _SchoolInputState();
+}
+
+class _SchoolInputState extends State<SchoolInput> {
+  final _focusNode = FocusNode();
+  final _layerLink = LayerLink();
+  late SchoolInputOverlay overlay;
+
+  @override
+  void initState() {
+    super.initState();
+
+    widget.controller.update = (fn) {
+      if (mounted) setState(fn);
+    };
+
+    overlay = SchoolInputOverlay(layerLink: _layerLink);
+
+    // Show school list when focused
+    _focusNode.addListener(() {
+      if (_focusNode.hasFocus) {
+        WidgetsBinding.instance
+            .addPostFrameCallback((_) => overlay.createOverlayEntry(context));
+        Future.delayed(const Duration(milliseconds: 100)).then((value) {
+          if (mounted && widget.scroll.hasClients) {
+            widget.scroll.animateTo(widget.scroll.offset + 500,
+                duration: const Duration(milliseconds: 500),
+                curve: Curves.ease);
+          }
+        });
+      } else {
+        overlay.entry?.remove();
+      }
+    });
+
+    // LoginInput TextField listener
+    widget.controller.textController.addListener(() {
+      String text = widget.controller.textController.text;
+      if (text.isEmpty) {
+        overlay.children = null;
+        return;
+      }
+
+      List<School> results =
+          searchSchools(widget.controller.schools ?? [], text);
+      setState(() {
+        overlay.children = results
+            .map((School e) => SchoolInputTile(
+                  school: e,
+                  onTap: () => _selectSchool(e),
+                ))
+            .toList();
+      });
+      Overlay.of(context).setState(() {});
+    });
+  }
+
+  void _selectSchool(School school) {
+    FocusScope.of(context).requestFocus(FocusNode());
+
+    setState(() {
+      widget.controller.selectedSchool = school;
+      widget.controller.textController.text = school.name;
+    });
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return CompositedTransformTarget(
+      link: _layerLink,
+      child: widget.controller.schools == null
+          ? Container(
+              width: double.infinity,
+              padding: const EdgeInsets.symmetric(vertical: 10.0),
+              decoration: BoxDecoration(
+                color: Colors.black.withOpacity(0.15),
+                borderRadius: BorderRadius.circular(12.0),
+              ),
+              child: const Center(
+                child: SizedBox(
+                  height: 28.0,
+                  width: 28.0,
+                  child: CircularProgressIndicator(
+                    color: Colors.white,
+                  ),
+                ),
+              ),
+            )
+          : LoginInput(
+              style: LoginInputStyle.school,
+              focusNode: _focusNode,
+              onClear: () {
+                widget.controller.selectedSchool = null;
+                FocusScope.of(context).requestFocus(_focusNode);
+              },
+              controller: widget.controller.textController,
+            ),
+    );
+  }
+}
+
+class SchoolInputController {
+  final textController = TextEditingController();
+  School? selectedSchool;
+  List<School>? schools;
+  late void Function(void Function()) update;
+}

refilc_mobile_ui/lib/screens/login/school_input/school_input_overlay.dart

@@ -0,0 +1,72 @@
+import 'package:flutter/material.dart';
+import 'school_input_overlay.i18n.dart';
+
+class SchoolInputOverlay {
+  OverlayEntry? entry;
+  final LayerLink layerLink;
+  List<Widget>? children;
+
+  SchoolInputOverlay({required this.layerLink});
+
+  void createOverlayEntry(BuildContext context) {
+    entry = OverlayEntry(builder: (_) => buildOverlayEntry(context));
+    Overlay.of(context).insert(entry!);
+  }
+
+  Widget buildOverlayEntry(BuildContext context) {
+    RenderBox renderBox = context.findRenderObject()! as RenderBox;
+    var size = renderBox.size;
+    return SchoolInputOverlayWidget(
+      children: children,
+      size: size,
+      layerLink: layerLink,
+    );
+  }
+}
+
+class SchoolInputOverlayWidget extends StatelessWidget {
+  const SchoolInputOverlayWidget({
+    Key? key,
+    required this.children,
+    required this.size,
+    required this.layerLink,
+  }) : super(key: key);
+
+  final Size size;
+  final List<Widget>? children;
+  final LayerLink layerLink;
+
+  @override
+  Widget build(BuildContext context) {
+    return children != null
+        ? Positioned(
+            width: size.width,
+            height: (children?.length ?? 0) > 0 ? 150.0 : 50.0,
+            child: CompositedTransformFollower(
+              link: layerLink,
+              showWhenUnlinked: false,
+              offset: Offset(0.0, size.height + 5.0),
+              child: Material(
+                color: Theme.of(context).colorScheme.background,
+                shape: RoundedRectangleBorder(borderRadius: BorderRadius.circular(8.0)),
+                elevation: 4.0,
+                shadowColor: Colors.black,
+                child: (children?.length ?? 0) > 0
+                    ? ListView.builder(
+                        physics: const BouncingScrollPhysics(),
+                        padding: EdgeInsets.zero,
+                        shrinkWrap: true,
+                        itemCount: children?.length ?? 0,
+                        itemBuilder: (context, index) {
+                          return children?[index] ?? Container();
+                        },
+                      )
+                    : Center(
+                        child: Text("noresults".i18n),
+                      ),
+              ),
+            ),
+          )
+        : Container();
+  }
+}

refilc_mobile_ui/lib/screens/login/school_input/school_input_overlay.i18n.dart

@@ -0,0 +1,21 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension Localization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          "noresults": "No results!",
+        },
+        "hu_hu": {
+          "noresults": "Nincs találat!",
+        },
+        "de_de": {
+          "noresults": "Keine Treffer!",
+        },
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}

refilc_mobile_ui/lib/screens/login/school_input/school_input_tile.dart

@@ -0,0 +1,62 @@
+import 'package:refilc_kreta_api/models/school.dart';
+import 'package:flutter/material.dart';
+
+class SchoolInputTile extends StatelessWidget {
+  const SchoolInputTile({Key? key, required this.school, this.onTap})
+      : super(key: key);
+
+  final School school;
+  final Function()? onTap;
+
+  @override
+  Widget build(BuildContext context) {
+    return Padding(
+      padding: const EdgeInsets.all(4.0),
+      child: InkWell(
+        onTap: () {
+          onTap!();
+        },
+        borderRadius: BorderRadius.circular(6.0),
+        child: Padding(
+          padding: const EdgeInsets.all(6.0),
+          child: Column(
+            crossAxisAlignment: CrossAxisAlignment.start,
+            children: [
+              // School name
+              Padding(
+                padding: const EdgeInsets.only(bottom: 4.0),
+                child: Text(
+                  school.name,
+                  maxLines: 2,
+                  overflow: TextOverflow.ellipsis,
+                  style: const TextStyle(fontWeight: FontWeight.w600),
+                ),
+              ),
+              Row(
+                children: [
+                  // School id
+                  Expanded(
+                    child: Text(
+                      school.instituteCode,
+                      maxLines: 1,
+                      overflow: TextOverflow.ellipsis,
+                    ),
+                  ),
+                  // School city
+                  Expanded(
+                    child: Text(
+                      school.city,
+                      textAlign: TextAlign.right,
+                      maxLines: 1,
+                      overflow: TextOverflow.ellipsis,
+                    ),
+                  ),
+                ],
+              ),
+            ],
+          ),
+        ),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/login/school_input/school_search.dart

@@ -0,0 +1,25 @@
+import 'package:refilc_kreta_api/models/school.dart';
+import 'package:refilc/utils/format.dart';
+
+List<School> searchSchools(List<School> all, String pattern) {
+  pattern = pattern.toLowerCase().specialChars();
+  if (pattern == "") return all;
+
+  List<School> results = [];
+
+  for (var item in all) {
+    int contains = 0;
+
+    pattern.split(" ").forEach((variation) {
+      if (item.name.toLowerCase().specialChars().contains(variation)) {
+        contains++;
+      }
+    });
+
+    if (contains == pattern.split(" ").length) results.add(item);
+  }
+
+  results.sort((a, b) => a.name.compareTo(b.name));
+
+  return results;
+}

refilc_mobile_ui/lib/screens/navigation/nabar.dart

@@ -0,0 +1,32 @@
+import 'package:refilc_mobile_ui/screens/navigation/navbar_item.dart';
+import 'package:flutter/material.dart';
+
+class Navbar extends StatelessWidget {
+  const Navbar(
+      {Key? key,
+      required this.selectedIndex,
+      required this.onSelected,
+      required this.items})
+      : super(key: key);
+
+  final int selectedIndex;
+  final void Function(int index) onSelected;
+  final List<NavItem> items;
+
+  @override
+  Widget build(BuildContext context) {
+    final List<Widget> buttons = List.generate(
+      items.length,
+      (index) => NavbarItem(
+        item: items[index],
+        active: index == selectedIndex,
+        onTap: () => onSelected(index),
+      ),
+    );
+
+    return Row(
+      mainAxisAlignment: MainAxisAlignment.center,
+      children: buttons,
+    );
+  }
+}

refilc_mobile_ui/lib/screens/navigation/navbar_item.dart

@@ -0,0 +1,64 @@
+import 'package:flutter/material.dart';
+
+class NavItem {
+  final String title;
+  final Widget icon;
+  final Widget activeIcon;
+
+  const NavItem(
+      {required this.title, required this.icon, required this.activeIcon});
+}
+
+class NavbarItem extends StatelessWidget {
+  const NavbarItem({
+    Key? key,
+    required this.item,
+    required this.active,
+    required this.onTap,
+  }) : super(key: key);
+
+  final NavItem item;
+  final bool active;
+  final void Function() onTap;
+
+  @override
+  Widget build(BuildContext context) {
+    final Widget icon = active ? item.activeIcon : item.icon;
+
+    return SafeArea(
+      child: GestureDetector(
+        onTap: onTap,
+        child: Padding(
+          padding: const EdgeInsets.symmetric(vertical: 12.0, horizontal: 6.0),
+          child: Container(
+            padding: const EdgeInsets.all(12.0),
+            decoration: BoxDecoration(
+              color: active
+                  ? Theme.of(context).colorScheme.secondary.withOpacity(.4)
+                  : null,
+              borderRadius: BorderRadius.circular(14.0),
+            ),
+            child: Stack(
+              children: [
+                IconTheme(
+                  data: IconThemeData(
+                    color: Theme.of(context).colorScheme.secondary,
+                  ),
+                  child: icon,
+                ),
+                IconTheme(
+                  data: IconThemeData(
+                    color: Theme.of(context).brightness == Brightness.light
+                        ? Colors.black.withOpacity(.5)
+                        : Colors.white.withOpacity(.3),
+                  ),
+                  child: icon,
+                ),
+              ],
+            ),
+          ),
+        ),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/navigation/navigation_route.dart

@@ -0,0 +1,25 @@
+class NavigationRoute {
+  late String _name;
+  late int _index;
+
+  final List<String> _internalPageMap = [
+    "home",
+    "grades",
+    "timetable",
+    "messages",
+    "absences",
+  ];
+
+  String get name => _name;
+  int get index => _index;
+
+  set name(String n) {
+    _name = n;
+    _index = _internalPageMap.indexOf(n);
+  }
+
+  set index(int i) {
+    _index = i;
+    _name = _internalPageMap.elementAt(i);
+  }
+}

refilc_mobile_ui/lib/screens/navigation/navigation_route_handler.dart

@@ -0,0 +1,38 @@
+import 'package:refilc_mobile_ui/pages/absences/absences_page.dart';
+import 'package:refilc_mobile_ui/pages/grades/grades_page.dart';
+import 'package:refilc_mobile_ui/pages/home/home_page.dart';
+import 'package:refilc_mobile_ui/pages/messages/messages_page.dart';
+import 'package:refilc_mobile_ui/pages/timetable/timetable_page.dart';
+import 'package:flutter/material.dart';
+import 'package:animations/animations.dart';
+
+Route navigationRouteHandler(RouteSettings settings) {
+  switch (settings.name) {
+    case "home":
+      return navigationPageRoute((context) => const HomePage());
+    case "grades":
+      return navigationPageRoute((context) => const GradesPage());
+    case "timetable":
+      return navigationPageRoute((context) => const TimetablePage());
+    case "messages":
+      return navigationPageRoute((context) => const MessagesPage());
+    case "absences":
+      return navigationPageRoute((context) => const AbsencesPage());
+    default:
+      return navigationPageRoute((context) => const HomePage());
+  }
+}
+
+Route navigationPageRoute(Widget Function(BuildContext) builder) {
+  return PageRouteBuilder(
+    pageBuilder: (context, _, __) => builder(context),
+    transitionsBuilder: (context, animation, secondaryAnimation, child) {
+      return FadeThroughTransition(
+        fillColor: Theme.of(context).scaffoldBackgroundColor,
+        animation: animation,
+        secondaryAnimation: secondaryAnimation,
+        child: child,
+      );
+    },
+  );
+}

refilc_mobile_ui/lib/screens/navigation/navigation_screen.dart

@@ -0,0 +1,341 @@
+import 'package:refilc/api/providers/update_provider.dart';
+import 'package:refilc/helpers/quick_actions.dart';
+import 'package:refilc/models/settings.dart';
+import 'package:refilc/theme/observer.dart';
+import 'package:refilc_kreta_api/client/client.dart';
+import 'package:refilc_kreta_api/providers/grade_provider.dart';
+import 'package:refilc_mobile_ui/common/system_chrome.dart';
+import 'package:refilc_mobile_ui/screens/navigation/nabar.dart';
+import 'package:refilc_mobile_ui/screens/navigation/navbar_item.dart';
+import 'package:refilc_mobile_ui/screens/navigation/navigation_route.dart';
+import 'package:refilc_mobile_ui/screens/navigation/navigation_route_handler.dart';
+import 'package:refilc/icons/filc_icons.dart';
+import 'package:refilc_mobile_ui/screens/navigation/status_bar.dart';
+import 'package:refilc_mobile_ui/screens/news/news_view.dart';
+import 'package:refilc_mobile_ui/screens/settings/settings_screen.dart';
+import 'package:refilc_premium/ui/mobile/goal_planner/goal_complete_modal.dart';
+import 'package:flutter/foundation.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter/services.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'package:refilc_mobile_ui/common/screens.i18n.dart';
+import 'package:refilc/api/providers/news_provider.dart';
+import 'package:refilc/api/providers/sync.dart';
+import 'package:home_widget/home_widget.dart';
+import 'package:wtf_sliding_sheet/wtf_sliding_sheet.dart';
+import 'package:background_fetch/background_fetch.dart';
+import 'package:refilc_premium/providers/goal_provider.dart';
+import 'package:refilc/api/providers/ad_provider.dart';
+
+class NavigationScreen extends StatefulWidget {
+  const NavigationScreen({Key? key}) : super(key: key);
+
+  static NavigationScreenState? of(BuildContext context) =>
+      context.findAncestorStateOfType<NavigationScreenState>();
+
+  @override
+  NavigationScreenState createState() => NavigationScreenState();
+}
+
+class NavigationScreenState extends State<NavigationScreen>
+    with WidgetsBindingObserver {
+  late NavigationRoute selected;
+  List<String> initializers = [];
+  final _navigatorState = GlobalKey<NavigatorState>();
+
+  late SettingsProvider settings;
+  late NewsProvider newsProvider;
+  late GoalProvider goalProvider;
+  late UpdateProvider updateProvider;
+  late GradeProvider gradeProvicer;
+  late AdProvider adProvider;
+
+  NavigatorState? get navigator => _navigatorState.currentState;
+
+  void customRoute(Route route) => navigator?.pushReplacement(route);
+
+  bool init(String id) {
+    if (initializers.contains(id)) return false;
+
+    initializers.add(id);
+
+    return true;
+  }
+
+  void _checkForWidgetLaunch() {
+    HomeWidget.initiallyLaunchedFromHomeWidget().then(_launchedFromWidget);
+  }
+
+  void _launchedFromWidget(Uri? uri) async {
+    if (uri == null) return;
+
+    if (uri.scheme == "timetable" && uri.authority == "refresh") {
+      Navigator.of(context).popUntil((route) => route.isFirst);
+
+      setPage("timetable");
+      _navigatorState.currentState
+          ?.pushNamedAndRemoveUntil("timetable", (_) => false);
+    } else if (uri.scheme == "settings" && uri.authority == "premium") {
+      Navigator.of(context).popUntil((route) => route.isFirst);
+
+      showSlidingBottomSheet(
+        context,
+        useRootNavigator: true,
+        builder: (context) => SlidingSheetDialog(
+          color: Theme.of(context).scaffoldBackgroundColor,
+          duration: const Duration(milliseconds: 400),
+          scrollSpec: const ScrollSpec.bouncingScroll(),
+          snapSpec: const SnapSpec(
+            snap: true,
+            snappings: [1.0],
+            initialSnap: 1.0,
+            positioning: SnapPositioning.relativeToSheetHeight,
+          ),
+          cornerRadius: 16,
+          cornerRadiusOnFullscreen: 0,
+          builder: (context, state) => Material(
+            color: Theme.of(context).scaffoldBackgroundColor,
+            child: const SettingsScreen(),
+          ),
+        ),
+      );
+    }
+  }
+
+  // Platform messages are asynchronous, so we initialize in an async method.
+  Future<void> initPlatformState() async {
+    // Configure BackgroundFetch.
+    int status = await BackgroundFetch.configure(
+        BackgroundFetchConfig(
+            minimumFetchInterval: 15,
+            stopOnTerminate: false,
+            enableHeadless: true,
+            requiresBatteryNotLow: false,
+            requiresCharging: false,
+            requiresStorageNotLow: false,
+            requiresDeviceIdle: false,
+            requiredNetworkType: NetworkType.ANY), (String taskId) async {
+      // <-- Event handler
+      // This is the fetch-event callback.
+      if (kDebugMode) {
+        print("[BackgroundFetch] Event received $taskId");
+      }
+
+      // IMPORTANT:  You must signal completion of your task or the OS can punish your app
+      // for taking too long in the background.
+      BackgroundFetch.finish(taskId);
+    }, (String taskId) async {
+      // <-- Task timeout handler.
+      // This task has exceeded its allowed running-time.  You must stop what you're doing and immediately .finish(taskId)
+      if (kDebugMode) {
+        print("[BackgroundFetch] TASK TIMEOUT taskId: $taskId");
+      }
+      BackgroundFetch.finish(taskId);
+    });
+    if (kDebugMode) {
+      print('[BackgroundFetch] configure success: $status');
+    }
+
+    // If the widget was removed from the tree while the asynchronous platform
+    // message was in flight, we want to discard the reply rather than calling
+    // setState to update our non-existent appearance.
+    if (!mounted) return;
+  }
+
+  @override
+  void initState() {
+    super.initState();
+
+    HomeWidget.setAppGroupId('hu.refilc.naplo.group');
+
+    _checkForWidgetLaunch();
+    HomeWidget.widgetClicked.listen(_launchedFromWidget);
+
+    settings = Provider.of<SettingsProvider>(context, listen: false);
+    selected = NavigationRoute();
+    selected.index = settings.startPage.index; // set page index to start page
+
+    // add brightness observer
+    WidgetsBinding.instance.addObserver(this);
+
+    // set client User-Agent
+    Provider.of<KretaClient>(context, listen: false).userAgent =
+        settings.config.userAgent;
+
+    // get news
+    newsProvider = Provider.of<NewsProvider>(context, listen: false);
+    newsProvider.restore().then((value) => newsProvider.fetch());
+
+    // init grade provider (for goals)
+    gradeProvicer = Provider.of<GradeProvider>(context, listen: false);
+
+    // get goals
+    goalProvider = Provider.of<GoalProvider>(context, listen: false);
+    goalProvider.fetchDone(gradeProvider: gradeProvicer);
+
+    // get releases
+    updateProvider = Provider.of<UpdateProvider>(context, listen: false);
+    updateProvider.fetch();
+
+    // get advertisements
+    adProvider = Provider.of<AdProvider>(context, listen: false);
+    adProvider.fetch();
+
+    // initial sync
+    syncAll(context);
+    setupQuickActions();
+  }
+
+  @override
+  void dispose() {
+    WidgetsBinding.instance.removeObserver(this);
+    super.dispose();
+  }
+
+  @override
+  void didChangePlatformBrightness() {
+    if (settings.theme == ThemeMode.system) {
+      // ignore: deprecated_member_use
+      Brightness? brightness =
+          // ignore: deprecated_member_use
+          WidgetsBinding.instance.window.platformBrightness;
+      Provider.of<ThemeModeObserver>(context, listen: false).changeTheme(
+          brightness == Brightness.light ? ThemeMode.light : ThemeMode.dark);
+    }
+    super.didChangePlatformBrightness();
+  }
+
+  void setPage(String page) => setState(() => selected.name = page);
+
+  @override
+  Widget build(BuildContext context) {
+    setSystemChrome(context);
+    settings = Provider.of<SettingsProvider>(context);
+    newsProvider = Provider.of<NewsProvider>(context);
+    goalProvider = Provider.of<GoalProvider>(context);
+
+    // show news and complete goals
+    WidgetsBinding.instance.addPostFrameCallback((_) {
+      if (newsProvider.show) {
+        NewsView.show(newsProvider.news[0], context: context)
+            .then((value) => newsProvider.release());
+        newsProvider.lock();
+      }
+
+      if (goalProvider.hasDoneGoals) {
+        GoalCompleteModal.show(goalProvider.doneSubject!, context: context);
+        goalProvider.lock();
+      }
+    });
+
+    handleQuickActions(context, (page) {
+      setPage(page);
+      _navigatorState.currentState?.pushReplacementNamed(page);
+    });
+
+    return WillPopScope(
+      onWillPop: () async {
+        if (_navigatorState.currentState?.canPop() ?? false) {
+          _navigatorState.currentState?.pop();
+          if (!kDebugMode) {
+            return true;
+          }
+          return false;
+        }
+
+        if (selected.index != 0) {
+          setState(() => selected.index = 0);
+          _navigatorState.currentState?.pushReplacementNamed(selected.name);
+        }
+
+        return false;
+      },
+      child: Scaffold(
+        body: Column(
+          children: [
+            Expanded(
+              child: Stack(
+                alignment: Alignment.bottomCenter,
+                children: [
+                  Navigator(
+                    key: _navigatorState,
+                    initialRoute: selected.name,
+                    onGenerateRoute: (settings) =>
+                        navigationRouteHandler(settings),
+                  ),
+                ],
+              ),
+            ),
+
+            // Status bar
+            Material(
+              color: Theme.of(context).colorScheme.background,
+              child: const StatusBar(),
+            ),
+
+            // Bottom Navigaton Bar
+            Material(
+              color: Theme.of(context).scaffoldBackgroundColor,
+              child: MediaQuery.removePadding(
+                context: context,
+                removeTop: true,
+                child: Navbar(
+                  selectedIndex: selected.index,
+                  onSelected: onPageSelected,
+                  items: [
+                    NavItem(
+                      title: "home".i18n,
+                      icon: const Icon(FilcIcons.home),
+                      activeIcon: const Icon(FilcIcons.homefill),
+                    ),
+                    NavItem(
+                      title: "grades".i18n,
+                      icon: const Icon(FeatherIcons.bookmark),
+                      activeIcon: const Icon(FilcIcons.gradesfill),
+                    ),
+                    NavItem(
+                      title: "timetable".i18n,
+                      icon: const Icon(FeatherIcons.calendar),
+                      activeIcon: const Icon(FilcIcons.timetablefill),
+                    ),
+                    NavItem(
+                      title: "messages".i18n,
+                      icon: const Icon(FeatherIcons.messageSquare),
+                      activeIcon: const Icon(FilcIcons.messagesfill),
+                    ),
+                    NavItem(
+                      title: "absences".i18n,
+                      icon: const Icon(FeatherIcons.clock),
+                      activeIcon: const Icon(FilcIcons.absencesfill),
+                    ),
+                  ],
+                ),
+              ),
+            ),
+          ],
+        ),
+      ),
+    );
+  }
+
+  void onPageSelected(int index) {
+    // Vibrate, then set the active screen
+    if (selected.index != index) {
+      switch (settings.vibrate) {
+        case VibrationStrength.light:
+          HapticFeedback.lightImpact();
+          break;
+        case VibrationStrength.medium:
+          HapticFeedback.mediumImpact();
+          break;
+        case VibrationStrength.strong:
+          HapticFeedback.heavyImpact();
+          break;
+        default:
+      }
+      setState(() => selected.index = index);
+      _navigatorState.currentState?.pushReplacementNamed(selected.name);
+    }
+  }
+}

refilc_mobile_ui/lib/screens/navigation/status_bar.dart

@@ -0,0 +1,120 @@
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:refilc/utils/color.dart';
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import 'package:refilc/api/providers/status_provider.dart';
+import 'status_bar.i18n.dart';
+
+class StatusBar extends StatefulWidget {
+  const StatusBar({Key? key}) : super(key: key);
+
+  @override
+  _StatusBarState createState() => _StatusBarState();
+}
+
+class _StatusBarState extends State<StatusBar> {
+  late StatusProvider statusProvider;
+
+  @override
+  Widget build(BuildContext context) {
+    statusProvider = Provider.of<StatusProvider>(context);
+
+    Status? currentStatus = statusProvider.getStatus();
+    Color backgroundColor = _statusColor(currentStatus);
+    Color color = ColorUtils.foregroundColor(backgroundColor);
+
+    return AnimatedContainer(
+      duration: const Duration(milliseconds: 250),
+      curve: Curves.easeInOut,
+      height: currentStatus != null ? 32.0 : 0,
+      width: double.infinity,
+      color: Theme.of(context).scaffoldBackgroundColor,
+      child: Stack(
+        children: [
+          // Background
+          AnimatedContainer(
+            margin: const EdgeInsets.only(left: 6.0, right: 6.0, top: 8.0),
+            duration: const Duration(milliseconds: 250),
+            curve: Curves.easeInOut,
+            height: currentStatus != null ? 28.0 : 0,
+            decoration: BoxDecoration(
+              color: backgroundColor,
+              boxShadow: [
+                BoxShadow(color: Theme.of(context).shadowColor, blurRadius: 8.0)
+              ],
+              borderRadius: BorderRadius.circular(45.0),
+            ),
+          ),
+
+          // Progress bar
+          if (currentStatus == Status.syncing)
+            Container(
+              margin: const EdgeInsets.only(left: 6.0, right: 6.0, top: 8.0),
+              alignment: Alignment.bottomLeft,
+              child: AnimatedContainer(
+                height: currentStatus != null ? 28.0 : 0,
+                duration: const Duration(milliseconds: 250),
+                curve: Curves.easeInOut,
+                width: MediaQuery.of(context).size.width *
+                        statusProvider.progress -
+                    16.0,
+                decoration: BoxDecoration(
+                  color:
+                      Theme.of(context).colorScheme.secondary.withOpacity(0.8),
+                  borderRadius: BorderRadius.circular(45.0),
+                ),
+              ),
+            ),
+
+          // Text
+          Padding(
+            padding: const EdgeInsets.only(top: 8.0),
+            child: Center(
+              child: Text(
+                _statusString(currentStatus),
+                style: TextStyle(color: color, fontWeight: FontWeight.w500),
+              ),
+            ),
+          ),
+        ],
+      ),
+    );
+  }
+
+  String _statusString(Status? status) {
+    switch (status) {
+      case Status.syncing:
+        return "Syncing data".i18n;
+      case Status.maintenance:
+        return "KRETA Maintenance".i18n;
+      case Status.apiError:
+        return "KRETA API error".i18n;
+      case Status.network:
+        return "No connection".i18n;
+      default:
+        return "";
+    }
+  }
+
+  Color _statusColor(Status? status) {
+    switch (status) {
+      case Status.maintenance:
+        return AppColors.of(context).red;
+      case Status.apiError:
+        return AppColors.of(context).red;
+      case Status.network:
+      case Status.syncing:
+      default:
+        HSLColor color =
+            HSLColor.fromColor(Theme.of(context).scaffoldBackgroundColor);
+        if (color.lightness >= 0.5) {
+          color = color.withSaturation(0.3);
+          color = color.withLightness(color.lightness - 0.1);
+        } else {
+          color = color.withSaturation(0);
+          color = color.withLightness(color.lightness + 0.2);
+        }
+        return color.toColor();
+    }
+  }
+}

refilc_mobile_ui/lib/screens/navigation/status_bar.i18n.dart

@@ -0,0 +1,30 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension Localization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          "Syncing data": "Syncing data",
+          "KRETA Maintenance": "KRETA Maintenance",
+          "KRETA API error": "KRETA API Error",
+          "No connection": "No connection",
+        },
+        "hu_hu": {
+          "Syncing data": "Adatok frissítése",
+          "KRETA Maintenance": "KRÉTA Karbantartás",
+          "KRETA API error": "KRÉTA API Hiba",
+          "No connection": "Nincs kapcsolat",
+        },
+        "de_de": {
+          "Syncing data": "Daten aktualisieren",
+          "KRETA Maintenance": "KRETA Wartung",
+          "KRETA API error": "KRETA API Fehler",
+          "No connection": "Keine Verbindung",
+        },
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}

refilc_mobile_ui/lib/screens/news/news_screen.dart

@@ -0,0 +1,66 @@
+import 'dart:math';
+
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:refilc_mobile_ui/common/empty.dart';
+import 'package:refilc_mobile_ui/common/panel/panel.dart';
+import 'package:refilc_mobile_ui/screens/news/news_tile.dart';
+import 'package:refilc/models/news.dart';
+import 'package:refilc_mobile_ui/screens/news/news_view.dart';
+import 'package:refilc_mobile_ui/screens/settings/settings_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import 'package:refilc/api/providers/news_provider.dart';
+
+class NewsScreen extends StatelessWidget {
+  const NewsScreen({Key? key}) : super(key: key);
+
+  @override
+  Widget build(BuildContext context) {
+    var newsProvider = Provider.of<NewsProvider>(context);
+
+    List<News> news = [];
+    news = newsProvider.news.where((e) => e.title != "").toList();
+
+    return Scaffold(
+      appBar: AppBar(
+        surfaceTintColor: Theme.of(context).scaffoldBackgroundColor,
+        leading: BackButton(color: AppColors.of(context).text),
+        title: Text("news".i18n,
+            style: TextStyle(color: AppColors.of(context).text)),
+      ),
+      body: SafeArea(
+        child: RefreshIndicator(
+          onRefresh: () => newsProvider.fetch(),
+          child: ListView.builder(
+            physics: const BouncingScrollPhysics(
+                parent: AlwaysScrollableScrollPhysics()),
+            itemCount: max(news.length, 1),
+            itemBuilder: (context, index) {
+              if (news.isNotEmpty) {
+                return Padding(
+                  padding: const EdgeInsets.symmetric(
+                      horizontal: 24.0, vertical: 12.0),
+                  child: Panel(
+                    child: Material(
+                      type: MaterialType.transparency,
+                      child: NewsTile(
+                        news[index],
+                        onTap: () => NewsView.show(news[index],
+                            context: context, force: true),
+                      ),
+                    ),
+                  ),
+                );
+              } else {
+                return const Padding(
+                  padding: EdgeInsets.only(top: 24.0),
+                  child: Empty(subtitle: "Nothing to see here"),
+                );
+              }
+            },
+          ),
+        ),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/news/news_tile.dart

@@ -0,0 +1,30 @@
+import 'package:flutter/material.dart';
+import 'package:refilc/models/news.dart';
+import 'package:refilc/utils/format.dart';
+
+class NewsTile extends StatelessWidget {
+  const NewsTile(this.news, {Key? key, this.onTap}) : super(key: key);
+
+  final News news;
+  final Function()? onTap;
+
+  @override
+  Widget build(BuildContext context) {
+    return ListTile(
+      title: Text(
+        news.title,
+        maxLines: 1,
+        overflow: TextOverflow.ellipsis,
+        style: const TextStyle(fontWeight: FontWeight.w600),
+      ),
+      subtitle: Text(
+        news.content.escapeHtml().replaceAll("\n", " "),
+        maxLines: 2,
+        overflow: TextOverflow.ellipsis,
+        style: const TextStyle(fontWeight: FontWeight.w500),
+      ),
+      onTap: onTap,
+      shape: RoundedRectangleBorder(borderRadius: BorderRadius.circular(12.0)),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/news/news_view.dart

@@ -0,0 +1,137 @@
+import 'dart:io';
+
+import 'package:refilc/models/settings.dart';
+import 'package:refilc_mobile_ui/common/dialog_button.dart';
+import 'package:flutter/material.dart';
+import 'package:refilc/models/news.dart';
+import 'package:refilc/utils/format.dart';
+import 'package:flutter_custom_tabs/flutter_custom_tabs.dart';
+import 'package:flutter_linkify/flutter_linkify.dart';
+import 'package:provider/provider.dart';
+import 'package:refilc_mobile_ui/screens/settings/settings_screen.i18n.dart';
+
+class NewsView extends StatelessWidget {
+  const NewsView(this.news, {Key? key}) : super(key: key);
+
+  final News news;
+
+  @override
+  Widget build(BuildContext context) {
+    return Padding(
+      padding: const EdgeInsets.symmetric(vertical: 100.0, horizontal: 32.0),
+      child: Material(
+        borderRadius: BorderRadius.circular(12.0),
+        child: Padding(
+          padding: const EdgeInsets.symmetric(horizontal: 12.0, vertical: 4.0),
+          child: Column(
+            children: [
+              // Content
+              Expanded(
+                child: ListView(
+                  physics: const BouncingScrollPhysics(),
+                  children: [
+                    Padding(
+                      padding: const EdgeInsets.only(
+                          left: 8.0, right: 6.0, top: 14.0, bottom: 8.0),
+                      child: Text(
+                        news.title,
+                        maxLines: 3,
+                        style: const TextStyle(
+                            fontWeight: FontWeight.w600, fontSize: 18.0),
+                      ),
+                    ),
+                    SelectableLinkify(
+                      text: news.content.escapeHtml(),
+                      options:
+                          const LinkifyOptions(looseUrl: true, removeWww: true),
+                      onOpen: (link) {
+                        launch(
+                          link.url,
+                          customTabsOption: CustomTabsOption(
+                              showPageTitle: true,
+                              toolbarColor:
+                                  Theme.of(context).scaffoldBackgroundColor),
+                        );
+                      },
+                      style: const TextStyle(
+                          fontWeight: FontWeight.w500, fontSize: 14.0),
+                    ),
+                  ],
+                ),
+              ),
+
+              // Actions
+              Row(
+                mainAxisAlignment: MainAxisAlignment.end,
+                children: [
+                  if (news.link != "")
+                    DialogButton(
+                      label: news.openLabel != ""
+                          ? news.openLabel
+                          : "open".i18n.toUpperCase(),
+                      onTap: () => launch(
+                        news.link,
+                        customTabsOption: CustomTabsOption(
+                            showPageTitle: true,
+                            toolbarColor:
+                                Theme.of(context).scaffoldBackgroundColor),
+                      ),
+                    ),
+                  DialogButton(
+                    label: "done".i18n,
+                    onTap: () => Navigator.of(context).maybePop(),
+                  ),
+                ],
+              ),
+            ],
+          ),
+        ),
+      ),
+    );
+  }
+
+  static Future<T?> show<T>(News news,
+      {required BuildContext context, bool force = false}) {
+    if (news.title == "") return Future<T?>.value(null);
+
+    bool popup = news.platform == 'all' || force;
+
+    if (Provider.of<SettingsProvider>(context, listen: false).newsEnabled ||
+        news.emergency ||
+        force) {
+      switch (news.platform.trim().toLowerCase()) {
+        case "android":
+          if (Platform.isAndroid) popup = true;
+          break;
+        case "ios":
+          if (Platform.isIOS) popup = true;
+          break;
+        case "linux":
+          if (Platform.isLinux) popup = true;
+          break;
+        case "windows":
+          if (Platform.isWindows) popup = true;
+          break;
+        case "macos":
+          if (Platform.isMacOS) popup = true;
+          break;
+        case "all":
+          popup = true;
+          break;
+        default:
+          popup = true;
+      }
+    } else {
+      popup = false;
+    }
+
+    if (popup) {
+      return showDialog<T?>(
+          context: context,
+          builder: (context) => NewsView(news),
+          barrierDismissible: true);
+    } else {
+      return Future<T?>.value(null);
+    }
+  }
+}

refilc_mobile_ui/lib/screens/settings/accounts/account_tile.dart

@@ -0,0 +1,48 @@
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+
+class AccountTile extends StatelessWidget {
+  const AccountTile(
+      {Key? key,
+      this.onTap,
+      this.onTapMenu,
+      this.profileImage,
+      this.name,
+      this.username})
+      : super(key: key);
+
+  final void Function()? onTap;
+  final void Function()? onTapMenu;
+  final Widget? profileImage;
+  final Widget? name;
+  final Widget? username;
+
+  @override
+  Widget build(BuildContext context) {
+    return Material(
+      color: Colors.transparent,
+      child: ListTile(
+        visualDensity: VisualDensity.compact,
+        contentPadding: const EdgeInsets.only(left: 12.0),
+        shape: RoundedRectangleBorder(borderRadius: BorderRadius.circular(8.0)),
+        onTap: onTap,
+        onLongPress: onTapMenu,
+        leading: profileImage,
+        title: name,
+        subtitle: username,
+        trailing: onTapMenu != null
+            ? Material(
+                color: Colors.transparent,
+                child: IconButton(
+                  splashRadius: 24.0,
+                  onPressed: onTapMenu,
+                  icon: Icon(FeatherIcons.moreVertical,
+                      color: AppColors.of(context).text.withOpacity(0.8)),
+                ),
+              )
+            : null,
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/settings/accounts/account_view.dart

@@ -0,0 +1,61 @@
+import 'package:refilc/models/user.dart';
+import 'package:refilc_mobile_ui/common/bottom_card.dart';
+import 'package:refilc_mobile_ui/common/detail.dart';
+import 'package:refilc_mobile_ui/common/profile_image/profile_image.dart';
+import 'package:refilc_mobile_ui/screens/settings/accounts/account_tile.dart';
+import 'package:flutter/material.dart';
+import 'package:intl/intl.dart';
+import 'account_view.i18n.dart';
+
+class AccountView extends StatelessWidget {
+  const AccountView(this.user, {Key? key}) : super(key: key);
+
+  final User user;
+
+  static void show(User user, {required BuildContext context}) =>
+      showBottomCard(context: context, child: AccountView(user));
+
+  @override
+  Widget build(BuildContext context) {
+    List<String> _nameParts = user.name.split(" ");
+    String _firstName = _nameParts.length > 1 ? _nameParts[1] : _nameParts[0];
+
+    return Padding(
+      padding: const EdgeInsets.only(bottom: 12.0),
+      child: Column(
+        crossAxisAlignment: CrossAxisAlignment.start,
+        children: [
+          AccountTile(
+            profileImage: ProfileImage(
+              name: _firstName,
+              backgroundColor: Theme.of(context).colorScheme.primary,
+              role: user.role,
+            ),
+            name: SelectableText(
+              user.name,
+              style: const TextStyle(fontWeight: FontWeight.w500),
+              maxLines: 2,
+              minLines: 1,
+            ),
+            username: SelectableText(user.username),
+          ),
+
+          // User details
+          Detail(
+              title: "birthdate".i18n,
+              description:
+                  DateFormat("yyyy. MM. dd.").format(user.student.birth)),
+          Detail(title: "school".i18n, description: user.student.school.name),
+          if (user.student.className != null)
+            Detail(title: "class".i18n, description: user.student.className!),
+          if (user.student.address != null)
+            Detail(title: "address".i18n, description: user.student.address!),
+          if (user.student.parents.isNotEmpty)
+            Detail(
+                title: "parents".plural(user.student.parents.length),
+                description: user.student.parents.join(", ")),
+        ],
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/settings/accounts/account_view.i18n.dart

@@ -0,0 +1,33 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension Localization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          "birthdate": "Birth date",
+          "school": "School",
+          "class": "Class",
+          "address": "Home address",
+          "parents": "Parents".one("Parent"),
+        },
+        "hu_hu": {
+          "birthdate": "Születési dátum",
+          "school": "Iskola",
+          "class": "Osztály",
+          "address": "Lakcím",
+          "parents": "Szülők".one("Szülő"),
+        },
+        "de_de": {
+          "birthdate": "Geburtsdatum",
+          "school": "Schule",
+          "class": "Klasse",
+          "address": "Wohnanschrift",
+          "parents": "Eltern",
+        },
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}

refilc_mobile_ui/lib/screens/settings/debug/subject_icon_gallery.dart

@@ -0,0 +1,81 @@
+import 'package:refilc/helpers/subject.dart';
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:flutter/material.dart';
+
+class SubjectIconGallery extends StatelessWidget {
+  const SubjectIconGallery({Key? key}) : super(key: key);
+
+  @override
+  Widget build(BuildContext context) {
+    return Scaffold(
+      appBar: AppBar(
+        surfaceTintColor: Theme.of(context).scaffoldBackgroundColor,
+        leading: BackButton(color: AppColors.of(context).text),
+        title: Text(
+          "Subject Icon Gallery",
+          style: TextStyle(color: AppColors.of(context).text),
+        ),
+      ),
+      body: ListView(
+        children: const [
+          SubjectIconItem("Matematika"),
+          SubjectIconItem("Magyar Nyelv"),
+          SubjectIconItem("Nyelvtan"),
+          SubjectIconItem("Irodalom"),
+          SubjectIconItem("Történelem"),
+          SubjectIconItem("Földrajz"),
+          SubjectIconItem("Rajz"),
+          SubjectIconItem("Vizuális kultúra"),
+          SubjectIconItem("Fizika"),
+          SubjectIconItem("Ének"),
+          SubjectIconItem("Testnevelés"),
+          SubjectIconItem("Kémia"),
+          SubjectIconItem("Biológia"),
+          SubjectIconItem("Természetismeret"),
+          SubjectIconItem("Erkölcstan"),
+          SubjectIconItem("Pénzügy"),
+          SubjectIconItem("Informatika"),
+          SubjectIconItem("Digitális kultúra"),
+          SubjectIconItem("Programozás"),
+          SubjectIconItem("Hálózat"),
+          SubjectIconItem("Színház technika"),
+          SubjectIconItem("Média"),
+          SubjectIconItem("Elektronika"),
+          SubjectIconItem("Gépészet"),
+          SubjectIconItem("Technika"),
+          SubjectIconItem("Tánc"),
+          SubjectIconItem("Filozófia"),
+          SubjectIconItem("Osztályfőnöki"),
+          SubjectIconItem("Gazdaság"),
+          SubjectIconItem("Szorgalom"),
+          SubjectIconItem("Magatartás"),
+          SubjectIconItem("Angol nyelv"),
+          SubjectIconItem("Linux"),
+        ],
+      ),
+    );
+  }
+}
+
+class SubjectIconItem extends StatelessWidget {
+  const SubjectIconItem(this.name, {Key? key}) : super(key: key);
+
+  final String name;
+
+  @override
+  Widget build(BuildContext context) {
+    return ListTile(
+      leading: Icon(
+        SubjectIcon.resolveVariant(subjectName: name, context: context),
+        color: AppColors.of(context).text,
+      ),
+      title: Text(
+        name,
+        style: TextStyle(
+          color: AppColors.of(context).text,
+          fontWeight: FontWeight.w500,
+        ),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/settings/notifications_screen.dart

@@ -0,0 +1,226 @@
+import 'package:refilc/models/settings.dart';
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:refilc_mobile_ui/common/beta_chip.dart';
+import 'package:refilc_mobile_ui/common/panel/panel.dart';
+import 'package:refilc_mobile_ui/common/panel/panel_button.dart';
+import 'package:flutter/cupertino.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'notifications_screen.i18n.dart';
+
+class MenuNotifications extends StatelessWidget {
+  const MenuNotifications({Key? key, required this.settings}) : super(key: key);
+
+  final SettingsProvider settings;
+
+  @override
+  Widget build(BuildContext context) {
+    return PanelButton(
+      padding: const EdgeInsets.only(left: 14.0),
+      onPressed: () {
+        Navigator.of(context, rootNavigator: true).push(
+          CupertinoPageRoute(builder: (context) => const NotificationsScreen()),
+        );
+      },
+      title: Row(
+        children: [
+          Text(
+            "notifications_screen".i18n,
+            style: TextStyle(
+                color: AppColors.of(context)
+                    .text
+                    .withOpacity(settings.notificationsEnabled ? 1.0 : .5)),
+          ),
+          const SizedBox(width: 5.0),
+          BetaChip(
+            disabled: !settings.notificationsEnabled,
+          ),
+        ],
+      ),
+      leading: settings.notificationsEnabled
+          ? const Icon(FeatherIcons.messageSquare)
+          : Icon(FeatherIcons.messageSquare,
+              color: AppColors.of(context).text.withOpacity(.25)),
+      trailingDivider: true,
+      trailing: Switch(
+        onChanged: (v) async {
+          settings.update(notificationsEnabled: v);
+        },
+        value: settings.notificationsEnabled,
+        activeColor: Theme.of(context).colorScheme.secondary,
+      ),
+    );
+  }
+}
+
+class NotificationsScreen extends StatelessWidget {
+  const NotificationsScreen({super.key});
+
+  @override
+  Widget build(BuildContext context) {
+    SettingsProvider settings = Provider.of<SettingsProvider>(context);
+
+    return Scaffold(
+      appBar: AppBar(
+        surfaceTintColor: Theme.of(context).scaffoldBackgroundColor,
+        leading: BackButton(color: AppColors.of(context).text),
+        title: Text(
+          "notifications_screen".i18n,
+          style: TextStyle(color: AppColors.of(context).text),
+        ),
+      ),
+      body: SingleChildScrollView(
+        child: Padding(
+          padding: const EdgeInsets.symmetric(vertical: 16.0, horizontal: 24.0),
+          child: Panel(
+            child: Column(
+              children: [
+                Material(
+                  type: MaterialType.transparency,
+                  child: SwitchListTile(
+                    shape: RoundedRectangleBorder(
+                        borderRadius: BorderRadius.circular(12.0)),
+                    value: settings.notificationsGradesEnabled,
+                    onChanged: (v) =>
+                        settings.update(notificationsGradesEnabled: v),
+                    title: Row(
+                      children: [
+                        Icon(
+                          FeatherIcons.bookmark,
+                          color: settings.notificationsGradesEnabled
+                              ? Theme.of(context).colorScheme.secondary
+                              : AppColors.of(context).text.withOpacity(.25),
+                        ),
+                        const SizedBox(width: 14.0),
+                        Expanded(
+                          child: Text(
+                            "grades".i18n,
+                            style: TextStyle(
+                              fontWeight: FontWeight.w600,
+                              fontSize: 16.0,
+                              color: AppColors.of(context).text.withOpacity(
+                                    settings.notificationsGradesEnabled
+                                        ? 1.0
+                                        : .5,
+                                  ),
+                            ),
+                          ),
+                        ),
+                      ],
+                    ),
+                  ),
+                ),
+                Material(
+                  type: MaterialType.transparency,
+                  child: SwitchListTile(
+                    shape: RoundedRectangleBorder(
+                        borderRadius: BorderRadius.circular(12.0)),
+                    value: settings.notificationsAbsencesEnabled,
+                    onChanged: (v) =>
+                        settings.update(notificationsAbsencesEnabled: v),
+                    title: Row(
+                      children: [
+                        Icon(
+                          FeatherIcons.clock,
+                          color: settings.notificationsAbsencesEnabled
+                              ? Theme.of(context).colorScheme.secondary
+                              : AppColors.of(context).text.withOpacity(.25),
+                        ),
+                        const SizedBox(width: 14.0),
+                        Expanded(
+                          child: Text(
+                            "absences".i18n,
+                            style: TextStyle(
+                              fontWeight: FontWeight.w600,
+                              fontSize: 16.0,
+                              color: AppColors.of(context).text.withOpacity(
+                                    settings.notificationsAbsencesEnabled
+                                        ? 1.0
+                                        : .5,
+                                  ),
+                            ),
+                          ),
+                        ),
+                      ],
+                    ),
+                  ),
+                ),
+                Material(
+                  type: MaterialType.transparency,
+                  child: SwitchListTile(
+                    shape: RoundedRectangleBorder(
+                        borderRadius: BorderRadius.circular(12.0)),
+                    value: settings.notificationsMessagesEnabled,
+                    onChanged: (v) =>
+                        settings.update(notificationsMessagesEnabled: v),
+                    title: Row(
+                      children: [
+                        Icon(
+                          FeatherIcons.messageSquare,
+                          color: settings.notificationsMessagesEnabled
+                              ? Theme.of(context).colorScheme.secondary
+                              : AppColors.of(context).text.withOpacity(.25),
+                        ),
+                        const SizedBox(width: 14.0),
+                        Expanded(
+                          child: Text(
+                            "messages".i18n,
+                            style: TextStyle(
+                              fontWeight: FontWeight.w600,
+                              fontSize: 16.0,
+                              color: AppColors.of(context).text.withOpacity(
+                                    settings.notificationsMessagesEnabled
+                                        ? 1.0
+                                        : .5,
+                                  ),
+                            ),
+                          ),
+                        ),
+                      ],
+                    ),
+                  ),
+                ),
+                Material(
+                  type: MaterialType.transparency,
+                  child: SwitchListTile(
+                    shape: RoundedRectangleBorder(
+                        borderRadius: BorderRadius.circular(12.0)),
+                    value: settings.notificationsLessonsEnabled,
+                    onChanged: (v) =>
+                        settings.update(notificationsLessonsEnabled: v),
+                    title: Row(
+                      children: [
+                        Icon(
+                          FeatherIcons.calendar,
+                          color: settings.notificationsLessonsEnabled
+                              ? Theme.of(context).colorScheme.secondary
+                              : AppColors.of(context).text.withOpacity(.25),
+                        ),
+                        const SizedBox(width: 14.0),
+                        Expanded(
+                          child: Text(
+                            "lessons".i18n,
+                            style: TextStyle(
+                              fontWeight: FontWeight.w600,
+                              fontSize: 16.0,
+                              color: AppColors.of(context).text.withOpacity(
+                                    settings.notificationsLessonsEnabled
+                                        ? 1.0
+                                        : .5,
+                                  ),
+                            ),
+                          ),
+                        ),
+                      ],
+                    ),
+                  ),
+                ),
+              ],
+            ),
+          ),
+        ),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/settings/notifications_screen.i18n.dart

@@ -0,0 +1,34 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension SettingsLocalization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          "notifications_screen": "Notifications",
+          "grades": "Grades",
+          "absences": "Absences",
+          "messages": "Messages",
+          "lessons": "Lessons"
+          
+        },
+        "hu_hu": {
+          "notifications_screen": "Értesítések",
+          "grades": "Jegyek",
+          "absences": "Hiányzások",
+          "messages": "Üzenetek",
+          "lessons": "Órák"
+        },
+        "de_de": {
+          "notifications_screen": "Mitteilung",
+          "grades": "Noten",
+          "absences": "Fehlen",
+          "messages": "Nachrichten",
+          "lessons": "Unterricht"
+        },
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}

refilc_mobile_ui/lib/screens/settings/privacy_view.dart

@@ -0,0 +1,59 @@
+import 'package:flutter/material.dart';
+import 'package:flutter_custom_tabs/flutter_custom_tabs.dart';
+import 'package:flutter_linkify/flutter_linkify.dart';
+import 'settings_screen.i18n.dart';
+
+class PrivacyView extends StatelessWidget {
+  const PrivacyView({Key? key}) : super(key: key);
+
+  static void show(BuildContext context) => showDialog(
+      context: context,
+      builder: (context) => const PrivacyView(),
+      barrierDismissible: true);
+
+  @override
+  Widget build(BuildContext context) {
+    return Padding(
+      padding: const EdgeInsets.symmetric(vertical: 100.0, horizontal: 32.0),
+      child: Material(
+        borderRadius: BorderRadius.circular(12.0),
+        child: Padding(
+          padding: const EdgeInsets.all(12.0),
+          child: ListView(
+            physics: const BouncingScrollPhysics(),
+            children: [
+              Padding(
+                padding: const EdgeInsets.all(8.0),
+                child: Text("privacy".i18n),
+              ),
+              SelectableLinkify(
+                text: """
+  • A reFilc (továbbiakban alkalmazás) egy mobilos, asztali és webes kliensalkalmazás, segítségével az e-Kréta rendszeréből letöltheted és felhasználóbarát módon megjelenítheted az adataidat. Tanulmányi adataid csak közvetlenül az alkalmazás és a Kréta-szerverek között közlekednek, titkosított kapcsolaton keresztül.
+
+  • A reFilc fejlesztői és/vagy üzemeltetői, valamint az alkalmazás a tanulmányi és személyes adataidat semmilyen célból és semmilyen körülmények között nem másolják, nem tárolják és harmadik félnek nem továbbítják. Ezeket így az Educational Development Informatikai Zrt. kezeli, az Ő adatkezeléssel kapcsolatos tájékoztatójukat itt találod: https://tudasbazis.ekreta.hu/pages/viewpage.action?pageId=4065038
+
+  • Azok törlésével vagy módosítával kapcsolatban keresd az osztályfőnöködet vagy az iskolád rendszergazdáját.
+
+  • Az alkalmazás névtelen használati statisztikákat gyűjt, ezek alapján tudjuk meghatározni a felhasználók és a telepítések számát, valamint az eszközük platformját. Ezt a beállításokban kikapcsolhatod. Kérünk, hogy ha csak teheted, hagyd ezt a funkciót bekapcsolva, hogy pontosabb információnk legyen a felhasználóink platform-megoszlásáról.
+
+  • Amikor az alkalmazás hibába ütközik, lehetőség van hibajelentés küldésére. Ez személyes- és/vagy tanulmányi adatokat nem tartalmaz, viszont részletes információval szolgál a hibáról, annak okáról és eszközödről. A küldés előtt megjelenő képernyőn a te felelősséged átnézni a továbbításra kerülő adatsort. A hibajelentéseket a reFilc fejlesztői felületén és egy privát Discord szobában tároljuk, ezekhez csak az app fejlesztői férnek hozzá.
+
+  • Az alkalmazás (az alábbi platformokon: Android, Linux, Windows) minden egyes indításakor a reFilc API, valamint a Github API segítségével ellenőrzi, hogy elérhető-e új verzió, és kérésre innen letölti és telepíti a frissítést.
+
+  • Amennyiben az adataiddal kapcsolatban bármilyen kérdésed van (megtekintés, törlés, módosítás, adathordozás), keress minket a social@refilc.hu e-mail címen, vagy Discord szerverünkön!
+  
+  • A kliensalkalmazás bármely eszközön és platformon történő használatával tudomásul vetted és elfogadod a jelen adatkezelési tájékoztatót. A reFilc csapata fenntartja a jogot a tájékoztató módosítására és a módosításokról nem köteles értesíteni a felhasználóit!
+""",
+                onOpen: (link) => launch(link.url,
+                    customTabsOption: CustomTabsOption(
+                      toolbarColor: Theme.of(context).scaffoldBackgroundColor,
+                      showPageTitle: true,
+                    )),
+              ),
+            ],
+          ),
+        ),
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/settings/settings_helper.dart

@@ -0,0 +1,680 @@
+// ignore_for_file: prefer_function_declarations_over_variables
+
+import 'dart:io';
+
+import 'package:refilc/helpers/quick_actions.dart';
+import 'package:refilc/icons/filc_icons.dart';
+import 'package:refilc/models/settings.dart';
+import 'package:refilc/theme/colors/colors.dart';
+import 'package:refilc/theme/observer.dart';
+import 'package:refilc_kreta_api/models/grade.dart';
+import 'package:refilc_kreta_api/models/week.dart';
+import 'package:refilc_kreta_api/providers/timetable_provider.dart';
+import 'package:refilc_mobile_ui/common/bottom_sheet_menu/bottom_sheet_menu.dart';
+import 'package:refilc_mobile_ui/common/bottom_sheet_menu/bottom_sheet_menu_item.dart';
+import 'package:refilc_mobile_ui/common/bottom_sheet_menu/rounded_bottom_sheet.dart';
+import 'package:refilc_mobile_ui/common/filter_bar.dart';
+import 'package:refilc_mobile_ui/common/material_action_button.dart';
+import 'package:refilc/ui/widgets/grade/grade_tile.dart';
+import 'package:flutter/cupertino.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter/services.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:i18n_extension/i18n_widget.dart';
+import 'package:provider/provider.dart';
+import 'package:refilc_mobile_ui/common/screens.i18n.dart';
+import 'package:refilc_mobile_ui/screens/settings/settings_screen.i18n.dart';
+import 'package:flutter_material_color_picker/flutter_material_color_picker.dart';
+import 'package:refilc/models/icon_pack.dart';
+import 'package:refilc/utils/format.dart';
+import 'package:refilc_premium/ui/mobile/settings/theme.dart';
+
+class SettingsHelper {
+  static const Map<String, String> langMap = {
+    "en": "🇬🇧  English",
+    "hu": "🇭🇺  Magyar",
+    "de": "🇩🇪  Deutsch"
+  };
+
+  static const Map<Pages, String> pageTitle = {
+    Pages.home: "home",
+    Pages.grades: "grades",
+    Pages.timetable: "timetable",
+    Pages.messages: "messages",
+    Pages.absences: "absences",
+  };
+
+  static Map<VibrationStrength, String> vibrationTitle = {
+    VibrationStrength.off: "voff",
+    VibrationStrength.light: "vlight",
+    VibrationStrength.medium: "vmedium",
+    VibrationStrength.strong: "vstrong",
+  };
+
+  static Map<Pages, String> localizedPageTitles() => pageTitle
+      .map((key, value) => MapEntry(key, ScreensLocalization(value).i18n));
+  static Map<VibrationStrength, String> localizedVibrationTitles() =>
+      vibrationTitle
+          .map((key, value) => MapEntry(key, SettingsLocalization(value).i18n));
+
+  static void language(BuildContext context) {
+    showBottomSheetMenu(
+      context,
+      items: List.generate(langMap.length, (index) {
+        String lang = langMap.keys.toList()[index];
+        return BottomSheetMenuItem(
+          onPressed: () {
+            Provider.of<SettingsProvider>(context, listen: false)
+                .update(language: lang);
+            I18n.of(context).locale = Locale(lang, lang.toUpperCase());
+            Navigator.of(context).maybePop();
+            if (Platform.isAndroid || Platform.isIOS) {
+              setupQuickActions();
+            }
+          },
+          title: Row(
+            mainAxisAlignment: MainAxisAlignment.spaceBetween,
+            children: [
+              Text(langMap.values.toList()[index]),
+              if (lang == I18n.of(context).locale.languageCode)
+                Icon(
+                  Icons.check_circle,
+                  color: Theme.of(context).colorScheme.secondary,
+                ),
+            ],
+          ),
+        );
+      }),
+    );
+  }
+
+  static void uwuMode(BuildContext context, value) {
+    final settings = Provider.of<SettingsProvider>(context, listen: false);
+    if (value) {
+      I18n.of(context).locale = const Locale('uw', 'UW');
+    } else {
+      I18n.of(context).locale =
+          Locale(settings.language, settings.language.toUpperCase());
+    }
+    if (Platform.isAndroid || Platform.isIOS) {
+      setupQuickActions();
+    }
+  }
+
+  static void iconPack(BuildContext context) {
+    final settings = Provider.of<SettingsProvider>(context, listen: false);
+    showBottomSheetMenu(
+      context,
+      items: List.generate(IconPack.values.length, (index) {
+        IconPack current = IconPack.values[index];
+        return BottomSheetMenuItem(
+          onPressed: () {
+            settings.update(iconPack: current);
+            Navigator.of(context).maybePop();
+          },
+          title: Row(
+            mainAxisAlignment: MainAxisAlignment.spaceBetween,
+            children: [
+              Text(current.name.capital()),
+              if (current == settings.iconPack)
+                Icon(
+                  Icons.check_circle,
+                  color: Theme.of(context).colorScheme.secondary,
+                ),
+            ],
+          ),
+        );
+      }),
+    );
+  }
+
+  static void startPage(BuildContext context) {
+    Map<Pages, IconData> pageIcons = {
+      Pages.home: FilcIcons.home,
+      Pages.grades: FeatherIcons.bookmark,
+      Pages.timetable: FeatherIcons.calendar,
+      Pages.messages: FeatherIcons.messageSquare,
+      Pages.absences: FeatherIcons.clock,
+    };
+
+    showBottomSheetMenu(
+      context,
+      items: List.generate(Pages.values.length, (index) {
+        return BottomSheetMenuItem(
+          onPressed: () {
+            Provider.of<SettingsProvider>(context, listen: false)
+                .update(startPage: Pages.values[index]);
+            Navigator.of(context).maybePop();
+          },
+          title: Row(
+            children: [
+              Icon(pageIcons[Pages.values[index]],
+                  size: 20.0, color: Theme.of(context).colorScheme.secondary),
+              const SizedBox(width: 16.0),
+              Text(localizedPageTitles()[Pages.values[index]] ?? ""),
+              const Spacer(),
+              if (Pages.values[index] ==
+                  Provider.of<SettingsProvider>(context, listen: false)
+                      .startPage)
+                Icon(
+                  Icons.check_circle,
+                  color: Theme.of(context).colorScheme.secondary,
+                ),
+            ],
+          ),
+        );
+      }),
+    );
+  }
+
+  static void rounding(BuildContext context) {
+    showRoundedModalBottomSheet(
+      context,
+      child: const RoundingSetting(),
+    );
+  }
+
+  static void theme(BuildContext context) {
+    var settings = Provider.of<SettingsProvider>(context, listen: false);
+    void Function(ThemeMode) setTheme = (mode) {
+      settings.update(theme: mode);
+      Provider.of<ThemeModeObserver>(context, listen: false).changeTheme(mode);
+      Navigator.of(context).maybePop();
+    };
+
+    showBottomSheetMenu(context, items: [
+      BottomSheetMenuItem(
+        onPressed: () => setTheme(ThemeMode.system),
+        title: Row(
+          children: [
+            Padding(
+              padding: const EdgeInsets.only(right: 16.0),
+              child: Icon(FeatherIcons.smartphone,
+                  size: 20.0, color: Theme.of(context).colorScheme.secondary),
+            ),
+            Text(SettingsLocalization("system").i18n),
+            const Spacer(),
+            if (settings.theme == ThemeMode.system)
+              Icon(
+                Icons.check_circle,
+                color: Theme.of(context).colorScheme.secondary,
+              ),
+          ],
+        ),
+      ),
+      BottomSheetMenuItem(
+        onPressed: () => setTheme(ThemeMode.light),
+        title: Row(
+          children: [
+            Padding(
+              padding: const EdgeInsets.only(right: 16.0),
+              child: Icon(FeatherIcons.sun,
+                  size: 20.0, color: Theme.of(context).colorScheme.secondary),
+            ),
+            Text(SettingsLocalization("light").i18n),
+            const Spacer(),
+            if (settings.theme == ThemeMode.light)
+              Icon(
+                Icons.check_circle,
+                color: Theme.of(context).colorScheme.secondary,
+              ),
+          ],
+        ),
+      ),
+      BottomSheetMenuItem(
+        onPressed: () => setTheme(ThemeMode.dark),
+        title: Row(
+          children: [
+            Padding(
+              padding: const EdgeInsets.only(right: 16.0),
+              child: Icon(FeatherIcons.moon,
+                  size: 20.0, color: Theme.of(context).colorScheme.secondary),
+            ),
+            Text(SettingsLocalization("dark").i18n),
+            const Spacer(),
+            if (settings.theme == ThemeMode.dark)
+              Icon(
+                Icons.check_circle,
+                color: Theme.of(context).colorScheme.secondary,
+              ),
+          ],
+        ),
+      )
+    ]);
+  }
+
+  static void accentColor(BuildContext context) {
+    Navigator.of(context, rootNavigator: true).push(
+      PageRouteBuilder(
+        pageBuilder: (context, _, __) =>
+            const PremiumCustomAccentColorSetting(),
+        transitionDuration: Duration.zero,
+        reverseTransitionDuration: Duration.zero,
+      ),
+    );
+  }
+
+  static void gradeColors(BuildContext context) {
+    showRoundedModalBottomSheet(
+      context,
+      child: const GradeColorsSetting(),
+    );
+  }
+
+  static void liveActivityColor(BuildContext context) {
+    showRoundedModalBottomSheet(
+      context,
+      child: const LiveActivityColorSetting(),
+    );
+  }
+
+  static void vibrate(BuildContext context) {
+    showBottomSheetMenu(
+      context,
+      items: List.generate(VibrationStrength.values.length, (index) {
+        VibrationStrength value = VibrationStrength.values[index];
+
+        return BottomSheetMenuItem(
+          onPressed: () {
+            Provider.of<SettingsProvider>(context, listen: false)
+                .update(vibrate: value);
+            Navigator.of(context).maybePop();
+          },
+          title: Row(
+            children: [
+              Container(
+                width: 12.0,
+                height: 12.0,
+                decoration: BoxDecoration(
+                  color: Theme.of(context)
+                      .colorScheme
+                      .secondary
+                      .withOpacity((index + 1) / (vibrationTitle.length + 1)),
+                  shape: BoxShape.circle,
+                ),
+              ),
+              const SizedBox(width: 16.0),
+              Text(localizedVibrationTitles()[value] ?? "?"),
+              const Spacer(),
+              if (value ==
+                  Provider.of<SettingsProvider>(context, listen: false).vibrate)
+                Icon(
+                  Icons.check_circle,
+                  color: Theme.of(context).colorScheme.secondary,
+                ),
+            ],
+          ),
+        );
+      }),
+    );
+  }
+
+  static void bellDelay(BuildContext context) {
+    showRoundedModalBottomSheet(
+      context,
+      child: const BellDelaySetting(),
+    );
+  }
+}
+
+// Rounding modal
+class RoundingSetting extends StatefulWidget {
+  const RoundingSetting({Key? key}) : super(key: key);
+
+  @override
+  _RoundingSettingState createState() => _RoundingSettingState();
+}
+
+class _RoundingSettingState extends State<RoundingSetting> {
+  late double rounding;
+
+  @override
+  void initState() {
+    super.initState();
+    rounding =
+        Provider.of<SettingsProvider>(context, listen: false).rounding / 10;
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    int roundingResult;
+
+    if (4.5 >= 4.5.floor() + rounding) {
+      roundingResult = 5;
+    } else {
+      roundingResult = 4;
+    }
+
+    return Column(children: [
+      Row(
+        mainAxisAlignment: MainAxisAlignment.spaceBetween,
+        children: [
+          Expanded(
+            child: Slider(
+              value: rounding,
+              min: 0.1,
+              max: 0.9,
+              divisions: 8,
+              label: rounding.toStringAsFixed(1),
+              activeColor: Theme.of(context).colorScheme.secondary,
+              thumbColor: Theme.of(context).colorScheme.secondary,
+              onChanged: (v) => setState(() => rounding = v),
+            ),
+          ),
+          Container(
+            width: 50.0,
+            padding: const EdgeInsets.only(right: 16.0),
+            child: Center(
+              child: Text(rounding.toStringAsFixed(1),
+                  style: const TextStyle(
+                    fontWeight: FontWeight.w600,
+                    fontSize: 18.0,
+                  )),
+            ),
+          ),
+        ],
+      ),
+      Row(
+        mainAxisAlignment: MainAxisAlignment.center,
+        children: [
+          const Text("4.5",
+              style: TextStyle(fontSize: 26.0, fontWeight: FontWeight.w500)),
+          const Padding(
+            padding: EdgeInsets.symmetric(horizontal: 24.0),
+            child: Icon(FeatherIcons.arrowRight, color: Colors.grey),
+          ),
+          GradeValueWidget(GradeValue(roundingResult, "", "", 100),
+              fill: true, size: 32.0),
+        ],
+      ),
+      Padding(
+        padding: const EdgeInsets.only(bottom: 12.0, top: 6.0),
+        child: MaterialActionButton(
+          child: Text(SettingsLocalization("done").i18n),
+          onPressed: () {
+            Provider.of<SettingsProvider>(context, listen: false)
+                .update(rounding: (rounding * 10).toInt());
+            Navigator.of(context).maybePop();
+          },
+        ),
+      ),
+    ]);
+  }
+}
+
+// Bell Delay Modal
+
+class BellDelaySetting extends StatefulWidget {
+  const BellDelaySetting({Key? key}) : super(key: key);
+
+  @override
+  State<BellDelaySetting> createState() => _BellDelaySettingState();
+}
+
+class _BellDelaySettingState extends State<BellDelaySetting>
+    with SingleTickerProviderStateMixin {
+  late TabController _tabController;
+  late Duration currentDelay;
+
+  @override
+  void initState() {
+    super.initState();
+    _tabController = TabController(
+        length: 2,
+        vsync: this,
+        initialIndex:
+            Provider.of<SettingsProvider>(context, listen: false).bellDelay > 0
+                ? 1
+                : 0);
+    currentDelay = Duration(
+        seconds:
+            Provider.of<SettingsProvider>(context, listen: false).bellDelay);
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(
+      children: [
+        FilterBar(
+          scrollable: false,
+          items: [
+            Tab(text: SettingsLocalization("delay").i18n),
+            Tab(text: SettingsLocalization("hurry").i18n),
+          ],
+          controller: _tabController,
+          onTap: (i) async {
+            // swap current page with target page
+            setState(() {
+              currentDelay = i == 0 ? -currentDelay.abs() : currentDelay.abs();
+            });
+          },
+        ),
+        SizedBox(
+          height: 200,
+          child: CupertinoTheme(
+            data: CupertinoThemeData(
+              brightness: Theme.of(context).brightness,
+            ),
+            child: CupertinoTimerPicker(
+              key: UniqueKey(),
+              mode: CupertinoTimerPickerMode.ms,
+              initialTimerDuration: currentDelay.abs(),
+              onTimerDurationChanged: (Duration d) {
+                HapticFeedback.selectionClick();
+
+                currentDelay = _tabController.index == 0 ? -d : d;
+              },
+            ),
+          ),
+        ),
+        Text(SettingsLocalization("sync_help").i18n,
+            textAlign: TextAlign.center,
+            style: TextStyle(
+                fontSize: 12.0,
+                fontWeight: FontWeight.w500,
+                color: AppColors.of(context).text.withOpacity(.75))),
+        Padding(
+          padding: const EdgeInsets.only(bottom: 12.0, top: 6.0),
+          child: Column(
+            children: [
+              MaterialActionButton(
+                backgroundColor: AppColors.of(context).filc,
+                child: Text(SettingsLocalization("sync").i18n),
+                onPressed: () {
+                  final lessonProvider =
+                      Provider.of<TimetableProvider>(context, listen: false);
+
+                  Duration? closest;
+                  DateTime now = DateTime.now();
+                  for (var lesson
+                      in lessonProvider.getWeek(Week.current()) ?? []) {
+                    Duration sdiff = lesson.start.difference(now);
+                    Duration ediff = lesson.end.difference(now);
+
+                    if (closest == null || sdiff.abs() < closest.abs()) {
+                      closest = sdiff;
+                    }
+                    if (ediff.abs() < closest.abs()) closest = ediff;
+                  }
+                  if (closest != null) {
+                    if (closest.inHours.abs() >= 1) return;
+                    currentDelay = closest;
+                    Provider.of<SettingsProvider>(context, listen: false)
+                        .update(bellDelay: currentDelay.inSeconds);
+                    _tabController.index = currentDelay.inSeconds > 0 ? 1 : 0;
+                    setState(() {});
+                  }
+                },
+              ),
+              MaterialActionButton(
+                child: Text(SettingsLocalization("done").i18n),
+                onPressed: () {
+                  //Provider.of<SettingsProvider>(context, listen: false).update(context, rounding: (r * 10).toInt());
+                  Provider.of<SettingsProvider>(context, listen: false)
+                      .update(bellDelay: currentDelay.inSeconds);
+                  Navigator.of(context).maybePop();
+                },
+              ),
+            ],
+          ),
+        ),
+      ],
+    );
+  }
+}
+
+class GradeColorsSetting extends StatefulWidget {
+  const GradeColorsSetting({Key? key}) : super(key: key);
+
+  @override
+  _GradeColorsSettingState createState() => _GradeColorsSettingState();
+}
+
+class _GradeColorsSettingState extends State<GradeColorsSetting> {
+  Color currentColor = const Color(0x00000000);
+  late SettingsProvider settings;
+
+  @override
+  void initState() {
+    super.initState();
+    settings = Provider.of<SettingsProvider>(context, listen: false);
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(children: [
+      Padding(
+        padding: const EdgeInsets.all(8.0),
+        child: Row(
+          mainAxisAlignment: MainAxisAlignment.spaceEvenly,
+          children: List.generate(5, (index) {
+            return ClipOval(
+              child: Material(
+                type: MaterialType.transparency,
+                child: InkWell(
+                  onTap: () {
+                    currentColor = settings.gradeColors[index];
+                    showRoundedModalBottomSheet(
+                      context,
+                      child: Column(children: [
+                        MaterialColorPicker(
+                          selectedColor: settings.gradeColors[index],
+                          onColorChange: (v) {
+                            setState(() {
+                              currentColor = v;
+                            });
+                          },
+                          allowShades: true,
+                          elevation: 0,
+                          physics: const NeverScrollableScrollPhysics(),
+                        ),
+                        Padding(
+                          padding: const EdgeInsets.only(bottom: 8.0),
+                          child: Row(
+                            mainAxisAlignment: MainAxisAlignment.spaceEvenly,
+                            children: [
+                              MaterialActionButton(
+                                onPressed: () {
+                                  List<Color> colors =
+                                      List.castFrom(settings.gradeColors);
+                                  var defaultColors =
+                                      SettingsProvider.defaultSettings()
+                                          .gradeColors;
+                                  colors[index] = defaultColors[index];
+                                  settings.update(gradeColors: colors);
+                                  Navigator.of(context).maybePop();
+                                },
+                                child: Text(SettingsLocalization("reset").i18n),
+                              ),
+                              MaterialActionButton(
+                                onPressed: () {
+                                  List<Color> colors =
+                                      List.castFrom(settings.gradeColors);
+                                  colors[index] = currentColor.withAlpha(255);
+                                  settings.update(
+                                      gradeColors: settings.gradeColors);
+                                  Navigator.of(context).maybePop();
+                                },
+                                child: Text(SettingsLocalization("done").i18n),
+                              ),
+                            ],
+                          ),
+                        ),
+                      ]),
+                    ).then((value) => setState(() {}));
+                  },
+                  child: GradeValueWidget(GradeValue(index + 1, "", "", 0),
+                      fill: true, size: 36.0),
+                ),
+              ),
+            );
+          }),
+        ),
+      ),
+    ]);
+  }
+}
+
+class LiveActivityColorSetting extends StatefulWidget {
+  const LiveActivityColorSetting({Key? key}) : super(key: key);
+
+  @override
+  _LiveActivityColorSettingState createState() =>
+      _LiveActivityColorSettingState();
+}
+
+class _LiveActivityColorSettingState extends State<LiveActivityColorSetting> {
+  late SettingsProvider settings;
+  Color currentColor = const Color(0x00000000);
+
+  @override
+  void initState() {
+    super.initState();
+    settings = Provider.of<SettingsProvider>(context, listen: false);
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(children: [
+      Padding(
+        padding: const EdgeInsets.all(8.0),
+        child: Material(
+          type: MaterialType.transparency,
+          child: Column(children: [
+            MaterialColorPicker(
+              allowShades: false,
+              selectedColor: settings.liveActivityColor,
+              onMainColorChange: (k) {
+                setState(() {
+                  currentColor = k as Color;
+                  settings.update(
+                      liveActivityColor: currentColor.withAlpha(255));
+                  Navigator.of(context).maybePop();
+                });
+              },
+              elevation: 0,
+              physics: const NeverScrollableScrollPhysics(),
+            ),
+            Padding(
+              padding: const EdgeInsets.only(bottom: 8.0, top: 40.0),
+              child: Row(
+                mainAxisAlignment: MainAxisAlignment.spaceEvenly,
+                children: [
+                  MaterialActionButton(
+                    onPressed: () {
+                      var defaultColors =
+                          SettingsProvider.defaultSettings().liveActivityColor;
+                      settings.update(liveActivityColor: defaultColors);
+                      Navigator.of(context).maybePop();
+                    },
+                    child: Text(SettingsLocalization("reset").i18n),
+                  ),
+                ],
+              ),
+            ),
+          ]),
+        ),
+      ),
+    ]);
+  }
+}

refilc_mobile_ui/lib/screens/settings/settings_route.dart

@@ -0,0 +1,21 @@
+import 'package:flutter/material.dart';
+
+Route settingsRoute(Widget widget) {
+  return PageRouteBuilder(
+    pageBuilder: (context, animation, secondaryAnimation) => widget,
+    transitionDuration: const Duration(milliseconds: 500),
+    transitionsBuilder: (context, animation, secondaryAnimation, child) {
+      var curve = Curves.ease;
+      var curveTween = CurveTween(curve: curve);
+      var begin = const Offset(0.0, 1.0);
+      var end = Offset.zero;
+      var tween = Tween(begin: begin, end: end).chain(curveTween);
+      var offsetAnimation = animation.drive(tween);
+
+      return SlideTransition(
+        position: offsetAnimation,
+        child: child,
+      );
+    },
+  );
+}

refilc_mobile_ui/lib/screens/settings/settings_screen.i18n.dart

@@ -0,0 +1,224 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension SettingsLocalization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          "personal_details": "Personal Details",
+          "open_dkt": "Open DKT",
+          "edit_nickname": "Edit Nickname",
+          "edit_profile_picture": "Edit Profile Picture",
+          "remove_profile_picture": "Remove Profile Picture",
+          "select_profile_picture": "to select a picture",
+          "click_here": "Click here",
+          "light": "Light",
+          "dark": "Dark",
+          "system": "System",
+          "add_user": "Add User",
+          "log_out": "Log Out",
+          "update_available": "Update Available",
+          "general": "General",
+          "language": "Language",
+          "startpage": "Startpage",
+          "rounding": "Rounding",
+          "appearance": "Appearance",
+          "theme": "Theme",
+          "color": "Color",
+          "grade_colors": "Grade Colors",
+          "live_activity_color": "Live Activity Color",
+          "notifications": "Notifications",
+          "popups": "Pop-up Alerts",
+          "news": "News",
+          "extras": "Extras",
+          "about": "About",
+          "supporters": "Supporters",
+          "privacy": "Privacy Policy",
+          "licenses": "Licenses",
+          "vibrate": "Vibration",
+          "voff": "Off",
+          "vlight": "Light",
+          "vmedium": "Medium",
+          "vstrong": "Strong",
+          "cancel": "Cancel",
+          "done": "Done",
+          "reset": "Reset",
+          "open": "Open",
+          "data_collected":
+              "Data collected: Platform (eg. Android), App version (eg. 3.0.0), Unique Install Identifier",
+          "Analytics": "Analytics",
+          "Anonymous Usage Analytics": "Anonymous Usage Analytics",
+          "graph_class_avg": "Class average on graph",
+          "goodstudent": "Good student mode",
+          "attention": "Attention!",
+          "goodstudent_disclaimer":
+              "reFilc can not be held liable for the usage of this feature.\n\n(if your mother beats you up because you showed her fake grades, you can only blame yourself for it)",
+          "understand": "I understand",
+          "secret": "Secret Settings",
+          "bell_delay": "Bell Delay",
+          "delay": "Delay",
+          "hurry": "Hurry",
+          "sync": "Synchronize",
+          "sync_help": "Press the Synchronize button when the bell rings.",
+          "surprise_grades": "Surprise Grades",
+          "icon_pack": "Icon Pack",
+          "change_username": "Set a nickname",
+          "Accent Color": "Accent Color",
+          "Background Color": "Background Color",
+          "Highlight Color": "Highlight Color",
+          "Adaptive Theme": "Adaptive Theme",
+          "presentation": "Presentation mode",
+          "uwufymode": "UwU-fied mode (hungarian)",
+          "devmoretaps": "You are %s taps away from Developer Mode.",
+          "devactivated": "Developer Mode successfully activated.",
+          "devsettings": "Developer Settings",
+          "devmode": "Developer Mode",
+          "copy_jwt": "Copy JWT",
+        },
+        "hu_hu": {
+          "personal_details": "Személyes információk",
+          "open_dkt": "DKT megnyitása",
+          "edit_nickname": "Becenév szerkesztése",
+          "edit_profile_picture": "Profil-kép szerkesztése",
+          "remove_profile_picture": "Profil-kép törlése",
+          "select_profile_picture": "a kép kiválasztásához",
+          "click_here": "Kattints ide",
+          "light": "Világos",
+          "dark": "Sötét",
+          "system": "Rendszer",
+          "add_user": "Felhasználó hozzáadása",
+          "log_out": "Kijelentkezés",
+          "update_available": "Frissítés elérhető",
+          "general": "Általános",
+          "language": "Nyelv",
+          "startpage": "Kezdőlap",
+          "rounding": "Kerekítés",
+          "appearance": "Kinézet",
+          "theme": "Téma",
+          "color": "Színek",
+          "grade_colors": "Jegyek színei",
+          "live_activity_color": "Live Activity színe",
+          "notifications": "Értesítések",
+          "popups": "Pop-up értesítések",
+          "news": "Hírek",
+          "extras": "Extrák",
+          "about": "Névjegy",
+          "supporters": "Támogatók",
+          "privacy": "Adatvédelmi irányelvek",
+          "licenses": "Licencek",
+          "vibrate": "Rezgés",
+          "voff": "Kikapcsolás",
+          "vlight": "Alacsony",
+          "vmedium": "Közepes",
+          "vstrong": "Erős",
+          "cancel": "Mégsem",
+          "done": "Kész",
+          "reset": "Visszaállítás",
+          "open": "Megnyitás",
+          "data_collected":
+              "Gyűjtött adat: Platform (pl. Android), App verzió (pl. 3.0.0), Egyedi telepítési azonosító",
+          "Analytics": "Analitika",
+          "Anonymous Usage Analytics": "Névtelen használati analitika",
+          "graph_class_avg": "Osztályátlag a grafikonon",
+          "goodstudent": "Jó tanuló mód",
+          "attention": "Figyelem!",
+          "goodstudent_disclaimer":
+              "A reFilc minden felelősséget elhárít a funkció használatával kapcsolatban.\n\n(Értsd: ha az anyád megver, mert megtévesztő ábrákat mutattál neki, azért csakis magadadat hibáztathatod.)",
+          "understand": "Értem",
+          "secret": "Titkos Beállítások",
+          "bell_delay": "Csengő eltolódása",
+          "delay": "Késleltetés",
+          "hurry": "Siettetés",
+          "sync": "Szinkronizálás",
+          "sync_help": "Csengetéskor nyomd meg a Szinkronizálás gombot.",
+          "surprise_grades": "Meglepetés jegyek",
+          "icon_pack": "Ikon séma",
+          "change_username": "Becenév beállítása",
+          "Accent Color": "Egyedi szín",
+          "Background Color": "Háttér színe",
+          "Highlight Color": "Panelek színe",
+          "Adaptive Theme": "Adaptív téma",
+          "presentation": "Bemutató mód",
+          "uwufymode": "UwU mód (magyar)",
+          "devmoretaps": "Még %s koppintásra vagy a Fejlesztői módtól.",
+          "devactivated": "Fejlesztői mód sikeresen aktiválva.",
+          "devsettings": "Fejlesztői Beállítások",
+          "devmode": "Fejlesztői mód",
+          "copy_jwt": "JWT másolása",
+        },
+        "de_de": {
+          "personal_details": "Persönliche Angaben",
+          "open_dkt": "Öffnen DKT",
+          "edit_nickname": "Spitznamen bearbeiten",
+          "edit_profile_picture": "Profilbild bearbeiten",
+          "remove_profile_picture": "Profilbild entfernen",
+          "select_profile_picture": "um ein Bild auszuwählen",
+          "click_here": "Klick hier",
+          "light": "Licht",
+          "dark": "Dunkel",
+          "system": "System",
+          "add_user": "Benutzer hinzufügen",
+          "log_out": "Abmelden",
+          "update_available": "Update verfügbar",
+          "general": "Allgemein",
+          "language": "Sprache",
+          "startpage": "Startseite",
+          "rounding": "Rundung",
+          "appearance": "Erscheinungsbild",
+          "theme": "Thema",
+          "color": "Farbe",
+          "grade_colors": "Grad Farben",
+          "live_activity_color": "Live Activity Farben",
+          "notifications": "Mitteilung",
+          "popups": "Popup-Nachrichten",
+          "news": "Nachrichten",
+          "extras": "Extras",
+          "about": "Informationen",
+          "supporters": "Unterstützer",
+          "privacy": "Datenschutzbestimmungen",
+          "licenses": "Lizenzen",
+          "vibrate": "Vibration",
+          "voff": "Aus",
+          "vlight": "Leicht",
+          "vmedium": "Mittel",
+          "vstrong": "Stark",
+          "cancel": "Abbrechen",
+          "done": "Fertig",
+          "reset": "Zurücksetzen",
+          "open": "Öffnen",
+          "data_collected":
+              "Erhobene Daten: Plattform (z.B. Android), App version (z.B. 3.0.0), Eindeutige Installationskennung",
+          "Analytics": "Analytik",
+          "Anonymous Usage Analytics": "Anonyme Nutzungsanalyse",
+          "graph_class_avg": "Klassendurchschnitt in der Grafik",
+          "goodstudent": "Guter Student Modus",
+          "attention": "Achtung!",
+          "goodstudent_disclaimer": "Same in English.",
+          "understand": "Ich verstehe",
+          "secret": "Geheime Einstellungen",
+          "bell_delay": "Klingelverzögerung",
+          "delay": "Verzögern",
+          "hurry": "Eile",
+          "sync": "Synchronisieren",
+          "sync_help": "Drücken Sie die Sync-Taste, wenn die Glocke läutet.",
+          "surprise_grades": "Überraschungsnoten",
+          "icon_pack": "Icon-Pack",
+          "change_username": "Einen Spitznamen festlegen",
+          "Accent Color": "Accent Color",
+          "Background Color": "Background Color",
+          "Highlight Color": "Highlight Color",
+          "Adaptive Theme": "Adaptive Theme",
+          "presentation": "Präsentationsmodus",
+          "uwufymode": "UwU-Modus (ungarisch)",
+          "devmoretaps": "Sie sind %s Taps vom Entwicklermodus entfernt.",
+          "devactivated": "Entwicklermodus erfolgreich aktiviert.",
+          "devsettings": "Entwickleroptionen",
+          "devmode": "Entwicklermodus",
+          "copy_jwt": "JWT kopieren",
+        },
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}

refilc_mobile_ui/lib/screens/summary/pages/allsum_page.dart

@@ -0,0 +1,230 @@
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc_kreta_api/models/absence.dart';
+import 'package:refilc_kreta_api/models/grade.dart';
+import 'package:refilc_kreta_api/models/subject.dart';
+import 'package:refilc_kreta_api/providers/absence_provider.dart';
+import 'package:refilc_kreta_api/providers/grade_provider.dart';
+import 'package:refilc_kreta_api/providers/homework_provider.dart';
+import 'package:refilc_mobile_ui/screens/summary/summary_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+
+class AllSumBody extends StatefulWidget {
+  const AllSumBody({Key? key}) : super(key: key);
+
+  @override
+  _AllSumBodyState createState() => _AllSumBodyState();
+}
+
+class _AllSumBodyState extends State<AllSumBody> {
+  late UserProvider user;
+  late GradeProvider gradeProvider;
+  late HomeworkProvider homeworkProvider;
+  late AbsenceProvider absenceProvider;
+  //late TimetableProvider timetableProvider;
+
+  late Map<String, Map<String, dynamic>> things = {};
+  late List<Widget> firstSixTiles = [];
+  late List<Widget> lastSixTiles = [];
+
+  int avgDropValue = 0;
+  bool animation = false;
+
+  List<Grade> getSubjectGrades(Subject subject, {int days = 0}) => gradeProvider
+      .grades
+      .where((e) =>
+          e.subject == subject &&
+          e.type == GradeType.midYear &&
+          (days == 0 ||
+              e.date.isBefore(DateTime.now().subtract(Duration(days: days)))))
+      .toList();
+
+  @override
+  void initState() {
+    super.initState();
+
+    gradeProvider = Provider.of<GradeProvider>(context, listen: false);
+    homeworkProvider = Provider.of<HomeworkProvider>(context, listen: false);
+    absenceProvider = Provider.of<AbsenceProvider>(context, listen: false);
+    //timetableProvider = Provider.of<TimetableProvider>(context, listen: false);
+
+    WidgetsBinding.instance.addPostFrameCallback((timeStamp) {
+      setState(() {
+        animation = true;
+      });
+    });
+  }
+
+  void getGrades() {
+    var allGrades = gradeProvider.grades;
+    var testsGrades = gradeProvider.grades.where((a) => a.value.weight == 100);
+    var closingTestsGrades =
+        gradeProvider.grades.where((a) => a.value.weight >= 200);
+
+    things.addAll({
+      'tests': {'name': 'test'.i18n, 'value': testsGrades.length},
+      'closingTests': {
+        'name': 'closingtest'.i18n,
+        'value': closingTestsGrades.length
+      },
+      'grades': {'name': 'grade'.i18n, 'value': allGrades.length}
+    });
+  }
+
+  void getHomework() {
+    var allHomework = homeworkProvider.homework;
+
+    things.addAll({
+      'homework': {'name': 'hw'.i18n, 'value': allHomework.length}
+    });
+  }
+
+  void getSubjects() {
+    var allSubjects = gradeProvider.grades
+        .map((e) => e.subject)
+        .toSet()
+        .toList()
+      ..sort((a, b) => a.name.compareTo(b.name));
+    //var totalLessons;
+    var totalLessons = 0;
+
+    things.addAll({
+      'subjects': {'name': 'subject'.i18n, 'value': allSubjects.length},
+      'lessons': {'name': 'lesson'.i18n, 'value': totalLessons}
+    });
+  }
+
+  void getAbsences() {
+    var allAbsences = absenceProvider.absences.where((a) => a.delay == 0);
+    var excusedAbsences = absenceProvider.absences
+        .where((a) => a.state == Justification.excused && a.delay == 0);
+    var unexcusedAbsences = absenceProvider.absences.where((a) =>
+        (a.state == Justification.unexcused ||
+            a.state == Justification.pending) &&
+        a.delay == 0);
+
+    things.addAll({
+      'absences': {'name': 'absence_sum'.i18n, 'value': allAbsences.length},
+      'excusedAbsences': {
+        'name': 'excused'.i18n,
+        'value': excusedAbsences.length
+      },
+      'unexcusedAbsences': {
+        'name': 'unexcused'.i18n,
+        'value': unexcusedAbsences.length
+      }
+    });
+  }
+
+  void getDelays() {
+    var allDelays = absenceProvider.absences.where((a) => a.delay > 0);
+    var delayTimeList = (allDelays.map((a) {
+      return a.delay;
+    }).toList());
+    var totalDelayTime = 0;
+    if (delayTimeList.isNotEmpty) {
+      totalDelayTime = delayTimeList.reduce((a, b) => a + b);
+    }
+    var unexcusedDelays = absenceProvider.absences
+        .where((a) => a.state == Justification.unexcused && a.delay > 0);
+
+    things.addAll({
+      'delays': {'name': 'delay_sum'.i18n, 'value': allDelays.length},
+      'totalDelay': {'name': 'min'.i18n, 'value': totalDelayTime},
+      'unexcusedDelays': {
+        'name': 'unexcused'.i18n,
+        'value': unexcusedDelays.length
+      }
+    });
+  }
+
+  void getEverything() {
+    getGrades();
+    getHomework();
+    getSubjects();
+    getAbsences();
+    getDelays();
+  }
+
+  void generateTiles() {
+    for (var i in things.values) {
+      Widget w = Column(
+        mainAxisAlignment: MainAxisAlignment.center,
+        crossAxisAlignment: CrossAxisAlignment.center,
+        children: [
+          Text(
+            i.values.toList()[1].toString(),
+            textAlign: TextAlign.center,
+            style: const TextStyle(
+              fontWeight: FontWeight.w800,
+              fontSize: 36.0,
+              color: Colors.white,
+            ),
+          ),
+          Text(
+            i.values.toList()[0],
+            textAlign: TextAlign.center,
+            style: const TextStyle(
+              fontSize: 18.0,
+              color: Colors.white,
+            ),
+          ),
+        ],
+      );
+
+      // TO-DO: az orakat es a hazikat szarul keri le, de majd meg lesz csinalva
+      if (firstSixTiles.length < 6) {
+        firstSixTiles.add(w);
+      } else if (lastSixTiles.length < 6) {
+        lastSixTiles.add(w);
+      } else {
+        break;
+      }
+    }
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    getEverything();
+    generateTiles();
+
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.center,
+      mainAxisAlignment: MainAxisAlignment.center,
+      children: [
+        const SizedBox(
+          height: 45,
+        ),
+        AnimatedContainer(
+          curve: Curves.easeInOut,
+          duration: const Duration(milliseconds: 420),
+          transform: Matrix4.translationValues(
+              animation ? 0 : MediaQuery.of(context).size.width, 0, 0),
+          height: 250,
+          child: GridView.count(
+            crossAxisCount: 3,
+            mainAxisSpacing: 0,
+            crossAxisSpacing: 5,
+            children: firstSixTiles,
+          ),
+        ),
+        const SizedBox(
+          height: 30,
+        ),
+        AnimatedContainer(
+          curve: Curves.easeInOut,
+          duration: const Duration(milliseconds: 420),
+          transform: Matrix4.translationValues(
+              animation ? 0 : -MediaQuery.of(context).size.width, 0, 0),
+          height: 250,
+          child: GridView.count(
+            crossAxisCount: 3,
+            mainAxisSpacing: 0,
+            crossAxisSpacing: 5,
+            children: lastSixTiles,
+          ),
+        ),
+      ],
+    );
+  }
+}

refilc_mobile_ui/lib/screens/summary/pages/grades_page.dart

@@ -0,0 +1,362 @@
+import 'dart:math';
+
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc/helpers/average_helper.dart';
+import 'package:refilc/models/settings.dart';
+import 'package:refilc/ui/widgets/grade/grade_tile.dart';
+import 'package:refilc/utils/format.dart';
+import 'package:refilc_kreta_api/models/grade.dart';
+import 'package:refilc_kreta_api/models/subject.dart';
+import 'package:refilc_kreta_api/providers/grade_provider.dart';
+import 'package:refilc_mobile_ui/screens/summary/summary_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import 'package:auto_size_text/auto_size_text.dart';
+import 'package:i18n_extension/i18n_widget.dart';
+
+List<String> faces = [
+  "(·.·)",
+  "(≥o≤)",
+  "(·_·)",
+  "(˚Δ˚)b",
+  "(^-^*)",
+  "(='X'=)",
+  "(>_<)",
+  "(;-;)",
+  "\\(^Д^)/",
+  "\\(o_o)/",
+];
+
+class GradesBody extends StatefulWidget {
+  const GradesBody({Key? key}) : super(key: key);
+
+  @override
+  _GradesBodyState createState() => _GradesBodyState();
+}
+
+class _GradesBodyState extends State<GradesBody> {
+  late UserProvider user;
+  late GradeProvider gradeProvider;
+  late SettingsProvider settings;
+
+  late double subjectAvg;
+  late double endYearAvg;
+  late String endYearAvgText;
+
+  List<Widget> subjectTiles5 = [];
+  List<Widget> subjectTiles3 = [];
+  List<Widget> subjectTiles1 = [];
+
+  int avgDropValue = 0;
+  bool animation = false;
+
+  List<Grade> getSubjectGrades(Subject subject, {int days = 0}) => gradeProvider
+      .grades
+      .where((e) =>
+          e.subject == subject &&
+          e.type == GradeType.midYear &&
+          (days == 0 ||
+              e.date.isBefore(DateTime.now().subtract(Duration(days: days)))))
+      .toList();
+
+  @override
+  void initState() {
+    super.initState();
+
+    gradeProvider = Provider.of<GradeProvider>(context, listen: false);
+    settings = Provider.of<SettingsProvider>(context, listen: false);
+
+    WidgetsBinding.instance.addPostFrameCallback((timeStamp) {
+      setState(() {
+        animation = true;
+      });
+    });
+  }
+
+  void generateTiles({required int filter}) {
+    List<Subject> subjects = gradeProvider.grades
+        .map((e) => e.subject)
+        .toSet()
+        .toList()
+      ..sort((a, b) => a.name.compareTo(b.name));
+    List<Widget> tiles = [];
+
+    Map<Subject, double> subjectAvgs = {};
+
+    var count = 1;
+
+    for (Subject subject in subjects) {
+      List<Grade> subjectGrades = getSubjectGrades(subject);
+
+      double avg = AverageHelper.averageEvals(subjectGrades);
+      if (avg != 0) subjectAvgs[subject] = avg;
+
+      Widget widget = AnimatedContainer(
+        curve: Curves.easeInOut,
+        duration: Duration(milliseconds: 300 + (count * 120)),
+        transform: Matrix4.translationValues(
+            animation ? 0 : MediaQuery.of(context).size.width, 0, 0),
+        child: Row(
+          children: [
+            GradeValueWidget(
+              GradeValue(avg.round(), '', '', 100),
+              fill: true,
+              size: 28.0,
+            ),
+            const SizedBox(width: 8),
+            Text(
+              subject.renamedTo ?? subject.name.capital(),
+              maxLines: 2,
+              overflow: TextOverflow.ellipsis,
+              style: TextStyle(
+                fontWeight: FontWeight.bold,
+                fontSize: 20.0,
+                color: Colors.white.withOpacity(0.98),
+                fontStyle: settings.renamedSubjectsItalics && subject.isRenamed
+                    ? FontStyle.italic
+                    : null,
+              ),
+            )
+          ],
+        ),
+      );
+
+      if (avg.round() == filter) {
+        tiles.add(widget);
+        count++;
+      }
+    }
+
+    if (tiles.isEmpty) {
+      int index = Random(DateTime.now().minute).nextInt(faces.length);
+      Widget faceWidget = Center(
+        child: Text.rich(
+          TextSpan(
+            text: faces[index],
+            style: const TextStyle(
+              fontSize: 32.0,
+              fontWeight: FontWeight.w500,
+              color: Colors.white,
+            ),
+            children: [
+              TextSpan(
+                text: "\n${'no_grades'.i18n}",
+                style: TextStyle(
+                    fontSize: 18.0,
+                    height: 2.0,
+                    color: Colors.white.withOpacity(0.5)),
+              ),
+            ],
+          ),
+          textAlign: TextAlign.center,
+        ),
+      );
+      tiles.insert(0, faceWidget);
+    }
+
+    subjectAvg = subjectAvgs.isNotEmpty
+        ? subjectAvgs.values.fold(0.0, (double a, double b) => a + b) /
+            subjectAvgs.length
+        : 0.0;
+
+    List<Grade> endYearGrades = gradeProvider.grades
+        .where((grade) => grade.type == GradeType.endYear)
+        .toList();
+    endYearAvg = AverageHelper.averageEvals(endYearGrades, finalAvg: true);
+    endYearAvgText = endYearAvg.toStringAsFixed(1);
+    if (I18n.of(context).locale.languageCode != "en") {
+      endYearAvgText = endYearAvgText.replaceAll(".", ",");
+    }
+
+    if (filter == 5) {
+      subjectTiles5 = List.castFrom(tiles);
+      if (subjectTiles5.length > 4) {
+        subjectTiles5.length = 4;
+      }
+    } else if (filter == 3) {
+      subjectTiles3 = List.castFrom(tiles);
+      if (subjectTiles3.length > 3) {
+        subjectTiles3.length = 3;
+      }
+    } else if (filter == 1) {
+      subjectTiles1 = List.castFrom(tiles);
+      if (subjectTiles1.length > 2) {
+        subjectTiles1.length = 2;
+      }
+    }
+  }
+
+  void getGrades() {
+    generateTiles(filter: 5);
+    generateTiles(filter: 3);
+    generateTiles(filter: 1);
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    user = Provider.of<UserProvider>(context);
+    settings = Provider.of<SettingsProvider>(context);
+
+    getGrades();
+
+    return Expanded(
+      child: ListView(
+        children: [
+          SizedBox(
+            height: ((100 * subjectTiles5.length) /
+                    (subjectTiles5[0].runtimeType == AnimatedContainer
+                        ? 1.95
+                        : 1.2))
+                .toDouble(),
+            child: ListView.builder(
+              padding: const EdgeInsets.only(left: 5),
+              physics: const BouncingScrollPhysics(),
+              itemCount: max(subjectTiles5.length, 1),
+              itemBuilder: (context, index) {
+                if (subjectTiles5.isNotEmpty) {
+                  EdgeInsetsGeometry panelPadding =
+                      const EdgeInsets.symmetric(horizontal: 24.0);
+
+                  if (subjectTiles5[index].runtimeType == AnimatedContainer) {
+                    return Padding(
+                        padding: const EdgeInsets.only(top: 8),
+                        child: subjectTiles5[index]);
+                  } else {
+                    return Padding(
+                        padding: panelPadding, child: subjectTiles5[index]);
+                  }
+                } else {
+                  return Container();
+                }
+              },
+            ),
+          ),
+          const SizedBox(height: 12.0),
+          Text(
+            'tryagain'.i18n,
+            style: const TextStyle(
+              fontWeight: FontWeight.bold,
+              fontSize: 22.0,
+              color: Colors.white,
+            ),
+          ),
+          const SizedBox(height: 12.0),
+          SizedBox(
+            height: ((100 * subjectTiles3.length) /
+                    (subjectTiles3[0].runtimeType == AnimatedContainer
+                        ? 1.95
+                        : 1.2))
+                .toDouble(),
+            child: ListView.builder(
+              padding: const EdgeInsets.only(left: 5),
+              physics: const BouncingScrollPhysics(),
+              itemCount: max(subjectTiles3.length, 1),
+              itemBuilder: (context, index) {
+                if (subjectTiles3.isNotEmpty) {
+                  EdgeInsetsGeometry panelPadding =
+                      const EdgeInsets.symmetric(horizontal: 24.0);
+
+                  if (subjectTiles3[index].runtimeType == AnimatedContainer) {
+                    return Padding(
+                        padding: const EdgeInsets.only(top: 8),
+                        child: subjectTiles3[index]);
+                  } else {
+                    return Padding(
+                        padding: panelPadding, child: subjectTiles3[index]);
+                  }
+                } else {
+                  return Container();
+                }
+              },
+            ),
+          ),
+          const SizedBox(height: 12.0),
+          Text(
+            'oops'.i18n,
+            style: const TextStyle(
+              fontWeight: FontWeight.bold,
+              fontSize: 22.0,
+              color: Colors.white,
+            ),
+          ),
+          const SizedBox(height: 12.0),
+          SizedBox(
+            height: ((100 * subjectTiles1.length) /
+                    (subjectTiles1[0].runtimeType == AnimatedContainer
+                        ? 1.95
+                        : 1.2))
+                .toDouble(),
+            child: ListView.builder(
+              padding: const EdgeInsets.only(left: 5),
+              physics: const BouncingScrollPhysics(),
+              itemCount: max(subjectTiles1.length, 1),
+              itemBuilder: (context, index) {
+                if (subjectTiles1.isNotEmpty) {
+                  EdgeInsetsGeometry panelPadding =
+                      const EdgeInsets.symmetric(horizontal: 24.0);
+
+                  if (subjectTiles1[index].runtimeType == AnimatedContainer) {
+                    return Padding(
+                        padding: const EdgeInsets.only(top: 8),
+                        child: subjectTiles1[index]);
+                  } else {
+                    return Padding(
+                        padding: panelPadding, child: subjectTiles1[index]);
+                  }
+                } else {
+                  return Container();
+                }
+              },
+            ),
+          ),
+          const SizedBox(height: 30.0),
+          Center(
+            child: Column(
+              mainAxisAlignment: MainAxisAlignment.center,
+              crossAxisAlignment: CrossAxisAlignment.center,
+              children: [
+                Text(
+                  'endyear_avg'.i18n,
+                  textAlign: TextAlign.center,
+                  style: const TextStyle(
+                    fontWeight: FontWeight.bold,
+                    fontSize: 22.0,
+                    color: Colors.white,
+                  ),
+                ),
+                Container(
+                  margin: const EdgeInsets.only(top: 10.0),
+                  padding: const EdgeInsets.symmetric(
+                      horizontal: 16.0, vertical: 4.0),
+                  decoration: BoxDecoration(
+                    color: gradeColor(context: context, value: endYearAvg)
+                        .withOpacity(.2),
+                    border: Border.all(
+                      color: (gradeColor(context: context, value: endYearAvg))
+                          .withOpacity(0.0),
+                      width: 2.0,
+                    ),
+                    borderRadius: BorderRadius.circular(45.0),
+                  ),
+                  child: AutoSizeText.rich(
+                    TextSpan(
+                      text: endYearAvgText,
+                    ),
+                    maxLines: 1,
+                    minFontSize: 5,
+                    textAlign: TextAlign.center,
+                    style: TextStyle(
+                      color: gradeColor(context: context, value: endYearAvg),
+                      fontWeight: FontWeight.w800,
+                      fontSize: 32.0,
+                    ),
+                  ),
+                ),
+              ],
+            ),
+          ),
+        ],
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/summary/pages/lessons_page.dart

@@ -0,0 +1,319 @@
+import 'dart:math';
+
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc/helpers/subject.dart';
+import 'package:refilc/models/settings.dart';
+import 'package:refilc/utils/format.dart';
+import 'package:refilc_kreta_api/models/absence.dart';
+import 'package:refilc_kreta_api/models/lesson.dart';
+import 'package:refilc_kreta_api/models/subject.dart';
+import 'package:refilc_kreta_api/models/week.dart';
+import 'package:refilc_kreta_api/providers/absence_provider.dart';
+import 'package:refilc_kreta_api/providers/timetable_provider.dart';
+import 'package:refilc_mobile_ui/screens/summary/summary_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+
+List<String> faces = [
+  "(·.·)",
+  "(≥o≤)",
+  "(·_·)",
+  "(˚Δ˚)b",
+  "(^-^*)",
+  "(='X'=)",
+  "(>_<)",
+  "(;-;)",
+  "\\(^Д^)/",
+  "\\(o_o)/",
+];
+
+class SubjectAbsence {
+  Subject subject;
+  List<Absence> absences;
+  double percentage;
+
+  SubjectAbsence(
+      {required this.subject, this.absences = const [], this.percentage = 0.0});
+}
+
+class LessonsBody extends StatefulWidget {
+  const LessonsBody({Key? key}) : super(key: key);
+
+  @override
+  _LessonsBodyState createState() => _LessonsBodyState();
+}
+
+class _LessonsBodyState extends State<LessonsBody> {
+  late UserProvider user;
+  late AbsenceProvider absenceProvider;
+  late SettingsProvider settingsProvider;
+  late TimetableProvider timetableProvider;
+
+  late List<SubjectAbsence> absences = [];
+  late List<Widget> lessons = [];
+  late List<Absence> delays = [];
+  final Map<Subject, Lesson> _lessonCount = {};
+
+  @override
+  void initState() {
+    super.initState();
+
+    absenceProvider = Provider.of<AbsenceProvider>(context, listen: false);
+    settingsProvider = Provider.of<SettingsProvider>(context, listen: false);
+    timetableProvider = Provider.of<TimetableProvider>(context, listen: false);
+
+    WidgetsBinding.instance.addPostFrameCallback((timeStamp) async {
+      for (final lesson in timetableProvider.getWeek(Week.current()) ?? []) {
+        if (!lesson.isEmpty &&
+            lesson.subject.id != '' &&
+            lesson.lessonYearIndex != null) {
+          _lessonCount.update(
+            lesson.subject,
+            (value) {
+              if (lesson.lessonYearIndex! > value.lessonYearIndex!) {
+                return lesson;
+              } else {
+                return value;
+              }
+            },
+            ifAbsent: () => lesson,
+          );
+        }
+      }
+      setState(() {});
+    });
+  }
+
+  void buildSubjectAbsences() {
+    Map<Subject, SubjectAbsence> _absences = {};
+
+    for (final absence in absenceProvider.absences) {
+      if (absence.delay != 0) continue;
+
+      if (!_absences.containsKey(absence.subject)) {
+        _absences[absence.subject] =
+            SubjectAbsence(subject: absence.subject, absences: [absence]);
+      } else {
+        _absences[absence.subject]?.absences.add(absence);
+      }
+    }
+
+    _absences.forEach((subject, absence) {
+      final absentLessonsOfSubject = absenceProvider.absences
+          .where((e) => e.subject == subject && e.delay == 0)
+          .length;
+      final totalLessonsOfSubject = _lessonCount[subject]?.lessonYearIndex ?? 0;
+
+      double absentLessonsOfSubjectPercentage;
+
+      if (absentLessonsOfSubject <= totalLessonsOfSubject) {
+        absentLessonsOfSubjectPercentage =
+            absentLessonsOfSubject / totalLessonsOfSubject * 100;
+      } else {
+        absentLessonsOfSubjectPercentage = -1;
+      }
+
+      _absences[subject]?.percentage =
+          absentLessonsOfSubjectPercentage.clamp(-1, 100.0);
+    });
+
+    absences = _absences.values.toList();
+    absences.sort((a, b) => -a.percentage.compareTo(b.percentage));
+  }
+
+  void getAndSortDelays() {
+    delays = absenceProvider.absences;
+    delays.sort((a, b) => -a.delay.compareTo(b.delay));
+  }
+
+  void generateTiles() {
+    Widget leastAbsent = Center(
+      child: Column(
+        mainAxisAlignment: MainAxisAlignment.center,
+        crossAxisAlignment: CrossAxisAlignment.center,
+        children: [
+          Icon(
+            SubjectIcon.resolveVariant(
+                subject: absences.last.subject, context: context),
+            color: Colors.white,
+            size: 64,
+          ),
+          Text(
+            absences.last.subject.renamedTo ??
+                absences.last.subject.name.capital(),
+            maxLines: 2,
+            overflow: TextOverflow.ellipsis,
+            style: TextStyle(
+              fontWeight: FontWeight.w800,
+              fontSize: 36.0,
+              fontStyle: absences.last.subject.isRenamed &&
+                      settingsProvider.renamedSubjectsItalics
+                  ? FontStyle.italic
+                  : null,
+              color: Colors.white,
+            ),
+          ),
+          Text(
+            'absence'.i18n.fill([absences.last.absences.length]),
+            style: const TextStyle(
+              fontSize: 18.0,
+              color: Colors.white,
+            ),
+          )
+        ],
+      ),
+    );
+    if (absences.last.absences.isNotEmpty) {
+      lessons.add(leastAbsent);
+    } else {
+      lessons.add(buildFaceWidget());
+    }
+
+    Widget mostAbsent = Center(
+      child: Column(
+        mainAxisAlignment: MainAxisAlignment.center,
+        crossAxisAlignment: CrossAxisAlignment.center,
+        children: [
+          Icon(
+            SubjectIcon.resolveVariant(
+                subject: absences.first.subject, context: context),
+            color: Colors.white,
+            size: 64,
+          ),
+          Text(
+            absences.first.subject.renamedTo ??
+                absences.first.subject.name.capital(),
+            maxLines: 2,
+            overflow: TextOverflow.ellipsis,
+            style: TextStyle(
+              fontWeight: FontWeight.w800,
+              fontSize: 36.0,
+              fontStyle: absences.first.subject.isRenamed &&
+                      settingsProvider.renamedSubjectsItalics
+                  ? FontStyle.italic
+                  : null,
+              color: Colors.white,
+            ),
+          ),
+          Text(
+            'absence'.i18n.fill([absences.first.absences.length]),
+            style: const TextStyle(
+              fontSize: 18.0,
+              color: Colors.white,
+            ),
+          )
+        ],
+      ),
+    );
+    if (absences.first.absences.isNotEmpty) {
+      lessons.add(mostAbsent);
+    } else {
+      lessons.add(buildFaceWidget());
+    }
+
+    Widget mostDelays = Center(
+      child: Column(
+        mainAxisAlignment: MainAxisAlignment.center,
+        crossAxisAlignment: CrossAxisAlignment.center,
+        children: [
+          Icon(
+            SubjectIcon.resolveVariant(
+                subject: delays.first.subject, context: context),
+            color: Colors.white,
+            size: 64,
+          ),
+          Text(
+            delays.first.subject.renamedTo ??
+                delays.first.subject.name.capital(),
+            maxLines: 2,
+            overflow: TextOverflow.ellipsis,
+            style: TextStyle(
+              fontWeight: FontWeight.w800,
+              fontSize: 36.0,
+              fontStyle: delays.first.subject.isRenamed &&
+                      settingsProvider.renamedSubjectsItalics
+                  ? FontStyle.italic
+                  : null,
+              color: Colors.white,
+            ),
+          ),
+          Text(
+            'delay'.i18n.fill([delays.first.delay]),
+            style: const TextStyle(
+              fontSize: 18.0,
+              color: Colors.white,
+            ),
+          )
+        ],
+      ),
+    );
+    if (delays.first.delay != 0) {
+      lessons.add(mostDelays);
+    } else {
+      lessons.add(buildFaceWidget());
+    }
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    buildSubjectAbsences();
+    getAndSortDelays();
+    generateTiles();
+
+    return Expanded(
+      child: ListView(
+        children: [
+          lessons[0],
+          const SizedBox(height: 18.0),
+          Text(
+            'dontfelt'.i18n,
+            style: const TextStyle(
+              fontWeight: FontWeight.bold,
+              fontSize: 22.0,
+              color: Colors.white,
+            ),
+          ),
+          const SizedBox(height: 18.0),
+          lessons[1],
+          const SizedBox(height: 18.0),
+          Text(
+            'youlate'.i18n,
+            style: const TextStyle(
+              fontWeight: FontWeight.bold,
+              fontSize: 22.0,
+              color: Colors.white,
+            ),
+          ),
+          const SizedBox(height: 18.0),
+          lessons[2],
+        ],
+      ),
+    );
+  }
+
+  Widget buildFaceWidget() {
+    int index = Random(DateTime.now().minute).nextInt(faces.length);
+    return Center(
+      child: Text.rich(
+        TextSpan(
+          text: faces[index],
+          style: const TextStyle(
+            fontSize: 32.0,
+            fontWeight: FontWeight.w500,
+            color: Colors.white,
+          ),
+          children: [
+            TextSpan(
+              text: "\n${'no_lesson'.i18n}",
+              style: TextStyle(
+                  fontSize: 18.0,
+                  height: 2.0,
+                  color: Colors.white.withOpacity(0.5)),
+            ),
+          ],
+        ),
+        textAlign: TextAlign.center,
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/summary/pages/personality_page.dart

@@ -0,0 +1,128 @@
+import 'dart:io';
+
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc_mobile_ui/common/personality_card/empty_card.dart';
+import 'package:refilc_mobile_ui/common/personality_card/personality_card.dart';
+import 'package:refilc_mobile_ui/screens/summary/summary_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'package:screenshot/screenshot.dart';
+import 'package:share_plus/share_plus.dart';
+import 'package:path_provider/path_provider.dart';
+import 'package:image_gallery_saver/image_gallery_saver.dart';
+
+class PersonalityBody extends StatefulWidget {
+  const PersonalityBody({Key? key}) : super(key: key);
+
+  @override
+  _PersonalityBodyState createState() => _PersonalityBodyState();
+}
+
+class _PersonalityBodyState extends State<PersonalityBody> {
+  late UserProvider user;
+
+  bool isRevealed = false;
+
+  ScreenshotController screenshotController = ScreenshotController();
+
+  sharePersonality() async {
+    await screenshotController.capture().then((image) async {
+      if (image != null) {
+        final directory = await getApplicationDocumentsDirectory();
+        if (await File('${directory.path}/refilc_personality.png').exists()) {
+          await File('${directory.path}/refilc_personality.png').delete();
+        }
+        final imagePath =
+            await File('${directory.path}/refilc_personality.png').create();
+        await imagePath.writeAsBytes(image);
+
+        await Share.shareXFiles([XFile(imagePath.path)]);
+      }
+    }).catchError((err) {
+      throw err;
+    });
+  }
+
+  savePersonality() async {
+    await screenshotController.capture().then((image) async {
+      if (image != null) {
+        await ImageGallerySaver.saveImage(image, name: 'refilc_personality');
+      }
+    }).catchError((err) {
+      throw err;
+    });
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    user = Provider.of<UserProvider>(context);
+
+    return Expanded(
+      child: ListView(
+        children: [
+          const SizedBox(height: 30),
+          AnimatedCrossFade(
+            duration: const Duration(milliseconds: 1000),
+            sizeCurve: Curves.easeInToLinear,
+            firstChild: Screenshot(
+              controller: screenshotController,
+              child: PersonalityCard(user: user),
+            ),
+            secondChild: GestureDetector(
+              onTap: () => setState(() {
+                isRevealed = true;
+              }),
+              child: EmptyCard(text: 'click_reveal'.i18n),
+            ),
+            crossFadeState: isRevealed
+                ? CrossFadeState.showFirst
+                : CrossFadeState.showSecond,
+          ),
+          const SizedBox(height: 30),
+          if (isRevealed)
+            Center(
+              child: Row(
+                mainAxisAlignment: MainAxisAlignment.center,
+                crossAxisAlignment: CrossAxisAlignment.center,
+                children: [
+                  IconButton(
+                    onPressed: () async {
+                      await sharePersonality();
+                    },
+                    icon: const Icon(
+                      FeatherIcons.share,
+                      color: Colors.white,
+                      size: 30,
+                    ),
+                    style: ButtonStyle(
+                      backgroundColor: MaterialStateProperty.all(
+                          Colors.white.withOpacity(0.2)),
+                    ),
+                  ),
+                  const SizedBox(
+                    width: 10,
+                  ),
+                  IconButton(
+                    onPressed: () async {
+                      await savePersonality();
+                    },
+                    icon: const Icon(
+                      FeatherIcons.bookmark,
+                      color: Colors.white,
+                      size: 30,
+                    ),
+                    style: ButtonStyle(
+                      backgroundColor: MaterialStateProperty.all(
+                          Colors.white.withOpacity(0.2)),
+                    ),
+                  ),
+                ],
+              ),
+            ),
+          const SizedBox(height: 60),
+        ],
+      ),
+    );
+  }
+}

refilc_mobile_ui/lib/screens/summary/pages/start_page.dart

@@ -0,0 +1,98 @@
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc/models/settings.dart';
+import 'package:refilc_kreta_api/providers/grade_provider.dart';
+import 'package:refilc_mobile_ui/screens/summary/summary_screen.dart';
+import 'package:refilc_mobile_ui/screens/summary/summary_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'package:wtf_sliding_sheet/wtf_sliding_sheet.dart';
+
+class StartBody extends StatefulWidget {
+  const StartBody({Key? key}) : super(key: key);
+
+  @override
+  _StartBodyState createState() => _StartBodyState();
+}
+
+class _StartBodyState extends State<StartBody> {
+  late UserProvider user;
+  late GradeProvider gradeProvider;
+  late SettingsProvider settings;
+
+  late String firstName;
+
+  @override
+  void initState() {
+    super.initState();
+
+    gradeProvider = Provider.of<GradeProvider>(context, listen: false);
+    settings = Provider.of<SettingsProvider>(context, listen: false);
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.center,
+      mainAxisAlignment: MainAxisAlignment.spaceBetween,
+      children: [
+        const SizedBox(height: 40.0),
+        GestureDetector(
+          onTap: () {
+            Navigator.of(context).pop();
+            showSlidingBottomSheet(
+              context,
+              useRootNavigator: true,
+              builder: (context) => SlidingSheetDialog(
+                color: Colors.black.withOpacity(0.99),
+                duration: const Duration(milliseconds: 400),
+                scrollSpec: const ScrollSpec.bouncingScroll(),
+                snapSpec: const SnapSpec(
+                  snap: true,
+                  snappings: [1.0],
+                  initialSnap: 1.0,
+                  positioning: SnapPositioning.relativeToAvailableSpace,
+                ),
+                minHeight: MediaQuery.of(context).size.height,
+                cornerRadius: 16,
+                cornerRadiusOnFullscreen: 0,
+                builder: (context, state) => const Material(
+                  color: Colors.black,
+                  child: SummaryScreen(
+                    currentPage: 'grades',
+                    isBottomSheet: true,
+                  ),
+                ),
+              ),
+            );
+          },
+          child: Center(
+            child: Column(
+              mainAxisAlignment: MainAxisAlignment.center,
+              crossAxisAlignment: CrossAxisAlignment.center,
+              children: [
+                const Icon(
+                  FeatherIcons.arrowRight,
+                  size: 145,
+                  color: Colors.white,
+                  grade: 0.001,
+                  weight: 0.001,
+                ),
+                Text(
+                  'start'.i18n,
+                  textAlign: TextAlign.center,
+                  style: TextStyle(
+                    fontWeight: FontWeight.w500,
+                    fontSize: 16.0,
+                    color: Colors.white.withOpacity(0.7),
+                  ),
+                ),
+              ],
+            ),
+          ),
+        ),
+        const SizedBox(height: 169.69),
+      ],
+    );
+  }
+}

refilc_mobile_ui/lib/screens/summary/summary_screen.dart

@@ -0,0 +1,222 @@
+import 'package:confetti/confetti.dart';
+import 'package:refilc/api/providers/user_provider.dart';
+import 'package:refilc/models/settings.dart';
+import 'package:flutter/cupertino.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'package:wtf_sliding_sheet/wtf_sliding_sheet.dart';
+import 'summary_screen.i18n.dart';
+
+import 'pages/allsum_page.dart';
+import 'pages/start_page.dart';
+import 'pages/grades_page.dart';
+import 'pages/lessons_page.dart';
+import 'pages/personality_page.dart';
+
+class SummaryScreen extends StatefulWidget {
+  final String currentPage;
+  final bool isBottomSheet;
+
+  const SummaryScreen({
+    Key? key,
+    this.currentPage = 'personality',
+    this.isBottomSheet = false,
+  }) : super(key: key);
+
+  @override
+  _SummaryScreenState createState() => _SummaryScreenState();
+
+  static show(
+          {required BuildContext context,
+          String currentPage = 'personality'}) =>
+      Navigator.of(context, rootNavigator: true).push(CupertinoPageRoute(
+          builder: (context) => SummaryScreen(currentPage: currentPage)));
+}
+
+class _SummaryScreenState extends State<SummaryScreen>
+    with SingleTickerProviderStateMixin {
+  late UserProvider user;
+  late SettingsProvider settings;
+
+  ConfettiController? _confettiController;
+
+  late String firstName;
+
+  final LinearGradient _backgroundGradient = const LinearGradient(
+    colors: [
+      Color(0xff1d56ac),
+      Color(0xff170a3d),
+    ],
+    begin: Alignment(-0.8, -1.0),
+    end: Alignment(0.8, 1.0),
+    stops: [-1.0, 1.0],
+  );
+
+  @override
+  void initState() {
+    super.initState();
+  }
+
+  @override
+  void dispose() {
+    _confettiController?.dispose();
+
+    super.dispose();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    user = Provider.of<UserProvider>(context);
+    settings = Provider.of<SettingsProvider>(context);
+
+    List<String> nameParts = user.displayName?.split(" ") ?? ["?"];
+    if (!settings.presentationMode) {
+      firstName = nameParts.length > 1 ? nameParts[1] : nameParts[0];
+    } else {
+      firstName = "János";
+    }
+
+    return widget.isBottomSheet
+        ? buildContainer()
+        : Scaffold(
+            body: buildContainer(),
+          );
+  }
+
+  Widget buildContainer() {
+    return Container(
+      decoration: BoxDecoration(gradient: _backgroundGradient),
+      child: Container(
+        decoration: BoxDecoration(gradient: _backgroundGradient),
+        width: MediaQuery.of(context).size.width,
+        height: MediaQuery.of(context).size.height,
+        child: SafeArea(
+          child: Padding(
+            padding: const EdgeInsets.only(
+              left: 24.0,
+              right: 24.0,
+              top: 15.0,
+              bottom: 40.0,
+            ),
+            child: Column(
+              crossAxisAlignment: widget.currentPage == 'start'
+                  ? CrossAxisAlignment.center
+                  : CrossAxisAlignment.start,
+              mainAxisAlignment: widget.currentPage == 'start'
+                  ? MainAxisAlignment.spaceBetween
+                  : MainAxisAlignment.start,
+              children: [
+                Row(
+                  mainAxisAlignment: MainAxisAlignment.spaceBetween,
+                  crossAxisAlignment: CrossAxisAlignment.center,
+                  children: [
+                    Expanded(
+                      child: Column(
+                        crossAxisAlignment: CrossAxisAlignment.start,
+                        children: [
+                          Text(
+                            'greeting'.i18n.fill([firstName]),
+                            textAlign: TextAlign.left,
+                            maxLines: 2,
+                            overflow: TextOverflow.ellipsis,
+                            softWrap: true,
+                            style: const TextStyle(
+                              fontWeight: FontWeight.w900,
+                              fontSize: 26.0,
+                              color: Colors.white,
+                            ),
+                          ),
+                          Text(
+                            widget.currentPage == 'start'
+                                ? 'title_start'.i18n
+                                : widget.currentPage == 'grades'
+                                    ? 'title_grades'.i18n
+                                    : widget.currentPage == 'lessons'
+                                        ? 'title_lessons'.i18n
+                                        : widget.currentPage == 'personality'
+                                            ? 'title_personality'.i18n
+                                            : '',
+                            maxLines: 1,
+                            overflow: TextOverflow.fade,
+                            softWrap: false,
+                            style: const TextStyle(
+                              fontWeight: FontWeight.bold,
+                              fontSize: 22.0,
+                              color: Colors.white,
+                            ),
+                          ),
+                        ],
+                      ),
+                    ),
+                    widget.currentPage != 'start'
+                        ? IconButton(
+                            onPressed: () async {
+                              Navigator.of(context).pop();
+                              if (widget.currentPage == 'grades') {
+                                openNewPage(page: 'lessons');
+                              } else if (widget.currentPage == 'lessons') {
+                                openNewPage(page: 'allsum');
+                              } else if (widget.currentPage == 'allsum') {
+                                openNewPage(page: 'personality');
+                              } else {
+                                Navigator.of(context).maybePop();
+                              }
+                            },
+                            icon: Icon(
+                              widget.currentPage == 'personality'
+                                  ? FeatherIcons.x
+                                  : FeatherIcons.arrowRight,
+                              color: Colors.white,
+                            ),
+                          )
+                        : Container()
+                  ],
+                ),
+                const SizedBox(height: 12.0),
+                widget.currentPage == 'start'
+                    ? const StartBody()
+                    : widget.currentPage == 'grades'
+                        ? const GradesBody()
+                        : widget.currentPage == 'lessons'
+                            ? const LessonsBody()
+                            : widget.currentPage == 'allsum'
+                                ? const AllSumBody()
+                                : const PersonalityBody(),
+              ],
+            ),
+          ),
+        ),
+      ),
+    );
+  }
+
+  void openNewPage({String page = 'personality'}) {
+    showSlidingBottomSheet(
+      context,
+      useRootNavigator: true,
+      builder: (context) => SlidingSheetDialog(
+        color: Colors.black.withOpacity(0.99),
+        duration: const Duration(milliseconds: 400),
+        scrollSpec: const ScrollSpec.bouncingScroll(),
+        snapSpec: const SnapSpec(
+          snap: true,
+          snappings: [1.0],
+          initialSnap: 1.0,
+          positioning: SnapPositioning.relativeToAvailableSpace,
+        ),
+        minHeight: MediaQuery.of(context).size.height,
+        cornerRadius: 16,
+        cornerRadiusOnFullscreen: 0,
+        builder: (context, state) => Material(
+          color: Colors.black,
+          child: SummaryScreen(
+            currentPage: page,
+            isBottomSheet: true,
+          ),
+        ),
+      ),
+    );
+    //SummaryScreen.show(context: context, currentPage: page);
+  }
+}

refilc_mobile_ui/lib/screens/summary/summary_screen.i18n.dart

@@ -0,0 +1,117 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension SettingsLocalization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          // main thingies
+          "no_grades": "No grades found",
+          "no_lesson": "No lessons found",
+          "greeting": "You had a good year, %s!",
+          "title_start": "So let's summarize...",
+          "title_grades": "Let's look at your marks... 📖",
+          "title_lessons": "Your favorite lesson 💓",
+          "title_personality": "Your personality is...",
+          // start page
+          "start": "Start",
+          // grades page
+          "tryagain": "He puts the master to the test! 🔃",
+          "oops": "Ouch... 🥴",
+          "endyear_avg": "Year-end average",
+          // lessons page
+          "absence": "%s absence(s)",
+          "delay": "A total of %s minute(s) late",
+          "dontfelt": "You didn't like it...",
+          "youlate": "You're late!",
+          // allsum page
+          "test": "test(s)",
+          "closingtest": "module test(s)",
+          "grade": "grades",
+          "hw": "homework",
+          "subject": "subjects",
+          "lesson": "lessons",
+          "absence_sum": "absence(s)",
+          "excused": "excused",
+          "unexcused": "unexcused",
+          "delay_sum": "delay(s)",
+          "min": "minute(s)",
+          // personality page
+          "click_reveal": "Click to reveal...",
+        },
+        "hu_hu": {
+          // main thingies
+          "no_grades": "Nincsenek jegyek",
+          "no_lesson": "Nincsenek tanórák",
+          "greeting": "Jó éved volt, %s!",
+          "title_start": "Összegezzünk hát...",
+          "title_grades": "Nézzük a jegyeidet... 📖",
+          "title_lessons": "A kedvenc órád 💓",
+          "title_personality": "A te személyiséged...",
+          // start page
+          "start": "Kezdés",
+          // grades page
+          "tryagain": "Próba teszi a mestert! 🔃",
+          "oops": "Ajjaj... 🥴",
+          "endyear_avg": "Év végi átlagod",
+          // lessons page
+          "absence": "%s hiányzás",
+          "delay": "Összesen %s perc késés",
+          "dontfelt": "Nem volt kedved hozzá...",
+          "youlate": "Késtél!",
+          // allsum page
+          "test": "dolgozat",
+          "closingtest": "témazáró",
+          "grade": "jegy",
+          "hw": "házi",
+          "subject": "tantárgy",
+          "lesson": "óra",
+          "absence_sum": "hiányzás",
+          "excused": "igazolt",
+          "unexcused": "igazolatlan",
+          "delay_sum": "késés",
+          "min": "perc",
+          // personality page
+          "click_reveal": "Kattints a felfedéshez...",
+        },
+        "de_de": {
+          // main thingies
+          "no_grades": "Keine Grade gefunden",
+          "no_lesson": "Keine Lektionen gefunden",
+          "greeting": "Du hattest ein gutes Jahr, %s!",
+          "title_start": "Fassen wir also zusammen...",
+          "title_grades": "Schauen wir uns eure Tickets an... 📖",
+          "title_lessons": "Deine Lieblingsuhr 💓",
+          "title_personality": "Deine Persönlichkeit...",
+          // start page
+          "start": "Anfang",
+          // grades page
+          "tryagain": "Er stellt den Meister auf die Probe! 🔃",
+          "oops": "Autsch... 🥴",
+          "endyear_avg": "Ihr Jahresenddurchschnitt",
+          // lessons page
+          "absence": "%s Abwesenheit(en)",
+          "delay": "Insgesamt %s Minute(n) zu spät",
+          "dontfelt": "Es hat dir nicht gefallen...",
+          "youlate": "Du bist spät!",
+          // allsum page
+          "test": "These(n)",
+          "closingtest": "Modultest",
+          "grade": "Grad",
+          "hw": "Hausaufgaben",
+          "subject": "Themen",
+          "lesson": "Lektionen",
+          "absence_sum": "Abwesenheit(en)",
+          "excused": "bescheinigte",
+          "unexcused": "unentschuldigte",
+          "delay_sum": "Verzögerung(en)",
+          "min": "Minute(n)",
+          // personality page
+          "click_reveal": "Klicken Sie hier, um es anzuzeigen...",
+        },
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}