fixed long subject names in grades summary

fixed misaligned text on final sum page
fixed 0 min delay thingies
2023-06-25 14:55:01 +02:00 · 2023-06-25 14:50:54 +02:00 · 2023-06-25 14:47:06 +02:00 · 2023-06-25 14:36:18 +02:00 · 2023-06-25 00:11:44 +02:00 · 2023-06-24 23:58:06 +02:00
80 changed files with 3454 additions and 537 deletions
--- a/.gitignore
+++ b/.gitignore
@@ -49,4 +49,4 @@ filcnaplo/linux/flutter/generated_plugin_registrant.h
 filcnaplo/linux/flutter/generated_plugins.cmake
 filcnaplo/macos/Flutter/GeneratedPluginRegistrant.swift
 .vscode/
- 
+key.properties
--- a/.idea/naplo.iml
+++ b/.idea/naplo.iml
@@ -2,7 +2,65 @@
 <module type="JAVA_MODULE" version="4">
  <component name="NewModuleRootManager" inherit-compiler-output="true">
    <exclude-output />
-    <content url="file://$MODULE_DIR$" />
+    <content url="file://$MODULE_DIR$">
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/.dart_tool" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/.pub" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/build" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/flutter_acrylic/example/.pub" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/flutter_acrylic/example/build" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/flutter_acrylic/example/.dart_tool" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo_desktop_ui/.dart_tool" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo_desktop_ui/.pub" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo_desktop_ui/build" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/share_plus/example/.pub" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/share_plus/example/.dart_tool" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/share_plus/example/build" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/dynamic_color/.pub" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/dynamic_color/.dart_tool" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/dynamic_color/build" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/url_launcher_linux/.pub" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/url_launcher_linux/build" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/url_launcher_linux/.dart_tool" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/dynamic_color/example/.pub" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/dynamic_color/example/.dart_tool" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/dynamic_color/example/build" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo_premium/build" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo_premium/.dart_tool" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo_premium/.pub" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/path_provider_linux/example/.pub" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/path_provider_linux/example/.dart_tool" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/path_provider_linux/example/build" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/share_plus/.dart_tool" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/share_plus/.pub" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/share_plus/build" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/url_launcher_linux/example/.pub" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/url_launcher_linux/example/.dart_tool" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/url_launcher_linux/example/build" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/connectivity_plus/.pub" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/connectivity_plus/build" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/connectivity_plus/.dart_tool" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/connectivity_plus/example/.dart_tool" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/connectivity_plus/example/build" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/connectivity_plus/example/.pub" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/package_info_plus/.pub" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/package_info_plus/build" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/package_info_plus/.dart_tool" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/path_provider_linux/build" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/path_provider_linux/.dart_tool" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/path_provider_linux/.pub" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo_kreta_api/.dart_tool" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo_kreta_api/build" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo_kreta_api/.pub" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo_mobile_ui/.dart_tool" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo_mobile_ui/.pub" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo_mobile_ui/build" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/package_info_plus/example/.pub" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/package_info_plus/example/.dart_tool" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/package_info_plus/example/build" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/flutter_acrylic/build" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/flutter_acrylic/.pub" />
+      <excludeFolder url="file://$MODULE_DIR$/filcnaplo/linux/flutter/ephemeral/.plugin_symlinks/flutter_acrylic/.dart_tool" />
+    </content>
    <orderEntry type="inheritedJdk" />
    <orderEntry type="sourceFolder" forTests="false" />
  </component>
--- a/CONTRIBUTING.md
+++ b/CONTRIBUTING.md
@@ -1,39 +1,36 @@

-# Contributing Guide
+# Contribution guide
 Köszönjük, ha programozással segíted a munkánkat!
-A folytatáshoz szükséged lesz egy Linuxot vagy Windowst futtató számítógépre, minimális programozási tapasztalatra és egy kis angoltudásra.
-Segít, ha nem csak kicsit tudsz programozni, és ha ismered a Gitet és a GitHubot ;)
+A folytatáshoz szükséged lesz egy Linux-ot vagy Windows-t futtató számítógépre, minimális programozási tapasztalatra és egy kis angoltudásra.
+Segít, ha már gyakorlottabb vagy a programozásban, és ha ismered a [Git](https://git-scm.com/) és a [GitHub](https://github.com/) működését. ;)

 ## Miben segítsek?
-Kérünk, **olyan dologgal járulj hozzá** a reFilchez, ami valószínűleg **sok embernek hasznos lesz** majd. Szeretnénk egy minél teljeskörűbb iskolai asszisztenst létrehozni, de az iskolaspecifikus, vagy külön neked hasznos funkciók helye inkább legyen a saját forkod.
+Kérünk, **olyan dologgal járulj hozzá** a **reFilc**hez, ami valószínűleg **sok embernek hasznos lehet**. Szeretnénk egy minél teljeskörűbb iskolai asszisztenst létrehozni, de az iskolaspecifikus, vagy külön neked hasznos funkciók helye inkább legyen a saját Fork-od.

-Fontos, hogy **mielőtt egy nagy volumenű projektbe belekezdesz, futtasd meg ötletedet a [Discord szerverünkön](https://dc.refilc.hu/),** ahol még azelőtt tudunk tanácsot adni, mielőtt sok-sok órát beleöltél volna egy esetleg felesleges dologba.
+Fontos, hogy **mielőtt egy nagyobb méretű projektbe belekezdenél, futtasd meg ötletedet a [Discord szerverünkön](https://dc.refilc.hu/)**, ahol még azelőtt tudunk tanácsot adni, hogy sok-sok órát beleöltél volna egy esetleg felesleges dologba.

-A legjobban annak örülünk, ha az [Issues](https://github.com/refilc/filcnaplo/issues) oldalról szemezgetsz, **ha lehet, a [priority taggel megjelöltekkel kezdd](https://github.com/refilc/filcnaplo/issues?q=is%3Aissue+is%3Aopen+label%3Apriority),** vagy ha új vagy a Flutterhez, ajánljuk figyelmedbe [ezeket a viszonylag könnyen javítható hibákat](https://github.com/refilc/filcnaplo/issues?q=is%3Aopen+is%3Aissue+label%3A%22good+first+issue%22) (ha épp van ilyen).
+A legjobban annak örülünk, ha az [Issues](https://github.com/refilc/naplo/issues) oldalról szemezgetsz. Ha még új vagy a Flutterben, ajánljuk figyelmedbe ezeket a [viszonylag könnyen javítható hibákat](https://github.com/refilc/naplo/issues?q=is%3Aopen+is%3Aissue+label%3A%22good+first+issue%22), ha éppen van ilyen.

 ## Hogyan segítsek?
+Nem ígérhetünk itt sem programozás-, sem Git-kurzust, de a projektspecifikus dolgokat leírjuk, és segítünk a Flutter telepítésében.

-Nem ígérhetünk itt sem programozás-, sem git-kurzust, de a projektspecifikus dolgokat leírjuk, és segítünk a Flutter feltelepítésében.
+A **reFilc** a Google által pár éve létrehozott **[Flutter](https://flutter.dev/)** keretrendszert használja, aminek nyelve a **[Dart](https://dart.dev/)**. Ha ismered a C#, Java, C++, vagy egyéb hasonló programnyelvek működését, **nem fog nagy gondot okozni a használata.** A felhasználói felület létrehozásában az is segíthet, ha foglalkoztál már korábban weboldalakkal vagy alkalmazásfejlesztéssel.
+Ha még nem használtad a Flutter-t, mindenképp böngészd át a [YouTube csatornájukat](https://www.youtube.com/channel/UCwXdFgeE9KYzlDdR7TG9cMw).
+Kód vagy UI teszteléséhez Flutter telepítése nélkül is használhatod a [DartPad](https://dartpad.dev/)-et.

-A reFilc a Google által pár éve létrehozott **[Fluttert](https://flutter.dev/)** használja, aminek nyelve a **[Dart](https://dart.dev/)**. Ha ismered a C#-ot, Javát, C++t, vagy egyéb hasonló nyelvet, **nem fog gondot okozni a használata.** A felhasználói felület létrehozásában az is segíthet, ha foglalkoztál már korábban weboldalakkal.
-Ha még nem használtál Fluttert, mindenképp böngészd át a [YouTube csatornájukat](https://www.youtube.com/channel/UCwXdFgeE9KYzlDdR7TG9cMw).
-Könnyen tudsz kódot, vagy akár UI-t is tesztelni a [DartPad](https://dartpad.dev/) oldalon.
+#### [Segítség a Flutter telepítéséhez](https://docs.flutter.dev/get-started/install)
+**Használd a Flutter stable verzióját!** Írd be a terminálba: `flutter channel stable`

-#### [Segítség a Flutter telepítéséhez és a forráskód futtatásához](/.github/SETUP.md)
-Fontos: **Legyél a flutter beta verzióján!** Írd be: `flutter channel beta`
+Ha nem értessz a Git-hez vagy a GitHub-hoz, ajánljuk figyelmedbe [ezt a cikket](https://medium.com/envienta-magyarorsz%C3%A1g/git-%C3%A9s-github-gyorstalpal%C3%B3-f2d78a732deb), viszont arra kérünk, hogy a használatukat ne a **reFilc**en próbáld ki először. Hozz létre egy saját Repo-t és abban tesztelgess. Ha már nagyjából kitapasztaltad, várjuk hozzájárulásodat.

-
-
-Ha nem értesz a Githez, ajánljuk figyelmedbe [ezt a cikket](https://medium.com/envienta-magyarorsz%C3%A1g/git-%C3%A9s-github-gyorstalpal%C3%B3-f2d78a732deb). Viszont arra kérünk, a Git használatát ne a reFilcen próbáld ki először, hozz létre előbb egy saját Repót, és abba tesztelgess. Ha már nagyjából kitapasztaltad, várjuk hozzájárulásodat.
-
-Készíts egy forkot a saját fiókod alá.
-A reFilc legfrissebb, épp fejlesztés alatt álló verzióját a [dev brancen](https://github.com/refilc/filcnaplo/tree/dev) találod, kérjük ide commitolj, és ide célozd a forkodból a Pull Requested. Írd le benne, mit változtattál, és ha lehet, csatolj képernyőképet is.
-Minél gyakrabban készíts minél részletesebben elnevezett commitokat, hogy el tudjunk tájékozódni az általad beküldött kódon.
+Készíts egy Fork-ot a saját GitHub fiókod alá.
+A **reFilc** legfrissebb, **épp fejlesztés alatt álló verzióját a [master branch](https://github.com/refilc/naplo/tree/master)-en találod**. Kérjük ide Commit-olj és ide célozd a Fork-odból a Pull Request-edet. Írd le benne, hogy mit változtattál és ha lehet, csatolj képernyőképet is.
+Minél gyakrabban készíts minél részletesebben elnevezett Commit-okat, hogy mások is el tudjanak igazodni az általad beküldött kódban.

 ---

-Az általad fejlesztett funkciók mellé a changelogban odakerül GitHub felhasználóneved.
-Ha jelentős és rendszeres hozzájáruló vagy, Discordon megkapod a `DEV` rangot.
+Az általad fejlesztett funkciók mellé a Changelog-ba odakerül a GitHub felhasználóneved.
+Ha jelentős és rendszeres hozzájáruló vagy, Discord-on megkaphatod a `DEV` rangot.

-Ha bárhol elakadtál, keress minket Discordon.
-Jó fejlesztést kívánunk!
+Ha bárhol elakadtál vagy kérdésed van, keress bátran Discordon!
+**Jó fejlesztést kívánunk!**
--- a/README.md
+++ b/README.md
@@ -5,7 +5,7 @@

 #### Nem hivatalos e-napló alkalmazás az eKRÉTA rendszerhez - tanulóktól, tanulóknak.

-[![Downloads](https://img.shields.io/github/downloads-pre/refilc/naplo/total?color=%23&label=Downloads&logo=github&sort=semver)](https://github.com/refilc/naplo/releases) &nbsp; [![discord](https://img.shields.io/discord/1111649116020285532?label=Discord)](http://dc.refilc.hu)
+[![Downloads](https://img.shields.io/github/downloads-pre/refilc/naplo/total?&logo=github&label=Downloads)](https://github.com/refilc/naplo/releases) &nbsp; [![Discord](https://img.shields.io/discord/1111649116020285532?logo=discord&label=Discord)](https://dc.refilc.hu)

 ## Setup

@@ -29,11 +29,13 @@ flutter run

 ### Contribution

+**Nézd meg a [Contribution guide](CONTRIBUTING.md)-ot!**
+
 Az összes (ugyan azon verzióhoz tartozó) contribution meg fog jelenni a release-nél. Kérjük, írd le a Discord nevedet a Description-be, hogy adhassunk rangot.

 -------

-# Kudo
+# Developers

 **annon:** a Filc napló készítője (ez az app a Filcen alapul)

--- a/filcnaplo/.gitignore
+++ b/filcnaplo/.gitignore
@@ -44,3 +44,4 @@ app.*.map.json
 /android/app/debug
 /android/app/profile
 /android/app/release
+key.properties
--- a/filcnaplo/android/app/src/main/AndroidManifest.xml
+++ b/filcnaplo/android/app/src/main/AndroidManifest.xml
@@ -1,6 +1,6 @@
 <manifest xmlns:android="http://schemas.android.com/apk/res/android"
    xmlns:tools="http://schemas.android.com/tools" package="hu.refilc.naplo">
-    <application android:label="reFilc" tools:replace="android:label" android:icon="@mipmap/ic_launcher"
+    <application android:name="${applicationName}" android:label="reFilc" tools:replace="android:label" android:icon="@mipmap/ic_launcher"
        android:requestLegacyExternalStorage="true">
        <activity android:exported="true" android:name=".MainActivity"
            android:launchMode="singleTop" android:theme="@style/LaunchTheme"
@@ -62,9 +62,10 @@
    <uses-permission android:name="android.permission.VIBRATE" />
    <uses-permission android:name="android.permission.READ_EXTERNAL_STORAGE" />
    <uses-permission android:name="android.permission.WRITE_EXTERNAL_STORAGE" />
+    <uses-permission android:name="android.permission.REQUEST_INSTALL_PACKAGES" />
    <uses-permission android:name="android.permission.REQUEST_IGNORE_BATTERY_OPTIMIZATIONS" />
    <uses-permission android:name="android.permission.FOREGROUND_SERVICE" />
    <uses-permission android:name="android.permission.WAKE_LOCK" />
    <uses-permission android:name="android.permission.SYSTEM_ALERT_WINDOW" />
    <uses-permission android:name="android.permission.RECEIVE_BOOT_COMPLETED" />
-</manifest>
+</manifest>
--- a/filcnaplo/android/app/src/main/java/hu/filc/naplo/MainActivity.java
+++ b/filcnaplo/android/app/src/main/java/hu/filc/naplo/MainActivity.java
@@ -1,18 +1,9 @@
 package hu.refilc.naplo;

-import android.os.Bundle;
-
 import io.flutter.embedding.android.FlutterActivity;
-import io.flutter.plugins.GeneratedPluginRegistrant;

 import io.flutter.embedding.engine.FlutterEngine;

 public class MainActivity extends FlutterActivity {
-
-    @Override
-    protected void onCreate(Bundle savedInstanceState) {
-        super.onCreate(savedInstanceState);
-
-        GeneratedPluginRegistrant.registerWith(new FlutterEngine(this));
-    }
+    
 }
--- a/filcnaplo/android/app/src/main/res/drawable/ic_notification.png
+++ b/filcnaplo/android/app/src/main/res/drawable/ic_notification.png
--- a/filcnaplo/assets/images/card_border.png
+++ b/filcnaplo/assets/images/card_border.png
--- a/filcnaplo/build-ipa.sh
+++ b/filcnaplo/build-ipa.sh
@@ -1,3 +1,7 @@
 #!/bin/sh

+flutter clean
+dart pub get
+flutter doctor -v
+
 flutter build ipa --release --dart-define=APPVER=$(cat pubspec.yaml | grep version: | cut -d' ' -f2 | cut -d+ -f1) --no-tree-shake-icons
--- a/filcnaplo/ios/Flutter/Generated
+++ b/filcnaplo/ios/Flutter/Generated
@@ -0,0 +1,15 @@
+// This is a generated file; do not edit or check into version control.
+FLUTTER_ROOT=/Users/kima/development/flutter
+FLUTTER_APPLICATION_PATH=/Users/kima/Documents/refilc/app/naplo/filcnaplo
+COCOAPODS_PARALLEL_CODE_SIGN=true
+FLUTTER_TARGET=/Users/kima/Documents/refilc/app/naplo/filcnaplo/lib/main.dart
+FLUTTER_BUILD_DIR=build
+FLUTTER_BUILD_NAME=4.1.0
+FLUTTER_BUILD_NUMBER=213
+EXCLUDED_ARCHS[sdk=iphonesimulator*]=i386
+EXCLUDED_ARCHS[sdk=iphoneos*]=armv7
+DART_DEFINES=RkxVVFRFUl9XRUJfQVVUT19ERVRFQ1Q9dHJ1ZQ==,RkxVVFRFUl9XRUJfQ0FOVkFTS0lUX1VSTD1odHRwczovL3d3dy5nc3RhdGljLmNvbS9mbHV0dGVyLWNhbnZhc2tpdC8yYTM0MDFjOWJiYjVhOWE5YWVjNzRkNGY3MzVkMThhOWRkM2ViZjJkLw==
+DART_OBFUSCATION=false
+TRACK_WIDGET_CREATION=true
+TREE_SHAKE_ICONS=false
+PACKAGE_CONFIG=/Users/kima/Documents/refilc/app/naplo/filcnaplo/.dart_tool/package_config.json
--- a/filcnaplo/ios/Flutter/flutter_export_environment
+++ b/filcnaplo/ios/Flutter/flutter_export_environment
@@ -0,0 +1,14 @@
+#!/bin/sh
+# This is a generated file; do not edit or check into version control.
+export "FLUTTER_ROOT=/Users/kima/development/flutter"
+export "FLUTTER_APPLICATION_PATH=/Users/kima/Documents/refilc/app/naplo/filcnaplo"
+export "COCOAPODS_PARALLEL_CODE_SIGN=true"
+export "FLUTTER_TARGET=/Users/kima/Documents/refilc/app/naplo/filcnaplo/lib/main.dart"
+export "FLUTTER_BUILD_DIR=build"
+export "FLUTTER_BUILD_NAME=4.1.0"
+export "FLUTTER_BUILD_NUMBER=213"
+export "DART_DEFINES=RkxVVFRFUl9XRUJfQVVUT19ERVRFQ1Q9dHJ1ZQ==,RkxVVFRFUl9XRUJfQ0FOVkFTS0lUX1VSTD1odHRwczovL3d3dy5nc3RhdGljLmNvbS9mbHV0dGVyLWNhbnZhc2tpdC8yYTM0MDFjOWJiYjVhOWE5YWVjNzRkNGY3MzVkMThhOWRkM2ViZjJkLw=="
+export "DART_OBFUSCATION=false"
+export "TRACK_WIDGET_CREATION=true"
+export "TREE_SHAKE_ICONS=false"
+export "PACKAGE_CONFIG=/Users/kima/Documents/refilc/app/naplo/filcnaplo/.dart_tool/package_config.json"
--- a/filcnaplo/ios/Podfile.lock
+++ b/filcnaplo/ios/Podfile.lock
@@ -204,7 +204,7 @@ SPEC CHECKSUMS:
  connectivity_plus: 07c49e96d7fc92bc9920617b83238c4d178b446a
  DKImagePickerController: b512c28220a2b8ac7419f21c491fc8534b7601ac
  DKPhotoGallery: fdfad5125a9fdda9cc57df834d49df790dbb4179
-  file_picker: 817ab1d8cd2da9d2da412a417162deee3500fc95
+  file_picker: ce3938a0df3cc1ef404671531facef740d03f920
  Flutter: f04841e97a9d0b0a8025694d0796dd46242b2854
  flutter_custom_tabs: 7a10a08686955cb748e5d26e0ae586d30689bf89
  flutter_image_compress: 5a5e9aee05b6553048b8df1c3bc456d0afaac433
@@ -218,14 +218,14 @@ SPEC CHECKSUMS:
  live_activities: 9ff56a06a2d43ecd68f56deeed13b18a8304789c
  Mantle: c5aa8794a29a022dfbbfc9799af95f477a69b62d
  open_file: 02eb5cb6b21264bd3a696876f5afbfb7ca4f4b7d
-  package_info_plus: 6c92f08e1f853dc01228d6f553146438dafcd14e
+  package_info_plus: fd030dabf36271f146f1f3beacd48f564b0f17f7
  path_provider_foundation: eaf5b3e458fc0e5fbb9940fb09980e853fe058b8
  permission_handler_apple: 44366e37eaf29454a1e7b1b7d736c2cceaeb17ce
  quick_actions_ios: 9e80dcfadfbc5d47d9cf8f47bcf428b11cf383d4
  ReachabilitySwift: 985039c6f7b23a1da463388634119492ff86c825
  SDWebImage: 72f86271a6f3139cc7e4a89220946489d4b9a866
  SDWebImageWebPCoder: 18503de6621dd2c420d680e33d46bf8e1d5169b0
-  share_plus: 056a1e8ac890df3e33cb503afffaf1e9b4fbae68
+  share_plus: 599aa54e4ea31d4b4c0e9c911bcc26c55e791028
  sqflite: 31f7eba61e3074736dff8807a9b41581e4f7f15a
  SwiftyGif: 6c3eafd0ce693cad58bb63d2b2fb9bacb8552780
  uni_links: d97da20c7701486ba192624d99bffaaffcfc298a
--- a/filcnaplo/ios/Runner.xcodeproj/project.pbxproj
+++ b/filcnaplo/ios/Runner.xcodeproj/project.pbxproj
@@ -488,7 +488,7 @@
 					"@executable_path/Frameworks",
 				);
 				MARKETING_VERSION = 3.6.0;
-				PRODUCT_BUNDLE_IDENTIFIER = com.refilc.naplo;
+				PRODUCT_BUNDLE_IDENTIFIER = com.refilctest.naplo;
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				SWIFT_OBJC_BRIDGING_HEADER = "Runner/Runner-Bridging-Header.h";
 				SWIFT_VERSION = 5.0;
@@ -526,7 +526,7 @@
 				MARKETING_VERSION = 1.0;
 				MTL_ENABLE_DEBUG_INFO = INCLUDE_SOURCE;
 				MTL_FAST_MATH = YES;
-				PRODUCT_BUNDLE_IDENTIFIER = com.refilc.naplo.livecardpro;
+				PRODUCT_BUNDLE_IDENTIFIER = com.refilctest.naplo.livecardpro;
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				PROVISIONING_PROFILE_SPECIFIER = "";
 				SKIP_INSTALL = YES;
@@ -567,7 +567,7 @@
 				);
 				MARKETING_VERSION = 1.0;
 				MTL_FAST_MATH = YES;
-				PRODUCT_BUNDLE_IDENTIFIER = com.refilc.naplo.livecardpro;
+				PRODUCT_BUNDLE_IDENTIFIER = com.refilctest.naplo.livecardpro;
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				PROVISIONING_PROFILE_SPECIFIER = "";
 				SKIP_INSTALL = YES;
@@ -607,7 +607,7 @@
 				);
 				MARKETING_VERSION = 1.0;
 				MTL_FAST_MATH = YES;
-				PRODUCT_BUNDLE_IDENTIFIER = com.refilc.naplo.livecardpro;
+				PRODUCT_BUNDLE_IDENTIFIER = com.refilctest.naplo.livecardpro;
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				PROVISIONING_PROFILE_SPECIFIER = "";
 				SKIP_INSTALL = YES;
@@ -746,7 +746,7 @@
 					"@executable_path/Frameworks",
 				);
 				MARKETING_VERSION = 3.6.0;
-				PRODUCT_BUNDLE_IDENTIFIER = com.refilc.naplo;
+				PRODUCT_BUNDLE_IDENTIFIER = com.refilctest.naplo;
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				SWIFT_OBJC_BRIDGING_HEADER = "Runner/Runner-Bridging-Header.h";
 				SWIFT_OPTIMIZATION_LEVEL = "-Onone";
@@ -774,7 +774,7 @@
 					"@executable_path/Frameworks",
 				);
 				MARKETING_VERSION = 3.6.0;
-				PRODUCT_BUNDLE_IDENTIFIER = com.refilc.naplo;
+				PRODUCT_BUNDLE_IDENTIFIER = com.refilctest.naplo;
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				SWIFT_OBJC_BRIDGING_HEADER = "Runner/Runner-Bridging-Header.h";
 				SWIFT_VERSION = 5.0;
--- a/filcnaplo/lib/api/client.dart
+++ b/filcnaplo/lib/api/client.dart
@@ -7,6 +7,7 @@ import 'package:filcnaplo/models/release.dart';
 import 'package:filcnaplo/models/settings.dart';
 import 'package:filcnaplo/models/supporter.dart';
 import 'package:filcnaplo_kreta_api/models/school.dart';
+import 'package:flutter/foundation.dart';
 import 'package:http/http.dart' as http;
 import 'package:connectivity_plus/connectivity_plus.dart';

@@ -68,7 +69,9 @@ class FilcAPI {
      http.Response res = await http.get(Uri.parse(config), headers: headers);

      if (res.statusCode == 200) {
-        print(jsonDecode(res.body));
+        if (kDebugMode) {
+          print(jsonDecode(res.body));
+        }
        return Config.fromJson(jsonDecode(res.body));
      } else if (res.statusCode == 429) {
        res = await http.get(Uri.parse(config));
--- a/filcnaplo/lib/api/login.dart
+++ b/filcnaplo/lib/api/login.dart
@@ -49,22 +49,22 @@ Future loginApi({
 }) async {
  Provider.of<KretaClient>(context, listen: false).userAgent =
      Provider.of<SettingsProvider>(context, listen: false).config.userAgent;
-
+  
  Map<String, String> headers = {
    "content-type": "application/x-www-form-urlencoded",
  };
-
+  
  String nonceStr = await Provider.of<KretaClient>(context, listen: false)
      .getAPI(KretaAPI.nonce, json: false);
-
-  Nonce nonce = getNonce(nonceStr, username.replaceAll(' ', '') + ' ', instituteCode);
+  
+  Nonce nonce = getNonce(nonceStr, username, instituteCode);
  headers.addAll(nonce.header());

  Map? res = await Provider.of<KretaClient>(context, listen: false)
      .postAPI(KretaAPI.login,
          headers: headers,
          body: User.loginBody(
-            username: username.replaceAll(' ', '') + ' ',
+            username: username,
            password: password,
            instituteCode: instituteCode,
          ));
@@ -83,7 +83,7 @@ Future loginApi({
                  .getAPI(KretaAPI.student(instituteCode));
          Student student = Student.fromJson(studentJson!);
          var user = User(
-            username: username.replaceAll(' ', '') + ' ',
+            username: username,
            password: password,
            instituteCode: instituteCode,
            name: student.name,
--- a/filcnaplo/lib/api/providers/database_provider.dart
+++ b/filcnaplo/lib/api/providers/database_provider.dart
@@ -2,7 +2,6 @@ import 'dart:io';

 import 'package:filcnaplo/database/query.dart';
 import 'package:filcnaplo/database/store.dart';
-import 'package:sqflite/sqflite.dart';
 // ignore: depend_on_referenced_packages
 import 'package:sqflite_common_ffi/sqflite_ffi.dart';

--- a/filcnaplo/lib/api/providers/live_card_provider.dart
+++ b/filcnaplo/lib/api/providers/live_card_provider.dart
@@ -19,7 +19,8 @@ enum LiveCardState {
  duringBreak,
  morning,
  afternoon,
-  night
+  night,
+  summary
 }

 class LiveCardProvider extends ChangeNotifier {
@@ -39,6 +40,8 @@ class LiveCardProvider extends ChangeNotifier {
  String? _latestActivityId;
  Map<String, String> _lastActivity = {};

+  bool _hasCheckedTimetable = false;
+
  LiveCardProvider({
    required TimetableProvider timetable,
    required SettingsProvider settings,
@@ -47,7 +50,9 @@ class LiveCardProvider extends ChangeNotifier {
    // Check if live card is enabled .areActivitiesEnabled()
    _liveActivitiesPlugin.areActivitiesEnabled().then((value) {
      // Console log
-      print("Live card enabled: $value");
+      if (kDebugMode) {
+        print("Live card enabled: $value");
+      }

      if (value) {
        _liveActivitiesPlugin.init(appGroupId: "group.refilc.livecard");
@@ -195,7 +200,8 @@ class LiveCardProvider extends ChangeNotifier {

    List<Lesson> today = _today(_timetable);

-    if (today.isEmpty) {
+    if (today.isEmpty && !_hasCheckedTimetable) {
+      _hasCheckedTimetable = true;
      await _timetable.fetch(week: Week.current());
      today = _today(_timetable);
    }
@@ -249,7 +255,10 @@ class LiveCardProvider extends ChangeNotifier {
      }
    }

-    if (currentLesson != null) {
+    if (now.isBefore(DateTime(now.year, DateTime.august, 31)) &&
+        now.isAfter(DateTime(now.year, DateTime.june, 14))) {
+      currentState = LiveCardState.summary;
+    } else if (currentLesson != null) {
      currentState = LiveCardState.duringLesson;
    } else if (nextLesson != null && prevLesson != null) {
      currentState = LiveCardState.duringBreak;
--- a/filcnaplo/lib/database/init.dart
+++ b/filcnaplo/lib/database/init.dart
@@ -5,28 +5,36 @@ import 'dart:io';
 import 'package:filcnaplo/api/providers/database_provider.dart';
 import 'package:filcnaplo/database/struct.dart';
 import 'package:filcnaplo/models/settings.dart';
-import 'package:sqflite/sqflite.dart';
 // ignore: depend_on_referenced_packages
 import 'package:sqflite_common_ffi/sqflite_ffi.dart';

 const settingsDB = DatabaseStruct("settings", {
-  "language": String, "start_page": int, "rounding": int, "theme": int, "accent_color": int, "news": int, "news_state": int, "developer_mode": int,
-  "update_channel": int, "config": String, "custom_accent_color": int, "custom_background_color": int, "custom_highlight_color": int, // general
-  "grade_color1": int, "grade_color2": int, "grade_color3": int, "grade_color4": int, "grade_color5": int, // grade colors
+  "language": String, "start_page": int, "rounding": int, "theme": int,
+  "accent_color": int, "news": int, "news_state": int, "developer_mode": int,
+  "update_channel": int, "config": String, "custom_accent_color": int,
+  "custom_background_color": int, "custom_highlight_color": int, // general
+  "grade_color1": int, "grade_color2": int, "grade_color3": int,
+  "grade_color4": int, "grade_color5": int, // grade colors
  "vibration_strength": int, "ab_weeks": int, "swap_ab_weeks": int,
-  "notifications": int, "notifications_bitfield": int, "notification_poll_interval": int, // notifications
-  "x_filc_id": String, "graph_class_avg": int, "presentation_mode": int, "bell_delay": int, "bell_delay_enabled": int,
-  "grade_opening_fun": int, "icon_pack": String, "premium_scopes": String, "premium_token": String, "premium_login": String,
+  "notifications": int, "notifications_bitfield": int,
+  "notification_poll_interval": int, // notifications
+  "x_filc_id": String, "graph_class_avg": int, "presentation_mode": int,
+  "bell_delay": int, "bell_delay_enabled": int,
+  "grade_opening_fun": int, "icon_pack": String, "premium_scopes": String,
+  "premium_token": String, "premium_login": String,
  "last_account_id": String, "renamed_subjects_enabled": int,
+  "renamed_subjects_italics": int,
 });
 // DON'T FORGET TO UPDATE DEFAULT VALUES IN `initDB` MIGRATION OR ELSE PARENTS WILL COMPLAIN ABOUT THEIR CHILDREN MISSING
 // YOU'VE BEEN WARNED!!!
 const usersDB = DatabaseStruct("users", {
-  "id": String, "name": String, "username": String, "password": String, "institute_code": String, "student": String, "role": int,
+  "id": String, "name": String, "username": String, "password": String,
+  "institute_code": String, "student": String, "role": int,
  "nickname": String, "picture": String // premium only
 });
 const userDataDB = DatabaseStruct("user_data", {
-  "id": String, "grades": String, "timetable": String, "exams": String, "homework": String, "messages": String, "notes": String,
+  "id": String, "grades": String, "timetable": String, "exams": String,
+  "homework": String, "messages": String, "notes": String,
  "events": String, "absences": String, "group_averages": String,
  // renamed subjects // non kreta data
  "renamed_subjects": String,
@@ -34,7 +42,8 @@ const userDataDB = DatabaseStruct("user_data", {
  "last_seen_grade": int,
 });

-Future<void> createTable(Database db, DatabaseStruct struct) => db.execute("CREATE TABLE IF NOT EXISTS ${struct.table} ($struct)");
+Future<void> createTable(Database db, DatabaseStruct struct) =>
+    db.execute("CREATE TABLE IF NOT EXISTS ${struct.table} ($struct)");

 Future<Database> initDB(DatabaseProvider database) async {
  Database db;
@@ -50,9 +59,11 @@ Future<Database> initDB(DatabaseProvider database) async {
  await createTable(db, usersDB);
  await createTable(db, userDataDB);

-  if ((await db.rawQuery("SELECT COUNT(*) FROM settings"))[0].values.first == 0) {
+  if ((await db.rawQuery("SELECT COUNT(*) FROM settings"))[0].values.first ==
+      0) {
    // Set default values for table Settings
-    await db.insert("settings", SettingsProvider.defaultSettings(database: database).toMap());
+    await db.insert("settings",
+        SettingsProvider.defaultSettings(database: database).toMap());
  }

  // Migrate Databases
@@ -60,7 +71,8 @@ Future<Database> initDB(DatabaseProvider database) async {
    await migrateDB(
      db,
      struct: settingsDB,
-      defaultValues: SettingsProvider.defaultSettings(database: database).toMap(),
+      defaultValues:
+          SettingsProvider.defaultSettings(database: database).toMap(),
    );
    await migrateDB(
      db,
@@ -68,7 +80,8 @@ Future<Database> initDB(DatabaseProvider database) async {
      defaultValues: {"role": 0, "nickname": "", "picture": ""},
    );
    await migrateDB(db, struct: userDataDB, defaultValues: {
-      "grades": "[]", "timetable": "[]", "exams": "[]", "homework": "[]", "messages": "[]", "notes": "[]", "events": "[]", "absences": "[]",
+      "grades": "[]", "timetable": "[]", "exams": "[]", "homework": "[]",
+      "messages": "[]", "notes": "[]", "events": "[]", "absences": "[]",
      "group_averages": "[]",
      // renamed subjects // non kreta data
      "renamed_subjects": "{}",
@@ -99,7 +112,8 @@ Future<void> migrateDB(

  // go through each row and add missing keys or delete non existing keys
  await Future.forEach<Map<String, Object?>>(originalRows, (original) async {
-    bool migrationRequired = struct.struct.keys.any((key) => !original.containsKey(key) || original[key] == null) ||
+    bool migrationRequired = struct.struct.keys.any(
+            (key) => !original.containsKey(key) || original[key] == null) ||
        original.keys.any((key) => !struct.struct.containsKey(key));

    if (migrationRequired) {
--- a/filcnaplo/lib/helpers/notification_helper.dart
+++ b/filcnaplo/lib/helpers/notification_helper.dart
@@ -0,0 +1,76 @@
+import 'dart:math';
+import 'dart:ui';
+
+import 'package:filcnaplo/api/providers/database_provider.dart';
+import 'package:filcnaplo/api/providers/status_provider.dart';
+import 'package:filcnaplo/api/providers/user_provider.dart';
+import 'package:filcnaplo/models/settings.dart';
+import 'package:filcnaplo/helpers/notification_helper.i18n.dart';
+import 'package:filcnaplo_kreta_api/client/client.dart';
+import 'package:filcnaplo_kreta_api/models/grade.dart';
+import 'package:filcnaplo_kreta_api/providers/grade_provider.dart';
+import 'package:flutter_local_notifications/flutter_local_notifications.dart';
+
+class NotificationsHelper {
+  @pragma('vm:entry-point')
+  void backgroundJob() async {
+    // initialize providers
+    FlutterLocalNotificationsPlugin flutterLocalNotificationsPlugin =
+        FlutterLocalNotificationsPlugin();
+    DatabaseProvider database = DatabaseProvider();
+    await database.init();
+    SettingsProvider settingsProvider =
+        await database.query.getSettings(database);
+    UserProvider userProvider = await database.query.getUsers(settingsProvider);
+
+    if (userProvider.id != null && settingsProvider.notificationsEnabled) {
+      // refresh grades
+      final status = StatusProvider();
+      final kretaClient = KretaClient(
+          user: userProvider, settings: settingsProvider, status: status);
+      kretaClient.refreshLogin();
+      GradeProvider gradeProvider = GradeProvider(
+          settings: settingsProvider,
+          user: userProvider,
+          database: database,
+          kreta: kretaClient);
+      gradeProvider.fetch();
+      List<Grade> grades =
+          await database.userQuery.getGrades(userId: userProvider.id ?? "");
+      DateTime lastSeenGrade =
+          await database.userQuery.lastSeenGrade(userId: userProvider.id ?? "");
+
+      // loop through grades and see which hasn't been seen yet
+      for (Grade grade in grades) {
+        // if the grade was added over a week ago, don't show it to avoid notification spam
+        if (grade.seenDate.isAfter(lastSeenGrade) &&
+            grade.date.difference(DateTime.now()).inDays * -1 < 7) {
+          // send notificiation about new grade
+          const AndroidNotificationDetails androidNotificationDetails =
+              AndroidNotificationDetails('GRADES', 'Jegyek',
+                  channelDescription: 'Értesítés jegyek beírásakor',
+                  importance: Importance.max,
+                  priority: Priority.max,
+                  color: Color(0xFF3D7BF4),
+                  ticker: 'Jegyek');
+          const NotificationDetails notificationDetails =
+              NotificationDetails(android: androidNotificationDetails);
+          await flutterLocalNotificationsPlugin.show(
+              // probably shouldn't use a random int
+              Random().nextInt(432234 * 2),
+              "title".i18n,
+              "body".i18n.fill([
+                grade.value.value.toString(),
+                grade.subject.isRenamed &&
+                        settingsProvider.renamedSubjectsEnabled
+                    ? grade.subject.renamedTo!
+                    : grade.subject.name
+              ]),
+              notificationDetails);
+        }
+      }
+      // set grade seen status
+      gradeProvider.seenAll();
+    }
+  }
+}
--- a/filcnaplo/lib/helpers/notification_helper.i18n.dart
+++ b/filcnaplo/lib/helpers/notification_helper.i18n.dart
@@ -0,0 +1,24 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension Localization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          "title": "New grade",
+          "body": "You got a %s in %s"
+        },
+        "hu_hu": {
+          "title": "Új jegy",
+          "body": "%s-st kaptál %s tantárgyból"
+        },
+        "de_de": {
+          "title": "Neue Note",
+          "body": "Du hast eine %s in %s"
+        },
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}
--- a/filcnaplo/lib/helpers/update_helper.dart
+++ b/filcnaplo/lib/helpers/update_helper.dart
@@ -19,7 +19,7 @@ extension UpdateHelper on Release {
    updateCallback!(-1, UpdateState.preparing);

    String downloads = await StorageHelper.downloadsPath();
-    File apk = File("$downloads/refilc-$version.apk");
+    File apk = File("$downloads/refilc-v$version.apk");

    if (!await apk.exists()) {
      updateCallback(-1, UpdateState.downloading);
--- a/filcnaplo/lib/main.dart
+++ b/filcnaplo/lib/main.dart
@@ -1,7 +1,10 @@
+import 'dart:io';
+
 import 'package:background_fetch/background_fetch.dart';
 import 'package:filcnaplo/api/providers/user_provider.dart';
 import 'package:filcnaplo/api/providers/database_provider.dart';
 import 'package:filcnaplo/database/init.dart';
+import 'package:filcnaplo/helpers/notification_helper.dart';
 import 'package:filcnaplo/models/settings.dart';
 import 'package:flutter/foundation.dart';
 import 'package:flutter/material.dart';
@@ -9,6 +12,7 @@ import 'package:filcnaplo/app.dart';
 import 'package:flutter/services.dart';
 import 'package:filcnaplo_mobile_ui/screens/error_screen.dart';
 import 'package:filcnaplo_mobile_ui/screens/error_report_screen.dart';
+import 'package:flutter_local_notifications/flutter_local_notifications.dart';

 void main() async {
  // Initalize
@@ -43,6 +47,57 @@ class Startup {
    await database.init();
    settings = await database.query.getSettings(database);
    user = await database.query.getUsers(settings);
+
+    // Notifications setup
+    initPlatformState();
+    FlutterLocalNotificationsPlugin flutterLocalNotificationsPlugin =
+        FlutterLocalNotificationsPlugin();
+
+    // Get permission to show notifications
+    if (Platform.isAndroid) {
+      await flutterLocalNotificationsPlugin
+          .resolvePlatformSpecificImplementation<
+              AndroidFlutterLocalNotificationsPlugin>()!
+          .requestPermission();
+    } else if (Platform.isIOS) {
+      await flutterLocalNotificationsPlugin
+          .resolvePlatformSpecificImplementation<
+              IOSFlutterLocalNotificationsPlugin>()
+          ?.requestPermissions(
+            alert: false,
+            badge: true,
+            sound: true,
+          );
+    } else if (Platform.isMacOS) {
+      await flutterLocalNotificationsPlugin
+          .resolvePlatformSpecificImplementation<
+              MacOSFlutterLocalNotificationsPlugin>()
+          ?.requestPermissions(
+            alert: false,
+            badge: true,
+            sound: true,
+          );
+    }
+
+    // Platform specific settings
+    const DarwinInitializationSettings initializationSettingsDarwin =
+        DarwinInitializationSettings(
+      requestSoundPermission: true,
+      requestBadgePermission: true,
+      requestAlertPermission: false,
+    );
+    const AndroidInitializationSettings initializationSettingsAndroid =
+        AndroidInitializationSettings('ic_notification');
+    const InitializationSettings initializationSettings =
+        InitializationSettings(
+            android: initializationSettingsAndroid,
+            iOS: initializationSettingsDarwin,
+            macOS: initializationSettingsDarwin);
+
+    // Initialize notifications
+    await flutterLocalNotificationsPlugin.initialize(
+      initializationSettings,
+    );
  }
 }

@@ -72,8 +127,58 @@ Widget errorBuilder(FlutterErrorDetails details) {
  });
 }

+Future<void> initPlatformState() async {
+  // Configure BackgroundFetch.
+  int status = await BackgroundFetch.configure(
+      BackgroundFetchConfig(
+          minimumFetchInterval: 15,
+          stopOnTerminate: false,
+          enableHeadless: true,
+          requiresBatteryNotLow: false,
+          requiresCharging: false,
+          requiresStorageNotLow: false,
+          requiresDeviceIdle: false,
+          requiredNetworkType: NetworkType.ANY,
+          startOnBoot: true), (String taskId) async {
+    // <-- Event handler
+    if (kDebugMode) {
+      print("[BackgroundFetch] Event received $taskId");
+    }
+    NotificationsHelper().backgroundJob();
+    BackgroundFetch.finish(taskId);
+  }, (String taskId) async {
+    // <-- Task timeout handler.
+    if (kDebugMode) {
+      print("[BackgroundFetch] TASK TIMEOUT taskId: $taskId");
+    }
+    BackgroundFetch.finish(taskId);
+  });
+  if (kDebugMode) {
+    print('[BackgroundFetch] configure success: $status');
+  }
+  BackgroundFetch.scheduleTask(TaskConfig(
+      taskId: "com.transistorsoft.refilcnotification",
+      delay: 900000, // 15 minutes
+      periodic: true,
+      forceAlarmManager: true,
+      stopOnTerminate: false,
+      enableHeadless: true));
+}
+
@pragma('vm:entry-point')
 void backgroundHeadlessTask(HeadlessTask task) {
-  print('[BackgroundFetch] Headless event received.');
+  String taskId = task.taskId;
+  bool isTimeout = task.timeout;
+  if (isTimeout) {
+    if (kDebugMode) {
+      print("[BackgroundFetch] Headless task timed-out: $taskId");
+    }
+    BackgroundFetch.finish(taskId);
+    return;
+  }
+  if (kDebugMode) {
+    print('[BackgroundFetch] Headless event received.');
+  }
+  NotificationsHelper().backgroundJob();
  BackgroundFetch.finish(task.taskId);
 }
--- a/filcnaplo/lib/models/personality.dart
+++ b/filcnaplo/lib/models/personality.dart
@@ -0,0 +1,21 @@
+class Personality {
+  PersonalityType type;
+
+  Personality({
+    this.type = PersonalityType.npc,
+  });
+}
+
+enum PersonalityType {
+  geek,
+  sick,
+  late,
+  quitter,
+  healthy,
+  acceptable,
+  fallible,
+  average,
+  diligent,
+  cheater,
+  npc
+}
--- a/filcnaplo/lib/models/settings.dart
+++ b/filcnaplo/lib/models/settings.dart
@@ -68,6 +68,7 @@ class SettingsProvider extends ChangeNotifier {
  String _premiumLogin;
  String _lastAccountId;
  bool _renamedSubjectsEnabled;
+  bool _renamedSubjectsItalics;

  SettingsProvider({
    DatabaseProvider? database,
@@ -104,6 +105,7 @@ class SettingsProvider extends ChangeNotifier {
    required String premiumLogin,
    required String lastAccountId,
    required bool renameSubjectsEnabled,
+    required bool renameSubjectsItalics,
  })  : _database = database,
        _language = language,
        _startPage = startPage,
@@ -137,7 +139,8 @@ class SettingsProvider extends ChangeNotifier {
        _premiumAccessToken = premiumAccessToken,
        _premiumLogin = premiumLogin,
        _lastAccountId = lastAccountId,
-        _renamedSubjectsEnabled = renameSubjectsEnabled;
+        _renamedSubjectsEnabled = renameSubjectsEnabled,
+        _renamedSubjectsItalics = renameSubjectsItalics;

  factory SettingsProvider.fromMap(Map map,
      {required DatabaseProvider database}) {
@@ -191,6 +194,7 @@ class SettingsProvider extends ChangeNotifier {
      premiumLogin: map["premium_login"],
      lastAccountId: map["last_account_id"],
      renameSubjectsEnabled: map["renamed_subjects_enabled"] == 1,
+      renameSubjectsItalics: map["renamed_subjects_italics"] == 1,
    );
  }

@@ -231,7 +235,8 @@ class SettingsProvider extends ChangeNotifier {
      "premium_token": _premiumAccessToken,
      "premium_login": _premiumLogin,
      "last_account_id": _lastAccountId,
-      "renamed_subjects_enabled": _renamedSubjectsEnabled ? 1 : 0
+      "renamed_subjects_enabled": _renamedSubjectsEnabled ? 1 : 0,
+      "renamed_subjects_italics": _renamedSubjectsItalics ? 1 : 0
    };
  }

@@ -277,6 +282,7 @@ class SettingsProvider extends ChangeNotifier {
      premiumLogin: "igen",
      lastAccountId: "",
      renameSubjectsEnabled: false,
+      renameSubjectsItalics: false,
    );
  }

@@ -317,6 +323,7 @@ class SettingsProvider extends ChangeNotifier {
  String get premiumLogin => _premiumLogin;
  String get lastAccountId => _lastAccountId;
  bool get renamedSubjectsEnabled => _renamedSubjectsEnabled;
+  bool get renamedSubjectsItalics => _renamedSubjectsItalics;

  Future<void> update({
    bool store = true,
@@ -353,69 +360,94 @@ class SettingsProvider extends ChangeNotifier {
    String? premiumLogin,
    String? lastAccountId,
    bool? renamedSubjectsEnabled,
+    bool? renamedSubjectsItalics,
  }) async {
    if (language != null && language != _language) _language = language;
    if (startPage != null && startPage != _startPage) _startPage = startPage;
    if (rounding != null && rounding != _rounding) _rounding = rounding;
    if (theme != null && theme != _theme) _theme = theme;
-    if (accentColor != null && accentColor != _accentColor)
+    if (accentColor != null && accentColor != _accentColor) {
      _accentColor = accentColor;
-    if (gradeColors != null && gradeColors != _gradeColors)
+    }
+    if (gradeColors != null && gradeColors != _gradeColors) {
      _gradeColors = gradeColors;
-    if (newsEnabled != null && newsEnabled != _newsEnabled)
+    }
+    if (newsEnabled != null && newsEnabled != _newsEnabled) {
      _newsEnabled = newsEnabled;
+    }
    if (newsState != null && newsState != _newsState) _newsState = newsState;
    if (notificationsEnabled != null &&
-        notificationsEnabled != _notificationsEnabled)
+        notificationsEnabled != _notificationsEnabled) {
      _notificationsEnabled = notificationsEnabled;
+    }
    if (notificationsBitfield != null &&
-        notificationsBitfield != _notificationsBitfield)
+        notificationsBitfield != _notificationsBitfield) {
      _notificationsBitfield = notificationsBitfield;
-    if (developerMode != null && developerMode != _developerMode)
+    }
+    if (developerMode != null && developerMode != _developerMode) {
      _developerMode = developerMode;
+    }
    if (notificationPollInterval != null &&
        notificationPollInterval != _notificationPollInterval) {
      _notificationPollInterval = notificationPollInterval;
    }
    if (vibrate != null && vibrate != _vibrate) _vibrate = vibrate;
    if (abWeeks != null && abWeeks != _abWeeks) _abWeeks = abWeeks;
-    if (swapABweeks != null && swapABweeks != _swapABweeks)
+    if (swapABweeks != null && swapABweeks != _swapABweeks) {
      _swapABweeks = swapABweeks;
-    if (updateChannel != null && updateChannel != _updateChannel)
+    }
+    if (updateChannel != null && updateChannel != _updateChannel) {
      _updateChannel = updateChannel;
+    }
    if (config != null && config != _config) _config = config;
    if (xFilcId != null && xFilcId != _xFilcId) _xFilcId = xFilcId;
-    if (graphClassAvg != null && graphClassAvg != _graphClassAvg)
+    if (graphClassAvg != null && graphClassAvg != _graphClassAvg) {
      _graphClassAvg = graphClassAvg;
+    }
    if (goodStudent != null) _goodStudent = goodStudent;
-    if (presentationMode != null && presentationMode != _presentationMode)
+    if (presentationMode != null && presentationMode != _presentationMode) {
      _presentationMode = presentationMode;
+    }
    if (bellDelay != null && bellDelay != _bellDelay) _bellDelay = bellDelay;
-    if (bellDelayEnabled != null && bellDelayEnabled != _bellDelayEnabled)
+    if (bellDelayEnabled != null && bellDelayEnabled != _bellDelayEnabled) {
      _bellDelayEnabled = bellDelayEnabled;
-    if (gradeOpeningFun != null && gradeOpeningFun != _gradeOpeningFun)
+    }
+    if (gradeOpeningFun != null && gradeOpeningFun != _gradeOpeningFun) {
      _gradeOpeningFun = gradeOpeningFun;
+    }
    if (iconPack != null && iconPack != _iconPack) _iconPack = iconPack;
-    if (customAccentColor != null && customAccentColor != _customAccentColor)
+    if (customAccentColor != null && customAccentColor != _customAccentColor) {
      _customAccentColor = customAccentColor;
+    }
    if (customBackgroundColor != null &&
-        customBackgroundColor != _customBackgroundColor)
+        customBackgroundColor != _customBackgroundColor) {
      _customBackgroundColor = customBackgroundColor;
+    }
    if (customHighlightColor != null &&
-        customHighlightColor != _customHighlightColor)
+        customHighlightColor != _customHighlightColor) {
      _customHighlightColor = customHighlightColor;
-    if (premiumScopes != null && premiumScopes != _premiumScopes)
+    }
+    if (premiumScopes != null && premiumScopes != _premiumScopes) {
      _premiumScopes = premiumScopes;
-    if (premiumAccessToken != null && premiumAccessToken != _premiumAccessToken)
+    }
+    if (premiumAccessToken != null &&
+        premiumAccessToken != _premiumAccessToken) {
      _premiumAccessToken = premiumAccessToken;
-    if (premiumLogin != null && premiumLogin != _premiumLogin)
+    }
+    if (premiumLogin != null && premiumLogin != _premiumLogin) {
      _premiumLogin = premiumLogin;
-    if (lastAccountId != null && lastAccountId != _lastAccountId)
+    }
+    if (lastAccountId != null && lastAccountId != _lastAccountId) {
      _lastAccountId = lastAccountId;
+    }
    if (renamedSubjectsEnabled != null &&
-        renamedSubjectsEnabled != _renamedSubjectsEnabled)
+        renamedSubjectsEnabled != _renamedSubjectsEnabled) {
      _renamedSubjectsEnabled = renamedSubjectsEnabled;
-
+    }
+    if (renamedSubjectsItalics != null &&
+        renamedSubjectsItalics != _renamedSubjectsItalics) {
+      _renamedSubjectsItalics = renamedSubjectsItalics;
+    }
    if (store) await _database?.store.storeSettings(this);
    notifyListeners();
  }
--- a/filcnaplo/lib/theme/colors/dark_mobile.dart
+++ b/filcnaplo/lib/theme/colors/dark_mobile.dart
@@ -38,6 +38,7 @@ class DarkMobileAppColors implements ThemeAppColors {
  final gradeTwo = const Color(0xFFAE3DF4);
  @override
  final gradeOne = const Color(0xFFF43DAB);
+  @override
  final purple = const Color(0xffBF5AF2);
  @override
  final pink = const Color(0xffFF375F);
--- a/filcnaplo/lib/ui/filter/widgets.dart
+++ b/filcnaplo/lib/ui/filter/widgets.dart
@@ -89,6 +89,7 @@ Future<List<DateWidget>> getFilterWidgets(FilterType activeData,

    // Grades
    case FilterType.grades:
+    gradeProvider.seenAll();
      items = grade_filter.getWidgets(
          gradeProvider.grades, gradeProvider.lastSeenDate);
      if (settingsProvider.gradeOpeningFun) {
--- a/filcnaplo/lib/ui/widgets/grade/grade_tile.dart
+++ b/filcnaplo/lib/ui/widgets/grade/grade_tile.dart
@@ -23,6 +23,8 @@ class GradeTile extends StatelessWidget {
  Widget build(BuildContext context) {
    String title;
    String subtitle;
+    bool isTitleItalic = false;
+    bool isSubtitleItalic = false;
    EdgeInsets leadingPadding = EdgeInsets.zero;
    bool isSubjectView = SubjectGradesContainer.of(context) != null;
    String subjectName =
@@ -32,7 +34,8 @@ class GradeTile extends StatelessWidget {

    GradeCalculatorProvider calculatorProvider =
        Provider.of<GradeCalculatorProvider>(context, listen: false);
-
+    SettingsProvider settingsProvider =
+        Provider.of<SettingsProvider>(context);
    // Test order:
    // description
    // mode
@@ -47,6 +50,7 @@ class GradeTile extends StatelessWidget {
      }
    } else {
      title = subjectName;
+      isTitleItalic = grade.subject.isRenamed && settingsProvider.renamedSubjectsItalics;
    }

    // Test order:
@@ -58,6 +62,7 @@ class GradeTile extends StatelessWidget {
              ? modeDescription
              : ""
          : subjectName;
+      isSubtitleItalic = isSubjectView ? false : grade.subject.isRenamed && settingsProvider.renamedSubjectsItalics;
    } else {
      subtitle = grade.value.valueName.split("(")[0];
    }
@@ -122,7 +127,7 @@ class GradeTile extends StatelessWidget {
                  overflow: TextOverflow.ellipsis,
                  style: TextStyle(
                      fontWeight: FontWeight.w600,
-                      fontStyle: grade.subject.isRenamed && title == subjectName
+                      fontStyle: isTitleItalic
                          ? FontStyle.italic
                          : null),
                ),
@@ -144,7 +149,7 @@ class GradeTile extends StatelessWidget {
                      subtitle,
                      maxLines: 1,
                      overflow: TextOverflow.ellipsis,
-                      style: const TextStyle(fontWeight: FontWeight.w500),
+                      style: TextStyle(fontWeight: FontWeight.w500, fontStyle: isSubtitleItalic ? FontStyle.italic : null),
                    )
              : null,
          trailing: isSubjectView
--- a/filcnaplo/lib/ui/widgets/lesson/lesson_tile.dart
+++ b/filcnaplo/lib/ui/widgets/lesson/lesson_tile.dart
@@ -1,3 +1,4 @@
+import 'package:filcnaplo/models/settings.dart';
 import 'package:filcnaplo_kreta_api/providers/exam_provider.dart';
 import 'package:filcnaplo_kreta_api/providers/homework_provider.dart';
 import 'package:filcnaplo/theme/colors/colors.dart';
@@ -30,6 +31,8 @@ class LessonTile extends StatelessWidget {
    bool fill = false;
    bool fillLeading = false;
    String lessonIndexTrailing = "";
+    
+    SettingsProvider settingsProvider = Provider.of<SettingsProvider>(context);

    // Only put a trailing . if its a digit
    if (RegExp(r'\d').hasMatch(lesson.lessonIndex)) lessonIndexTrailing = ".";
@@ -159,7 +162,7 @@ class LessonTile extends StatelessWidget {
                            .text
                            .withOpacity(!lesson.isEmpty ? 1.0 : 0.5),
                        fontStyle:
-                            lesson.subject.isRenamed ? FontStyle.italic : null),
+                            lesson.subject.isRenamed && settingsProvider.renamedSubjectsItalics ? FontStyle.italic : null),
                  ),
                  subtitle: description != ""
                      ? Text(
--- a/filcnaplo/linux/flutter/generated_plugin_registrant.cc
+++ b/filcnaplo/linux/flutter/generated_plugin_registrant.cc
@@ -7,6 +7,7 @@
 #include "generated_plugin_registrant.h"

 #include <dynamic_color/dynamic_color_plugin.h>
+#include <file_selector_linux/file_selector_plugin.h>
 #include <flutter_acrylic/flutter_acrylic_plugin.h>
 #include <url_launcher_linux/url_launcher_plugin.h>

@@ -14,6 +15,9 @@ void fl_register_plugins(FlPluginRegistry* registry) {
  g_autoptr(FlPluginRegistrar) dynamic_color_registrar =
      fl_plugin_registry_get_registrar_for_plugin(registry, "DynamicColorPlugin");
  dynamic_color_plugin_register_with_registrar(dynamic_color_registrar);
+  g_autoptr(FlPluginRegistrar) file_selector_linux_registrar =
+      fl_plugin_registry_get_registrar_for_plugin(registry, "FileSelectorPlugin");
+  file_selector_plugin_register_with_registrar(file_selector_linux_registrar);
  g_autoptr(FlPluginRegistrar) flutter_acrylic_registrar =
      fl_plugin_registry_get_registrar_for_plugin(registry, "FlutterAcrylicPlugin");
  flutter_acrylic_plugin_register_with_registrar(flutter_acrylic_registrar);
--- a/filcnaplo/linux/flutter/generated_plugins.cmake
+++ b/filcnaplo/linux/flutter/generated_plugins.cmake
@@ -4,6 +4,7 @@

 list(APPEND FLUTTER_PLUGIN_LIST
  dynamic_color
+  file_selector_linux
  flutter_acrylic
  url_launcher_linux
 )
--- a/filcnaplo/macos/Flutter/GeneratedPluginRegistrant.swift
+++ b/filcnaplo/macos/Flutter/GeneratedPluginRegistrant.swift
@@ -7,19 +7,21 @@ import Foundation

 import connectivity_plus
 import dynamic_color
-import flutter_acrylic
+import file_selector_macos
 import flutter_local_notifications
+import macos_window_utils
 import package_info_plus
 import path_provider_foundation
-import share_plus_macos
+import share_plus
 import sqflite
 import url_launcher_macos

 func RegisterGeneratedPlugins(registry: FlutterPluginRegistry) {
  ConnectivityPlugin.register(with: registry.registrar(forPlugin: "ConnectivityPlugin"))
  DynamicColorPlugin.register(with: registry.registrar(forPlugin: "DynamicColorPlugin"))
-  FlutterAcrylicPlugin.register(with: registry.registrar(forPlugin: "FlutterAcrylicPlugin"))
+  FileSelectorPlugin.register(with: registry.registrar(forPlugin: "FileSelectorPlugin"))
  FlutterLocalNotificationsPlugin.register(with: registry.registrar(forPlugin: "FlutterLocalNotificationsPlugin"))
+  MacOSWindowUtilsPlugin.register(with: registry.registrar(forPlugin: "MacOSWindowUtilsPlugin"))
  FLTPackageInfoPlusPlugin.register(with: registry.registrar(forPlugin: "FLTPackageInfoPlusPlugin"))
  PathProviderPlugin.register(with: registry.registrar(forPlugin: "PathProviderPlugin"))
  SharePlusMacosPlugin.register(with: registry.registrar(forPlugin: "SharePlusMacosPlugin"))
--- a/filcnaplo/pubspec.yaml
+++ b/filcnaplo/pubspec.yaml
@@ -3,7 +3,7 @@ description: "Nem hivatalos e-napló alkalmazás az e-Kréta rendszerhez"
 homepage: https://refilc.hu
 publish_to: "none"

-version: 4.0.4+212
+version: 4.1.1+215

 environment:
  sdk: ">=2.17.0 <3.0.0"
@@ -38,7 +38,7 @@ dependencies:
      ref: master
  path_provider: ^2.0.2
  permission_handler: ^10.2.0
-  share_plus: ^5.0.0
+  share_plus: ^7.0.2
  connectivity_plus: ^4.0.1
  flutter_displaymode: ^0.6.0
  quick_actions: ^1.0.1
@@ -48,17 +48,14 @@ dependencies:
  crypto: ^3.0.2
  elegant_notification: ^1.6.1
  flutter_feather_icons: ^2.0.0+1
-  live_activities: ^1.0.0
+  live_activities: ^1.7.4
  animated_flip_counter: ^0.2.5
  lottie: ^1.4.3
  rive: ^0.9.1
  animated_background: ^2.0.0
  dropdown_button2: ^1.8.9
  home_widget: ^0.1.6
-  flutter_expandable_fab:
-    git:
-      url: https://github.com/filc/flutter_expandable_fab
-      ref: master
+  flutter_expandable_fab: ^1.8.1
  uni_links: ^0.5.1
  url_launcher: ^6.1.6
  workmanager: ^0.5.1
@@ -67,7 +64,8 @@ dependencies:
  animations: ^2.0.1
  background_fetch: ^1.1.5
  flutter_local_notifications: ^14.1.0
-  package_info_plus: ^3.1.2
+  package_info_plus: ^4.0.2
+  screenshot: ^2.1.0

 dev_dependencies:
  flutter_lints: ^2.0.1
--- a/filcnaplo_desktop_ui/lib/screens/navigation/navigation_screen.dart
+++ b/filcnaplo_desktop_ui/lib/screens/navigation/navigation_screen.dart
@@ -16,13 +16,15 @@ import 'package:filcnaplo_kreta_api/client/client.dart';
 class NavigationScreen extends StatefulWidget {
  const NavigationScreen({Key? key}) : super(key: key);

-  static NavigationScreenState? of(BuildContext context) => context.findAncestorStateOfType<NavigationScreenState>();
+  static NavigationScreenState? of(BuildContext context) =>
+      context.findAncestorStateOfType<NavigationScreenState>();

  @override
  State<NavigationScreen> createState() => NavigationScreenState();
 }

-class NavigationScreenState extends State<NavigationScreen> with WidgetsBindingObserver {
+class NavigationScreenState extends State<NavigationScreen>
+    with WidgetsBindingObserver {
  final _navigatorState = GlobalKey<NavigatorState>();
  late NavigationRoute selected;
  late SettingsProvider settings;
@@ -40,7 +42,8 @@ class NavigationScreenState extends State<NavigationScreen> with WidgetsBindingO
    WidgetsBinding.instance.addObserver(this);

    // set client User-Agent
-    Provider.of<KretaClient>(context, listen: false).userAgent = settings.config.userAgent;
+    Provider.of<KretaClient>(context, listen: false).userAgent =
+        settings.config.userAgent;

    // Get news
    newsProvider = Provider.of<NewsProvider>(context, listen: false);
@@ -54,7 +57,11 @@ class NavigationScreenState extends State<NavigationScreen> with WidgetsBindingO
        await Window.initialize();
      } catch (_) {}
      // Transparent sidebar
-      await Window.setEffect(effect: WindowEffect.acrylic, color: Platform.isMacOS ? Colors.transparent : const Color.fromARGB(27, 27, 27, 27));
+      await Window.setEffect(
+          effect: WindowEffect.acrylic,
+          color: Platform.isMacOS
+              ? Colors.transparent
+              : const Color.fromARGB(27, 27, 27, 27));

      // todo: do for windows
      if (Platform.isMacOS) {
@@ -75,8 +82,12 @@ class NavigationScreenState extends State<NavigationScreen> with WidgetsBindingO
  @override
  void didChangePlatformBrightness() {
    if (settings.theme == ThemeMode.system) {
-      Brightness? brightness = WidgetsBinding.instance.window.platformBrightness;
-      Provider.of<ThemeModeObserver>(context, listen: false).changeTheme(brightness == Brightness.light ? ThemeMode.light : ThemeMode.dark);
+      // ignore: deprecated_member_use
+      Brightness? brightness =
+          // ignore: deprecated_member_use
+          WidgetsBinding.instance.window.platformBrightness;
+      Provider.of<ThemeModeObserver>(context, listen: false).changeTheme(
+          brightness == Brightness.light ? ThemeMode.light : ThemeMode.dark);
    }
    super.didChangePlatformBrightness();
  }
@@ -103,8 +114,12 @@ class NavigationScreenState extends State<NavigationScreen> with WidgetsBindingO
          if (_navigatorState.currentState != null)
            Container(
              decoration: BoxDecoration(
-                color: Theme.of(context).scaffoldBackgroundColor.withOpacity(.5),
-                border: Border(right: BorderSide(color: AppColors.of(context).shadow.withOpacity(.7), width: 1.0)),
+                color:
+                    Theme.of(context).scaffoldBackgroundColor.withOpacity(.5),
+                border: Border(
+                    right: BorderSide(
+                        color: AppColors.of(context).shadow.withOpacity(.7),
+                        width: 1.0)),
              ),
              child: Padding(
                padding: EdgeInsets.only(top: topInset),
@@ -125,7 +140,8 @@ class NavigationScreenState extends State<NavigationScreen> with WidgetsBindingO
                child: Navigator(
                  key: _navigatorState,
                  initialRoute: selected.name,
-                  onGenerateRoute: (settings) => navigationRouteHandler(settings),
+                  onGenerateRoute: (settings) =>
+                      navigationRouteHandler(settings),
                ),
              ),
            ),
--- a/filcnaplo_desktop_ui/pubspec.yaml
+++ b/filcnaplo_desktop_ui/pubspec.yaml
@@ -23,10 +23,7 @@ dependencies:
  animations: ^2.0.1
  confetti: ^0.6.0
  auto_size_text: ^3.0.0
-  flutter_acrylic:
-    git:
-      url: https://github.com/filc/flutter_acrylic
-      ref: master
+  flutter_acrylic: ^1.1.3
  elegant_notification: ^1.6.1

 dev_dependencies:
--- a/filcnaplo_kreta_api/lib/client/client.dart
+++ b/filcnaplo_kreta_api/lib/client/client.dart
@@ -169,7 +169,7 @@ class KretaClient {
    Map? loginRes = await postAPI(KretaAPI.login,
        headers: headers,
        body: User.loginBody(
-          username: loginUser.username.replaceAll(' ', '') + ' ',
+          username: loginUser.username,
          password: loginUser.password,
          instituteCode: loginUser.instituteCode,
        ));
--- a/filcnaplo_kreta_api/lib/providers/grade_provider.dart
+++ b/filcnaplo_kreta_api/lib/providers/grade_provider.dart
@@ -51,7 +51,6 @@ class GradeProvider with ChangeNotifier {
      final userStore = _database.userStore;
      userStore.storeLastSeenGrade(DateTime.now(), userId: userId);
      _lastSeen = DateTime.now();
-      notifyListeners();
    }
  }

@@ -98,7 +97,11 @@ class GradeProvider with ChangeNotifier {
              .i18n;
      grade.value.shortName = _settings.goodStudent
          ? "Jeles".i18n
-          : '${grade.json!["SzovegesErtekelesRovidNev"]}' != "null" && '${grade.json!["SzovegesErtekelesRovidNev"]}' != "-" && '${grade.json!["SzovegesErtekelesRovidNev"]}'.replaceAll(RegExp(r'[0123456789]+[%]?'), '') != ""
+          : '${grade.json!["SzovegesErtekelesRovidNev"]}' != "null" &&
+                  '${grade.json!["SzovegesErtekelesRovidNev"]}' != "-" &&
+                  '${grade.json!["SzovegesErtekelesRovidNev"]}'
+                          .replaceAll(RegExp(r'[0123456789]+[%]?'), '') !=
+                      ""
              ? '${grade.json!["SzovegesErtekelesRovidNev"]}'.i18n
              : grade.value.valueName;
    }
@@ -119,14 +122,16 @@ class GradeProvider with ChangeNotifier {
    if (grades.isNotEmpty || _grades.isNotEmpty) await store(grades);

    List? groupsJson = await _kreta.getAPI(KretaAPI.groups(iss));
-    if (groupsJson == null || groupsJson.isEmpty)
+    if (groupsJson == null || groupsJson.isEmpty) {
      throw "Cannot fetch Groups for User ${user.id}";
+    }
    _groups = (groupsJson[0]["OktatasNevelesiFeladat"] ?? {})["Uid"] ?? "";

    List? groupAvgJson =
        await _kreta.getAPI(KretaAPI.groupAverages(iss, _groups));
-    if (groupAvgJson == null)
+    if (groupAvgJson == null) {
      throw "Cannot fetch Class Averages for User ${user.id}";
+    }
    final groupAvgs =
        groupAvgJson.map((e) => GroupAverage.fromJson(e)).toList();
    await storeGroupAvg(groupAvgs);
--- a/filcnaplo_kreta_api/lib/providers/timetable_provider.dart
+++ b/filcnaplo_kreta_api/lib/providers/timetable_provider.dart
@@ -37,10 +37,14 @@ class TimetableProvider with ChangeNotifier {
  // for renamed subjects
  Future<void> convertBySettings() async {
    Map<String, String> renamedSubjects =
-        (await _database.query.getSettings(_database)).renamedSubjectsEnabled ? await _database.userQuery.renamedSubjects(userId: _user.id!) : {};
+        (await _database.query.getSettings(_database)).renamedSubjectsEnabled
+            ? await _database.userQuery.renamedSubjects(userId: _user.id!)
+            : {};

    for (Lesson lesson in _lessons.values.expand((e) => e)) {
-      lesson.subject.renamedTo = renamedSubjects.isNotEmpty ? renamedSubjects[lesson.subject.id] : null;
+      lesson.subject.renamedTo = renamedSubjects.isNotEmpty
+          ? renamedSubjects[lesson.subject.id]
+          : null;
    }

    notifyListeners();
@@ -54,7 +58,8 @@ class TimetableProvider with ChangeNotifier {
    User? user = _user.user;
    if (user == null) throw "Cannot fetch Lessons for User null";
    String iss = user.instituteCode;
-    List? lessonsJson = await _kreta.getAPI(KretaAPI.timetable(iss, start: week.start, end: week.end));
+    List? lessonsJson = await _kreta
+        .getAPI(KretaAPI.timetable(iss, start: week.start, end: week.end));
    if (lessonsJson == null) throw "Cannot fetch Lessons for User ${user.id}";
    List<Lesson> lessons = lessonsJson.map((e) => Lesson.fromJson(e)).toList();

@@ -72,7 +77,7 @@ class TimetableProvider with ChangeNotifier {
    if (user == null) throw "Cannot store Lessons for User null";
    String userId = user.id;

-    // TODO: clear indexes with weeks outside of the current school year
+    // -TODO: clear indexes with weeks outside of the current school year
    await _database.userStore.storeLessons(_lessons, userId: userId);
  }

--- a/filcnaplo_kreta_api/pubspec.yaml
+++ b/filcnaplo_kreta_api/pubspec.yaml
@@ -11,10 +11,7 @@ dependencies:
    path: ../filcnaplo/
  http: ^0.13.3
  provider: ^5.0.0
-  file_picker:
-    git:
-      url: https://github.com/filc/flutter_file_picker.git
-      ref: master
+  file_picker: ^5.3.2

 dev_dependencies:
  flutter_lints: ^1.0.0
--- a/filcnaplo_mobile_ui/lib/common/empty.dart
+++ b/filcnaplo_mobile_ui/lib/common/empty.dart
@@ -23,7 +23,6 @@ class Empty extends StatelessWidget {

  @override
  Widget build(BuildContext context) {
-    // make the face randomness a bit more constant (to avoid strokes)
    int index = Random(DateTime.now().minute).nextInt(faces.length);

    return Center(
@@ -32,9 +31,19 @@ class Empty extends StatelessWidget {
        child: Text.rich(
          TextSpan(
            text: faces[index],
-            style: TextStyle(fontSize: 32.0, fontWeight: FontWeight.w500, color: AppColors.of(context).text.withOpacity(.75)),
+            style: TextStyle(
+                fontSize: 32.0,
+                fontWeight: FontWeight.w500,
+                color: AppColors.of(context).text.withOpacity(.75)),
            children: subtitle != null
-                ? [TextSpan(text: "\n" + subtitle!, style: TextStyle(fontSize: 18.0, height: 2.0, color: AppColors.of(context).text.withOpacity(.5)))]
+                ? [
+                    TextSpan(
+                        text: "\n" + subtitle!,
+                        style: TextStyle(
+                            fontSize: 18.0,
+                            height: 2.0,
+                            color: AppColors.of(context).text.withOpacity(.5)))
+                  ]
                : [],
          ),
          textAlign: TextAlign.center,
--- a/filcnaplo_mobile_ui/lib/common/personality_card/empty_card.dart
+++ b/filcnaplo_mobile_ui/lib/common/personality_card/empty_card.dart
@@ -0,0 +1,68 @@
+import 'package:dotted_border/dotted_border.dart';
+import 'package:flutter/material.dart';
+
+class EmptyCard extends StatefulWidget {
+  const EmptyCard({
+    Key? key,
+    required this.text,
+  }) : super(key: key);
+
+  final String text;
+
+  @override
+  State<EmptyCard> createState() => _EmptyCardState();
+}
+
+class _EmptyCardState extends State<EmptyCard> {
+  bool hold = false;
+
+  @override
+  void initState() {
+    super.initState();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return GestureDetector(
+      onLongPressDown: (_) => setState(() => hold = true),
+      onLongPressEnd: (_) => setState(() => hold = false),
+      onLongPressCancel: () => setState(() => hold = false),
+      child: AnimatedScale(
+        scale: hold ? 1.018 : 1.0,
+        curve: Curves.easeInOutBack,
+        duration: const Duration(milliseconds: 300),
+        child: Container(
+          height: 444,
+          padding:
+              const EdgeInsets.only(top: 12, bottom: 12, left: 12, right: 12),
+          decoration: BoxDecoration(
+            color: const Color(0x280008FF),
+            borderRadius: const BorderRadius.all(Radius.circular(5)),
+            boxShadow: [
+              BoxShadow(
+                color: Colors.black.withOpacity(0.08),
+                offset: const Offset(0, 5),
+                blurRadius: 20,
+                spreadRadius: 10,
+              ),
+            ],
+          ),
+          child: DottedBorder(
+            color: Colors.black.withOpacity(0.9),
+            dashPattern: const [12, 12],
+            padding:
+                const EdgeInsets.only(top: 20, bottom: 20, left: 20, right: 20),
+            child: Center(
+              child: Text(
+                widget.text,
+                style: TextStyle(
+                  color: Colors.white.withOpacity(0.9),
+                ),
+              ),
+            ),
+          ),
+        ),
+      ),
+    );
+  }
+}
--- a/filcnaplo_mobile_ui/lib/common/personality_card/personality_card.dart
+++ b/filcnaplo_mobile_ui/lib/common/personality_card/personality_card.dart
@@ -0,0 +1,374 @@
+import 'package:dotted_border/dotted_border.dart';
+import 'package:filcnaplo/api/providers/user_provider.dart';
+import 'package:filcnaplo/helpers/average_helper.dart';
+import 'package:filcnaplo/models/settings.dart';
+import 'package:filcnaplo/models/personality.dart';
+import 'package:filcnaplo_kreta_api/models/absence.dart';
+import 'package:filcnaplo_kreta_api/models/grade.dart';
+import 'package:filcnaplo_kreta_api/models/lesson.dart';
+import 'package:filcnaplo_kreta_api/models/subject.dart';
+import 'package:filcnaplo_kreta_api/models/week.dart';
+import 'package:filcnaplo_kreta_api/providers/absence_provider.dart';
+import 'package:filcnaplo_kreta_api/providers/grade_provider.dart';
+import 'package:filcnaplo_kreta_api/providers/timetable_provider.dart';
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+
+import 'personality_card.i18n.dart';
+
+class PersonalityCard extends StatefulWidget {
+  const PersonalityCard({
+    Key? key,
+    required this.user,
+  }) : super(key: key);
+
+  final UserProvider user;
+
+  @override
+  State<PersonalityCard> createState() => _PersonalityCardState();
+}
+
+class _PersonalityCardState extends State<PersonalityCard> {
+  late GradeProvider gradeProvider;
+  late AbsenceProvider absenceProvider;
+  late TimetableProvider timetableProvider;
+  late SettingsProvider settings;
+
+  late List<int> subjectAvgsList = [];
+  late Map<Subject, double> subjectAvgs = {};
+  late double subjectAvg;
+  late List<Grade> classWorkGrades;
+  late Map<int, int> mostCommonGrade;
+  late List<Absence> absences = [];
+  final Map<Subject, Lesson> _lessonCount = {};
+  late int totalDelays;
+  late int unexcusedAbsences;
+
+  late PersonalityType finalPersonality;
+
+  bool hold = false;
+
+  List<Grade> getSubjectGrades(Subject subject, {int days = 0}) => gradeProvider
+      .grades
+      .where((e) =>
+          e.subject == subject &&
+          e.type == GradeType.midYear &&
+          (days == 0 ||
+              e.date.isBefore(DateTime.now().subtract(Duration(days: days)))))
+      .toList();
+
+  @override
+  void initState() {
+    super.initState();
+
+    gradeProvider = Provider.of<GradeProvider>(context, listen: false);
+    absenceProvider = Provider.of<AbsenceProvider>(context, listen: false);
+    timetableProvider = Provider.of<TimetableProvider>(context, listen: false);
+    settings = Provider.of<SettingsProvider>(context, listen: false);
+
+    WidgetsBinding.instance.addPostFrameCallback((timeStamp) async {
+      for (final lesson in timetableProvider.getWeek(Week.current()) ?? []) {
+        if (!lesson.isEmpty &&
+            lesson.subject.id != '' &&
+            lesson.lessonYearIndex != null) {
+          _lessonCount.update(
+            lesson.subject,
+            (value) {
+              if (lesson.lessonYearIndex! > value.lessonYearIndex!) {
+                return lesson;
+              } else {
+                return value;
+              }
+            },
+            ifAbsent: () => lesson,
+          );
+        }
+      }
+      setState(() {});
+    });
+  }
+
+  void getGrades() {
+    List<Subject> subjects = gradeProvider.grades
+        .map((e) => e.subject)
+        .toSet()
+        .toList()
+      ..sort((a, b) => a.name.compareTo(b.name));
+
+    for (Subject subject in subjects) {
+      List<Grade> subjectGrades = getSubjectGrades(subject);
+
+      double avg = AverageHelper.averageEvals(subjectGrades);
+      if (avg != 0) subjectAvgs[subject] = avg;
+
+      subjectAvgsList.add(avg.round());
+    }
+
+    subjectAvg = subjectAvgs.isNotEmpty
+        ? subjectAvgs.values.fold(0.0, (double a, double b) => a + b) /
+            subjectAvgs.length
+        : 0.0;
+
+    classWorkGrades =
+        gradeProvider.grades.where((a) => a.value.weight <= 75).toList();
+  }
+
+  void getMostCommonGrade() {
+    Map<int, int> counts = {};
+
+    subjectAvgsList.map((e) {
+      if (counts.containsKey(e)) {
+        counts.update(e, (value) => value++);
+      } else {
+        counts[e] = 1;
+      }
+    });
+
+    var maxValue = 0;
+    var maxKey = 0;
+
+    counts.forEach((k, v) {
+      if (v > maxValue) {
+        maxValue = v;
+        maxKey = k;
+      }
+    });
+
+    mostCommonGrade = {maxKey: maxValue};
+  }
+
+  void getAbsences() {
+    absences = absenceProvider.absences.where((a) => a.delay == 0).toList();
+
+    unexcusedAbsences = absences
+        .where((a) => a.state == Justification.unexcused && a.delay == 0)
+        .length;
+  }
+
+  void getAndSortDelays() {
+    Iterable<int> unexcusedDelays = absences
+        .where((a) => a.state == Justification.unexcused && a.delay > 0)
+        .map((e) => e.delay);
+    totalDelays = unexcusedDelays.isNotEmpty
+        ? unexcusedDelays.reduce((a, b) => a + b)
+        : 0;
+  }
+
+  void doEverything() {
+    getGrades();
+    getMostCommonGrade();
+    getAbsences();
+    getAndSortDelays();
+  }
+
+  void getPersonality() {
+    if (settings.goodStudent) {
+      finalPersonality = PersonalityType.cheater;
+    } else if (subjectAvg > 4.7) {
+      finalPersonality = PersonalityType.geek;
+    } else if (mostCommonGrade.keys.toList()[0] == 1 &&
+        mostCommonGrade.values.toList()[0] > 1) {
+      finalPersonality = PersonalityType.fallible;
+    } else if (absences.length < 10) {
+      finalPersonality = PersonalityType.healthy;
+    } else if (unexcusedAbsences >= 10) {
+      finalPersonality = PersonalityType.quitter;
+    } else if (totalDelays > 50) {
+      finalPersonality = PersonalityType.late;
+    } else if (absences.length >= 100) {
+      finalPersonality = PersonalityType.sick;
+    } else if (mostCommonGrade.keys.toList()[0] == 2) {
+      finalPersonality = PersonalityType.acceptable;
+    } else if (mostCommonGrade.keys.toList()[0] == 3) {
+      finalPersonality = PersonalityType.average;
+    } else if (classWorkGrades.length >= 5) {
+      finalPersonality = PersonalityType.diligent;
+    } else {
+      finalPersonality = PersonalityType.npc;
+    }
+  }
+
+  Widget cardInnerBuilder() {
+    Map<PersonalityType, Map<String, String>> personality = {
+      PersonalityType.geek: {
+        'emoji': '🤓',
+        'title': 't_geek',
+        'description': 'd_geek',
+        'subtitle': 's_geek',
+        'subvalue': subjectAvg.toStringAsFixed(2),
+      },
+      PersonalityType.sick: {
+        'emoji': '🤒',
+        'title': 't_sick',
+        'description': 'd_sick',
+        'subtitle': 's_sick',
+        'subvalue': absences.length.toString(),
+      },
+      PersonalityType.late: {
+        'emoji': '⌛',
+        'title': 't_late',
+        'description': 'd_late',
+        'subtitle': 's_late',
+        'subvalue': totalDelays.toString(),
+      },
+      PersonalityType.quitter: {
+        'emoji': '❓',
+        'title': 't_quitter',
+        'description': 'd_quitter',
+        'subtitle': 's_quitter',
+        'subvalue': unexcusedAbsences.toString(),
+      },
+      PersonalityType.healthy: {
+        'emoji': '😷',
+        'title': 't_healthy',
+        'description': 'd_healthy',
+        'subtitle': 's_healthy',
+        'subvalue': absences.length.toString(),
+      },
+      PersonalityType.acceptable: {
+        'emoji': '🤏',
+        'title': 't_acceptable',
+        'description': 'd_acceptable',
+        'subtitle': 's_acceptable',
+        'subvalue': mostCommonGrade.values.toList()[0].toString(),
+      },
+      PersonalityType.fallible: {
+        'emoji': '📉',
+        'title': 't_fallible',
+        'description': 'd_fallible',
+        'subtitle': 's_fallible',
+        'subvalue': mostCommonGrade.values.toList()[0].toString(),
+      },
+      PersonalityType.average: {
+        'emoji': '👌',
+        'title': 't_average',
+        'description': 'd_average',
+        'subtitle': 's_average',
+        'subvalue': mostCommonGrade.values.toList()[0].toString(),
+      },
+      PersonalityType.diligent: {
+        'emoji': '💫',
+        'title': 't_diligent',
+        'description': 'd_diligent',
+        'subtitle': 's_diligent',
+        'subvalue': classWorkGrades.length.toString(),
+      },
+      PersonalityType.cheater: {
+        'emoji': '‍🧑‍💻',
+        'title': 't_cheater',
+        'description': 'd_cheater',
+        'subtitle': 's_cheater',
+        'subvalue': '0',
+      },
+      PersonalityType.npc: {
+        'emoji': '⛰️',
+        'title': 't_npc',
+        'description': 'd_npc',
+        'subtitle': 's_npc',
+        'subvalue': '69420',
+      }
+    };
+
+    Map<PersonalityType, Widget> personalityWidgets = {};
+
+    for (var i in personality.keys) {
+      Widget w = Column(
+        mainAxisAlignment: MainAxisAlignment.center,
+        crossAxisAlignment: CrossAxisAlignment.center,
+        children: [
+          Text(
+            personality[i]?['emoji'] ?? '❓',
+            textAlign: TextAlign.center,
+            style: const TextStyle(
+              fontSize: 128.0,
+              height: 1.2,
+            ),
+          ),
+          Text(
+            (personality[i]?['title'] ?? 'unknown').i18n,
+            textAlign: TextAlign.center,
+            style: const TextStyle(
+              fontSize: 38.0,
+              color: Colors.white,
+              fontWeight: FontWeight.w800,
+            ),
+          ),
+          const SizedBox(height: 5),
+          Text(
+            (personality[i]?['description'] ?? 'unknown_personality').i18n,
+            textAlign: TextAlign.start,
+            style: TextStyle(
+              fontSize: 16,
+              height: 1.2,
+              color: Colors.white.withOpacity(0.8),
+            ),
+          ),
+          const SizedBox(height: 25),
+          Text(
+            (personality[i]?['subtitle'] ?? 'unknown').i18n,
+            textAlign: TextAlign.center,
+            style: const TextStyle(
+              fontSize: 20.0,
+              color: Colors.white,
+              fontWeight: FontWeight.bold,
+            ),
+          ),
+          Text(
+            personality[i]?['subvalue'] ?? '0',
+            textAlign: TextAlign.center,
+            style: const TextStyle(
+              fontSize: 69.0,
+              height: 1.15,
+              color: Colors.white,
+              fontWeight: FontWeight.w800,
+            ),
+          ),
+        ],
+      );
+
+      personalityWidgets.addAll({i: w});
+    }
+
+    return personalityWidgets[finalPersonality] ?? Container();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    doEverything();
+    getPersonality();
+
+    return GestureDetector(
+      onLongPressDown: (_) => setState(() => hold = true),
+      onLongPressEnd: (_) => setState(() => hold = false),
+      onLongPressCancel: () => setState(() => hold = false),
+      child: AnimatedScale(
+        scale: hold ? 1.018 : 1.0,
+        curve: Curves.easeInOutBack,
+        duration: const Duration(milliseconds: 300),
+        child: Container(
+          padding:
+              const EdgeInsets.only(top: 12, bottom: 12, left: 12, right: 12),
+          decoration: BoxDecoration(
+            color: const Color(0x280008FF),
+            borderRadius: const BorderRadius.all(Radius.circular(5)),
+            boxShadow: [
+              BoxShadow(
+                color: Colors.black.withOpacity(0.08),
+                offset: const Offset(0, 5),
+                blurRadius: 20,
+                spreadRadius: 10,
+              ),
+            ],
+          ),
+          child: DottedBorder(
+            color: Colors.black.withOpacity(0.9),
+            dashPattern: const [12, 12],
+            padding:
+                const EdgeInsets.only(top: 20, bottom: 20, left: 20, right: 20),
+            child: cardInnerBuilder(),
+          ),
+        ),
+      ),
+    );
+  }
+}
--- a/filcnaplo_mobile_ui/lib/common/personality_card/personality_card.i18n.dart
+++ b/filcnaplo_mobile_ui/lib/common/personality_card/personality_card.i18n.dart
@@ -0,0 +1,154 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension Localization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          // main
+          "unknown": "???",
+          "unknown_personality": "Unknown personality...",
+          // personalities
+          "t_geek": "Know-It-All",
+          "d_geek":
+              "You learn a lot, but don't worry - Being a know-it-all is a blessing in disguise. You'll be successful in life.",
+          "s_geek": "Year-end average",
+          "t_sick": "Sick",
+          "d_sick":
+              "Get well soon, bro. Even if you lied about being sick to skip school.",
+          "s_sick": "Absences",
+          "t_late": "Late",
+          "d_late":
+              "The tram's wheel got punctured. The airplane was derailed. Your dog ate your shoe. We believe you.",
+          "s_late": "Delays (minutes)",
+          "t_quitter": "Skipper",
+          "d_quitter": "Supplementary exam incoming.",
+          "s_quitter": "Igazolatlan hiányzások",
+          "t_healthy": "Healthy",
+          "d_healthy":
+              "As cool as a cucumber! You almost never missed a class.",
+          "s_healthy": "Absences",
+          "t_acceptable": "Acceptable",
+          "d_acceptable":
+              "Final exams are D. But who cares? It's still a grade. Not a good one, but it's definitely a grade.",
+          "s_acceptable": "D's",
+          "t_fallible": "Failed",
+          "d_fallible": "Good luck next year.",
+          "s_fallible": "F's",
+          "t_average": "It's okay",
+          "d_average": "Not good, not bad. The golden mean, if you will...",
+          "s_average": "C's",
+          "t_diligent": "Hard-worker",
+          "d_diligent":
+              "You noted everything, you made that presentation, and you lead the group project.",
+          "s_diligent": "Class work A's",
+          "t_cheater": "Cheater",
+          "d_cheater":
+              "You enabled the \"Good Student\" mode. Wow. You may have outsmarted me, but I have outsmarted your outsmarting.",
+          "s_cheater": "Bitches",
+          "t_npc": "NPC",
+          "d_npc":
+              "You're such a non-player character, we couldn't give you a personality.",
+          "s_npc": "In-game playtime (hours)",
+        },
+        "hu_hu": {
+          // main
+          "unknown": "???",
+          "unknown_personality": "Ismeretlen személyiség...",
+          // personalities
+          "t_geek": "Stréber",
+          "d_geek":
+              "Sokat tanulsz, de ezzel semmi baj! Ez egyben áldás és átok, de legalább az életben sikeres leszel.",
+          "s_geek": "Év végi átlagod",
+          "t_sick": "Beteges",
+          "d_sick":
+              "Jobbulást, tesó. Még akkor is, ha hazudtál arról, hogy beteg vagy, hogy ne kelljen suliba menned.",
+          "s_sick": "Hiányzásaid",
+          "t_late": "Késős",
+          "d_late":
+              "Kilyukadt a villamos kereke. Kisiklott a repülő. A kutyád megette a cipőd. Elhisszük.",
+          "s_late": "Késések (perc)",
+          "t_quitter": "Lógós",
+          "d_quitter": "Osztályzóvizsga incoming.",
+          "s_quitter": "Igazolatlan hiányzások",
+          "t_healthy": "Makk",
+          "d_healthy":
+              "...egészséges vagy! Egész évben alig hiányoztál az iskolából.",
+          "s_healthy": "Hiányzásaid",
+          "t_acceptable": "Elmegy",
+          "d_acceptable":
+              "A kettes érettségi is érettségi. Nem egy jó érettségi, de biztos, hogy egy érettségi.",
+          "s_acceptable": "Kettesek",
+          "t_fallible": "Bukós",
+          "d_fallible": "Jövőre több sikerrel jársz.",
+          "s_fallible": "Karók",
+          "t_average": "Közepes",
+          "d_average": "Se jó, se rossz. Az arany középút, ha akarsz...",
+          "s_average": "Hármasok",
+          "t_diligent": "Szorgalmas",
+          "d_diligent":
+              "Leírtad a jegyzetet, megcsináltad a prezentációt, és te vezetted a projektmunkát.",
+          "s_diligent": "Órai munka ötösök",
+          "t_cheater": "Csaló",
+          "d_cheater":
+              "Bekapcsoltad a “Jó Tanuló” módot. Wow. Azt hitted, túl járhatsz az eszemen, de kijátszottam a kijátszásod.",
+          "s_cheater": "Bitches",
+          "t_npc": "NPC",
+          "d_npc":
+              "Egy akkora nagy non-player character vagy, hogy neked semmilyen személyiség nem jutott ezen kívül.",
+          "s_npc": "In-game playtime (óra)",
+        },
+        "de_de": {
+          // main
+          "unknown": "???",
+          "unknown_personality": "Unbekannte Persönlichkeit...",
+          // personalities
+          "t_geek": "Besserwisser",
+          "d_geek":
+              "Du lernst eine Menge, aber sorge dich nicht - ein Besserwisser zu sein wird sich letzten Endes doch als Segen erweisen. Du wirst erfolgreich sein im Leben.",
+          "s_geek": "Durchschnittsschüler",
+          "t_sick": "Krank",
+          "d_sick":
+              "Werd schnell wieder gesund, Brudi. Selbst wenn du gelogen hast, nur um Schule zu schwänzen zu können.",
+          "s_sick": "Abwesenheiten",
+          "t_late": "Verspätet",
+          "d_late":
+              "Die Straßenbahn hat eine Reifenpanne. Das Flugzeug ist entgleist. Dein Hund hat deinen Schuh gefressen. Klar, wir glauben dir.",
+          "s_late": "Verspätung (Minuten)",
+          "t_quitter": "Schulschwänzer",
+          "d_quitter": "Ein zusätzlicher Test wird anstehen.",
+          "s_quitter": "Unentschuldigte Abwesenheiten",
+          "t_healthy": "Gesund",
+          "d_healthy":
+              "Du bist die Ruhe selbst! Du hast fast nie eine Unterrichtsstunde verpasst.",
+          "s_healthy": "Abwesenheiten",
+          "t_acceptable": "Akzeptabel",
+          "d_acceptable":
+              "Die Abschlussprüfungen waren gerade einmal eine 4. Aber wen juckt's? Es ist immer noch positiv. Nicht allzu gut, aber definitiv positiv.",
+          "s_acceptable": "4er",
+          "t_fallible": "Durchgefallen",
+          "d_fallible": "Viel Glück im nächsten Jahr.",
+          "s_fallible": "5er",
+          "t_average": "Es ist in Ordnung",
+          "d_average":
+              "Nicht gut, nicht schlecht. Der goldene Durchschnitt, wenn du so willst...",
+          "s_average": "3er",
+          "t_diligent": "Ein Fleißiger",
+          "d_diligent":
+              "Du hast bei allem mitgeschrieben, du hast den Vortrag gehalten, und du hast die Gruppenarbeit geleitet.",
+          "s_diligent": "1er Schüler",
+          "t_cheater": "Geschummelt",
+          "d_cheater":
+              "Du hast den „Guter Schüler“ Modus aktiviert. Wow. Du magst mich zwar vielleicht überlistet haben, aber ich habe deine Überlistung überlistet.",
+          "s_cheater": "Bitches",
+          "t_npc": "COM",
+          "d_npc":
+              "Du bist einfach so sehr wie ein Computer, dass wir dir nicht einmal eine Persönlichkeit geben konnten.",
+          "s_npc": "Spielzeit (Stunden)",
+        }
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}
--- a/filcnaplo_mobile_ui/lib/common/widgets/absence/absence_subject_tile.dart
+++ b/filcnaplo_mobile_ui/lib/common/widgets/absence/absence_subject_tile.dart
@@ -1,9 +1,11 @@
 import 'package:filcnaplo/helpers/subject.dart';
+import 'package:filcnaplo/models/settings.dart';
 import 'package:filcnaplo/theme/colors/colors.dart';
 import 'package:filcnaplo/utils/format.dart';
 import 'package:filcnaplo_kreta_api/models/subject.dart';
 import 'package:filcnaplo_mobile_ui/common/widgets/absence/absence_display.dart';
 import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';

 class AbsenceSubjectTile extends StatelessWidget {
  const AbsenceSubjectTile(this.subject, {Key? key, this.percentage = 0.0, this.excused = 0, this.unexcused = 0, this.pending = 0, this.onTap})
@@ -19,6 +21,7 @@ class AbsenceSubjectTile extends StatelessWidget {

  @override
  Widget build(BuildContext context) {
+    SettingsProvider settingsProvider = Provider.of<SettingsProvider>(context);
    return Material(
      type: MaterialType.transparency,
      child: ListTile(
@@ -33,7 +36,7 @@ class AbsenceSubjectTile extends StatelessWidget {
          subject.renamedTo ?? subject.name.capital(),
          maxLines: 2,
          overflow: TextOverflow.ellipsis,
-          style: TextStyle(fontWeight: FontWeight.w600, fontSize: 15.0, fontStyle: subject.isRenamed ? FontStyle.italic : null),
+          style: TextStyle(fontWeight: FontWeight.w600, fontSize: 15.0, fontStyle: subject.isRenamed && settingsProvider.renamedSubjectsItalics ? FontStyle.italic : null),
        ),
        subtitle: AbsenceDisplay(excused, unexcused, pending),
        trailing: Row(
--- a/filcnaplo_mobile_ui/lib/common/widgets/absence/absence_tile.dart
+++ b/filcnaplo_mobile_ui/lib/common/widgets/absence/absence_tile.dart
@@ -1,9 +1,11 @@
+import 'package:filcnaplo/models/settings.dart';
 import 'package:filcnaplo/theme/colors/colors.dart';
 import 'package:filcnaplo/utils/format.dart';
 import 'package:filcnaplo_kreta_api/models/absence.dart';
 import 'package:filcnaplo_mobile_ui/common/widgets/absence_group/absence_group_container.dart';
 import 'package:flutter/material.dart';
 import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
 import 'absence_tile.i18n.dart';

 class AbsenceTile extends StatelessWidget {
@@ -18,6 +20,7 @@ class AbsenceTile extends StatelessWidget {
  Widget build(BuildContext context) {
    Color color = justificationColor(absence.state, context: context);
    bool group = AbsenceGroupContainer.of(context) != null;
+    SettingsProvider settingsProvider = Provider.of<SettingsProvider>(context);

    return Container(
      decoration: BoxDecoration(
@@ -66,7 +69,7 @@ class AbsenceTile extends StatelessWidget {
                    (absence.lessonIndex != null ? "${absence.lessonIndex}. " : "") + (absence.subject.renamedTo ?? absence.subject.name.capital()),
                    maxLines: 2,
                    overflow: TextOverflow.ellipsis,
-                    style: TextStyle(fontWeight: FontWeight.w500, fontSize: 14.0, fontStyle: absence.subject.isRenamed ? FontStyle.italic : null),
+                    style: TextStyle(fontWeight: FontWeight.w500, fontSize: 14.0, fontStyle: absence.subject.isRenamed && settingsProvider.renamedSubjectsItalics ? FontStyle.italic : null),
                  ),
            subtitle: !group
                ? Text(
@@ -74,7 +77,7 @@ class AbsenceTile extends StatelessWidget {
                    maxLines: 2,
                    overflow: TextOverflow.ellipsis,
                    // DateFormat("MM. dd. (EEEEE)", I18n.of(context).locale.toString()).format(absence.date),
-                    style: TextStyle(fontWeight: FontWeight.w500, fontStyle: absence.subject.isRenamed ? FontStyle.italic : null),
+                    style: TextStyle(fontWeight: FontWeight.w500, fontStyle: absence.subject.isRenamed && settingsProvider.renamedSubjectsItalics ? FontStyle.italic : null),
                  )
                : null,
          ),
--- a/filcnaplo_mobile_ui/lib/common/widgets/absence/absence_view.dart
+++ b/filcnaplo_mobile_ui/lib/common/widgets/absence/absence_view.dart
@@ -1,5 +1,6 @@
 // ignore_for_file: empty_catches

+import 'package:filcnaplo/models/settings.dart';
 import 'package:filcnaplo/theme/colors/colors.dart';
 import 'package:filcnaplo_kreta_api/models/absence.dart';
 import 'package:filcnaplo_mobile_ui/common/bottom_card.dart';
@@ -12,6 +13,7 @@ import 'package:filcnaplo_mobile_ui/pages/timetable/timetable_page.dart';
 import 'package:flutter/material.dart';
 import 'package:flutter_feather_icons/flutter_feather_icons.dart';
 import 'package:filcnaplo/utils/reverse_search.dart';
+import 'package:provider/provider.dart';
 import 'absence_view.i18n.dart';

 class AbsenceView extends StatelessWidget {
@@ -28,6 +30,7 @@ class AbsenceView extends StatelessWidget {
  @override
  Widget build(BuildContext context) {
    Color color = AbsenceTile.justificationColor(absence.state, context: context);
+    SettingsProvider settingsProvider = Provider.of<SettingsProvider>(context);

    return Padding(
      padding: const EdgeInsets.only(bottom: 12.0),
@@ -57,7 +60,7 @@ class AbsenceView extends StatelessWidget {
              absence.subject.renamedTo ?? absence.subject.name.capital(),
              maxLines: 2,
              overflow: TextOverflow.ellipsis,
-              style: TextStyle(fontWeight: FontWeight.w700, fontStyle: absence.subject.isRenamed ? FontStyle.italic : null),
+              style: TextStyle(fontWeight: FontWeight.w700, fontStyle: absence.subject.isRenamed && settingsProvider.renamedSubjectsItalics ? FontStyle.italic : null),
            ),
            subtitle: Text(
              absence.teacher,
--- a/filcnaplo_mobile_ui/lib/common/widgets/cretification/certification_tile.dart
+++ b/filcnaplo_mobile_ui/lib/common/widgets/cretification/certification_tile.dart
@@ -1,4 +1,5 @@
 import 'package:filcnaplo/helpers/subject.dart';
+import 'package:filcnaplo/models/settings.dart';
 import 'package:filcnaplo/theme/colors/colors.dart';
 import 'package:filcnaplo_kreta_api/models/grade.dart';
 import 'package:filcnaplo/ui/widgets/grade/grade_tile.dart';
@@ -6,6 +7,7 @@ import 'package:filcnaplo_mobile_ui/pages/grades/subject_grades_container.dart';
 import 'package:flutter/material.dart';
 import 'package:flutter_feather_icons/flutter_feather_icons.dart';
 import 'package:filcnaplo/utils/format.dart';
+import 'package:provider/provider.dart';
 import 'certification_tile.i18n.dart';

 class CertificationTile extends StatelessWidget {
@@ -20,6 +22,8 @@ class CertificationTile extends StatelessWidget {
    bool isSubjectView = SubjectGradesContainer.of(context) != null;
    String certificationName;

+    SettingsProvider settingsProvider = Provider.of<SettingsProvider>(context);
+
    switch (grade.type) {
      case GradeType.endYear:
        certificationName = "final".i18n;
@@ -78,7 +82,7 @@ class CertificationTile extends StatelessWidget {
          title: Text(isSubjectView ? certificationName : grade.subject.renamedTo ?? grade.subject.name.capital(),
              maxLines: 2,
              overflow: TextOverflow.ellipsis,
-              style: TextStyle(fontWeight: FontWeight.w700, fontSize: 18.0, fontStyle: grade.subject.isRenamed ? FontStyle.italic : null)),
+              style: TextStyle(fontWeight: FontWeight.w700, fontSize: 18.0, fontStyle: grade.subject.isRenamed && settingsProvider.renamedSubjectsItalics ? FontStyle.italic : null)),
          subtitle: Text(grade.value.valueName, style: const TextStyle(fontWeight: FontWeight.w600, fontSize: 16.0)),
        ),
      ),
--- a/filcnaplo_mobile_ui/lib/common/widgets/grade/grade_subject_tile.dart
+++ b/filcnaplo_mobile_ui/lib/common/widgets/grade/grade_subject_tile.dart
@@ -1,9 +1,11 @@
 import 'package:filcnaplo/helpers/subject.dart';
+import 'package:filcnaplo/models/settings.dart';
 import 'package:filcnaplo/theme/colors/colors.dart';
 import 'package:filcnaplo/utils/format.dart';
 import 'package:filcnaplo_kreta_api/models/subject.dart';
 import 'package:filcnaplo_mobile_ui/common/average_display.dart';
 import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';

 class GradeSubjectTile extends StatelessWidget {
  const GradeSubjectTile(this.subject,
@@ -19,10 +21,10 @@ class GradeSubjectTile extends StatelessWidget {
  final double average;
  final double groupAverage;
  final double averageBefore;
-
  @override
  Widget build(BuildContext context) {
    Color textColor = AppColors.of(context).text;
+    SettingsProvider settingsProvider = Provider.of<SettingsProvider>(context);

    // Failing indicator
    if (average < 2.0 && average >= 1.0) {
@@ -54,7 +56,7 @@ class GradeSubjectTile extends StatelessWidget {
              fontWeight: FontWeight.w600,
              fontSize: 14.0,
              color: textColor,
-              fontStyle: subject.isRenamed ? FontStyle.italic : null),
+              fontStyle: settingsProvider.renamedSubjectsItalics && subject.isRenamed ? FontStyle.italic : null),
        ),
        trailing: Row(
          mainAxisSize: MainAxisSize.min,
--- a/filcnaplo_mobile_ui/lib/common/widgets/grade/grade_view.dart
+++ b/filcnaplo_mobile_ui/lib/common/widgets/grade/grade_view.dart
@@ -17,6 +17,7 @@ class GradeView extends StatelessWidget {

  @override
  Widget build(BuildContext context) {
+    SettingsProvider settingsProvider = Provider.of<SettingsProvider>(context);
    return Padding(
      padding: const EdgeInsets.only(bottom: 12.0),
      child: Column(
@@ -29,7 +30,7 @@ class GradeView extends StatelessWidget {
              grade.subject.renamedTo ?? grade.subject.name.capital(),
              maxLines: 1,
              overflow: TextOverflow.ellipsis,
-              style: TextStyle(fontWeight: FontWeight.w600, fontStyle: grade.subject.isRenamed ? FontStyle.italic : null),
+              style: TextStyle(fontWeight: FontWeight.w600, fontStyle: grade.subject.isRenamed && settingsProvider.renamedSubjectsItalics ? FontStyle.italic : null),
            ),
            subtitle: Text(
              !Provider.of<SettingsProvider>(context, listen: false).presentationMode ? grade.teacher : "Tanár",
--- a/filcnaplo_mobile_ui/lib/common/widgets/grade/new_grades.dart
+++ b/filcnaplo_mobile_ui/lib/common/widgets/grade/new_grades.dart
@@ -62,7 +62,9 @@ class NewGradesSurprise extends StatelessWidget {
                  ],
                )
              : Text(
-                  "new_grades".i18n,
+                  grades.length == 1 ?
+                    "new_grade".i18n :
+                    "new_grades".i18n,
                  maxLines: 2,
                  overflow: TextOverflow.ellipsis,
                  style: const TextStyle(fontWeight: FontWeight.w600),
--- a/filcnaplo_mobile_ui/lib/common/widgets/grade/new_grades.i18n.dart
+++ b/filcnaplo_mobile_ui/lib/common/widgets/grade/new_grades.i18n.dart
@@ -9,6 +9,7 @@ extension Localization on String {
          "rare": "Rare",
          "epic": "Epic",
          "legendary": "Legendary",
+          "new_grade": "New grade",
          "new_grades": "New grades",
          "tap_to_open": "Tap to open now!",
          "open_subtitle": "Tap to open...",
@@ -19,6 +20,7 @@ extension Localization on String {
          "rare": "Ritka",
          "epic": "Epikus",
          "legendary": "Legendás",
+          "new_grade": "Új jegy",
          "new_grades": "Új jegyek",
          "tap_to_open": "Nyisd ki őket!",
          "open_subtitle": "Nyomd meg a kinyitáshoz...",
@@ -29,6 +31,7 @@ extension Localization on String {
          "rare": "Selten",
          "epic": "Episch",
          "legendary": "Legendär",
+          "new_grade": "Neue Note",
          "new_grades": "Neue Noten",
          "tap_to_open": "Tippen, um jetzt zu öffnen!",
          "open_subtitle": "Antippen zum Öffnen...",
--- a/filcnaplo_mobile_ui/lib/common/widgets/homework/homework_tile.dart
+++ b/filcnaplo_mobile_ui/lib/common/widgets/homework/homework_tile.dart
@@ -1,9 +1,11 @@
 import 'package:filcnaplo/helpers/subject.dart';
+import 'package:filcnaplo/models/settings.dart';
 import 'package:filcnaplo/theme/colors/colors.dart';
 import 'package:filcnaplo_kreta_api/models/homework.dart';
 import 'package:filcnaplo/utils/format.dart';
 import 'package:flutter/material.dart';
 import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';

 class HomeworkTile extends StatelessWidget {
  const HomeworkTile(this.homework,
@@ -17,6 +19,8 @@ class HomeworkTile extends StatelessWidget {

  @override
  Widget build(BuildContext context) {
+    SettingsProvider settingsProvider = Provider.of<SettingsProvider>(context);
+
    return Material(
      color: Theme.of(context).colorScheme.background,
      borderRadius: BorderRadius.circular(8.0),
@@ -65,7 +69,7 @@ class HomeworkTile extends StatelessWidget {
                  homework.subject.renamedTo ?? homework.subject.name.capital(),
                  maxLines: 2,
                  overflow: TextOverflow.ellipsis,
-                  style: const TextStyle(fontWeight: FontWeight.w600),
+                  style: TextStyle(fontWeight: FontWeight.w600, fontStyle: homework.subject.isRenamed && settingsProvider.renamedSubjectsItalics ? FontStyle.italic : null),
                ),
          subtitle: censored
              ? Wrap(
--- a/filcnaplo_mobile_ui/lib/common/widgets/homework/homework_view.dart
+++ b/filcnaplo_mobile_ui/lib/common/widgets/homework/homework_view.dart
@@ -1,4 +1,5 @@
 import 'package:filcnaplo/helpers/subject.dart';
+import 'package:filcnaplo/models/settings.dart';
 import 'package:filcnaplo_kreta_api/models/homework.dart';
 import 'package:filcnaplo/utils/format.dart';
 import 'package:filcnaplo_mobile_ui/common/detail.dart';
@@ -7,6 +8,7 @@ import 'package:filcnaplo_mobile_ui/common/widgets/homework/homework_attachment_
 import 'package:flutter/material.dart';
 import 'package:flutter_custom_tabs/flutter_custom_tabs.dart';
 import 'package:flutter_linkify/flutter_linkify.dart';
+import 'package:provider/provider.dart';
 import 'homework_view.i18n.dart';

 class HomeworkView extends StatelessWidget {
@@ -21,6 +23,7 @@ class HomeworkView extends StatelessWidget {
  @override
  Widget build(BuildContext context) {
    List<Widget> attachmentTiles = [];
+    SettingsProvider settingsProvider = Provider.of<SettingsProvider>(context);

    for (var attachment in homework.attachments) {
      attachmentTiles.add(Padding(
@@ -48,7 +51,7 @@ class HomeworkView extends StatelessWidget {
              homework.subject.renamedTo ?? homework.subject.name.capital(),
              maxLines: 1,
              overflow: TextOverflow.ellipsis,
-              style: const TextStyle(fontWeight: FontWeight.w600),
+              style: TextStyle(fontWeight: FontWeight.w600, fontStyle: homework.subject.isRenamed && settingsProvider.renamedSubjectsItalics ? FontStyle.italic : null),
            ),
            subtitle: Text(
              homework.teacher,
--- a/filcnaplo_mobile_ui/lib/common/widgets/lesson/lesson_view.dart
+++ b/filcnaplo_mobile_ui/lib/common/widgets/lesson/lesson_view.dart
@@ -1,9 +1,11 @@
+import 'package:filcnaplo/models/settings.dart';
 import 'package:filcnaplo/theme/colors/colors.dart';
 import 'package:filcnaplo/utils/format.dart';
 import 'package:filcnaplo_kreta_api/models/lesson.dart';
 import 'package:filcnaplo_mobile_ui/common/bottom_card.dart';
 import 'package:filcnaplo_mobile_ui/common/detail.dart';
 import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
 import 'lesson_view.i18n.dart';

 class LessonView extends StatelessWidget {
@@ -16,6 +18,8 @@ class LessonView extends StatelessWidget {
    Color accent = Theme.of(context).colorScheme.secondary;
    String lessonIndexTrailing = "";

+    SettingsProvider settingsProvider = Provider.of<SettingsProvider>(context);
+
    if (RegExp(r'\d').hasMatch(lesson.lessonIndex)) lessonIndexTrailing = ".";

    if (lesson.substituteTeacher != "") {
@@ -50,7 +54,7 @@ class LessonView extends StatelessWidget {
              lesson.subject.renamedTo ?? lesson.subject.name.capital(),
              maxLines: 1,
              overflow: TextOverflow.ellipsis,
-              style: TextStyle(fontWeight: FontWeight.w600, fontStyle: lesson.subject.isRenamed ? FontStyle.italic : null),
+              style: TextStyle(fontWeight: FontWeight.w600, fontStyle: lesson.subject.isRenamed && settingsProvider.renamedSubjectsItalics ? FontStyle.italic : null),
            ),
            subtitle: Text(
              lesson.substituteTeacher == "" ? lesson.teacher : lesson.substituteTeacher,
--- a/filcnaplo_mobile_ui/lib/common/widgets/message/message_view_tile.dart
+++ b/filcnaplo_mobile_ui/lib/common/widgets/message/message_view_tile.dart
@@ -22,16 +22,22 @@ class MessageViewTile extends StatelessWidget {
    UserProvider user = Provider.of<UserProvider>(context, listen: false);
    String recipientLabel = "";

-    if (message.recipients.any((r) => r.name == user.student?.name)) recipientLabel = "me".i18n;
+    if (message.recipients.any((r) => r.name == user.student?.name)) {
+      recipientLabel = "me".i18n;
+    }

    if (recipientLabel != "" && message.recipients.length > 1) {
      recipientLabel += " +";
-      recipientLabel += message.recipients.where((r) => r.name != user.student?.name).length.toString();
+      recipientLabel += message.recipients
+          .where((r) => r.name != user.student?.name)
+          .length
+          .toString();
    }

    if (recipientLabel == "") {
      // note: convertint to set to remove duplicates
-      recipientLabel += message.recipients.map((r) => r.name).toSet().join(", ");
+      recipientLabel +=
+          message.recipients.map((r) => r.name).toSet().join(", ");
    }

    List<Widget> attachments = [];
@@ -75,9 +81,9 @@ class MessageViewTile extends StatelessWidget {
              overflow: TextOverflow.ellipsis,
              maxLines: 1,
            ),
-            trailing: Row(
+            trailing: const Row(
              mainAxisSize: MainAxisSize.min,
-              children: const [
+              children: [
                // IconButton(
                //   onPressed: () {},
                //   icon: Icon(FeatherIcons.cornerUpLeft, color: AppColors.of(context).text),
--- a/filcnaplo_mobile_ui/lib/common/widgets/missed_exam/missed_exam_view.dart
+++ b/filcnaplo_mobile_ui/lib/common/widgets/missed_exam/missed_exam_view.dart
@@ -1,4 +1,5 @@
 import 'package:filcnaplo/helpers/subject.dart';
+import 'package:filcnaplo/models/settings.dart';
 import 'package:filcnaplo/theme/colors/colors.dart';
 import 'package:filcnaplo_kreta_api/models/lesson.dart';
 import 'package:filcnaplo_mobile_ui/common/bottom_sheet_menu/rounded_bottom_sheet.dart';
@@ -6,6 +7,7 @@ import 'package:filcnaplo_mobile_ui/pages/timetable/timetable_page.dart';
 import 'package:flutter/material.dart';
 import 'package:flutter_feather_icons/flutter_feather_icons.dart';
 import 'package:filcnaplo/utils/format.dart';
+import 'package:provider/provider.dart';
 import 'missed_exam_tile.i18n.dart';

 class MissedExamView extends StatelessWidget {
@@ -30,6 +32,7 @@ class MissedExamViewTile extends StatelessWidget {

  @override
  Widget build(BuildContext context) {
+    SettingsProvider settingsProvider = Provider.of<SettingsProvider>(context);
    return Material(
      type: MaterialType.transparency,
      child: Padding(
@@ -43,7 +46,7 @@ class MissedExamViewTile extends StatelessWidget {
          ),
          title: Text(
            "${lesson.subject.renamedTo ?? lesson.subject.name.capital()} • ${lesson.date.format(context)}",
-            style: TextStyle(fontWeight: FontWeight.w600, fontStyle: lesson.subject.isRenamed ? FontStyle.italic : null),
+            style: TextStyle(fontWeight: FontWeight.w600, fontStyle: lesson.subject.isRenamed && settingsProvider.renamedSubjectsItalics ? FontStyle.italic : null),
          ),
          subtitle: Text(
            "missed_exam_contact".i18n.fill([lesson.teacher]),
--- a/filcnaplo_mobile_ui/lib/pages/absences/absence_subject_view.dart
+++ b/filcnaplo_mobile_ui/lib/pages/absences/absence_subject_view.dart
@@ -1,4 +1,5 @@
 import 'package:filcnaplo/helpers/subject.dart';
+import 'package:filcnaplo/models/settings.dart';
 import 'package:filcnaplo/theme/colors/colors.dart';
 import 'package:filcnaplo/ui/date_widget.dart';
 import 'package:filcnaplo/utils/reverse_search.dart';
@@ -15,6 +16,7 @@ import 'package:flutter/material.dart';
 import 'package:filcnaplo/utils/format.dart';

 import 'package:filcnaplo_mobile_ui/common/widgets/absence/absence_view.i18n.dart';
+import 'package:provider/provider.dart';

 class AbsenceSubjectView extends StatelessWidget {
  const AbsenceSubjectView(this.subject, {Key? key, this.absences = const []}) : super(key: key);
@@ -54,10 +56,12 @@ class AbsenceSubjectView extends StatelessWidget {
        .toList();
    List<Widget> absenceTiles = sortDateWidgets(context, dateWidgets: dateWidgets, padding: EdgeInsets.zero, hasShadow: true);

+    SettingsProvider settingsProvider = Provider.of<SettingsProvider>(context);
+
    return Scaffold(
      body: HeroScrollView(
        title: subject.renamedTo ?? subject.name.capital(),
-        italic: subject.isRenamed,
+        italic: subject.isRenamed && settingsProvider.renamedSubjectsItalics,
        icon: SubjectIcon.resolveVariant(subject: subject, context: context),
        child: AbsenceSubjectViewContainer(
          child: CupertinoScrollbar(
--- a/filcnaplo_mobile_ui/lib/pages/grades/grade_subject_view.dart
+++ b/filcnaplo_mobile_ui/lib/pages/grades/grade_subject_view.dart
@@ -1,6 +1,7 @@
 import 'dart:math';

 import 'package:animations/animations.dart';
+import 'package:filcnaplo/models/settings.dart';
 import 'package:filcnaplo/utils/format.dart';
 import 'package:filcnaplo_kreta_api/providers/grade_provider.dart';
 import 'package:filcnaplo/helpers/average_helper.dart';
@@ -56,6 +57,7 @@ class _GradeSubjectViewState extends State<GradeSubjectView> {
  // Providers
  late GradeProvider gradeProvider;
  late GradeCalculatorProvider calculatorProvider;
+  late SettingsProvider settingsProvider;

  late double average;
  late Widget gradeGraph;
@@ -149,6 +151,7 @@ class _GradeSubjectViewState extends State<GradeSubjectView> {
  Widget build(BuildContext context) {
    gradeProvider = Provider.of<GradeProvider>(context);
    calculatorProvider = Provider.of<GradeCalculatorProvider>(context);
+    settingsProvider = Provider.of<SettingsProvider>(context);

    List<Grade> subjectGrades = getSubjectGrades(widget.subject).toList();
    average = AverageHelper.averageEvals(subjectGrades);
@@ -260,7 +263,7 @@ class _GradeSubjectViewState extends State<GradeSubjectView> {
                  subject: widget.subject, context: context),
              scrollController: _scrollController,
              title: widget.subject.renamedTo ?? widget.subject.name.capital(),
-              italic: widget.subject.isRenamed,
+              italic: settingsProvider.renamedSubjectsItalics && widget.subject.isRenamed,
              child: SubjectGradesContainer(
                child: CupertinoScrollbar(
                  child: ListView.builder(
@@ -277,7 +280,7 @@ class _GradeSubjectViewState extends State<GradeSubjectView> {

  void gradeCalc(BuildContext context) {
    // Scroll to the top of the page
-    _scrollController.animateTo(75,
+    _scrollController.animateTo(100,
        duration: const Duration(milliseconds: 500), curve: Curves.ease);

    calculatorProvider.clear();
--- a/filcnaplo_mobile_ui/lib/pages/home/live_card/live_card.dart
+++ b/filcnaplo_mobile_ui/lib/pages/home/live_card/live_card.dart
@@ -2,7 +2,9 @@ import 'package:animations/animations.dart';
 import 'package:filcnaplo/api/providers/user_provider.dart';
 import 'package:filcnaplo/helpers/subject.dart';
 import 'package:filcnaplo/icons/filc_icons.dart';
+import 'package:filcnaplo/models/settings.dart';
 import 'package:filcnaplo_mobile_ui/pages/home/live_card/heads_up_countdown.dart';
+import 'package:filcnaplo_mobile_ui/screens/summary/summary_screen.dart';
 import 'package:flutter/material.dart';
 import 'package:filcnaplo/utils/format.dart';
 import 'package:filcnaplo/api/providers/live_card_provider.dart';
@@ -43,6 +45,7 @@ class _LiveCardState extends State<LiveCard> {
  @override
  Widget build(BuildContext context) {
    liveCard = Provider.of<LiveCardProvider>(context);
+    SettingsProvider settingsProvider = Provider.of<SettingsProvider>(context);

    if (!liveCard.show) return Container();

@@ -50,10 +53,54 @@ class _LiveCardState extends State<LiveCard> {
    Duration bellDelay = liveCard.delay;

    switch (liveCard.currentState) {
+      case LiveCardState.summary:
+        child = LiveCardWidget(
+          key: const Key('livecard.summary'),
+          title: 'Vége a tanévnek! 🥳',
+          icon: FeatherIcons.arrowRight,
+          description: Text(
+            'Irány az összefoglaláshoz',
+            style: TextStyle(
+              fontWeight: FontWeight.w500,
+              fontSize: 18.0,
+              color: Theme.of(context).textTheme.bodyMedium?.color,
+            ),
+          ),
+          onTap: () {
+            // showSlidingBottomSheet(
+            //   context,
+            //   useRootNavigator: true,
+            //   builder: (context) => SlidingSheetDialog(
+            //     color: Colors.black.withOpacity(0.99),
+            //     duration: const Duration(milliseconds: 400),
+            //     scrollSpec: const ScrollSpec.bouncingScroll(),
+            //     snapSpec: const SnapSpec(
+            //       snap: true,
+            //       snappings: [1.0],
+            //       initialSnap: 1.0,
+            //       positioning: SnapPositioning.relativeToAvailableSpace,
+            //     ),
+            //     minHeight: MediaQuery.of(context).size.height,
+            //     cornerRadius: 16,
+            //     cornerRadiusOnFullscreen: 0,
+            //     builder: (context, state) => const Material(
+            //       color: Colors.black,
+            //       child: SummaryScreen(
+            //         currentPage: 'start',
+            //       ),
+            //     ),
+            //   ),
+            // );
+            SummaryScreen.show(context: context, currentPage: 'start');
+          },
+        );
+        break;
      case LiveCardState.morning:
        child = LiveCardWidget(
          key: const Key('livecard.morning'),
-          title: DateFormat("EEEE", I18n.of(context).locale.toString()).format(DateTime.now()).capital(),
+          title: DateFormat("EEEE", I18n.of(context).locale.toString())
+              .format(DateTime.now())
+              .capital(),
          icon: FeatherIcons.sun,
          description: liveCard.nextLesson != null
              ? Text.rich(
@@ -61,26 +108,40 @@ class _LiveCardState extends State<LiveCard> {
                    children: [
                      TextSpan(text: "first_lesson_1".i18n),
                      TextSpan(
-                        text: liveCard.nextLesson!.subject.renamedTo ?? liveCard.nextLesson!.subject.name.capital(),
+                        text: liveCard.nextLesson!.subject.renamedTo ??
+                            liveCard.nextLesson!.subject.name.capital(),
                        style: TextStyle(
                            fontWeight: FontWeight.w600,
-                            color: Theme.of(context).colorScheme.secondary.withOpacity(.85),
-                            fontStyle: liveCard.nextLesson!.subject.isRenamed ? FontStyle.italic : null),
+                            color: Theme.of(context)
+                                .colorScheme
+                                .secondary
+                                .withOpacity(.85),
+                            fontStyle: liveCard.nextLesson!.subject.isRenamed &&
+                                    settingsProvider.renamedSubjectsItalics
+                                ? FontStyle.italic
+                                : null),
                      ),
                      TextSpan(text: "first_lesson_2".i18n),
                      TextSpan(
                        text: liveCard.nextLesson!.room.capital(),
                        style: TextStyle(
                          fontWeight: FontWeight.w600,
-                          color: Theme.of(context).colorScheme.secondary.withOpacity(.85),
+                          color: Theme.of(context)
+                              .colorScheme
+                              .secondary
+                              .withOpacity(.85),
                        ),
                      ),
                      TextSpan(text: "first_lesson_3".i18n),
                      TextSpan(
-                        text: DateFormat('H:mm').format(liveCard.nextLesson!.start),
+                        text: DateFormat('H:mm')
+                            .format(liveCard.nextLesson!.start),
                        style: TextStyle(
                          fontWeight: FontWeight.w600,
-                          color: Theme.of(context).colorScheme.secondary.withOpacity(.85),
+                          color: Theme.of(context)
+                              .colorScheme
+                              .secondary
+                              .withOpacity(.85),
                        ),
                      ),
                      TextSpan(text: "first_lesson_4".i18n),
@@ -91,30 +152,48 @@ class _LiveCardState extends State<LiveCard> {
        );
        break;
      case LiveCardState.duringLesson:
-        final elapsedTime = DateTime.now().difference(liveCard.currentLesson!.start).inSeconds.toDouble() + bellDelay.inSeconds;
-        final maxTime = liveCard.currentLesson!.end.difference(liveCard.currentLesson!.start).inSeconds.toDouble();
+        final elapsedTime = DateTime.now()
+                .difference(liveCard.currentLesson!.start)
+                .inSeconds
+                .toDouble() +
+            bellDelay.inSeconds;
+        final maxTime = liveCard.currentLesson!.end
+            .difference(liveCard.currentLesson!.start)
+            .inSeconds
+            .toDouble();

        final showMinutes = maxTime - elapsedTime > 60;

        child = LiveCardWidget(
          key: const Key('livecard.duringLesson'),
-          leading: liveCard.currentLesson!.lessonIndex + (RegExp(r'\d').hasMatch(liveCard.currentLesson!.lessonIndex) ? "." : ""),
-          title: liveCard.currentLesson!.subject.renamedTo ?? liveCard.currentLesson!.subject.name.capital(),
+          leading: liveCard.currentLesson!.lessonIndex +
+              (RegExp(r'\d').hasMatch(liveCard.currentLesson!.lessonIndex)
+                  ? "."
+                  : ""),
+          title: liveCard.currentLesson!.subject.renamedTo ??
+              liveCard.currentLesson!.subject.name.capital(),
          titleItalic: liveCard.currentLesson!.subject.isRenamed,
          subtitle: liveCard.currentLesson!.room,
-          icon: SubjectIcon.resolveVariant(subject: liveCard.currentLesson!.subject, context: context),
-          description: liveCard.currentLesson!.description != "" ? Text(liveCard.currentLesson!.description) : null,
-          nextSubject: liveCard.nextLesson?.subject.renamedTo ?? liveCard.nextLesson?.subject.name.capital(),
-          nextSubjectItalic: liveCard.nextLesson?.subject.isRenamed ?? false,
+          icon: SubjectIcon.resolveVariant(
+              subject: liveCard.currentLesson!.subject, context: context),
+          description: liveCard.currentLesson!.description != ""
+              ? Text(liveCard.currentLesson!.description)
+              : null,
+          nextSubject: liveCard.nextLesson?.subject.renamedTo ??
+              liveCard.nextLesson?.subject.name.capital(),
+          nextSubjectItalic: liveCard.nextLesson?.subject.isRenamed == true &&
+              settingsProvider.renamedSubjectsItalics,
          nextRoom: liveCard.nextLesson?.room,
          progressMax: showMinutes ? maxTime / 60 : maxTime,
          progressCurrent: showMinutes ? elapsedTime / 60 : elapsedTime,
-          progressAccuracy: showMinutes ? ProgressAccuracy.minutes : ProgressAccuracy.seconds,
+          progressAccuracy:
+              showMinutes ? ProgressAccuracy.minutes : ProgressAccuracy.seconds,
          onProgressTap: () {
            showDialog(
              barrierColor: Colors.black,
              context: context,
-              builder: (context) => HeadsUpCountdown(maxTime: maxTime, elapsedTime: elapsedTime),
+              builder: (context) =>
+                  HeadsUpCountdown(maxTime: maxTime, elapsedTime: elapsedTime),
            );
          },
        );
@@ -129,8 +208,15 @@ class _LiveCardState extends State<LiveCard> {

        final diff = liveCard.getFloorDifference();

-        final maxTime = liveCard.nextLesson!.start.difference(liveCard.prevLesson!.end).inSeconds.toDouble();
-        final elapsedTime = DateTime.now().difference(liveCard.prevLesson!.end).inSeconds.toDouble() + bellDelay.inSeconds.toDouble();
+        final maxTime = liveCard.nextLesson!.start
+            .difference(liveCard.prevLesson!.end)
+            .inSeconds
+            .toDouble();
+        final elapsedTime = DateTime.now()
+                .difference(liveCard.prevLesson!.end)
+                .inSeconds
+                .toDouble() +
+            bellDelay.inSeconds.toDouble();

        final showMinutes = maxTime - elapsedTime > 60;

@@ -139,14 +225,21 @@ class _LiveCardState extends State<LiveCard> {
          title: "break".i18n,
          icon: iconFloorMap[diff],
          description: liveCard.nextLesson!.room != liveCard.prevLesson!.room
-              ? Text("go $diff".i18n.fill([diff != "to room" ? (liveCard.nextLesson!.getFloor() ?? 0) : liveCard.nextLesson!.room]))
+              ? Text("go $diff".i18n.fill([
+                  diff != "to room"
+                      ? (liveCard.nextLesson!.getFloor() ?? 0)
+                      : liveCard.nextLesson!.room
+                ]))
              : Text("stay".i18n),
-          nextSubject: liveCard.nextLesson?.subject.renamedTo ?? liveCard.nextLesson?.subject.name.capital(),
-          nextSubjectItalic: liveCard.nextLesson?.subject.isRenamed ?? false,
+          nextSubject: liveCard.nextLesson?.subject.renamedTo ??
+              liveCard.nextLesson?.subject.name.capital(),
+          nextSubjectItalic: liveCard.nextLesson?.subject.isRenamed == true &&
+              settingsProvider.renamedSubjectsItalics,
          nextRoom: diff != "to room" ? liveCard.nextLesson?.room : null,
          progressMax: showMinutes ? maxTime / 60 : maxTime,
          progressCurrent: showMinutes ? elapsedTime / 60 : elapsedTime,
-          progressAccuracy: showMinutes ? ProgressAccuracy.minutes : ProgressAccuracy.seconds,
+          progressAccuracy:
+              showMinutes ? ProgressAccuracy.minutes : ProgressAccuracy.seconds,
          onProgressTap: () {
            showDialog(
              barrierColor: Colors.black,
@@ -162,14 +255,18 @@ class _LiveCardState extends State<LiveCard> {
      case LiveCardState.afternoon:
        child = LiveCardWidget(
          key: const Key('livecard.afternoon'),
-          title: DateFormat("EEEE", I18n.of(context).locale.toString()).format(DateTime.now()).capital(),
+          title: DateFormat("EEEE", I18n.of(context).locale.toString())
+              .format(DateTime.now())
+              .capital(),
          icon: FeatherIcons.coffee,
        );
        break;
      case LiveCardState.night:
        child = LiveCardWidget(
          key: const Key('livecard.night'),
-          title: DateFormat("EEEE", I18n.of(context).locale.toString()).format(DateTime.now()).capital(),
+          title: DateFormat("EEEE", I18n.of(context).locale.toString())
+              .format(DateTime.now())
+              .capital(),
          icon: FeatherIcons.moon,
        );
        break;
--- a/filcnaplo_mobile_ui/lib/pages/home/live_card/live_card_widget.dart
+++ b/filcnaplo_mobile_ui/lib/pages/home/live_card/live_card_widget.dart
@@ -9,6 +9,7 @@ enum ProgressAccuracy { minutes, seconds }
 class LiveCardWidget extends StatefulWidget {
  const LiveCardWidget({
    Key? key,
+    this.isEvent = false,
    this.leading,
    this.title,
    this.titleItalic = false,
@@ -22,8 +23,10 @@ class LiveCardWidget extends StatefulWidget {
    this.progressMax,
    this.progressAccuracy = ProgressAccuracy.minutes,
    this.onProgressTap,
+    this.onTap,
  }) : super(key: key);

+  final bool isEvent;
  final String? leading;
  final String? title;
  final bool titleItalic;
@@ -37,6 +40,7 @@ class LiveCardWidget extends StatefulWidget {
  final double? progressMax;
  final ProgressAccuracy? progressAccuracy;
  final Function()? onProgressTap;
+  final Function()? onTap;

  @override
  State<LiveCardWidget> createState() => _LiveCardWidgetState();
@@ -51,6 +55,7 @@ class _LiveCardWidgetState extends State<LiveCardWidget> {
      onLongPressDown: (_) => setState(() => hold = true),
      onLongPressEnd: (_) => setState(() => hold = false),
      onLongPressCancel: () => setState(() => hold = false),
+      onTap: widget.onTap,
      child: AnimatedScale(
        scale: hold ? 1.03 : 1.0,
        curve: Curves.easeInOutBack,
@@ -73,171 +78,305 @@ class _LiveCardWidgetState extends State<LiveCardWidget> {
            padding: const EdgeInsets.symmetric(horizontal: 6.0),
            child: OverflowBox(
              maxHeight: 96.0,
-              child: Column(
-                crossAxisAlignment: CrossAxisAlignment.start,
-                mainAxisAlignment: MainAxisAlignment.spaceAround,
-                children: [
-                  Expanded(
-                    child: Row(
-                      crossAxisAlignment: CrossAxisAlignment.start,
+              child: widget.isEvent
+                  ? Column(
+                      crossAxisAlignment: CrossAxisAlignment.center,
+                      mainAxisAlignment: MainAxisAlignment.center,
                      children: [
-                        if (widget.leading != null)
-                          Padding(
-                            padding: const EdgeInsets.only(right: 12.0, top: 8.0),
-                            child: Text(
-                              widget.leading!,
-                              textAlign: TextAlign.center,
-                              style: TextStyle(
-                                fontSize: 32.0,
-                                fontWeight: FontWeight.w600,
-                                color: Theme.of(context).colorScheme.secondary,
-                              ),
-                            ),
-                          ),
-                        Expanded(
-                          child: Column(
-                            crossAxisAlignment: CrossAxisAlignment.start,
-                            mainAxisAlignment: MainAxisAlignment.spaceAround,
-                            children: [
-                              Row(
-                                children: [
-                                  if (widget.title != null)
-                                    Expanded(
-                                      child: Text.rich(
-                                        TextSpan(
-                                          children: [
-                                            TextSpan(text: widget.title!, style: TextStyle(fontStyle: widget.titleItalic ? FontStyle.italic : null)),
-                                            if (widget.subtitle != null)
-                                              WidgetSpan(
-                                                child: Container(
-                                                  margin: const EdgeInsets.only(left: 6.0, bottom: 3.0),
-                                                  padding: const EdgeInsets.symmetric(horizontal: 4.0, vertical: 2.0),
-                                                  decoration: BoxDecoration(
-                                                    color: Theme.of(context).colorScheme.secondary.withOpacity(.3),
-                                                    borderRadius: BorderRadius.circular(4.0),
-                                                  ),
-                                                  child: Text(
-                                                    widget.subtitle!,
-                                                    style: TextStyle(
-                                                      height: 1.2,
-                                                      fontSize: 14.0,
-                                                      fontWeight: FontWeight.w600,
-                                                      color: Theme.of(context).colorScheme.secondary,
-                                                    ),
-                                                  ),
-                                                ),
-                                              ),
-                                          ],
-                                        ),
-                                        style: const TextStyle(fontWeight: FontWeight.w600, fontSize: 22.0),
-                                        maxLines: 1,
-                                        softWrap: false,
-                                        overflow: TextOverflow.ellipsis,
-                                      ),
-                                    ),
-                                  if (widget.title != null) const SizedBox(width: 6.0),
-                                  if (widget.icon != null)
-                                    Padding(
-                                      padding: const EdgeInsets.symmetric(vertical: 4.0),
-                                      child: Icon(
-                                        widget.icon,
-                                        size: 26.0,
-                                        color: AppColors.of(context).text.withOpacity(.75),
-                                      ),
-                                    ),
-                                ],
-                              ),
-                              if (widget.description != null)
-                                DefaultTextStyle(
-                                  style: Theme.of(context).textTheme.bodyMedium!.copyWith(
-                                        fontWeight: FontWeight.w500,
-                                        fontSize: 16.0,
-                                        height: 1.0,
-                                        color: AppColors.of(context).text.withOpacity(.75),
-                                      ),
-                                  maxLines: !(widget.nextSubject == null && widget.progressCurrent == null && widget.progressMax == null) ? 1 : 2,
-                                  softWrap: false,
-                                  overflow: TextOverflow.ellipsis,
-                                  child: widget.description!,
-                                ),
-                            ],
+                        Text(
+                          widget.title ?? 'Esemény',
+                          style: TextStyle(
+                            fontWeight: FontWeight.bold,
+                            fontSize: 24.0,
+                            color:
+                                Theme.of(context).textTheme.bodyMedium?.color,
+                            fontStyle:
+                                widget.titleItalic ? FontStyle.italic : null,
                          ),
                        ),
+                        Row(
+                          crossAxisAlignment: CrossAxisAlignment.center,
+                          mainAxisAlignment: MainAxisAlignment.center,
+                          children: [
+                            widget.description ??
+                                Text(
+                                  'Nincs leírás megadva.',
+                                  style: TextStyle(
+                                    fontWeight: FontWeight.w500,
+                                    fontSize: 18.0,
+                                    color: Theme.of(context)
+                                        .textTheme
+                                        .bodyMedium
+                                        ?.color,
+                                  ),
+                                ),
+                            SizedBox(
+                              height: 15,
+                              child: Container(
+                                decoration: BoxDecoration(
+                                  color: Theme.of(context)
+                                      .colorScheme
+                                      .secondary
+                                      .withOpacity(0.5),
+                                  borderRadius: const BorderRadius.all(
+                                    Radius.circular(10),
+                                  ),
+                                ),
+                                child: Padding(
+                                  padding: const EdgeInsets.all(4),
+                                  child: Icon(widget.icon),
+                                ),
+                              ),
+                            ),
+                          ],
+                        ),
                      ],
-                    ),
-                  ),
-                  if (!(widget.nextSubject == null && widget.progressCurrent == null && widget.progressMax == null))
-                    Padding(
-                      padding: const EdgeInsets.only(top: 8.0),
-                      child: Row(
-                        children: [
-                          if (widget.nextSubject != null) const Icon(FeatherIcons.arrowRight, size: 12.0),
-                          if (widget.nextSubject != null) const SizedBox(width: 4.0),
-                          if (widget.nextSubject != null)
-                            Expanded(
-                              child: Text.rich(
-                                TextSpan(
+                    )
+                  : Column(
+                      crossAxisAlignment: CrossAxisAlignment.start,
+                      mainAxisAlignment: MainAxisAlignment.spaceAround,
+                      children: [
+                        Expanded(
+                          child: Row(
+                            crossAxisAlignment: CrossAxisAlignment.start,
+                            children: [
+                              if (widget.leading != null)
+                                Padding(
+                                  padding: const EdgeInsets.only(
+                                      right: 12.0, top: 8.0),
+                                  child: Text(
+                                    widget.leading!,
+                                    textAlign: TextAlign.center,
+                                    style: TextStyle(
+                                      fontSize: 32.0,
+                                      fontWeight: FontWeight.w600,
+                                      color: Theme.of(context)
+                                          .colorScheme
+                                          .secondary,
+                                    ),
+                                  ),
+                                ),
+                              Expanded(
+                                child: Column(
+                                  crossAxisAlignment: CrossAxisAlignment.start,
+                                  mainAxisAlignment:
+                                      MainAxisAlignment.spaceAround,
                                  children: [
-                                    TextSpan(
-                                        text: widget.nextSubject!, style: TextStyle(fontStyle: widget.nextSubjectItalic ? FontStyle.italic : null)),
-                                    if (widget.nextRoom != null)
-                                      WidgetSpan(
-                                        child: Container(
-                                          margin: const EdgeInsets.only(left: 4.0),
-                                          padding: const EdgeInsets.symmetric(horizontal: 3.0, vertical: 1.5),
-                                          decoration: BoxDecoration(
-                                            color: Theme.of(context).colorScheme.secondary.withOpacity(.25),
-                                            borderRadius: BorderRadius.circular(4.0),
-                                          ),
-                                          child: Text(
-                                            widget.nextRoom!,
-                                            style: TextStyle(
-                                              height: 1.1,
-                                              fontSize: 11.0,
-                                              fontWeight: FontWeight.w600,
-                                              color: Theme.of(context).colorScheme.secondary.withOpacity(.9),
+                                    Row(
+                                      children: [
+                                        if (widget.title != null)
+                                          Expanded(
+                                            child: Text.rich(
+                                              TextSpan(
+                                                children: [
+                                                  TextSpan(
+                                                      text: widget.title!,
+                                                      style: TextStyle(
+                                                          fontStyle: widget
+                                                                  .titleItalic
+                                                              ? FontStyle.italic
+                                                              : null)),
+                                                  if (widget.subtitle != null)
+                                                    WidgetSpan(
+                                                      child: Container(
+                                                        margin: const EdgeInsets
+                                                                .only(
+                                                            left: 6.0,
+                                                            bottom: 3.0),
+                                                        padding:
+                                                            const EdgeInsets
+                                                                    .symmetric(
+                                                                horizontal: 4.0,
+                                                                vertical: 2.0),
+                                                        decoration:
+                                                            BoxDecoration(
+                                                          color: Theme.of(
+                                                                  context)
+                                                              .colorScheme
+                                                              .secondary
+                                                              .withOpacity(.3),
+                                                          borderRadius:
+                                                              BorderRadius
+                                                                  .circular(
+                                                                      4.0),
+                                                        ),
+                                                        child: Text(
+                                                          widget.subtitle!,
+                                                          style: TextStyle(
+                                                            height: 1.2,
+                                                            fontSize: 14.0,
+                                                            fontWeight:
+                                                                FontWeight.w600,
+                                                            color: Theme.of(
+                                                                    context)
+                                                                .colorScheme
+                                                                .secondary,
+                                                          ),
+                                                        ),
+                                                      ),
+                                                    ),
+                                                ],
+                                              ),
+                                              style: const TextStyle(
+                                                  fontWeight: FontWeight.w600,
+                                                  fontSize: 22.0),
+                                              maxLines: 1,
+                                              softWrap: false,
+                                              overflow: TextOverflow.ellipsis,
                                            ),
                                          ),
-                                        ),
+                                        if (widget.title != null)
+                                          const SizedBox(width: 6.0),
+                                        if (widget.icon != null)
+                                          Padding(
+                                            padding: const EdgeInsets.symmetric(
+                                                vertical: 4.0),
+                                            child: Icon(
+                                              widget.icon,
+                                              size: 26.0,
+                                              color: AppColors.of(context)
+                                                  .text
+                                                  .withOpacity(.75),
+                                            ),
+                                          ),
+                                      ],
+                                    ),
+                                    if (widget.description != null)
+                                      DefaultTextStyle(
+                                        style: Theme.of(context)
+                                            .textTheme
+                                            .bodyMedium!
+                                            .copyWith(
+                                              fontWeight: FontWeight.w500,
+                                              fontSize: 16.0,
+                                              height: 1.0,
+                                              color: AppColors.of(context)
+                                                  .text
+                                                  .withOpacity(.75),
+                                            ),
+                                        maxLines:
+                                            !(widget.nextSubject == null &&
+                                                    widget.progressCurrent ==
+                                                        null &&
+                                                    widget.progressMax == null)
+                                                ? 1
+                                                : 2,
+                                        softWrap: false,
+                                        overflow: TextOverflow.ellipsis,
+                                        child: widget.description!,
                                      ),
                                  ],
                                ),
-                                style: TextStyle(
-                                  color: AppColors.of(context).text.withOpacity(.8),
-                                  fontWeight: FontWeight.w600,
-                                ),
-                                maxLines: 1,
-                                overflow: TextOverflow.ellipsis,
-                                softWrap: false,
                              ),
-                            ),
-                          if (widget.nextRoom == null && widget.nextSubject == null) const Spacer(),
-                          if (widget.progressCurrent != null && widget.progressMax != null)
-                            GestureDetector(
-                              onTap: widget.onProgressTap,
-                              child: Container(
-                                color: Colors.transparent,
-                                child: Text(
-                                  "remaining ${widget.progressAccuracy == ProgressAccuracy.minutes ? 'min' : 'sec'}"
-                                      .plural((widget.progressMax! - widget.progressCurrent!).round()),
-                                  maxLines: 1,
-                                  style: TextStyle(
-                                    fontWeight: FontWeight.w500,
-                                    color: AppColors.of(context).text.withOpacity(.75),
+                            ],
+                          ),
+                        ),
+                        if (!(widget.nextSubject == null &&
+                            widget.progressCurrent == null &&
+                            widget.progressMax == null))
+                          Padding(
+                            padding: const EdgeInsets.only(top: 8.0),
+                            child: Row(
+                              children: [
+                                if (widget.nextSubject != null)
+                                  const Icon(FeatherIcons.arrowRight,
+                                      size: 12.0),
+                                if (widget.nextSubject != null)
+                                  const SizedBox(width: 4.0),
+                                if (widget.nextSubject != null)
+                                  Expanded(
+                                    child: Text.rich(
+                                      TextSpan(
+                                        children: [
+                                          TextSpan(
+                                              text: widget.nextSubject!,
+                                              style: TextStyle(
+                                                  fontStyle:
+                                                      widget.nextSubjectItalic
+                                                          ? FontStyle.italic
+                                                          : null)),
+                                          if (widget.nextRoom != null)
+                                            WidgetSpan(
+                                              child: Container(
+                                                margin: const EdgeInsets.only(
+                                                    left: 4.0),
+                                                padding:
+                                                    const EdgeInsets.symmetric(
+                                                        horizontal: 3.0,
+                                                        vertical: 1.5),
+                                                decoration: BoxDecoration(
+                                                  color: Theme.of(context)
+                                                      .colorScheme
+                                                      .secondary
+                                                      .withOpacity(.25),
+                                                  borderRadius:
+                                                      BorderRadius.circular(
+                                                          4.0),
+                                                ),
+                                                child: Text(
+                                                  widget.nextRoom!,
+                                                  style: TextStyle(
+                                                    height: 1.1,
+                                                    fontSize: 11.0,
+                                                    fontWeight: FontWeight.w600,
+                                                    color: Theme.of(context)
+                                                        .colorScheme
+                                                        .secondary
+                                                        .withOpacity(.9),
+                                                  ),
+                                                ),
+                                              ),
+                                            ),
+                                        ],
+                                      ),
+                                      style: TextStyle(
+                                        color: AppColors.of(context)
+                                            .text
+                                            .withOpacity(.8),
+                                        fontWeight: FontWeight.w600,
+                                      ),
+                                      maxLines: 1,
+                                      overflow: TextOverflow.ellipsis,
+                                      softWrap: false,
+                                    ),
                                  ),
-                                ),
-                              ),
-                            )
-                        ],
-                      ),
+                                if (widget.nextRoom == null &&
+                                    widget.nextSubject == null)
+                                  const Spacer(),
+                                if (widget.progressCurrent != null &&
+                                    widget.progressMax != null)
+                                  GestureDetector(
+                                    onTap: widget.onProgressTap,
+                                    child: Container(
+                                      color: Colors.transparent,
+                                      child: Text(
+                                        "remaining ${widget.progressAccuracy == ProgressAccuracy.minutes ? 'min' : 'sec'}"
+                                            .plural((widget.progressMax! -
+                                                    widget.progressCurrent!)
+                                                .round()),
+                                        maxLines: 1,
+                                        style: TextStyle(
+                                          fontWeight: FontWeight.w500,
+                                          color: AppColors.of(context)
+                                              .text
+                                              .withOpacity(.75),
+                                        ),
+                                      ),
+                                    ),
+                                  )
+                              ],
+                            ),
+                          ),
+                        if (widget.progressCurrent != null &&
+                            widget.progressMax != null)
+                          Padding(
+                            padding: const EdgeInsets.symmetric(vertical: 4.0),
+                            child: ProgressBar(
+                                value: widget.progressCurrent! /
+                                    widget.progressMax!),
+                          )
+                      ],
                    ),
-                  if (widget.progressCurrent != null && widget.progressMax != null)
-                    Padding(
-                      padding: const EdgeInsets.symmetric(vertical: 4.0),
-                      child: ProgressBar(value: widget.progressCurrent! / widget.progressMax!),
-                    )
-                ],
-              ),
            ),
          ),
        ),
--- a/filcnaplo_mobile_ui/lib/pages/timetable/timetable_page.dart
+++ b/filcnaplo_mobile_ui/lib/pages/timetable/timetable_page.dart
@@ -199,7 +199,7 @@ class _TimetablePageState extends State<TimetablePage>
                snap: false,
                surfaceTintColor: Theme.of(context).scaffoldBackgroundColor,
                actions: [
-                  PremiumFSTimetableButton(controller: _controller),
+                  PremiumFSTimetableButton(controller: _controller, tabcontroller: _tabController),

                  // Profile Icon
                  Padding(
--- a/filcnaplo_mobile_ui/lib/pages/timetable/timetable_page.i18n.dart
+++ b/filcnaplo_mobile_ui/lib/pages/timetable/timetable_page.i18n.dart
@@ -8,18 +8,21 @@ extension Localization on String {
          "empty": "No school this week!",
          "week": "Week",
          "error": "Failed to fetch timetable!",
+          "empty_timetable": "Timetable is empty!",
        },
        "hu_hu": {
          "timetable": "Órarend",
          "empty": "Ezen a héten nincs iskola.",
          "week": "Hét",
          "error": "Nem sikerült lekérni az órarendet!",
+          "empty_timetable": "Az órarend üres!",
        },
        "de_de": {
          "timetable": "Zeitplan",
          "empty": "Keine Schule diese Woche.",
          "week": "Woche",
          "error": "Der Fahrplan konnte nicht abgerufen werden!",
+          "empty_timetable": "Der Zeitplan ist blank!",
        },
      };

--- a/filcnaplo_mobile_ui/lib/premium/premium_button.dart
+++ b/filcnaplo_mobile_ui/lib/premium/premium_button.dart
@@ -12,14 +12,16 @@ class PremiumButton extends StatefulWidget {
  State<PremiumButton> createState() => _PremiumButtonState();
 }

-class _PremiumButtonState extends State<PremiumButton> with TickerProviderStateMixin {
+class _PremiumButtonState extends State<PremiumButton>
+    with TickerProviderStateMixin {
  late final AnimationController _animation;
  bool _heldDown = false;

  @override
  void initState() {
    super.initState();
-    _animation = AnimationController(vsync: this, duration: const Duration(seconds: 3));
+    _animation =
+        AnimationController(vsync: this, duration: const Duration(seconds: 3));
    _animation.repeat();
  }

@@ -38,7 +40,8 @@ class _PremiumButtonState extends State<PremiumButton> with TickerProviderStateM
      transitionType: ContainerTransitionType.fadeThrough,
      openElevation: 0,
      closedElevation: 0,
-      closedShape: RoundedRectangleBorder(borderRadius: BorderRadius.circular(14.0)),
+      closedShape:
+          RoundedRectangleBorder(borderRadius: BorderRadius.circular(14.0)),
      openBuilder: (context, _) => const PremiumScreen(),
      closedBuilder: (context, action) => GestureDetector(
        onTapDown: (_) => setState(() => _heldDown = true),
@@ -57,16 +60,20 @@ class _PremiumButtonState extends State<PremiumButton> with TickerProviderStateM
                    child: ClipRRect(
                      borderRadius: BorderRadius.circular(14.0),
                      child: ImageFiltered(
-                        imageFilter: ImageFilter.blur(sigmaX: 10.0, sigmaY: 10.0),
+                        imageFilter:
+                            ImageFilter.blur(sigmaX: 10.0, sigmaY: 10.0),
                        child: Container(
                          height: 70,
                          decoration: BoxDecoration(
-                            gradient: SweepGradient(colors: const [
-                              Colors.blue,
-                              Colors.orange,
-                              Colors.purple,
-                              Colors.blue,
-                            ], transform: GradientRotation(_animation.value * 6.283185)),
+                            gradient: SweepGradient(
+                                colors: const [
+                                  Colors.blue,
+                                  Colors.orange,
+                                  Colors.purple,
+                                  Colors.blue,
+                                ],
+                                transform: GradientRotation(
+                                    _animation.value * 6.283185)),
                          ),
                        ),
                      ),
@@ -92,9 +99,9 @@ class _PremiumButtonState extends State<PremiumButton> with TickerProviderStateM
                      Color(0xff1EA18F),
                    ]),
                  ),
-                  child: Row(
+                  child: const Row(
                    mainAxisAlignment: MainAxisAlignment.center,
-                    children: const [
+                    children: [
                      Icon(FilcIcons.premium, color: Colors.white),
                      SizedBox(width: 12.0),
                      Text(
--- a/filcnaplo_mobile_ui/lib/premium/premium_screen.dart
+++ b/filcnaplo_mobile_ui/lib/premium/premium_screen.dart
@@ -21,8 +21,9 @@ class PremiumScreen extends StatelessWidget {

  @override
  Widget build(BuildContext context) {
-    final middleColor =
-        Theme.of(context).brightness == Brightness.dark ? const Color.fromARGB(255, 20, 57, 46) : const Color.fromARGB(255, 10, 140, 123);
+    final middleColor = Theme.of(context).brightness == Brightness.dark
+        ? const Color.fromARGB(255, 20, 57, 46)
+        : const Color.fromARGB(255, 10, 140, 123);

    final future = FilcAPI.getSupporters();

@@ -78,7 +79,8 @@ class PremiumScreen extends StatelessWidget {
                        children: [
                          Expanded(
                            child: Padding(
-                              padding: const EdgeInsets.symmetric(horizontal: 24.0),
+                              padding:
+                                  const EdgeInsets.symmetric(horizontal: 24.0),
                              child: Column(
                                crossAxisAlignment: CrossAxisAlignment.start,
                                children: [
@@ -87,16 +89,25 @@ class PremiumScreen extends StatelessWidget {
                                  const SizedBox(height: 12.0),
                                  const Text(
                                    "Még több filc.",
-                                    style: TextStyle(fontWeight: FontWeight.w600, fontSize: 25.0, color: Colors.white),
+                                    style: TextStyle(
+                                        fontWeight: FontWeight.w600,
+                                        fontSize: 25.0,
+                                        color: Colors.white),
                                  ),
                                  const Text(
                                    "reFilc Premium.",
-                                    style: TextStyle(fontWeight: FontWeight.w800, fontSize: 35.0, color: Colors.white),
+                                    style: TextStyle(
+                                        fontWeight: FontWeight.w800,
+                                        fontSize: 35.0,
+                                        color: Colors.white),
                                  ),
                                  const SizedBox(height: 15.0),
                                  Text(
                                    "Támogasd a filcet, és szerezz cserébe pár kényelmes jutalmat!",
-                                    style: TextStyle(fontWeight: FontWeight.w500, fontSize: 20, color: Colors.white.withOpacity(.8)),
+                                    style: TextStyle(
+                                        fontWeight: FontWeight.w500,
+                                        fontSize: 20,
+                                        color: Colors.white.withOpacity(.8)),
                                  ),
                                  const SizedBox(height: 25.0),
                                  SupportersButton(supporters: future),
@@ -110,43 +121,61 @@ class PremiumScreen extends StatelessWidget {
                  ),
                ),
                SliverPadding(
-                  padding: const EdgeInsets.symmetric(horizontal: 24.0).add(const EdgeInsets.only(bottom: 100)),
+                  padding: const EdgeInsets.symmetric(horizontal: 24.0)
+                      .add(const EdgeInsets.only(bottom: 100)),
                  sliver: SliverToBoxAdapter(
                    child: Column(
                      children: [
                        PremiumPlanCard(
                          icon: const Icon(FilcIcons.kupak),
-                          title: Text("Kupak", style: TextStyle(foreground: GradientStyles.kupakPaint)),
+                          title: Text("Kupak",
+                              style: TextStyle(
+                                  foreground: GradientStyles.kupakPaint)),
                          gradient: GradientStyles.kupak,
                          price: 2,
-                          description: const Text("Szabd személyre a filcet és láss részletesebb statisztikákat."),
-                          url: "https://github.com/sponsors/filc/sponsorships?tier_id=238453&preview=true",
-                          active: ActiveSponsorCard.estimateLevel(context.watch<PremiumProvider>().scopes) == PremiumFeatureLevel.kupak,
+                          description: const Text(
+                              "Szabd személyre a filcet és láss részletesebb statisztikákat."),
+                          url:
+                              "https://github.com/sponsors/filc/sponsorships?tier_id=238453&preview=true",
+                          active: ActiveSponsorCard.estimateLevel(
+                                  context.watch<PremiumProvider>().scopes) ==
+                              PremiumFeatureLevel.kupak,
                        ),
                        const SizedBox(height: 8.0),
                        PremiumPlanCard(
                          icon: const Icon(FilcIcons.tinta),
-                          title: Text("Tinta", style: TextStyle(foreground: GradientStyles.tintaPaint)),
+                          title: Text("Tinta",
+                              style: TextStyle(
+                                  foreground: GradientStyles.tintaPaint)),
                          gradient: GradientStyles.tinta,
                          price: 5,
-                          description: const Text("Kényelmesebb órarend, asztali alkalmazás és célok kitűzése."),
-                          url: "https://github.com/sponsors/filc/sponsorships?tier_id=238454&preview=true",
-                          active: ActiveSponsorCard.estimateLevel(context.watch<PremiumProvider>().scopes) == PremiumFeatureLevel.tinta,
+                          description: const Text(
+                              "Kényelmesebb órarend, asztali alkalmazás és célok kitűzése."),
+                          url:
+                              "https://github.com/sponsors/filc/sponsorships?tier_id=238454&preview=true",
+                          active: ActiveSponsorCard.estimateLevel(
+                                  context.watch<PremiumProvider>().scopes) ==
+                              PremiumFeatureLevel.tinta,
                        ),
                        const SizedBox(height: 12.0),
-                        PremiumGoalCard(progress: snapshot.data?.progress ?? 0, target: snapshot.data?.max ?? 1),
+                        PremiumGoalCard(
+                            progress: snapshot.data?.progress ?? 0,
+                            target: snapshot.data?.max ?? 1),
                        const SizedBox(height: 12.0),
                        const GithubConnectButton(),
                        Padding(
-                          padding: const EdgeInsets.symmetric(vertical: 14.0).add(const EdgeInsets.only(top: 12.0)),
-                          child: Row(
-                            children: const [
+                          padding: const EdgeInsets.symmetric(vertical: 14.0)
+                              .add(const EdgeInsets.only(top: 12.0)),
+                          child: const Row(
+                            children: [
                              Icon(FilcIcons.kupak),
                              SizedBox(width: 12.0),
                              Expanded(
                                child: Text(
                                  "Kupak jutalmak",
-                                  style: TextStyle(fontWeight: FontWeight.w500, fontSize: 20),
+                                  style: TextStyle(
+                                      fontWeight: FontWeight.w500,
+                                      fontSize: 20),
                                ),
                              ),
                            ],
@@ -154,40 +183,50 @@ class PremiumScreen extends StatelessWidget {
                        ),
                        PremiumRewardCard(
                          imageKey: "premium_nickname_showcase",
-                          icon: SvgPicture.asset("assets/images/nickname_icon.svg", color: Theme.of(context).iconTheme.color),
+                          icon: SvgPicture.asset(
+                              "assets/images/nickname_icon.svg",
+                              color: Theme.of(context).iconTheme.color),
                          title: const Text("Profil személyre szabás"),
-                          description: const Text("Állíts be egy saját becenevet és egy profilképet (akár animáltat is!)"),
+                          description: const Text(
+                              "Állíts be egy saját becenevet és egy profilképet (akár animáltat is!)"),
                        ),
                        const SizedBox(height: 14.0),
                        PremiumRewardCard(
                          imageKey: "premium_theme_showcase",
-                          icon: SvgPicture.asset("assets/images/theme_icon.svg", color: Theme.of(context).iconTheme.color),
+                          icon: SvgPicture.asset("assets/images/theme_icon.svg",
+                              color: Theme.of(context).iconTheme.color),
                          title: const Text("Téma+"),
-                          description: const Text("Válassz saját háttérszínt és kártyaszínt is, akár saját HEX-kóddal!"),
+                          description: const Text(
+                              "Válassz saját háttérszínt és kártyaszínt is, akár saját HEX-kóddal!"),
                        ),
                        const SizedBox(height: 14.0),
                        PremiumRewardCard(
                          imageKey: "premium_stats_showcase",
-                          icon: SvgPicture.asset("assets/images/stats_icon.svg", color: Theme.of(context).iconTheme.color),
+                          icon: SvgPicture.asset("assets/images/stats_icon.svg",
+                              color: Theme.of(context).iconTheme.color),
                          title: const Text("Részletes jegy statisztika"),
-                          description: const Text("Válassz heti, havi és háromhavi időtartam közül, és pontosan lásd, mennyi jegyed van."),
+                          description: const Text(
+                              "Válassz heti, havi és háromhavi időtartam közül, és pontosan lásd, mennyi jegyed van."),
                        ),
                        const SizedBox(height: 14.0),
                        const PremiumRewardCard(
                          title: Text("Még pár dolog..."),
-                          description:
-                              Text("🔣\tVálassz ikon témát\n✨\tPrémium rang és csevegő a discord szerverünkön\n📬\tElsőbbségi segítségnyújtás"),
+                          description: Text(
+                              "🔣\tVálassz ikon témát\n✨\tPrémium rang és csevegő a discord szerverünkön\n📬\tElsőbbségi segítségnyújtás"),
                        ),
                        Padding(
-                          padding: const EdgeInsets.symmetric(vertical: 14.0).add(const EdgeInsets.only(top: 12.0)),
-                          child: Row(
-                            children: const [
+                          padding: const EdgeInsets.symmetric(vertical: 14.0)
+                              .add(const EdgeInsets.only(top: 12.0)),
+                          child: const Row(
+                            children: [
                              Icon(FilcIcons.tinta),
                              SizedBox(width: 12.0),
                              Expanded(
                                child: Text(
                                  "Tinta jutalmak",
-                                  style: TextStyle(fontWeight: FontWeight.w500, fontSize: 20),
+                                  style: TextStyle(
+                                      fontWeight: FontWeight.w500,
+                                      fontSize: 20),
                                ),
                              ),
                            ],
@@ -195,48 +234,62 @@ class PremiumScreen extends StatelessWidget {
                        ),
                        PremiumRewardCard(
                          imageKey: "premium_timetable_showcase",
-                          icon: SvgPicture.asset("assets/images/timetable_icon.svg", color: Theme.of(context).iconTheme.color),
+                          icon: SvgPicture.asset(
+                              "assets/images/timetable_icon.svg",
+                              color: Theme.of(context).iconTheme.color),
                          title: const Text("Heti órarend nézet"),
-                          description:
-                              const Text("Egy órarend, ami a teljes képernyődet kihasználja, csak nem olyan idegesítő, mint az eKRÉTA féle."),
+                          description: const Text(
+                              "Egy órarend, ami a teljes képernyődet kihasználja, csak nem olyan idegesítő, mint az eKRÉTA féle."),
                        ),
                        const SizedBox(height: 14.0),
                        PremiumRewardCard(
                          imageKey: "premium_widget_showcase",
-                          icon: SvgPicture.asset("assets/images/widget_icon.svg", color: Theme.of(context).iconTheme.color),
+                          icon: SvgPicture.asset(
+                              "assets/images/widget_icon.svg",
+                              color: Theme.of(context).iconTheme.color),
                          title: const Text("Widget"),
-                          description: const Text("Mindig lásd, milyen órád lesz, a kezdőképernyőd kényelméből."),
+                          description: const Text(
+                              "Mindig lásd, milyen órád lesz, a kezdőképernyőd kényelméből."),
                        ),
                        const SizedBox(height: 14.0),
                        PremiumRewardCard(
                          soon: true,
                          imageKey: "premium_goal_showcase",
-                          icon: SvgPicture.asset("assets/images/goal_icon.svg", color: Theme.of(context).iconTheme.color),
+                          icon: SvgPicture.asset("assets/images/goal_icon.svg",
+                              color: Theme.of(context).iconTheme.color),
                          title: const Text("Cél követés"),
-                          description: const Text("Add meg, mi a célod, és mi majd kiszámoljuk, hogyan juthatsz oda!"),
+                          description: const Text(
+                              "Add meg, mi a célod, és mi majd kiszámoljuk, hogyan juthatsz oda!"),
                        ),
                        const SizedBox(height: 14.0),
                        PremiumRewardCard(
                          soon: true,
                          imageKey: "premium_desktop_showcase",
-                          icon: SvgPicture.asset("assets/images/desktop_icon.svg", color: Theme.of(context).iconTheme.color),
+                          icon: SvgPicture.asset(
+                              "assets/images/desktop_icon.svg",
+                              color: Theme.of(context).iconTheme.color),
                          title: const Text("Asztali verzió"),
-                          description: const Text("Érd el a reFilcet a gépeden is, és menekülj meg a csúnya felhasználói felületektől!"),
+                          description: const Text(
+                              "Érd el a reFilcet a gépeden is, és menekülj meg a csúnya felhasználói felületektől!"),
                        ),
                        const SizedBox(height: 14.0),
                        const PremiumRewardCard(
                          title: Text("Még pár dolog..."),
-                          description: Text("🖋️\tMinden kupak jutalom\n✨\tKorai hozzáférés új verziókhoz"),
+                          description: Text(
+                              "🖋️\tMinden kupak jutalom\n✨\tKorai hozzáférés új verziókhoz"),
                        ),
                        Padding(
-                          padding: const EdgeInsets.symmetric(vertical: 14.0).add(const EdgeInsets.only(top: 12.0)),
-                          child: Row(
-                            children: const [
+                          padding: const EdgeInsets.symmetric(vertical: 14.0)
+                              .add(const EdgeInsets.only(top: 12.0)),
+                          child: const Row(
+                            children: [
                              SizedBox(width: 12.0),
                              Expanded(
                                child: Text(
                                  "Mire vársz még?",
-                                  style: TextStyle(fontWeight: FontWeight.w500, fontSize: 20),
+                                  style: TextStyle(
+                                      fontWeight: FontWeight.w500,
+                                      fontSize: 20),
                                ),
                              ),
                            ],
@@ -244,20 +297,24 @@ class PremiumScreen extends StatelessWidget {
                        ),
                        GithubCard(
                          onPressed: () {
-                            Navigator.of(context).push(MaterialPageRoute(builder: (context) {
+                            Navigator.of(context)
+                                .push(MaterialPageRoute(builder: (context) {
                              return const PremiumActivationView();
                            }));
                          },
                        ),
                        Padding(
-                          padding: const EdgeInsets.symmetric(vertical: 14.0).add(const EdgeInsets.only(top: 12.0)),
-                          child: Row(
-                            children: const [
+                          padding: const EdgeInsets.symmetric(vertical: 14.0)
+                              .add(const EdgeInsets.only(top: 12.0)),
+                          child: const Row(
+                            children: [
                              SizedBox(width: 12.0),
                              Expanded(
                                child: Text(
                                  "Gyakori kérdések",
-                                  style: TextStyle(fontWeight: FontWeight.w500, fontSize: 20),
+                                  style: TextStyle(
+                                      fontWeight: FontWeight.w500,
+                                      fontSize: 20),
                                ),
                              ),
                            ],
--- a/filcnaplo_mobile_ui/lib/screens/navigation/navigation_screen.dart
+++ b/filcnaplo_mobile_ui/lib/screens/navigation/navigation_screen.dart
@@ -110,7 +110,9 @@ class NavigationScreenState extends State<NavigationScreen>
            requiredNetworkType: NetworkType.ANY), (String taskId) async {
      // <-- Event handler
      // This is the fetch-event callback.
-      print("[BackgroundFetch] Event received $taskId");
+      if (kDebugMode) {
+        print("[BackgroundFetch] Event received $taskId");
+      }

      // IMPORTANT:  You must signal completion of your task or the OS can punish your app
      // for taking too long in the background.
@@ -118,10 +120,14 @@ class NavigationScreenState extends State<NavigationScreen>
    }, (String taskId) async {
      // <-- Task timeout handler.
      // This task has exceeded its allowed running-time.  You must stop what you're doing and immediately .finish(taskId)
-      print("[BackgroundFetch] TASK TIMEOUT taskId: $taskId");
+      if (kDebugMode) {
+        print("[BackgroundFetch] TASK TIMEOUT taskId: $taskId");
+      }
      BackgroundFetch.finish(taskId);
    });
-    print('[BackgroundFetch] configure success: $status');
+    if (kDebugMode) {
+      print('[BackgroundFetch] configure success: $status');
+    }

    // If the widget was removed from the tree while the asynchronous platform
    // message was in flight, we want to discard the reply rather than calling
@@ -133,7 +139,6 @@ class NavigationScreenState extends State<NavigationScreen>
  void initState() {
    super.initState();

-    initPlatformState();

    HomeWidget.setAppGroupId('hu.refilc.naplo.group');

@@ -173,7 +178,10 @@ class NavigationScreenState extends State<NavigationScreen>
  @override
  void didChangePlatformBrightness() {
    if (settings.theme == ThemeMode.system) {
-      Brightness? brightness = MediaQuery.of(context).platformBrightness;
+      // ignore: deprecated_member_use
+      Brightness? brightness =
+          // ignore: deprecated_member_use
+          WidgetsBinding.instance.window.platformBrightness;
      Provider.of<ThemeModeObserver>(context, listen: false).changeTheme(
          brightness == Brightness.light ? ThemeMode.light : ThemeMode.dark);
    }
--- a/filcnaplo_mobile_ui/lib/screens/settings/settings_helper.dart
+++ b/filcnaplo_mobile_ui/lib/screens/settings/settings_helper.dart
@@ -484,8 +484,9 @@ class _BellDelaySettingState extends State<BellDelaySetting>
                    Duration sdiff = lesson.start.difference(now);
                    Duration ediff = lesson.end.difference(now);

-                    if (closest == null || sdiff.abs() < closest.abs())
+                    if (closest == null || sdiff.abs() < closest.abs()) {
                      closest = sdiff;
+                    }
                    if (ediff.abs() < closest.abs()) closest = ediff;
                  }
                  if (closest != null) {
--- a/filcnaplo_mobile_ui/lib/screens/settings/settings_screen.dart
+++ b/filcnaplo_mobile_ui/lib/screens/settings/settings_screen.dart
@@ -84,34 +84,37 @@ class _SettingsScreenState extends State<SettingsScreen>

      String _firstName;

-      List<String> _nameParts = user.displayName?.split(" ") ?? ["?"];
+      List<String> _nameParts = account.displayName.split(" ");
      if (!settings.presentationMode) {
        _firstName = _nameParts.length > 1 ? _nameParts[1] : _nameParts[0];
      } else {
        _firstName = "János";
      }

-      accountTiles.add(AccountTile(
-        name: Text(!settings.presentationMode ? account.name : "János",
-            style: const TextStyle(fontWeight: FontWeight.w500)),
-        username:
-            Text(!settings.presentationMode ? account.username : "01234567890"),
-        profileImage: ProfileImage(
-          name: _firstName,
-          backgroundColor: Theme.of(context)
-              .colorScheme
-              .primary, //!settings.presentationMode
-          //? ColorUtils.stringToColor(account.name)
-          //: Theme.of(context).colorScheme.secondary,
-          role: account.role,
+      accountTiles.add(
+        AccountTile(
+          name: Text(!settings.presentationMode ? account.name : "János",
+              style: const TextStyle(fontWeight: FontWeight.w500)),
+          username: Text(
+              !settings.presentationMode ? account.username : "01234567890"),
+          profileImage: ProfileImage(
+            name: _firstName,
+            role: account.role,
+            profilePictureString: account.picture,
+            backgroundColor: Theme.of(context)
+                .colorScheme
+                .primary, //!settings.presentationMode
+            //? ColorUtils.stringToColor(account.name)
+            //: Theme.of(context).colorScheme.secondary,
+          ),
+          onTap: () {
+            user.setUser(account.id);
+            restore().then((_) => user.setUser(account.id));
+            Navigator.of(context).pop();
+          },
+          onTapMenu: () => _showBottomSheet(account),
        ),
-        onTap: () {
-          user.setUser(account.id);
-          restore().then((_) => user.setUser(account.id));
-          Navigator.of(context).pop();
-        },
-        onTapMenu: () => _showBottomSheet(account),
-      ));
+      );
    });
  }

@@ -153,7 +156,7 @@ class _SettingsScreenState extends State<SettingsScreen>
  void initState() {
    super.initState();
    Future.delayed(Duration.zero, () {
-      futureRelease = Provider.of<UpdateProvider>(context).installedVersion();
+      futureRelease = Provider.of<UpdateProvider>(context, listen: false).installedVersion();
    });
    _hideContainersController = AnimationController(
        vsync: this, duration: const Duration(milliseconds: 200));
@@ -434,6 +437,62 @@ class _SettingsScreenState extends State<SettingsScreen>
                        activeColor: Theme.of(context).colorScheme.secondary,
                      ),
                    ),
+                    Material(
+                      type: MaterialType.transparency,
+                      child: SwitchListTile(
+                        value: settings.notificationsEnabled,
+                        activeColor: Theme.of(context).colorScheme.secondary,
+                        contentPadding: const EdgeInsets.only(left: 12.0),
+                        shape: RoundedRectangleBorder(
+                            borderRadius: BorderRadius.circular(12.0)),
+                        title: Row(children: [
+                          Icon(FeatherIcons.messageSquare,
+                              color: settings.notificationsEnabled ? Theme.of(context).colorScheme.secondary : AppColors.of(context).text.withOpacity(.25)),
+                          const SizedBox(width: 14.0),
+                          Text(
+                            "notifications".i18n,
+                            style: TextStyle(
+                              color: AppColors.of(context).text.withOpacity(
+                                  settings.notificationsEnabled ? 1.0 : .5),
+                              fontWeight: FontWeight.w600,
+                              fontSize: 16.0,
+                            ),
+                          ),
+                          const SizedBox(
+                            width: 5,
+                          ),
+                          SizedBox(
+                            height: 30,
+                            child: AnimatedContainer(
+                              duration: const Duration(milliseconds: 200),
+                              child: Padding(
+                                padding:
+                                    const EdgeInsets.only(left: 10, right: 10),
+                                child: Center(
+                                    child: Text("BETA",
+                                        style: TextStyle(
+                                            fontSize: 9.1,
+                                            color: AppColors.of(context)
+                                                .text
+                                                .withOpacity(
+                                                    settings.notificationsEnabled
+                                                        ? 1.0
+                                                        : .5),
+                                            fontWeight: FontWeight.w600,
+                                            overflow: TextOverflow.ellipsis))),
+                              ),
+                              decoration: BoxDecoration(
+                                  color: settings.notificationsEnabled 
+                                    ? Theme.of(context).colorScheme.secondary
+                                    : AppColors.of(context).text.withOpacity(.25),
+                                  borderRadius: BorderRadius.circular(40)),
+                            ),
+                          )
+                        ]),
+                        onChanged: (value) =>
+                            settings.update(notificationsEnabled: value),
+                      ),
+                    ),
                  ],
                ),
              ),
@@ -854,7 +913,7 @@ class _SettingsScreenState extends State<SettingsScreen>
                padding: const EdgeInsets.symmetric(
                    vertical: 12.0, horizontal: 24.0),
                child: Panel(
-                  title: const Text("Developer Settings"),
+                  title: Text("devsettings".i18n),
                  child: Column(
                    children: [
                      Material(
@@ -863,8 +922,8 @@ class _SettingsScreenState extends State<SettingsScreen>
                          contentPadding: const EdgeInsets.only(left: 12.0),
                          shape: RoundedRectangleBorder(
                              borderRadius: BorderRadius.circular(12.0)),
-                          title: const Text("Developer Mode",
-                              style: TextStyle(fontWeight: FontWeight.w500)),
+                          title: Text("devmode".i18n,
+                              style: const TextStyle(fontWeight: FontWeight.w500)),
                          onChanged: (v) =>
                              settings.update(developerMode: false),
                          value: settings.developerMode,
@@ -873,7 +932,7 @@ class _SettingsScreenState extends State<SettingsScreen>
                      ),
                      PanelButton(
                        leading: const Icon(FeatherIcons.copy),
-                        title: const Text("Copy JWT"),
+                        title: Text("copy_jwt".i18n),
                        onPressed: () => Clipboard.setData(ClipboardData(
                            text:
                                Provider.of<KretaClient>(context, listen: false)
@@ -918,6 +977,9 @@ class _SettingsScreenState extends State<SettingsScreen>
                          child: Text("v${release.data!['version']}"),
                        );
                      } else {
+                        String envAppVer = const String.fromEnvironment(
+                            "APPVER",
+                            defaultValue: "?");
                        return DefaultTextStyle(
                          style: Theme.of(context)
                              .textTheme
@@ -927,7 +989,7 @@ class _SettingsScreenState extends State<SettingsScreen>
                                  color: AppColors.of(context)
                                      .text
                                      .withOpacity(0.65)),
-                          child: const Text("v?"),
+                          child: Text("v$envAppVer"),
                        );
                      }
                    },
@@ -937,13 +999,13 @@ class _SettingsScreenState extends State<SettingsScreen>
                      ScaffoldMessenger.of(context).showSnackBar(SnackBar(
                        duration: const Duration(milliseconds: 200),
                        content: Text(
-                            "You are $devmodeCountdown taps away from Developer Mode."),
+                            "devmoretaps".i18n.fill([devmodeCountdown])),
                      ));

                      setState(() => devmodeCountdown--);
                    } else if (devmodeCountdown == 0) {
-                      ScaffoldMessenger.of(context).showSnackBar(const SnackBar(
-                        content: Text("Developer Mode successfully activated."),
+                      ScaffoldMessenger.of(context).showSnackBar(SnackBar(
+                        content: Text("devactivated".i18n),
                      ));

                      settings.update(developerMode: true);
--- a/filcnaplo_mobile_ui/lib/screens/settings/settings_screen.i18n.dart
+++ b/filcnaplo_mobile_ui/lib/screens/settings/settings_screen.i18n.dart
@@ -66,6 +66,11 @@ extension SettingsLocalization on String {
          "Adaptive Theme": "Adaptive Theme",
          "presentation": "Presentation mode",
          "uwufymode": "UwU-fied mode (hungarian)",
+          "devmoretaps": "You are %s taps away from Developer Mode.",
+          "devactivated": "Developer Mode successfully activated.",
+          "devsettings": "Developer Settings",
+          "devmode": "Developer Mode",
+          "copy_jwt": "Copy JWT",
        },
        "hu_hu": {
          "personal_details": "Személyes információk",
@@ -130,6 +135,11 @@ extension SettingsLocalization on String {
          "Adaptive Theme": "Adaptív téma",
          "presentation": "Bemutató mód",
          "uwufymode": "UwU mód (magyar)",
+          "devmoretaps": "Még %s koppintásra vagy a Fejlesztői módtól.",
+          "devactivated": "Fejlesztői mód sikeresen aktiválva.",
+          "devsettings": "Fejlesztői Beállítások",
+          "devmode": "Fejlesztői mód",
+          "copy_jwt": "JWT másolása",
        },
        "de_de": {
          "personal_details": "Persönliche Angaben",
@@ -193,6 +203,11 @@ extension SettingsLocalization on String {
          "Adaptive Theme": "Adaptive Theme",
          "presentation": "Präsentationsmodus",
          "uwufymode": "UwU-Modus (ungarisch)",
+          "devmoretaps": "Sie sind %s Taps vom Entwicklermodus entfernt.",
+          "devactivated": "Entwicklermodus erfolgreich aktiviert.",
+          "devsettings": "Entwickleroptionen",
+          "devmode": "Entwicklermodus",
+          "copy_jwt": "JWT kopieren",
        },
      };

--- a/filcnaplo_mobile_ui/lib/screens/summary/pages/allsum_page.dart
+++ b/filcnaplo_mobile_ui/lib/screens/summary/pages/allsum_page.dart
@@ -0,0 +1,227 @@
+import 'package:filcnaplo/api/providers/user_provider.dart';
+import 'package:filcnaplo_kreta_api/models/absence.dart';
+import 'package:filcnaplo_kreta_api/models/grade.dart';
+import 'package:filcnaplo_kreta_api/models/subject.dart';
+import 'package:filcnaplo_kreta_api/providers/absence_provider.dart';
+import 'package:filcnaplo_kreta_api/providers/grade_provider.dart';
+import 'package:filcnaplo_kreta_api/providers/homework_provider.dart';
+import 'package:filcnaplo_mobile_ui/screens/summary/summary_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+
+class AllSumBody extends StatefulWidget {
+  const AllSumBody({Key? key}) : super(key: key);
+
+  @override
+  _AllSumBodyState createState() => _AllSumBodyState();
+}
+
+class _AllSumBodyState extends State<AllSumBody> {
+  late UserProvider user;
+  late GradeProvider gradeProvider;
+  late HomeworkProvider homeworkProvider;
+  late AbsenceProvider absenceProvider;
+  //late TimetableProvider timetableProvider;
+
+  late Map<String, Map<String, dynamic>> things = {};
+  late List<Widget> firstSixTiles = [];
+  late List<Widget> lastSixTiles = [];
+
+  int avgDropValue = 0;
+  bool animation = false;
+
+  List<Grade> getSubjectGrades(Subject subject, {int days = 0}) => gradeProvider
+      .grades
+      .where((e) =>
+          e.subject == subject &&
+          e.type == GradeType.midYear &&
+          (days == 0 ||
+              e.date.isBefore(DateTime.now().subtract(Duration(days: days)))))
+      .toList();
+
+  @override
+  void initState() {
+    super.initState();
+
+    gradeProvider = Provider.of<GradeProvider>(context, listen: false);
+    homeworkProvider = Provider.of<HomeworkProvider>(context, listen: false);
+    absenceProvider = Provider.of<AbsenceProvider>(context, listen: false);
+    //timetableProvider = Provider.of<TimetableProvider>(context, listen: false);
+
+    WidgetsBinding.instance.addPostFrameCallback((timeStamp) {
+      setState(() {
+        animation = true;
+      });
+    });
+  }
+
+  void getGrades() {
+    var allGrades = gradeProvider.grades;
+    var testsGrades = gradeProvider.grades.where((a) => a.value.weight == 100);
+    var closingTestsGrades =
+        gradeProvider.grades.where((a) => a.value.weight >= 200);
+
+    things.addAll({
+      'tests': {'name': 'test'.i18n, 'value': testsGrades.length},
+      'closingTests': {
+        'name': 'closingtest'.i18n,
+        'value': closingTestsGrades.length
+      },
+      'grades': {'name': 'grade'.i18n, 'value': allGrades.length}
+    });
+  }
+
+  void getHomework() {
+    var allHomework = homeworkProvider.homework;
+
+    things.addAll({
+      'homework': {'name': 'hw'.i18n, 'value': allHomework.length}
+    });
+  }
+
+  void getSubjects() {
+    var allSubjects = gradeProvider.grades
+        .map((e) => e.subject)
+        .toSet()
+        .toList()
+      ..sort((a, b) => a.name.compareTo(b.name));
+    //var totalLessons;
+    var totalLessons = 0;
+
+    things.addAll({
+      'subjects': {'name': 'subject'.i18n, 'value': allSubjects.length},
+      'lessons': {'name': 'lesson'.i18n, 'value': totalLessons}
+    });
+  }
+
+  void getAbsences() {
+    var allAbsences = absenceProvider.absences.where((a) => a.delay == 0);
+    var excusedAbsences = absenceProvider.absences
+        .where((a) => a.state == Justification.excused && a.delay == 0);
+    var unexcusedAbsences = absenceProvider.absences.where((a) =>
+        (a.state == Justification.unexcused ||
+            a.state == Justification.pending) &&
+        a.delay == 0);
+
+    things.addAll({
+      'absences': {'name': 'absence_sum'.i18n, 'value': allAbsences.length},
+      'excusedAbsences': {
+        'name': 'excused'.i18n,
+        'value': excusedAbsences.length
+      },
+      'unexcusedAbsences': {
+        'name': 'unexcused'.i18n,
+        'value': unexcusedAbsences.length
+      }
+    });
+  }
+
+  void getDelays() {
+    var allDelays = absenceProvider.absences.where((a) => a.delay > 0);
+    var totalDelayTime = (allDelays.map((a) {
+      return a.delay;
+    }).toList())
+        .reduce((a, b) => a + b);
+    var unexcusedDelays = absenceProvider.absences
+        .where((a) => a.state == Justification.unexcused && a.delay > 0);
+
+    things.addAll({
+      'delays': {'name': 'delay_sum'.i18n, 'value': allDelays.length},
+      'totalDelay': {'name': 'min'.i18n, 'value': totalDelayTime},
+      'unexcusedDelays': {
+        'name': 'unexcused'.i18n,
+        'value': unexcusedDelays.length
+      }
+    });
+  }
+
+  void getEverything() {
+    getGrades();
+    getHomework();
+    getSubjects();
+    getAbsences();
+    getDelays();
+  }
+
+  void generateTiles() {
+    for (var i in things.values) {
+      Widget w = Column(
+        mainAxisAlignment: MainAxisAlignment.center,
+        crossAxisAlignment: CrossAxisAlignment.center,
+        children: [
+          Text(
+            i.values.toList()[1].toString(),
+            textAlign: TextAlign.center,
+            style: const TextStyle(
+              fontWeight: FontWeight.w800,
+              fontSize: 36.0,
+              color: Colors.white,
+            ),
+          ),
+          Text(
+            i.values.toList()[0],
+            textAlign: TextAlign.center,
+            style: const TextStyle(
+              fontSize: 18.0,
+              color: Colors.white,
+            ),
+          ),
+        ],
+      );
+
+      // TODO: az orakat es a hazikat szarul keri le, de majd meg lesz csinalva
+      if (firstSixTiles.length < 6) {
+        firstSixTiles.add(w);
+      } else if (lastSixTiles.length < 6) {
+        lastSixTiles.add(w);
+      } else {
+        break;
+      }
+    }
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    getEverything();
+    generateTiles();
+
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.center,
+      mainAxisAlignment: MainAxisAlignment.center,
+      children: [
+        const SizedBox(
+          height: 45,
+        ),
+        AnimatedContainer(
+          curve: Curves.easeInOut,
+          duration: const Duration(milliseconds: 420),
+          transform: Matrix4.translationValues(
+              animation ? 0 : MediaQuery.of(context).size.width, 0, 0),
+          height: 250,
+          child: GridView.count(
+            crossAxisCount: 3,
+            mainAxisSpacing: 0,
+            crossAxisSpacing: 5,
+            children: firstSixTiles,
+          ),
+        ),
+        const SizedBox(
+          height: 30,
+        ),
+        AnimatedContainer(
+          curve: Curves.easeInOut,
+          duration: const Duration(milliseconds: 420),
+          transform: Matrix4.translationValues(
+              animation ? 0 : -MediaQuery.of(context).size.width, 0, 0),
+          height: 250,
+          child: GridView.count(
+            crossAxisCount: 3,
+            mainAxisSpacing: 0,
+            crossAxisSpacing: 5,
+            children: lastSixTiles,
+          ),
+        ),
+      ],
+    );
+  }
+}
--- a/filcnaplo_mobile_ui/lib/screens/summary/pages/grades_page.dart
+++ b/filcnaplo_mobile_ui/lib/screens/summary/pages/grades_page.dart
@@ -1,10 +1,362 @@
-import 'package:flutter/material.dart';
+import 'dart:math';

-class GradesBody extends StatelessWidget {
+import 'package:filcnaplo/api/providers/user_provider.dart';
+import 'package:filcnaplo/helpers/average_helper.dart';
+import 'package:filcnaplo/models/settings.dart';
+import 'package:filcnaplo/ui/widgets/grade/grade_tile.dart';
+import 'package:filcnaplo/utils/format.dart';
+import 'package:filcnaplo_kreta_api/models/grade.dart';
+import 'package:filcnaplo_kreta_api/models/subject.dart';
+import 'package:filcnaplo_kreta_api/providers/grade_provider.dart';
+import 'package:filcnaplo_mobile_ui/screens/summary/summary_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import 'package:auto_size_text/auto_size_text.dart';
+import 'package:i18n_extension/i18n_widget.dart';
+
+List<String> faces = [
+  "(·.·)",
+  "(≥o≤)",
+  "(·_·)",
+  "(˚Δ˚)b",
+  "(^-^*)",
+  "(='X'=)",
+  "(>_<)",
+  "(;-;)",
+  "\\(^Д^)/",
+  "\\(o_o)/",
+];
+
+class GradesBody extends StatefulWidget {
  const GradesBody({Key? key}) : super(key: key);

+  @override
+  _GradesBodyState createState() => _GradesBodyState();
+}
+
+class _GradesBodyState extends State<GradesBody> {
+  late UserProvider user;
+  late GradeProvider gradeProvider;
+  late SettingsProvider settings;
+
+  late double subjectAvg;
+  late double endYearAvg;
+  late String endYearAvgText;
+
+  List<Widget> subjectTiles5 = [];
+  List<Widget> subjectTiles3 = [];
+  List<Widget> subjectTiles1 = [];
+
+  int avgDropValue = 0;
+  bool animation = false;
+
+  List<Grade> getSubjectGrades(Subject subject, {int days = 0}) => gradeProvider
+      .grades
+      .where((e) =>
+          e.subject == subject &&
+          e.type == GradeType.midYear &&
+          (days == 0 ||
+              e.date.isBefore(DateTime.now().subtract(Duration(days: days)))))
+      .toList();
+
+  @override
+  void initState() {
+    super.initState();
+
+    gradeProvider = Provider.of<GradeProvider>(context, listen: false);
+    settings = Provider.of<SettingsProvider>(context, listen: false);
+
+    WidgetsBinding.instance.addPostFrameCallback((timeStamp) {
+      setState(() {
+        animation = true;
+      });
+    });
+  }
+
+  void generateTiles({required int filter}) {
+    List<Subject> subjects = gradeProvider.grades
+        .map((e) => e.subject)
+        .toSet()
+        .toList()
+      ..sort((a, b) => a.name.compareTo(b.name));
+    List<Widget> tiles = [];
+
+    Map<Subject, double> subjectAvgs = {};
+
+    var count = 1;
+
+    for (Subject subject in subjects) {
+      List<Grade> subjectGrades = getSubjectGrades(subject);
+
+      double avg = AverageHelper.averageEvals(subjectGrades);
+      if (avg != 0) subjectAvgs[subject] = avg;
+
+      Widget widget = AnimatedContainer(
+        curve: Curves.easeInOut,
+        duration: Duration(milliseconds: 300 + (count * 120)),
+        transform: Matrix4.translationValues(
+            animation ? 0 : MediaQuery.of(context).size.width, 0, 0),
+        child: Row(
+          children: [
+            GradeValueWidget(
+              GradeValue(avg.round(), '', '', 100),
+              fill: true,
+              size: 28.0,
+            ),
+            const SizedBox(width: 8),
+            Text(
+              subject.renamedTo ?? subject.name.capital(),
+              maxLines: 2,
+              overflow: TextOverflow.ellipsis,
+              style: TextStyle(
+                fontWeight: FontWeight.bold,
+                fontSize: 20.0,
+                color: Colors.white.withOpacity(0.98),
+                fontStyle: settings.renamedSubjectsItalics && subject.isRenamed
+                    ? FontStyle.italic
+                    : null,
+              ),
+            )
+          ],
+        ),
+      );
+
+      if (avg.round() == filter) {
+        tiles.add(widget);
+        count++;
+      }
+    }
+
+    if (tiles.isEmpty) {
+      int index = Random(DateTime.now().minute).nextInt(faces.length);
+      Widget faceWidget = Center(
+        child: Text.rich(
+          TextSpan(
+            text: faces[index],
+            style: const TextStyle(
+              fontSize: 32.0,
+              fontWeight: FontWeight.w500,
+              color: Colors.white,
+            ),
+            children: [
+              TextSpan(
+                text: "\n${'no_grades'.i18n}",
+                style: TextStyle(
+                    fontSize: 18.0,
+                    height: 2.0,
+                    color: Colors.white.withOpacity(0.5)),
+              ),
+            ],
+          ),
+          textAlign: TextAlign.center,
+        ),
+      );
+      tiles.insert(0, faceWidget);
+    }
+
+    subjectAvg = subjectAvgs.isNotEmpty
+        ? subjectAvgs.values.fold(0.0, (double a, double b) => a + b) /
+            subjectAvgs.length
+        : 0.0;
+
+    List<Grade> endYearGrades = gradeProvider.grades
+        .where((grade) => grade.type == GradeType.endYear)
+        .toList();
+    endYearAvg = AverageHelper.averageEvals(endYearGrades, finalAvg: true);
+    endYearAvgText = endYearAvg.toStringAsFixed(1);
+    if (I18n.of(context).locale.languageCode != "en") {
+      endYearAvgText = endYearAvgText.replaceAll(".", ",");
+    }
+
+    if (filter == 5) {
+      subjectTiles5 = List.castFrom(tiles);
+      if (subjectTiles5.length > 4) {
+        subjectTiles5.length = 4;
+      }
+    } else if (filter == 3) {
+      subjectTiles3 = List.castFrom(tiles);
+      if (subjectTiles3.length > 3) {
+        subjectTiles3.length = 3;
+      }
+    } else if (filter == 1) {
+      subjectTiles1 = List.castFrom(tiles);
+      if (subjectTiles1.length > 2) {
+        subjectTiles1.length = 2;
+      }
+    }
+  }
+
+  void getGrades() {
+    generateTiles(filter: 5);
+    generateTiles(filter: 3);
+    generateTiles(filter: 1);
+  }
+
  @override
  Widget build(BuildContext context) {
-    return Column();
+    user = Provider.of<UserProvider>(context);
+    settings = Provider.of<SettingsProvider>(context);
+
+    getGrades();
+
+    return Expanded(
+      child: ListView(
+        children: [
+          SizedBox(
+            height: ((100 * subjectTiles5.length) /
+                    (subjectTiles5[0].runtimeType == AnimatedContainer
+                        ? 1.95
+                        : 1.2))
+                .toDouble(),
+            child: ListView.builder(
+              padding: const EdgeInsets.only(left: 5),
+              physics: const BouncingScrollPhysics(),
+              itemCount: max(subjectTiles5.length, 1),
+              itemBuilder: (context, index) {
+                if (subjectTiles5.isNotEmpty) {
+                  EdgeInsetsGeometry panelPadding =
+                      const EdgeInsets.symmetric(horizontal: 24.0);
+
+                  if (subjectTiles5[index].runtimeType == AnimatedContainer) {
+                    return Padding(
+                        padding: const EdgeInsets.only(top: 8),
+                        child: subjectTiles5[index]);
+                  } else {
+                    return Padding(
+                        padding: panelPadding, child: subjectTiles5[index]);
+                  }
+                } else {
+                  return Container();
+                }
+              },
+            ),
+          ),
+          const SizedBox(height: 12.0),
+          Text(
+            'tryagain'.i18n,
+            style: const TextStyle(
+              fontWeight: FontWeight.bold,
+              fontSize: 22.0,
+              color: Colors.white,
+            ),
+          ),
+          const SizedBox(height: 12.0),
+          SizedBox(
+            height: ((100 * subjectTiles3.length) /
+                    (subjectTiles3[0].runtimeType == AnimatedContainer
+                        ? 1.95
+                        : 1.2))
+                .toDouble(),
+            child: ListView.builder(
+              padding: const EdgeInsets.only(left: 5),
+              physics: const BouncingScrollPhysics(),
+              itemCount: max(subjectTiles3.length, 1),
+              itemBuilder: (context, index) {
+                if (subjectTiles3.isNotEmpty) {
+                  EdgeInsetsGeometry panelPadding =
+                      const EdgeInsets.symmetric(horizontal: 24.0);
+
+                  if (subjectTiles3[index].runtimeType == AnimatedContainer) {
+                    return Padding(
+                        padding: const EdgeInsets.only(top: 8),
+                        child: subjectTiles3[index]);
+                  } else {
+                    return Padding(
+                        padding: panelPadding, child: subjectTiles3[index]);
+                  }
+                } else {
+                  return Container();
+                }
+              },
+            ),
+          ),
+          const SizedBox(height: 12.0),
+          Text(
+            'oops'.i18n,
+            style: const TextStyle(
+              fontWeight: FontWeight.bold,
+              fontSize: 22.0,
+              color: Colors.white,
+            ),
+          ),
+          const SizedBox(height: 12.0),
+          SizedBox(
+            height: ((100 * subjectTiles1.length) /
+                    (subjectTiles1[0].runtimeType == AnimatedContainer
+                        ? 1.95
+                        : 1.2))
+                .toDouble(),
+            child: ListView.builder(
+              padding: const EdgeInsets.only(left: 5),
+              physics: const BouncingScrollPhysics(),
+              itemCount: max(subjectTiles1.length, 1),
+              itemBuilder: (context, index) {
+                if (subjectTiles1.isNotEmpty) {
+                  EdgeInsetsGeometry panelPadding =
+                      const EdgeInsets.symmetric(horizontal: 24.0);
+
+                  if (subjectTiles1[index].runtimeType == AnimatedContainer) {
+                    return Padding(
+                        padding: const EdgeInsets.only(top: 8),
+                        child: subjectTiles1[index]);
+                  } else {
+                    return Padding(
+                        padding: panelPadding, child: subjectTiles1[index]);
+                  }
+                } else {
+                  return Container();
+                }
+              },
+            ),
+          ),
+          const SizedBox(height: 30.0),
+          Center(
+            child: Column(
+              mainAxisAlignment: MainAxisAlignment.center,
+              crossAxisAlignment: CrossAxisAlignment.center,
+              children: [
+                Text(
+                  'endyear_avg'.i18n,
+                  textAlign: TextAlign.center,
+                  style: const TextStyle(
+                    fontWeight: FontWeight.bold,
+                    fontSize: 22.0,
+                    color: Colors.white,
+                  ),
+                ),
+                Container(
+                  margin: const EdgeInsets.only(top: 10.0),
+                  padding: const EdgeInsets.symmetric(
+                      horizontal: 16.0, vertical: 4.0),
+                  decoration: BoxDecoration(
+                    color: gradeColor(context: context, value: endYearAvg)
+                        .withOpacity(.2),
+                    border: Border.all(
+                      color: (gradeColor(context: context, value: endYearAvg))
+                          .withOpacity(0.0),
+                      width: 2.0,
+                    ),
+                    borderRadius: BorderRadius.circular(45.0),
+                  ),
+                  child: AutoSizeText.rich(
+                    TextSpan(
+                      text: endYearAvgText,
+                    ),
+                    maxLines: 1,
+                    minFontSize: 5,
+                    textAlign: TextAlign.center,
+                    style: TextStyle(
+                      color: gradeColor(context: context, value: endYearAvg),
+                      fontWeight: FontWeight.w800,
+                      fontSize: 32.0,
+                    ),
+                  ),
+                ),
+              ],
+            ),
+          ),
+        ],
+      ),
+    );
  }
 }
--- a/filcnaplo_mobile_ui/lib/screens/summary/pages/lessons_page.dart
+++ b/filcnaplo_mobile_ui/lib/screens/summary/pages/lessons_page.dart
@@ -0,0 +1,319 @@
+import 'dart:math';
+
+import 'package:filcnaplo/api/providers/user_provider.dart';
+import 'package:filcnaplo/helpers/subject.dart';
+import 'package:filcnaplo/models/settings.dart';
+import 'package:filcnaplo/utils/format.dart';
+import 'package:filcnaplo_kreta_api/models/absence.dart';
+import 'package:filcnaplo_kreta_api/models/lesson.dart';
+import 'package:filcnaplo_kreta_api/models/subject.dart';
+import 'package:filcnaplo_kreta_api/models/week.dart';
+import 'package:filcnaplo_kreta_api/providers/absence_provider.dart';
+import 'package:filcnaplo_kreta_api/providers/timetable_provider.dart';
+import 'package:filcnaplo_mobile_ui/screens/summary/summary_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+
+List<String> faces = [
+  "(·.·)",
+  "(≥o≤)",
+  "(·_·)",
+  "(˚Δ˚)b",
+  "(^-^*)",
+  "(='X'=)",
+  "(>_<)",
+  "(;-;)",
+  "\\(^Д^)/",
+  "\\(o_o)/",
+];
+
+class SubjectAbsence {
+  Subject subject;
+  List<Absence> absences;
+  double percentage;
+
+  SubjectAbsence(
+      {required this.subject, this.absences = const [], this.percentage = 0.0});
+}
+
+class LessonsBody extends StatefulWidget {
+  const LessonsBody({Key? key}) : super(key: key);
+
+  @override
+  _LessonsBodyState createState() => _LessonsBodyState();
+}
+
+class _LessonsBodyState extends State<LessonsBody> {
+  late UserProvider user;
+  late AbsenceProvider absenceProvider;
+  late SettingsProvider settingsProvider;
+  late TimetableProvider timetableProvider;
+
+  late List<SubjectAbsence> absences = [];
+  late List<Widget> lessons = [];
+  late List<Absence> delays = [];
+  final Map<Subject, Lesson> _lessonCount = {};
+
+  @override
+  void initState() {
+    super.initState();
+
+    absenceProvider = Provider.of<AbsenceProvider>(context, listen: false);
+    settingsProvider = Provider.of<SettingsProvider>(context, listen: false);
+    timetableProvider = Provider.of<TimetableProvider>(context, listen: false);
+
+    WidgetsBinding.instance.addPostFrameCallback((timeStamp) async {
+      for (final lesson in timetableProvider.getWeek(Week.current()) ?? []) {
+        if (!lesson.isEmpty &&
+            lesson.subject.id != '' &&
+            lesson.lessonYearIndex != null) {
+          _lessonCount.update(
+            lesson.subject,
+            (value) {
+              if (lesson.lessonYearIndex! > value.lessonYearIndex!) {
+                return lesson;
+              } else {
+                return value;
+              }
+            },
+            ifAbsent: () => lesson,
+          );
+        }
+      }
+      setState(() {});
+    });
+  }
+
+  void buildSubjectAbsences() {
+    Map<Subject, SubjectAbsence> _absences = {};
+
+    for (final absence in absenceProvider.absences) {
+      if (absence.delay != 0) continue;
+
+      if (!_absences.containsKey(absence.subject)) {
+        _absences[absence.subject] =
+            SubjectAbsence(subject: absence.subject, absences: [absence]);
+      } else {
+        _absences[absence.subject]?.absences.add(absence);
+      }
+    }
+
+    _absences.forEach((subject, absence) {
+      final absentLessonsOfSubject = absenceProvider.absences
+          .where((e) => e.subject == subject && e.delay == 0)
+          .length;
+      final totalLessonsOfSubject = _lessonCount[subject]?.lessonYearIndex ?? 0;
+
+      double absentLessonsOfSubjectPercentage;
+
+      if (absentLessonsOfSubject <= totalLessonsOfSubject) {
+        absentLessonsOfSubjectPercentage =
+            absentLessonsOfSubject / totalLessonsOfSubject * 100;
+      } else {
+        absentLessonsOfSubjectPercentage = -1;
+      }
+
+      _absences[subject]?.percentage =
+          absentLessonsOfSubjectPercentage.clamp(-1, 100.0);
+    });
+
+    absences = _absences.values.toList();
+    absences.sort((a, b) => -a.percentage.compareTo(b.percentage));
+  }
+
+  void getAndSortDelays() {
+    delays = absenceProvider.absences;
+    delays.sort((a, b) => -a.delay.compareTo(b.delay));
+  }
+
+  void generateTiles() {
+    Widget leastAbsent = Center(
+      child: Column(
+        mainAxisAlignment: MainAxisAlignment.center,
+        crossAxisAlignment: CrossAxisAlignment.center,
+        children: [
+          Icon(
+            SubjectIcon.resolveVariant(
+                subject: absences.last.subject, context: context),
+            color: Colors.white,
+            size: 64,
+          ),
+          Text(
+            absences.last.subject.renamedTo ??
+                absences.last.subject.name.capital(),
+            maxLines: 2,
+            overflow: TextOverflow.ellipsis,
+            style: TextStyle(
+              fontWeight: FontWeight.w800,
+              fontSize: 36.0,
+              fontStyle: absences.last.subject.isRenamed &&
+                      settingsProvider.renamedSubjectsItalics
+                  ? FontStyle.italic
+                  : null,
+              color: Colors.white,
+            ),
+          ),
+          Text(
+            'absence'.i18n.fill([absences.last.absences.length]),
+            style: const TextStyle(
+              fontSize: 18.0,
+              color: Colors.white,
+            ),
+          )
+        ],
+      ),
+    );
+    if (absences.last.absences.isNotEmpty) {
+      lessons.add(leastAbsent);
+    } else {
+      lessons.add(buildFaceWidget());
+    }
+
+    Widget mostAbsent = Center(
+      child: Column(
+        mainAxisAlignment: MainAxisAlignment.center,
+        crossAxisAlignment: CrossAxisAlignment.center,
+        children: [
+          Icon(
+            SubjectIcon.resolveVariant(
+                subject: absences.first.subject, context: context),
+            color: Colors.white,
+            size: 64,
+          ),
+          Text(
+            absences.first.subject.renamedTo ??
+                absences.first.subject.name.capital(),
+            maxLines: 2,
+            overflow: TextOverflow.ellipsis,
+            style: TextStyle(
+              fontWeight: FontWeight.w800,
+              fontSize: 36.0,
+              fontStyle: absences.first.subject.isRenamed &&
+                      settingsProvider.renamedSubjectsItalics
+                  ? FontStyle.italic
+                  : null,
+              color: Colors.white,
+            ),
+          ),
+          Text(
+            'absence'.i18n.fill([absences.first.absences.length]),
+            style: const TextStyle(
+              fontSize: 18.0,
+              color: Colors.white,
+            ),
+          )
+        ],
+      ),
+    );
+    if (absences.first.absences.isNotEmpty) {
+      lessons.add(mostAbsent);
+    } else {
+      lessons.add(buildFaceWidget());
+    }
+
+    Widget mostDelays = Center(
+      child: Column(
+        mainAxisAlignment: MainAxisAlignment.center,
+        crossAxisAlignment: CrossAxisAlignment.center,
+        children: [
+          Icon(
+            SubjectIcon.resolveVariant(
+                subject: delays.first.subject, context: context),
+            color: Colors.white,
+            size: 64,
+          ),
+          Text(
+            delays.first.subject.renamedTo ??
+                delays.first.subject.name.capital(),
+            maxLines: 2,
+            overflow: TextOverflow.ellipsis,
+            style: TextStyle(
+              fontWeight: FontWeight.w800,
+              fontSize: 36.0,
+              fontStyle: delays.first.subject.isRenamed &&
+                      settingsProvider.renamedSubjectsItalics
+                  ? FontStyle.italic
+                  : null,
+              color: Colors.white,
+            ),
+          ),
+          Text(
+            'delay'.i18n.fill([delays.first.delay]),
+            style: const TextStyle(
+              fontSize: 18.0,
+              color: Colors.white,
+            ),
+          )
+        ],
+      ),
+    );
+    if (delays.first.delay != 0) {
+      lessons.add(mostDelays);
+    } else {
+      lessons.add(buildFaceWidget());
+    }
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    buildSubjectAbsences();
+    getAndSortDelays();
+    generateTiles();
+
+    return Expanded(
+      child: ListView(
+        children: [
+          lessons[0],
+          const SizedBox(height: 18.0),
+          Text(
+            'dontfelt'.i18n,
+            style: const TextStyle(
+              fontWeight: FontWeight.bold,
+              fontSize: 22.0,
+              color: Colors.white,
+            ),
+          ),
+          const SizedBox(height: 18.0),
+          lessons[1],
+          const SizedBox(height: 18.0),
+          Text(
+            'youlate'.i18n,
+            style: const TextStyle(
+              fontWeight: FontWeight.bold,
+              fontSize: 22.0,
+              color: Colors.white,
+            ),
+          ),
+          const SizedBox(height: 18.0),
+          lessons[2],
+        ],
+      ),
+    );
+  }
+
+  Widget buildFaceWidget() {
+    int index = Random(DateTime.now().minute).nextInt(faces.length);
+    return Center(
+      child: Text.rich(
+        TextSpan(
+          text: faces[index],
+          style: const TextStyle(
+            fontSize: 32.0,
+            fontWeight: FontWeight.w500,
+            color: Colors.white,
+          ),
+          children: [
+            TextSpan(
+              text: "\n${'no_lesson'.i18n}",
+              style: TextStyle(
+                  fontSize: 18.0,
+                  height: 2.0,
+                  color: Colors.white.withOpacity(0.5)),
+            ),
+          ],
+        ),
+        textAlign: TextAlign.center,
+      ),
+    );
+  }
+}
--- a/filcnaplo_mobile_ui/lib/screens/summary/pages/personality_page.dart
+++ b/filcnaplo_mobile_ui/lib/screens/summary/pages/personality_page.dart
@@ -1,10 +1,128 @@
-import 'package:flutter/material.dart';
+import 'dart:io';

-class PersonalityBody extends StatelessWidget {
+import 'package:filcnaplo/api/providers/user_provider.dart';
+import 'package:filcnaplo_mobile_ui/common/personality_card/empty_card.dart';
+import 'package:filcnaplo_mobile_ui/common/personality_card/personality_card.dart';
+import 'package:filcnaplo_mobile_ui/screens/summary/summary_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'package:screenshot/screenshot.dart';
+import 'package:share_plus/share_plus.dart';
+import 'package:path_provider/path_provider.dart';
+import 'package:image_gallery_saver/image_gallery_saver.dart';
+
+class PersonalityBody extends StatefulWidget {
  const PersonalityBody({Key? key}) : super(key: key);

+  @override
+  _PersonalityBodyState createState() => _PersonalityBodyState();
+}
+
+class _PersonalityBodyState extends State<PersonalityBody> {
+  late UserProvider user;
+
+  bool isRevealed = false;
+
+  ScreenshotController screenshotController = ScreenshotController();
+
+  sharePersonality() async {
+    await screenshotController.capture().then((image) async {
+      if (image != null) {
+        final directory = await getApplicationDocumentsDirectory();
+        if (await File('${directory.path}/refilc_personality.png').exists()) {
+          await File('${directory.path}/refilc_personality.png').delete();
+        }
+        final imagePath =
+            await File('${directory.path}/refilc_personality.png').create();
+        await imagePath.writeAsBytes(image);
+
+        await Share.shareXFiles([XFile(imagePath.path)]);
+      }
+    }).catchError((err) {
+      throw err;
+    });
+  }
+
+  savePersonality() async {
+    await screenshotController.capture().then((image) async {
+      if (image != null) {
+        await ImageGallerySaver.saveImage(image, name: 'refilc_personality');
+      }
+    }).catchError((err) {
+      throw err;
+    });
+  }
+
  @override
  Widget build(BuildContext context) {
-    return Column();
+    user = Provider.of<UserProvider>(context);
+
+    return Expanded(
+      child: ListView(
+        children: [
+          const SizedBox(height: 30),
+          AnimatedCrossFade(
+            duration: const Duration(milliseconds: 1000),
+            sizeCurve: Curves.easeInToLinear,
+            firstChild: Screenshot(
+              controller: screenshotController,
+              child: PersonalityCard(user: user),
+            ),
+            secondChild: GestureDetector(
+              onTap: () => setState(() {
+                isRevealed = true;
+              }),
+              child: EmptyCard(text: 'click_reveal'.i18n),
+            ),
+            crossFadeState: isRevealed
+                ? CrossFadeState.showFirst
+                : CrossFadeState.showSecond,
+          ),
+          const SizedBox(height: 30),
+          if (isRevealed)
+            Center(
+              child: Row(
+                mainAxisAlignment: MainAxisAlignment.center,
+                crossAxisAlignment: CrossAxisAlignment.center,
+                children: [
+                  IconButton(
+                    onPressed: () async {
+                      await sharePersonality();
+                    },
+                    icon: const Icon(
+                      FeatherIcons.share,
+                      color: Colors.white,
+                      size: 30,
+                    ),
+                    style: ButtonStyle(
+                      backgroundColor: MaterialStateProperty.all(
+                          Colors.white.withOpacity(0.2)),
+                    ),
+                  ),
+                  const SizedBox(
+                    width: 10,
+                  ),
+                  IconButton(
+                    onPressed: () async {
+                      await savePersonality();
+                    },
+                    icon: const Icon(
+                      FeatherIcons.bookmark,
+                      color: Colors.white,
+                      size: 30,
+                    ),
+                    style: ButtonStyle(
+                      backgroundColor: MaterialStateProperty.all(
+                          Colors.white.withOpacity(0.2)),
+                    ),
+                  ),
+                ],
+              ),
+            ),
+          const SizedBox(height: 60),
+        ],
+      ),
+    );
  }
 }
--- a/filcnaplo_mobile_ui/lib/screens/summary/pages/start_page.dart
+++ b/filcnaplo_mobile_ui/lib/screens/summary/pages/start_page.dart
@@ -0,0 +1,98 @@
+import 'package:filcnaplo/api/providers/user_provider.dart';
+import 'package:filcnaplo/models/settings.dart';
+import 'package:filcnaplo_kreta_api/providers/grade_provider.dart';
+import 'package:filcnaplo_mobile_ui/screens/summary/summary_screen.dart';
+import 'package:filcnaplo_mobile_ui/screens/summary/summary_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'package:wtf_sliding_sheet/wtf_sliding_sheet.dart';
+
+class StartBody extends StatefulWidget {
+  const StartBody({Key? key}) : super(key: key);
+
+  @override
+  _StartBodyState createState() => _StartBodyState();
+}
+
+class _StartBodyState extends State<StartBody> {
+  late UserProvider user;
+  late GradeProvider gradeProvider;
+  late SettingsProvider settings;
+
+  late String firstName;
+
+  @override
+  void initState() {
+    super.initState();
+
+    gradeProvider = Provider.of<GradeProvider>(context, listen: false);
+    settings = Provider.of<SettingsProvider>(context, listen: false);
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.center,
+      mainAxisAlignment: MainAxisAlignment.spaceBetween,
+      children: [
+        const SizedBox(height: 40.0),
+        GestureDetector(
+          onTap: () {
+            Navigator.of(context).pop();
+            showSlidingBottomSheet(
+              context,
+              useRootNavigator: true,
+              builder: (context) => SlidingSheetDialog(
+                color: Colors.black.withOpacity(0.99),
+                duration: const Duration(milliseconds: 400),
+                scrollSpec: const ScrollSpec.bouncingScroll(),
+                snapSpec: const SnapSpec(
+                  snap: true,
+                  snappings: [1.0],
+                  initialSnap: 1.0,
+                  positioning: SnapPositioning.relativeToAvailableSpace,
+                ),
+                minHeight: MediaQuery.of(context).size.height,
+                cornerRadius: 16,
+                cornerRadiusOnFullscreen: 0,
+                builder: (context, state) => const Material(
+                  color: Colors.black,
+                  child: SummaryScreen(
+                    currentPage: 'grades',
+                    isBottomSheet: true,
+                  ),
+                ),
+              ),
+            );
+          },
+          child: Center(
+            child: Column(
+              mainAxisAlignment: MainAxisAlignment.center,
+              crossAxisAlignment: CrossAxisAlignment.center,
+              children: [
+                const Icon(
+                  FeatherIcons.arrowRight,
+                  size: 145,
+                  color: Colors.white,
+                  grade: 0.001,
+                  weight: 0.001,
+                ),
+                Text(
+                  'start'.i18n,
+                  textAlign: TextAlign.center,
+                  style: TextStyle(
+                    fontWeight: FontWeight.w500,
+                    fontSize: 16.0,
+                    color: Colors.white.withOpacity(0.7),
+                  ),
+                ),
+              ],
+            ),
+          ),
+        ),
+        const SizedBox(height: 169.69),
+      ],
+    );
+  }
+}
--- a/filcnaplo_mobile_ui/lib/screens/summary/summary_screen.dart
+++ b/filcnaplo_mobile_ui/lib/screens/summary/summary_screen.dart
@@ -1,17 +1,48 @@
+import 'package:confetti/confetti.dart';
+import 'package:filcnaplo/api/providers/user_provider.dart';
+import 'package:filcnaplo/models/settings.dart';
+import 'package:flutter/cupertino.dart';
 import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'package:wtf_sliding_sheet/wtf_sliding_sheet.dart';
+import 'summary_screen.i18n.dart';
+
+import 'pages/allsum_page.dart';
+import 'pages/start_page.dart';
 import 'pages/grades_page.dart';
+import 'pages/lessons_page.dart';
+import 'pages/personality_page.dart';

 class SummaryScreen extends StatefulWidget {
  final String currentPage;
+  final bool isBottomSheet;

-  const SummaryScreen({Key? key, this.currentPage = 'personality'})
-      : super(key: key);
+  const SummaryScreen({
+    Key? key,
+    this.currentPage = 'personality',
+    this.isBottomSheet = false,
+  }) : super(key: key);

  @override
  _SummaryScreenState createState() => _SummaryScreenState();
+
+  static show(
+          {required BuildContext context,
+          String currentPage = 'personality'}) =>
+      Navigator.of(context, rootNavigator: true).push(CupertinoPageRoute(
+          builder: (context) => SummaryScreen(currentPage: currentPage)));
 }

-class _SummaryScreenState extends State<SummaryScreen> {
+class _SummaryScreenState extends State<SummaryScreen>
+    with SingleTickerProviderStateMixin {
+  late UserProvider user;
+  late SettingsProvider settings;
+
+  ConfettiController? _confettiController;
+
+  late String firstName;
+
  final LinearGradient _backgroundGradient = const LinearGradient(
    colors: [
      Color(0xff1d56ac),
@@ -22,34 +53,170 @@ class _SummaryScreenState extends State<SummaryScreen> {
    stops: [-1.0, 1.0],
  );

+  @override
+  void initState() {
+    super.initState();
+  }
+
+  @override
+  void dispose() {
+    _confettiController?.dispose();
+
+    super.dispose();
+  }
+
  @override
  Widget build(BuildContext context) {
-    return Scaffold(
-      body: Container(
+    user = Provider.of<UserProvider>(context);
+    settings = Provider.of<SettingsProvider>(context);
+
+    List<String> nameParts = user.displayName?.split(" ") ?? ["?"];
+    if (!settings.presentationMode) {
+      firstName = nameParts.length > 1 ? nameParts[1] : nameParts[0];
+    } else {
+      firstName = "János";
+    }
+
+    return widget.isBottomSheet
+        ? buildContainer()
+        : Scaffold(
+            body: buildContainer(),
+          );
+  }
+
+  Widget buildContainer() {
+    return Container(
+      decoration: BoxDecoration(gradient: _backgroundGradient),
+      child: Container(
        decoration: BoxDecoration(gradient: _backgroundGradient),
-        child: Container(
-          decoration: BoxDecoration(gradient: _backgroundGradient),
-          width: MediaQuery.of(context).size.width,
-          height: MediaQuery.of(context).size.height,
-          child: SafeArea(
-            child: Padding(
-              padding: EdgeInsets.only(
-                left: 24.0,
-                right: 24.0,
-                top: 26.0 + MediaQuery.of(context).padding.top,
-                bottom: 52.0,
-              ),
-              child: widget.currentPage == 'grades'
-                  ? const GradesBody()
-                  : widget.currentPage == 'lessons'
-                      ? const GradesBody()
-                      : widget.currentPage == 'allsum'
-                          ? const GradesBody()
-                          : const GradesBody(),
+        width: MediaQuery.of(context).size.width,
+        height: MediaQuery.of(context).size.height,
+        child: SafeArea(
+          child: Padding(
+            padding: const EdgeInsets.only(
+              left: 24.0,
+              right: 24.0,
+              top: 15.0,
+              bottom: 40.0,
+            ),
+            child: Column(
+              crossAxisAlignment: widget.currentPage == 'start'
+                  ? CrossAxisAlignment.center
+                  : CrossAxisAlignment.start,
+              mainAxisAlignment: widget.currentPage == 'start'
+                  ? MainAxisAlignment.spaceBetween
+                  : MainAxisAlignment.start,
+              children: [
+                Row(
+                  mainAxisAlignment: MainAxisAlignment.spaceBetween,
+                  crossAxisAlignment: CrossAxisAlignment.center,
+                  children: [
+                    Expanded(
+                      child: Column(
+                        crossAxisAlignment: CrossAxisAlignment.start,
+                        children: [
+                          Text(
+                            'greeting'.i18n.fill([firstName]),
+                            textAlign: TextAlign.left,
+                            maxLines: 2,
+                            overflow: TextOverflow.ellipsis,
+                            softWrap: true,
+                            style: const TextStyle(
+                              fontWeight: FontWeight.w900,
+                              fontSize: 26.0,
+                              color: Colors.white,
+                            ),
+                          ),
+                          Text(
+                            widget.currentPage == 'start'
+                                ? 'title_start'.i18n
+                                : widget.currentPage == 'grades'
+                                    ? 'title_grades'.i18n
+                                    : widget.currentPage == 'lessons'
+                                        ? 'title_lessons'.i18n
+                                        : widget.currentPage == 'personality'
+                                            ? 'title_personality'.i18n
+                                            : '',
+                            maxLines: 1,
+                            overflow: TextOverflow.fade,
+                            softWrap: false,
+                            style: const TextStyle(
+                              fontWeight: FontWeight.bold,
+                              fontSize: 22.0,
+                              color: Colors.white,
+                            ),
+                          ),
+                        ],
+                      ),
+                    ),
+                    widget.currentPage != 'start'
+                        ? IconButton(
+                            onPressed: () async {
+                              Navigator.of(context).pop();
+                              if (widget.currentPage == 'grades') {
+                                openNewPage(page: 'lessons');
+                              } else if (widget.currentPage == 'lessons') {
+                                openNewPage(page: 'allsum');
+                              } else if (widget.currentPage == 'allsum') {
+                                openNewPage(page: 'personality');
+                              } else {
+                                Navigator.of(context).maybePop();
+                              }
+                            },
+                            icon: Icon(
+                              widget.currentPage == 'personality'
+                                  ? FeatherIcons.x
+                                  : FeatherIcons.arrowRight,
+                              color: Colors.white,
+                            ),
+                          )
+                        : Container()
+                  ],
+                ),
+                const SizedBox(height: 12.0),
+                widget.currentPage == 'start'
+                    ? const StartBody()
+                    : widget.currentPage == 'grades'
+                        ? const GradesBody()
+                        : widget.currentPage == 'lessons'
+                            ? const LessonsBody()
+                            : widget.currentPage == 'allsum'
+                                ? const AllSumBody()
+                                : const PersonalityBody(),
+              ],
            ),
          ),
        ),
      ),
    );
  }
+
+  void openNewPage({String page = 'personality'}) {
+    showSlidingBottomSheet(
+      context,
+      useRootNavigator: true,
+      builder: (context) => SlidingSheetDialog(
+        color: Colors.black.withOpacity(0.99),
+        duration: const Duration(milliseconds: 400),
+        scrollSpec: const ScrollSpec.bouncingScroll(),
+        snapSpec: const SnapSpec(
+          snap: true,
+          snappings: [1.0],
+          initialSnap: 1.0,
+          positioning: SnapPositioning.relativeToAvailableSpace,
+        ),
+        minHeight: MediaQuery.of(context).size.height,
+        cornerRadius: 16,
+        cornerRadiusOnFullscreen: 0,
+        builder: (context, state) => Material(
+          color: Colors.black,
+          child: SummaryScreen(
+            currentPage: page,
+            isBottomSheet: true,
+          ),
+        ),
+      ),
+    );
+    //SummaryScreen.show(context: context, currentPage: page);
+  }
 }
--- a/filcnaplo_mobile_ui/lib/screens/summary/summary_screen.i18n.dart
+++ b/filcnaplo_mobile_ui/lib/screens/summary/summary_screen.i18n.dart
@@ -3,9 +3,111 @@ import 'package:i18n_extension/i18n_extension.dart';
 extension SettingsLocalization on String {
  static final _t = Translations.byLocale("hu_hu") +
      {
-        "en_en": {},
-        "hu_hu": {},
-        "de_de": {},
+        "en_en": {
+          // main thingies
+          "no_grades": "No grades found",
+          "no_lesson": "No lessons found",
+          "greeting": "You had a good year, %s!",
+          "title_start": "So let's summarize...",
+          "title_grades": "Let's look at your marks... 📖",
+          "title_lessons": "Your favorite lesson 💓",
+          "title_personality": "Your personality is...",
+          // start page
+          "start": "Start",
+          // grades page
+          "tryagain": "He puts the master to the test! 🔃",
+          "oops": "Ouch... 🥴",
+          "endyear_avg": "Year-end average",
+          // lessons page
+          "absence": "%s absence(s)",
+          "delay": "A total of %s minute(s) late",
+          "dontfelt": "You didn't like it...",
+          "youlate": "You're late!",
+          // allsum page
+          "test": "test(s)",
+          "closingtest": "module test(s)",
+          "grade": "grades",
+          "hw": "homework",
+          "subject": "subjects",
+          "lesson": "lessons",
+          "absence_sum": "absence(s)",
+          "excused": "excused",
+          "unexcused": "unexcused",
+          "delay_sum": "delay(s)",
+          "min": "minute(s)",
+          // personality page
+          "click_reveal": "Click to reveal...",
+        },
+        "hu_hu": {
+          // main thingies
+          "no_grades": "Nincsenek jegyek",
+          "no_lesson": "Nincsenek tanórák",
+          "greeting": "Jó éved volt, %s!",
+          "title_start": "Összegezzünk hát...",
+          "title_grades": "Nézzük a jegyeidet... 📖",
+          "title_lessons": "A kedvenc órád 💓",
+          "title_personality": "A te személyiséged...",
+          // start page
+          "start": "Kezdés",
+          // grades page
+          "tryagain": "Próba teszi a mestert! 🔃",
+          "oops": "Ajjaj... 🥴",
+          "endyear_avg": "Év végi átlagod",
+          // lessons page
+          "absence": "%s hiányzás",
+          "delay": "Összesen %s perc késés",
+          "dontfelt": "Nem volt kedved hozzá...",
+          "youlate": "Késtél!",
+          // allsum page
+          "test": "dolgozat",
+          "closingtest": "témazáró",
+          "grade": "jegy",
+          "hw": "házi",
+          "subject": "tantárgy",
+          "lesson": "óra",
+          "absence_sum": "hiányzás",
+          "excused": "igazolt",
+          "unexcused": "igazolatlan",
+          "delay_sum": "késés",
+          "min": "perc",
+          // personality page
+          "click_reveal": "Kattints a felfedéshez...",
+        },
+        "de_de": {
+          // main thingies
+          "no_grades": "Keine Grade gefunden",
+          "no_lesson": "Keine Lektionen gefunden",
+          "greeting": "Du hattest ein gutes Jahr, %s!",
+          "title_start": "Fassen wir also zusammen...",
+          "title_grades": "Schauen wir uns eure Tickets an... 📖",
+          "title_lessons": "Deine Lieblingsuhr 💓",
+          "title_personality": "Deine Persönlichkeit...",
+          // start page
+          "start": "Anfang",
+          // grades page
+          "tryagain": "Er stellt den Meister auf die Probe! 🔃",
+          "oops": "Autsch... 🥴",
+          "endyear_avg": "Ihr Jahresenddurchschnitt",
+          // lessons page
+          "absence": "%s Abwesenheit(en)",
+          "delay": "Insgesamt %s Minute(n) zu spät",
+          "dontfelt": "Es hat dir nicht gefallen...",
+          "youlate": "Du bist spät!",
+          // allsum page
+          "test": "These(n)",
+          "closingtest": "Modultest",
+          "grade": "Grad",
+          "hw": "Hausaufgaben",
+          "subject": "Themen",
+          "lesson": "Lektionen",
+          "absence_sum": "Abwesenheit(en)",
+          "excused": "bescheinigte",
+          "unexcused": "unentschuldigte",
+          "delay_sum": "Verzögerung(en)",
+          "min": "Minute(n)",
+          // personality page
+          "click_reveal": "Klicken Sie hier, um es anzuzeigen...",
+        },
      };

  String get i18n => localize(this, _t);
--- a/filcnaplo_mobile_ui/pubspec.yaml
+++ b/filcnaplo_mobile_ui/pubspec.yaml
@@ -39,7 +39,10 @@ dependencies:
  flutter_svg: ^1.1.6
  background_fetch: ^1.1.5
  wtf_sliding_sheet: ^1.0.0
-  package_info_plus: ^3.1.2
+  package_info_plus: ^4.0.2
+  dotted_border: ^2.0.0+3
+  screenshot: ^2.1.0
+  image_gallery_saver: ^2.0.2
  
 dev_dependencies:
  flutter_lints: ^1.0.0
--- a/filcnaplo_premium/lib/ui/mobile/premium/activation_view/activation_dashboard.dart
+++ b/filcnaplo_premium/lib/ui/mobile/premium/activation_view/activation_dashboard.dart
@@ -24,7 +24,8 @@ class _ActivationDashboardState extends State<ActivationDashboard> {
    setState(() {
      manualActivationLoading = true;
    });
-    final result = await context.read<PremiumProvider>().auth.finishAuth(data.text!);
+    final result =
+        await context.read<PremiumProvider>().auth.finishAuth(data.text!);
    setState(() {
      manualActivationLoading = false;
    });
@@ -63,24 +64,27 @@ class _ActivationDashboardState extends State<ActivationDashboard> {
          ),
          const SizedBox(height: 12.0),
          Card(
-            shape: RoundedRectangleBorder(borderRadius: BorderRadius.circular(14.0)),
-            child: Padding(
-              padding: const EdgeInsets.all(20.0),
+            shape: RoundedRectangleBorder(
+                borderRadius: BorderRadius.circular(14.0)),
+            child: const Padding(
+              padding: EdgeInsets.all(20.0),
              child: Column(
                crossAxisAlignment: CrossAxisAlignment.start,
                children: [
                  Row(
-                    children: const [
-                      Icon(FeatherIcons.alertTriangle, size: 20.0, color: Colors.orange),
+                    children: [
+                      Icon(FeatherIcons.alertTriangle,
+                          size: 20.0, color: Colors.orange),
                      SizedBox(width: 12.0),
                      Text(
                        "Figyelem!",
-                        style: TextStyle(fontSize: 18.0, fontWeight: FontWeight.bold),
+                        style: TextStyle(
+                            fontSize: 18.0, fontWeight: FontWeight.bold),
                      ),
                    ],
                  ),
-                  const SizedBox(height: 6.0),
-                  const Text(
+                  SizedBox(height: 6.0),
+                  Text(
                    "Csak akkor érzékeli a Filc a támogatói státuszod, ha nem állítod privátra!",
                    style: TextStyle(fontSize: 16.0),
                  ),
@@ -90,24 +94,27 @@ class _ActivationDashboardState extends State<ActivationDashboard> {
          ),
          const SizedBox(height: 12.0),
          Card(
-            shape: RoundedRectangleBorder(borderRadius: BorderRadius.circular(14.0)),
-            child: Padding(
-              padding: const EdgeInsets.all(20.0),
+            shape: RoundedRectangleBorder(
+                borderRadius: BorderRadius.circular(14.0)),
+            child: const Padding(
+              padding: EdgeInsets.all(20.0),
              child: Column(
                crossAxisAlignment: CrossAxisAlignment.start,
                children: [
                  Row(
-                    children: const [
-                      Icon(FeatherIcons.alertTriangle, size: 20.0, color: Colors.orange),
+                    children: [
+                      Icon(FeatherIcons.alertTriangle,
+                          size: 20.0, color: Colors.orange),
                      SizedBox(width: 12.0),
                      Text(
                        "Figyelem!",
-                        style: TextStyle(fontSize: 18.0, fontWeight: FontWeight.bold),
+                        style: TextStyle(
+                            fontSize: 18.0, fontWeight: FontWeight.bold),
                      ),
                    ],
                  ),
-                  const SizedBox(height: 6.0),
-                  const Text(
+                  SizedBox(height: 6.0),
+                  Text(
                    "Ha friss támogató vagy, 5-10 percbe telhet az aktiválás. Kérlek gyere vissza később, és próbáld újra!",
                    style: TextStyle(fontSize: 16.0),
                  ),
@@ -117,7 +124,8 @@ class _ActivationDashboardState extends State<ActivationDashboard> {
          ),
          const SizedBox(height: 12.0),
          Card(
-            shape: RoundedRectangleBorder(borderRadius: BorderRadius.circular(14.0)),
+            shape: RoundedRectangleBorder(
+                borderRadius: BorderRadius.circular(14.0)),
            child: Padding(
              padding: const EdgeInsets.all(20.0),
              child: Column(
@@ -125,15 +133,20 @@ class _ActivationDashboardState extends State<ActivationDashboard> {
                children: [
                  const Text(
                    "Ha bejelentkezés után nem lép vissza az alkalmazásba automatikusan, aktiváld a támogatásod manuálisan",
-                    style: TextStyle(fontSize: 15.0, fontWeight: FontWeight.w500),
+                    style:
+                        TextStyle(fontSize: 15.0, fontWeight: FontWeight.w500),
                  ),
                  const SizedBox(height: 6.0),
                  Center(
                    child: TextButton.icon(
                      onPressed: onManualActivation,
                      style: ButtonStyle(
-                        foregroundColor: MaterialStatePropertyAll(Theme.of(context).colorScheme.secondary),
-                        overlayColor: MaterialStatePropertyAll(Theme.of(context).colorScheme.secondary.withOpacity(.1)),
+                        foregroundColor: MaterialStatePropertyAll(
+                            Theme.of(context).colorScheme.secondary),
+                        overlayColor: MaterialStatePropertyAll(Theme.of(context)
+                            .colorScheme
+                            .secondary
+                            .withOpacity(.1)),
                      ),
                      icon: manualActivationLoading
                          ? const SizedBox(
@@ -164,8 +177,10 @@ class _ActivationDashboardState extends State<ActivationDashboard> {
                  Navigator.of(context).pop();
                },
                style: ButtonStyle(
-                  foregroundColor: MaterialStatePropertyAll(AppColors.of(context).text),
-                  overlayColor: MaterialStatePropertyAll(AppColors.of(context).text.withOpacity(.1)),
+                  foregroundColor:
+                      MaterialStatePropertyAll(AppColors.of(context).text),
+                  overlayColor: MaterialStatePropertyAll(
+                      AppColors.of(context).text.withOpacity(.1)),
                ),
                icon: const Icon(FeatherIcons.arrowLeft, size: 20.0),
                label: const Text(
--- a/filcnaplo_premium/lib/ui/mobile/settings/modify_subject_names.dart
+++ b/filcnaplo_premium/lib/ui/mobile/settings/modify_subject_names.dart
@@ -22,7 +22,8 @@ import 'package:provider/provider.dart';
 import 'modify_subject_names.i18n.dart';

 class MenuRenamedSubjects extends StatelessWidget {
-  const MenuRenamedSubjects({Key? key, required this.settings}) : super(key: key);
+  const MenuRenamedSubjects({Key? key, required this.settings})
+      : super(key: key);

  final SettingsProvider settings;

@@ -31,8 +32,10 @@ class MenuRenamedSubjects extends StatelessWidget {
    return PanelButton(
      padding: const EdgeInsets.only(left: 14.0),
      onPressed: () {
-        if (!Provider.of<PremiumProvider>(context, listen: false).hasScope(PremiumScopes.renameSubjects)) {
-          PremiumLockedFeatureUpsell.show(context: context, feature: PremiumFeature.subjectrename);
+        if (!Provider.of<PremiumProvider>(context, listen: false)
+            .hasScope(PremiumScopes.renameSubjects)) {
+          PremiumLockedFeatureUpsell.show(
+              context: context, feature: PremiumFeature.subjectrename);
          return;
        }

@@ -42,23 +45,32 @@ class MenuRenamedSubjects extends StatelessWidget {
      },
      title: Text(
        "rename_subjects".i18n,
-        style: TextStyle(color: AppColors.of(context).text.withOpacity(settings.renamedSubjectsEnabled ? 1.0 : .5)),
+        style: TextStyle(
+            color: AppColors.of(context)
+                .text
+                .withOpacity(settings.renamedSubjectsEnabled ? 1.0 : .5)),
      ),
      leading: settings.renamedSubjectsEnabled
          ? const Icon(FeatherIcons.penTool)
-          : Icon(FeatherIcons.penTool, color: AppColors.of(context).text.withOpacity(.25)),
+          : Icon(FeatherIcons.penTool,
+              color: AppColors.of(context).text.withOpacity(.25)),
      trailingDivider: true,
      trailing: Switch(
        onChanged: (v) async {
-          if (!Provider.of<PremiumProvider>(context, listen: false).hasScope(PremiumScopes.renameSubjects)) {
-            PremiumLockedFeatureUpsell.show(context: context, feature: PremiumFeature.subjectrename);
+          if (!Provider.of<PremiumProvider>(context, listen: false)
+              .hasScope(PremiumScopes.renameSubjects)) {
+            PremiumLockedFeatureUpsell.show(
+                context: context, feature: PremiumFeature.subjectrename);
            return;
          }

          settings.update(renamedSubjectsEnabled: v);
-          await Provider.of<GradeProvider>(context, listen: false).convertBySettings();
-          await Provider.of<TimetableProvider>(context, listen: false).convertBySettings();
-          await Provider.of<AbsenceProvider>(context, listen: false).convertBySettings();
+          await Provider.of<GradeProvider>(context, listen: false)
+              .convertBySettings();
+          await Provider.of<TimetableProvider>(context, listen: false)
+              .convertBySettings();
+          await Provider.of<AbsenceProvider>(context, listen: false)
+              .convertBySettings();
        },
        value: settings.renamedSubjectsEnabled,
        activeColor: Theme.of(context).colorScheme.secondary,
@@ -82,11 +94,16 @@ class _ModifySubjectNamesState extends State<ModifySubjectNames> {
  late List<Subject> subjects;
  late UserProvider user;
  late DatabaseProvider dbProvider;
+  late SettingsProvider settings;

  @override
  void initState() {
    super.initState();
-    subjects = Provider.of<GradeProvider>(context, listen: false).grades.map((e) => e.subject).toSet().toList()
+    subjects = Provider.of<GradeProvider>(context, listen: false)
+        .grades
+        .map((e) => e.subject)
+        .toSet()
+        .toList()
      ..sort((a, b) => a.name.compareTo(b.name));
    user = Provider.of<UserProvider>(context, listen: false);
    dbProvider = Provider.of<DatabaseProvider>(context, listen: false);
@@ -101,7 +118,8 @@ class _ModifySubjectNamesState extends State<ModifySubjectNames> {
      context: context,
      builder: (context) => StatefulBuilder(builder: (context, setS) {
        return AlertDialog(
-          shape: const RoundedRectangleBorder(borderRadius: BorderRadius.all(Radius.circular(14.0))),
+          shape: const RoundedRectangleBorder(
+              borderRadius: BorderRadius.all(Radius.circular(14.0))),
          title: Text("rename_subject".i18n),
          content: Column(
            mainAxisSize: MainAxisSize.min,
@@ -161,13 +179,18 @@ class _ModifySubjectNamesState extends State<ModifySubjectNames> {
                    border: Border.all(color: Colors.grey, width: 2),
                    borderRadius: BorderRadius.circular(12.0),
                  ),
-                  padding: const EdgeInsets.symmetric(vertical: 12.0, horizontal: 8.0),
+                  padding: const EdgeInsets.symmetric(
+                      vertical: 12.0, horizontal: 8.0),
                  child: Text(
-                    selectedSubjectId == null ? "select_subject".i18n : subjects.firstWhere((element) => element.id == selectedSubjectId).name,
-                    style: Theme.of(context)
-                        .textTheme
-                        .titleSmall!
-                        .copyWith(fontWeight: FontWeight.w700, color: AppColors.of(context).text.withOpacity(0.75)),
+                    selectedSubjectId == null
+                        ? "select_subject".i18n
+                        : subjects
+                            .firstWhere(
+                                (element) => element.id == selectedSubjectId)
+                            .name,
+                    style: Theme.of(context).textTheme.titleSmall!.copyWith(
+                        fontWeight: FontWeight.w700,
+                        color: AppColors.of(context).text.withOpacity(0.75)),
                    overflow: TextOverflow.ellipsis,
                    maxLines: 2,
                    textAlign: TextAlign.center,
@@ -182,11 +205,13 @@ class _ModifySubjectNamesState extends State<ModifySubjectNames> {
                controller: _subjectName,
                decoration: InputDecoration(
                  border: OutlineInputBorder(
-                    borderSide: const BorderSide(color: Colors.grey, width: 1.5),
+                    borderSide:
+                        const BorderSide(color: Colors.grey, width: 1.5),
                    borderRadius: BorderRadius.circular(12.0),
                  ),
                  focusedBorder: OutlineInputBorder(
-                    borderSide: const BorderSide(color: Colors.grey, width: 1.5),
+                    borderSide:
+                        const BorderSide(color: Colors.grey, width: 1.5),
                    borderRadius: BorderRadius.circular(12.0),
                  ),
                  contentPadding: const EdgeInsets.symmetric(horizontal: 12.0),
@@ -226,10 +251,14 @@ class _ModifySubjectNamesState extends State<ModifySubjectNames> {
                  final renamedSubs = await fetchRenamedSubjects();

                  renamedSubs[selectedSubjectId!] = _subjectName.text;
-                  await dbProvider.userStore.storeRenamedSubjects(renamedSubs, userId: user.id!);
-                  await Provider.of<GradeProvider>(context, listen: false).convertBySettings();
-                  await Provider.of<TimetableProvider>(context, listen: false).convertBySettings();
-                  await Provider.of<AbsenceProvider>(context, listen: false).convertBySettings();
+                  await dbProvider.userStore
+                      .storeRenamedSubjects(renamedSubs, userId: user.id!);
+                  await Provider.of<GradeProvider>(context, listen: false)
+                      .convertBySettings();
+                  await Provider.of<TimetableProvider>(context, listen: false)
+                      .convertBySettings();
+                  await Provider.of<AbsenceProvider>(context, listen: false)
+                      .convertBySettings();
                }
                Navigator.of(context).pop(true);
                setState(() {});
@@ -246,6 +275,7 @@ class _ModifySubjectNamesState extends State<ModifySubjectNames> {

  @override
  Widget build(BuildContext context) {
+    settings = Provider.of<SettingsProvider>(context);
    return Scaffold(
        key: _scaffoldKey,
        appBar: AppBar(
@@ -262,6 +292,15 @@ class _ModifySubjectNamesState extends State<ModifySubjectNames> {
            child: Column(
              crossAxisAlignment: CrossAxisAlignment.start,
              children: [
+                Panel(
+                  child: SwitchListTile(
+                      title: Text("italics_toggle".i18n),
+                      onChanged: (value) => settings.update(renamedSubjectsItalics: value),
+                      value: settings.renamedSubjectsItalics,),
+                ),
+                const SizedBox(
+                  height: 20,
+                ),
                InkWell(
                  onTap: showRenameDialog,
                  borderRadius: BorderRadius.circular(12.0),
@@ -271,7 +310,8 @@ class _ModifySubjectNamesState extends State<ModifySubjectNames> {
                      border: Border.all(color: Colors.grey, width: 2),
                      borderRadius: BorderRadius.circular(12.0),
                    ),
-                    padding: const EdgeInsets.symmetric(vertical: 18.0, horizontal: 12.0),
+                    padding: const EdgeInsets.symmetric(
+                        vertical: 18.0, horizontal: 12.0),
                    child: Center(
                      child: Text(
                        "rename_new_subject".i18n,
@@ -290,14 +330,17 @@ class _ModifySubjectNamesState extends State<ModifySubjectNames> {
                FutureBuilder<Map<String, String>>(
                  future: fetchRenamedSubjects(),
                  builder: (context, snapshot) {
-                    if (!snapshot.hasData || snapshot.data!.isEmpty) return Container();
+                    if (!snapshot.hasData || snapshot.data!.isEmpty) {
+                      return Container();
+                    }

                    return Panel(
                      title: Text("renamed_subjects".i18n),
                      child: Column(
                        children: snapshot.data!.keys.map(
                          (key) {
-                            Subject? subject = subjects.firstWhere((element) => key == element.id);
+                            Subject? subject = subjects
+                                .firstWhere((element) => key == element.id);
                            String renameTo = snapshot.data![key]!;
                            return RenamedSubjectItem(
                              subject: subject,
@@ -311,9 +354,12 @@ class _ModifySubjectNamesState extends State<ModifySubjectNames> {
                              },
                              removeCallback: () {
                                setState(() {
-                                  Map<String, String> subs = Map.from(snapshot.data!);
+                                  Map<String, String> subs =
+                                      Map.from(snapshot.data!);
                                  subs.remove(key);
-                                  dbProvider.userStore.storeRenamedSubjects(subs, userId: user.id!);
+                                  dbProvider.userStore.storeRenamedSubjects(
+                                      subs,
+                                      userId: user.id!);
                                });
                              },
                            );
@@ -349,11 +395,14 @@ class RenamedSubjectItem extends StatelessWidget {
    return ListTile(
      minLeadingWidth: 32.0,
      dense: true,
-      contentPadding: const EdgeInsets.symmetric(horizontal: 16.0, vertical: 6.0),
+      contentPadding:
+          const EdgeInsets.symmetric(horizontal: 16.0, vertical: 6.0),
      shape: RoundedRectangleBorder(borderRadius: BorderRadius.circular(8.0)),
      visualDensity: VisualDensity.compact,
      onTap: () {},
-      leading: Icon(SubjectIcon.resolveVariant(subject: subject, context: context), color: AppColors.of(context).text.withOpacity(.75)),
+      leading: Icon(
+          SubjectIcon.resolveVariant(subject: subject, context: context),
+          color: AppColors.of(context).text.withOpacity(.75)),
      title: InkWell(
        onTap: modifyCallback,
        child: Column(
@@ -361,7 +410,10 @@ class RenamedSubjectItem extends StatelessWidget {
          children: [
            Text(
              subject.name.capital(),
-              style: TextStyle(fontWeight: FontWeight.w500, fontSize: 14, color: AppColors.of(context).text.withOpacity(.75)),
+              style: TextStyle(
+                  fontWeight: FontWeight.w500,
+                  fontSize: 14,
+                  color: AppColors.of(context).text.withOpacity(.75)),
              maxLines: 1,
              overflow: TextOverflow.ellipsis,
            ),
@@ -376,7 +428,8 @@ class RenamedSubjectItem extends StatelessWidget {
      ),
      trailing: InkWell(
        onTap: removeCallback,
-        child: Icon(FeatherIcons.trash, color: AppColors.of(context).red.withOpacity(.75)),
+        child: Icon(FeatherIcons.trash,
+            color: AppColors.of(context).red.withOpacity(.75)),
      ),
    );
  }
--- a/filcnaplo_premium/lib/ui/mobile/settings/modify_subject_names.i18n.dart
+++ b/filcnaplo_premium/lib/ui/mobile/settings/modify_subject_names.i18n.dart
@@ -13,6 +13,7 @@ extension SettingsLocalization on String {
          "cancel": "Cancel",
          "done": "Done",
          "rename_new_subject": "Rename New Subject",
+          "italics_toggle": "Toggle Italics",
        },
        "hu_hu": {
          "renamed_subjects": "Átnevezett Tantárgyaid",
@@ -24,6 +25,7 @@ extension SettingsLocalization on String {
          "cancel": "Mégse",
          "done": "Kész",
          "rename_new_subject": "Új Tantárgy átnevezése",
+          "italics_toggle": "Dőlt betűs megjelenítés",
        },
        "de_de": {
          "renamed_subjects": "Umbenannte Fächer",
@@ -35,6 +37,7 @@ extension SettingsLocalization on String {
          "cancel": "Abbrechen",
          "done": "Erledigt",
          "rename_new_subject": "Neues Fach umbenennen",
+          "italics_toggle": "Kursivschrift umschalten",
        },
      };

--- a/filcnaplo_premium/lib/ui/mobile/timetable/fs_timetable_button.dart
+++ b/filcnaplo_premium/lib/ui/mobile/timetable/fs_timetable_button.dart
@@ -9,11 +9,15 @@ import 'package:flutter/material.dart';
 import 'package:flutter/services.dart';
 import 'package:flutter_feather_icons/flutter_feather_icons.dart';
 import 'package:provider/provider.dart';
+import 'package:filcnaplo_mobile_ui/pages/timetable/timetable_page.i18n.dart';

 class PremiumFSTimetableButton extends StatelessWidget {
-  const PremiumFSTimetableButton({Key? key, required this.controller}) : super(key: key);
+  const PremiumFSTimetableButton(
+      {Key? key, required this.controller, required this.tabcontroller})
+      : super(key: key);

  final TimetableController controller;
+  final TabController tabcontroller;

  @override
  Widget build(BuildContext context) {
@@ -22,19 +26,32 @@ class PremiumFSTimetableButton extends StatelessWidget {
      child: IconButton(
        splashRadius: 24.0,
        onPressed: () {
-          if (!Provider.of<PremiumProvider>(context, listen: false).hasScope(PremiumScopes.fsTimetable)) {
-            PremiumLockedFeatureUpsell.show(context: context, feature: PremiumFeature.weeklytimetable);
+          if (!Provider.of<PremiumProvider>(context, listen: false)
+              .hasScope(PremiumScopes.fsTimetable)) {
+            PremiumLockedFeatureUpsell.show(
+                context: context, feature: PremiumFeature.weeklytimetable);
+            return;
+          }
+
+          // If timetable empty, show empty
+          if (tabcontroller.length == 0) {
+            ScaffoldMessenger.of(context).showSnackBar(SnackBar(
+              content: Text("empty_timetable".i18n),
+              duration: const Duration(seconds: 2),
+            ));
            return;
          }

          Navigator.of(context, rootNavigator: true)
              .push(PageRouteBuilder(
-            pageBuilder: (context, animation, secondaryAnimation) => PremiumFSTimetable(
+            pageBuilder: (context, animation, secondaryAnimation) =>
+                PremiumFSTimetable(
              controller: controller,
            ),
          ))
              .then((_) {
-            SystemChrome.setPreferredOrientations([DeviceOrientation.portraitUp]);
+            SystemChrome.setPreferredOrientations(
+                [DeviceOrientation.portraitUp]);
            setSystemChrome(context);
          });
        },
Author	SHA1	Message	Date
kima	9d9f99a955	fixed long subject names in grades summary	2023-06-25 14:55:01 +02:00
kima	2c5939fab4	fixed misaligned text on final sum page	2023-06-25 14:50:54 +02:00
kima	95ed503e53	fixed 0 min delay thingies	2023-06-25 14:47:06 +02:00
kima	51e2c63134	fixed navigation and ui bugs in summary	2023-06-25 14:36:18 +02:00
kima	50bc03f403	updated version string	2023-06-25 00:11:44 +02:00
kima	f5bc16ba42	created translation for personality card	2023-06-24 23:58:06 +02:00
kima	f4501ce251	finished translation for summary	2023-06-24 21:41:18 +02:00
kima	3317472773	fixed end-year average	2023-06-23 11:20:18 +02:00
kima	acdd47a49a	fixed style bug and added reveal check to buttons	2023-06-23 01:17:26 +02:00
kima	fa8be89aaf	fixed some issues and added gallery save feature	2023-06-23 01:06:48 +02:00
kima	5034af2fb4	finished animations and started reveal/share	2023-06-23 00:54:56 +02:00
kima	87842de421	finished personality card style	2023-06-22 23:33:28 +02:00
kima	1f46a0509f	fixed summary crash error	2023-06-22 21:55:57 +02:00
kima	8e9713e436	almost finished personality page	2023-06-22 21:12:34 +02:00
kima	fe0a7d81ae	finished personalities map	2023-06-22 20:52:45 +02:00
kima	f9e14349b7	Merge branch 'master' of github.com:refilc/naplo	2023-06-22 19:44:09 +02:00
kima	a1f087758f	started summary personality page	2023-06-22 19:15:02 +02:00
kima	4068abdb95	finished final summary style and fixed thingies	2023-06-22 16:45:57 +02:00
kima	9314c613bc	added lessons/misses page and final summary page	2023-06-22 15:59:57 +02:00
Márton Kiss	458e93e19f	Merge pull request #25 from Monke14/master fix italics toggle bugs	2023-06-20 17:44:42 +02:00
hihihaha	ba8d26d250	fix italics toggle bugs	2023-06-20 16:19:49 +02:00
Márton Kiss	33e3495d9f	Merge pull request #23 from Monke14/master fix high network usage	2023-06-20 10:28:27 +02:00
Márton Kiss	f71e72e443	Merge pull request #24 from PredatorPotatoX/master Contribution guide update	2023-06-20 10:26:28 +02:00
hihihaha	c615a33bd2	make variable private	2023-06-19 22:34:53 +02:00
PredatorPotatoX	7ad0ea26e2	Contributing guide update	2023-06-19 21:04:32 +02:00
hihihaha	0ad663beb3	fix network activity	2023-06-18 17:36:01 +02:00
kima	1366984c15	added start page to summary	2023-06-17 21:30:48 +02:00
kima	62d3895373	added next page button to summary	2023-06-17 20:41:30 +02:00
kima	3579c4e821	fixed grades page ui in summary	2023-06-17 20:04:11 +02:00
Kima	5c39865d40	commit	2023-06-17 16:37:24 +02:00
Kima	551b2849fe	grade page done in summary	2023-06-16 01:30:17 +02:00
Márton Kiss	ce1c5eb0d8	fixed nonce login error	2023-06-15 09:33:36 +02:00
Márton Kiss	d929c804df	Merge pull request #21 from TMarccci/master LiveActivity	2023-06-14 23:53:17 +02:00
Tihanyi Marcell	19c128eecd	LiveActivity	2023-06-14 23:46:21 +02:00
kima	57cf764804	updated version string	2023-06-14 23:08:54 +02:00
kima	ea812e0b67	fixed project problems	2023-06-13 23:37:35 +02:00
kima	1c517a99f2	fixed project problems	2023-06-13 23:37:25 +02:00
kima	2687cb146b	gitignore changes	2023-06-13 23:35:11 +02:00
kima	1a9080dcc2	added event functionality and summary to livecard	2023-06-13 23:27:40 +02:00
Márton Kiss	580c92b13d	Merge pull request #20 from TMarccci/master On empty timetable block fullscreen mode.	2023-06-13 21:10:04 +02:00
Tihanyi Marcell	ae4c4aa89c	Merge branch 'refilc:master' into master	2023-06-12 21:54:47 +02:00
Tihanyi Marcell	ded7c51f44	Block empty fullscreen timetable	2023-06-12 21:54:13 +02:00
Márton Kiss	485e85ddaa	Merge pull request #19 from TMarccci/master Fixes	2023-06-12 20:26:48 +02:00
Márton Kiss	3c0082a786	Merge pull request #18 from CroatianHusky/master Developer Settings i18n + Notifications toggle color fix	2023-06-12 20:25:28 +02:00
Tihanyi Marcell	c474512088	Live Activity version update, build-ipa.sh	2023-06-12 20:11:15 +02:00
Tihanyi Marcell	f78a542be2	iOS notification permission fix	2023-06-12 20:09:48 +02:00
Tihanyi Marcell	131454b99d	Notification Capabilitie	2023-06-12 20:09:27 +02:00
Tihanyi Marcell	e255182b93	Removed " " from login	2023-06-12 20:09:11 +02:00
Tihanyi Marcell	3857896d6c	Ghost Grade title overflow fix	2023-06-12 20:08:53 +02:00
CroatianHusky	301e8cb638	Updated settings_screen.i18n.dart	2023-06-12 17:35:13 +02:00
CroatianHusky	ae7c724f65	notification toggle color fix	2023-06-12 17:33:00 +02:00
CroatianHusky	751cd04ce2	developer settings i18n	2023-06-12 17:14:42 +02:00
Márton Kiss	a88ccfa3fc	Merge pull request #15 from Monke14/notifications Értesítések	2023-06-10 22:47:03 +02:00
Márton Kiss	9e914974b7	Merge branch 'master' into notifications	2023-06-10 22:46:40 +02:00
Kima	9cfa8296b8	fixed some bugs	2023-06-10 22:38:01 +02:00
hihihaha	27ef942723	fix headless task	2023-06-10 21:46:53 +02:00
hihihaha	fe03554fbf	backend changes	2023-06-10 21:19:49 +02:00
hihihaha	8c2227df73	update design	2023-06-10 21:03:01 +02:00
hihihaha	0274c2f070	start on boot	2023-06-10 20:43:03 +02:00
hihihaha	8f85c6a33b	add timeout safety to headless task	2023-06-10 20:41:31 +02:00
hihihaha	cf81ca8207	add annotation to function	2023-06-10 20:39:06 +02:00
hihihaha	07bbafe7dd	add toggle for notifications in settings	2023-06-10 20:34:01 +02:00
hihihaha	3eee2c7a55	set grade as seen	2023-06-10 19:55:40 +02:00
hihihaha	1cdde3b6ce	add notification	2023-06-10 19:50:32 +02:00
Márton Kiss	67aea46c06	Update navigation_screen.dart	2023-06-10 13:59:03 +02:00
Márton Kiss	7adec7dfa5	maybe fixed dark mode bug	2023-06-10 13:57:11 +02:00
Kima	95fa819ed2	updatet things in pubspec	2023-06-10 13:26:28 +02:00
Kima	1e87d344e2	fixed versions in pubspec	2023-06-10 11:25:24 +02:00
Márton Kiss	9223375304	Merge pull request #11 from CroatianHusky/master "Új jegyek" többesszám fix + verzió "v?" fix	2023-06-10 11:10:04 +02:00
Márton Kiss	bb862f15bd	Merge pull request #10 from PredatorPotatoX/master CONTRIBUTING.md link fix	2023-06-10 11:09:46 +02:00
CroatianHusky	261c94e9bb	fixed version counter "v?"	2023-06-10 10:38:26 +02:00
CroatianHusky	06016514e5	new grade plurality fix	2023-06-10 09:32:21 +02:00
CroatianHusky	cead24b65a	removed dead filc links from pubspec	2023-06-10 09:29:44 +02:00
PredatorPotatoX	6eaab57468	CONTRIBUTING.md link fix	2023-06-09 23:31:29 +02:00
Márton Kiss	5852fc233d	Update AndroidManifest.xml	2023-06-09 21:15:25 +02:00
Márton Kiss	d7e21f6332	Update update_helper.dart	2023-06-09 21:13:38 +02:00
Márton Kiss	c78b8d3b97	Merge pull request #9 from Monke14/bug-fixes Dőlt betűk toggle	2023-06-09 20:15:31 +02:00
hihihaha	940e3d8ca1	add toggle for italics	2023-06-09 17:29:03 +02:00