fixed long subject names in grades summary

fix italics toggle bugs

CONTRIBUTING.md

@@ -1,39 +1,36 @@
 
-# Hozzájárulási útmutató
+# Contribution guide
 Köszönjük, ha programozással segíted a munkánkat!
-A folytatáshoz szükséged lesz egy Linuxot vagy Windowst futtató számítógépre, minimális programozási tapasztalatra és egy kis angoltudásra.
-Segít, ha nem csak kicsit tudsz programozni, és ha ismered a Gitet és a GitHubot ;)
+A folytatáshoz szükséged lesz egy Linux-ot vagy Windows-t futtató számítógépre, minimális programozási tapasztalatra és egy kis angoltudásra.
+Segít, ha már gyakorlottabb vagy a programozásban, és ha ismered a [Git](https://git-scm.com/) és a [GitHub](https://github.com/) működését. ;)
 
 ## Miben segítsek?
-Kérünk, **olyan dologgal járulj hozzá** a reFilchez, ami valószínűleg **sok embernek hasznos lesz** majd. Szeretnénk egy minél teljeskörűbb iskolai asszisztenst létrehozni, de az iskolaspecifikus, vagy külön neked hasznos funkciók helye inkább legyen a saját forkod.
+Kérünk, **olyan dologgal járulj hozzá** a **reFilc**hez, ami valószínűleg **sok embernek hasznos lehet**. Szeretnénk egy minél teljeskörűbb iskolai asszisztenst létrehozni, de az iskolaspecifikus, vagy külön neked hasznos funkciók helye inkább legyen a saját Fork-od.
 
-Fontos, hogy **mielőtt egy nagy volumenű projektbe belekezdesz, futtasd meg ötletedet a [Discord szerverünkön](https://dc.refilc.hu/),** ahol még azelőtt tudunk tanácsot adni, mielőtt sok-sok órát beleöltél volna egy esetleg felesleges dologba.
+Fontos, hogy **mielőtt egy nagyobb méretű projektbe belekezdenél, futtasd meg ötletedet a [Discord szerverünkön](https://dc.refilc.hu/)**, ahol még azelőtt tudunk tanácsot adni, hogy sok-sok órát beleöltél volna egy esetleg felesleges dologba.
 
-A legjobban annak örülünk, ha az [Issues](https://github.com/refilc/naplo/issues) oldalról szemezgetsz, **ha lehet, a [help wanted taggel megjelöltekkel kezdd](https://github.com/refilc/naplo/issues?q=is%3Aissue+is%3Aopen+label%3A%22help+wanted%22),** vagy ha új vagy a Flutterhez, ajánljuk figyelmedbe [ezeket a viszonylag könnyen javítható hibákat](https://github.com/refilc/naplo/issues?q=is%3Aopen+is%3Aissue+label%3A%22good+first+issue%22) (ha épp van ilyen).
+A legjobban annak örülünk, ha az [Issues](https://github.com/refilc/naplo/issues) oldalról szemezgetsz. Ha még új vagy a Flutterben, ajánljuk figyelmedbe ezeket a [viszonylag könnyen javítható hibákat](https://github.com/refilc/naplo/issues?q=is%3Aopen+is%3Aissue+label%3A%22good+first+issue%22), ha éppen van ilyen.
 
 ## Hogyan segítsek?
+Nem ígérhetünk itt sem programozás-, sem Git-kurzust, de a projektspecifikus dolgokat leírjuk, és segítünk a Flutter telepítésében.
 
-Nem ígérhetünk itt sem programozás-, sem git-kurzust, de a projektspecifikus dolgokat leírjuk, és segítünk a Flutter feltelepítésében.
+A **reFilc** a Google által pár éve létrehozott **[Flutter](https://flutter.dev/)** keretrendszert használja, aminek nyelve a **[Dart](https://dart.dev/)**. Ha ismered a C#, Java, C++, vagy egyéb hasonló programnyelvek működését, **nem fog nagy gondot okozni a használata.** A felhasználói felület létrehozásában az is segíthet, ha foglalkoztál már korábban weboldalakkal vagy alkalmazásfejlesztéssel.
+Ha még nem használtad a Flutter-t, mindenképp böngészd át a [YouTube csatornájukat](https://www.youtube.com/channel/UCwXdFgeE9KYzlDdR7TG9cMw).
+Kód vagy UI teszteléséhez Flutter telepítése nélkül is használhatod a [DartPad](https://dartpad.dev/)-et.
 
-A reFilc a Google által pár éve létrehozott **[Fluttert](https://flutter.dev/)** használja, aminek nyelve a **[Dart](https://dart.dev/)**. Ha ismered a C#-ot, Javát, C++t, vagy egyéb hasonló nyelvet, **nem fog gondot okozni a használata.** A felhasználói felület létrehozásában az is segíthet, ha foglalkoztál már korábban weboldalakkal.
-Ha még nem használtál Fluttert, mindenképp böngészd át a [YouTube csatornájukat](https://www.youtube.com/channel/UCwXdFgeE9KYzlDdR7TG9cMw).
-Könnyen tudsz kódot, vagy akár UI-t is tesztelni a [DartPad](https://dartpad.dev/) oldalon.
+#### [Segítség a Flutter telepítéséhez](https://docs.flutter.dev/get-started/install)
+**Használd a Flutter stable verzióját!** Írd be a terminálba: `flutter channel stable`
 
-#### [Segítség a Flutter telepítéséhez és a forráskód futtatásához](https://docs.flutter.dev/get-started/install)
-Fontos: **Legyél a flutter beta verzióján!** Írd be: `flutter channel beta`
+Ha nem értessz a Git-hez vagy a GitHub-hoz, ajánljuk figyelmedbe [ezt a cikket](https://medium.com/envienta-magyarorsz%C3%A1g/git-%C3%A9s-github-gyorstalpal%C3%B3-f2d78a732deb), viszont arra kérünk, hogy a használatukat ne a **reFilc**en próbáld ki először. Hozz létre egy saját Repo-t és abban tesztelgess. Ha már nagyjából kitapasztaltad, várjuk hozzájárulásodat.
 
-
-
-Ha nem értesz a Githez, ajánljuk figyelmedbe [ezt a cikket](https://medium.com/envienta-magyarorsz%C3%A1g/git-%C3%A9s-github-gyorstalpal%C3%B3-f2d78a732deb). Viszont arra kérünk, a Git használatát ne a reFilcen próbáld ki először, hozz létre előbb egy saját Repót, és abba tesztelgess. Ha már nagyjából kitapasztaltad, várjuk hozzájárulásodat.
-
-Készíts egy forkot a saját fiókod alá.
-A reFilc legfrissebb, épp fejlesztés alatt álló verzióját a [master branch](https://github.com/refilc/naplo/tree/master)-en találod, kérjük ide commitolj, és ide célozd a forkodból a Pull Requested. Írd le benne, mit változtattál, és ha lehet, csatolj képernyőképet is.
-Minél gyakrabban készíts minél részletesebben elnevezett commitokat, hogy el tudjunk tájékozódni az általad beküldött kódon.
+Készíts egy Fork-ot a saját GitHub fiókod alá.
+A **reFilc** legfrissebb, **épp fejlesztés alatt álló verzióját a [master branch](https://github.com/refilc/naplo/tree/master)-en találod**. Kérjük ide Commit-olj és ide célozd a Fork-odból a Pull Request-edet. Írd le benne, hogy mit változtattál és ha lehet, csatolj képernyőképet is.
+Minél gyakrabban készíts minél részletesebben elnevezett Commit-okat, hogy mások is el tudjanak igazodni az általad beküldött kódban.
 
 ---
 
-Az általad fejlesztett funkciók mellé a changelogban odakerül GitHub felhasználóneved.
-Ha jelentős és rendszeres hozzájáruló vagy, Discordon megkapod a `DEV` rangot.
+Az általad fejlesztett funkciók mellé a Changelog-ba odakerül a GitHub felhasználóneved.
+Ha jelentős és rendszeres hozzájáruló vagy, Discord-on megkaphatod a `DEV` rangot.
 
-Ha bárhol elakadtál, keress minket Discordon.
-Jó fejlesztést kívánunk!
+Ha bárhol elakadtál vagy kérdésed van, keress bátran Discordon!
+**Jó fejlesztést kívánunk!**

README.md

@@ -5,7 +5,7 @@
 
 #### Nem hivatalos e-napló alkalmazás az eKRÉTA rendszerhez - tanulóktól, tanulóknak.
 
-[![Downloads](https://img.shields.io/github/downloads-pre/refilc/naplo/total?color=%23&label=Downloads&logo=github&sort=semver)](https://github.com/refilc/naplo/releases)   [![discord](https://img.shields.io/discord/1111649116020285532?label=Discord)](http://dc.refilc.hu)
+[![Downloads](https://img.shields.io/github/downloads-pre/refilc/naplo/total?&logo=github&label=Downloads)](https://github.com/refilc/naplo/releases)   [![Discord](https://img.shields.io/discord/1111649116020285532?logo=discord&label=Discord)](https://dc.refilc.hu)
 
 ## Setup
 
@@ -29,11 +29,13 @@ flutter run
 
 ### Contribution
 
+**Nézd meg a [Contribution guide](CONTRIBUTING.md)-ot!**
+
 Az összes (ugyan azon verzióhoz tartozó) contribution meg fog jelenni a release-nél. Kérjük, írd le a Discord nevedet a Description-be, hogy adhassunk rangot.
 
 -------
 
-# Kudo
+# Developers
 
 **annon:** a Filc napló készítője (ez az app a Filcen alapul)
 

filcnaplo/ios/Flutter/Generated 3.xcconfig

@@ -0,0 +1,15 @@
+// This is a generated file; do not edit or check into version control.
+FLUTTER_ROOT=/Users/kima/development/flutter
+FLUTTER_APPLICATION_PATH=/Users/kima/Documents/refilc/app/naplo/filcnaplo
+COCOAPODS_PARALLEL_CODE_SIGN=true
+FLUTTER_TARGET=/Users/kima/Documents/refilc/app/naplo/filcnaplo/lib/main.dart
+FLUTTER_BUILD_DIR=build
+FLUTTER_BUILD_NAME=4.1.0
+FLUTTER_BUILD_NUMBER=213
+EXCLUDED_ARCHS[sdk=iphonesimulator*]=i386
+EXCLUDED_ARCHS[sdk=iphoneos*]=armv7
+DART_DEFINES=RkxVVFRFUl9XRUJfQVVUT19ERVRFQ1Q9dHJ1ZQ==,RkxVVFRFUl9XRUJfQ0FOVkFTS0lUX1VSTD1odHRwczovL3d3dy5nc3RhdGljLmNvbS9mbHV0dGVyLWNhbnZhc2tpdC8yYTM0MDFjOWJiYjVhOWE5YWVjNzRkNGY3MzVkMThhOWRkM2ViZjJkLw==
+DART_OBFUSCATION=false
+TRACK_WIDGET_CREATION=true
+TREE_SHAKE_ICONS=false
+PACKAGE_CONFIG=/Users/kima/Documents/refilc/app/naplo/filcnaplo/.dart_tool/package_config.json

filcnaplo/ios/Flutter/flutter_export_environment 2.sh

@@ -0,0 +1,14 @@
+#!/bin/sh
+# This is a generated file; do not edit or check into version control.
+export "FLUTTER_ROOT=/Users/kima/development/flutter"
+export "FLUTTER_APPLICATION_PATH=/Users/kima/Documents/refilc/app/naplo/filcnaplo"
+export "COCOAPODS_PARALLEL_CODE_SIGN=true"
+export "FLUTTER_TARGET=/Users/kima/Documents/refilc/app/naplo/filcnaplo/lib/main.dart"
+export "FLUTTER_BUILD_DIR=build"
+export "FLUTTER_BUILD_NAME=4.1.0"
+export "FLUTTER_BUILD_NUMBER=213"
+export "DART_DEFINES=RkxVVFRFUl9XRUJfQVVUT19ERVRFQ1Q9dHJ1ZQ==,RkxVVFRFUl9XRUJfQ0FOVkFTS0lUX1VSTD1odHRwczovL3d3dy5nc3RhdGljLmNvbS9mbHV0dGVyLWNhbnZhc2tpdC8yYTM0MDFjOWJiYjVhOWE5YWVjNzRkNGY3MzVkMThhOWRkM2ViZjJkLw=="
+export "DART_OBFUSCATION=false"
+export "TRACK_WIDGET_CREATION=true"
+export "TREE_SHAKE_ICONS=false"
+export "PACKAGE_CONFIG=/Users/kima/Documents/refilc/app/naplo/filcnaplo/.dart_tool/package_config.json"

filcnaplo/ios/Runner.xcodeproj/project.pbxproj

@@ -488,7 +488,7 @@
 					"@executable_path/Frameworks",
 				);
 				MARKETING_VERSION = 3.6.0;
-				PRODUCT_BUNDLE_IDENTIFIER = com.refilc.naplo;
+				PRODUCT_BUNDLE_IDENTIFIER = com.refilctest.naplo;
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				SWIFT_OBJC_BRIDGING_HEADER = "Runner/Runner-Bridging-Header.h";
 				SWIFT_VERSION = 5.0;
@@ -526,7 +526,7 @@
 				MARKETING_VERSION = 1.0;
 				MTL_ENABLE_DEBUG_INFO = INCLUDE_SOURCE;
 				MTL_FAST_MATH = YES;
-				PRODUCT_BUNDLE_IDENTIFIER = com.refilc.naplo.livecardpro;
+				PRODUCT_BUNDLE_IDENTIFIER = com.refilctest.naplo.livecardpro;
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				PROVISIONING_PROFILE_SPECIFIER = "";
 				SKIP_INSTALL = YES;
@@ -567,7 +567,7 @@
 				);
 				MARKETING_VERSION = 1.0;
 				MTL_FAST_MATH = YES;
-				PRODUCT_BUNDLE_IDENTIFIER = com.refilc.naplo.livecardpro;
+				PRODUCT_BUNDLE_IDENTIFIER = com.refilctest.naplo.livecardpro;
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				PROVISIONING_PROFILE_SPECIFIER = "";
 				SKIP_INSTALL = YES;
@@ -607,7 +607,7 @@
 				);
 				MARKETING_VERSION = 1.0;
 				MTL_FAST_MATH = YES;
-				PRODUCT_BUNDLE_IDENTIFIER = com.refilc.naplo.livecardpro;
+				PRODUCT_BUNDLE_IDENTIFIER = com.refilctest.naplo.livecardpro;
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				PROVISIONING_PROFILE_SPECIFIER = "";
 				SKIP_INSTALL = YES;
@@ -746,7 +746,7 @@
 					"@executable_path/Frameworks",
 				);
 				MARKETING_VERSION = 3.6.0;
-				PRODUCT_BUNDLE_IDENTIFIER = com.refilc.naplo;
+				PRODUCT_BUNDLE_IDENTIFIER = com.refilctest.naplo;
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				SWIFT_OBJC_BRIDGING_HEADER = "Runner/Runner-Bridging-Header.h";
 				SWIFT_OPTIMIZATION_LEVEL = "-Onone";
@@ -774,7 +774,7 @@
 					"@executable_path/Frameworks",
 				);
 				MARKETING_VERSION = 3.6.0;
-				PRODUCT_BUNDLE_IDENTIFIER = com.refilc.naplo;
+				PRODUCT_BUNDLE_IDENTIFIER = com.refilctest.naplo;
 				PRODUCT_NAME = "$(TARGET_NAME)";
 				SWIFT_OBJC_BRIDGING_HEADER = "Runner/Runner-Bridging-Header.h";
 				SWIFT_VERSION = 5.0;

filcnaplo/ios/Runner/Runner.entitlements

@@ -2,8 +2,6 @@
 <!DOCTYPE plist PUBLIC "-//Apple//DTD PLIST 1.0//EN" "http://www.apple.com/DTDs/PropertyList-1.0.dtd">
 <plist version="1.0">
 <dict>
-	<key>aps-environment</key>
-	<string>development</string>
 	<key>com.apple.security.application-groups</key>
 	<array>
 		<string>group.refilcnaplo.livecard</string>

filcnaplo/ios/livecard/Info.plist

@@ -7,7 +7,5 @@
 		<key>NSExtensionPointIdentifier</key>
 		<string>com.apple.widgetkit-extension</string>
 	</dict>
-	<key>NSSupportsLiveActivities</key>
-    <true/>
 </dict>
 </plist>

filcnaplo/lib/api/login.dart

@@ -54,6 +54,12 @@ Future loginApi({
     "content-type": "application/x-www-form-urlencoded",
   };
   
+  String nonceStr = await Provider.of<KretaClient>(context, listen: false)
+      .getAPI(KretaAPI.nonce, json: false);
+  
+  Nonce nonce = getNonce(nonceStr, username, instituteCode);
+  headers.addAll(nonce.header());
+
   Map? res = await Provider.of<KretaClient>(context, listen: false)
       .postAPI(KretaAPI.login,
           headers: headers,

filcnaplo/lib/api/providers/live_card_provider.dart

@@ -40,6 +40,8 @@ class LiveCardProvider extends ChangeNotifier {
   String? _latestActivityId;
   Map<String, String> _lastActivity = {};
 
+  bool _hasCheckedTimetable = false;
+
   LiveCardProvider({
     required TimetableProvider timetable,
     required SettingsProvider settings,
@@ -198,7 +200,8 @@ class LiveCardProvider extends ChangeNotifier {
 
     List<Lesson> today = _today(_timetable);
 
-    if (today.isEmpty) {
+    if (today.isEmpty && !_hasCheckedTimetable) {
+      _hasCheckedTimetable = true;
       await _timetable.fetch(week: Week.current());
       today = _today(_timetable);
     }
@@ -252,7 +255,10 @@ class LiveCardProvider extends ChangeNotifier {
       }
     }
 
-    if (currentLesson != null) {
+    if (now.isBefore(DateTime(now.year, DateTime.august, 31)) &&
+        now.isAfter(DateTime(now.year, DateTime.june, 14))) {
+      currentState = LiveCardState.summary;
+    } else if (currentLesson != null) {
       currentState = LiveCardState.duringLesson;
     } else if (nextLesson != null && prevLesson != null) {
       currentState = LiveCardState.duringBreak;

filcnaplo/lib/models/personality.dart

@@ -0,0 +1,21 @@
+class Personality {
+  PersonalityType type;
+
+  Personality({
+    this.type = PersonalityType.npc,
+  });
+}
+
+enum PersonalityType {
+  geek,
+  sick,
+  late,
+  quitter,
+  healthy,
+  acceptable,
+  fallible,
+  average,
+  diligent,
+  cheater,
+  npc
+}

filcnaplo/lib/models/settings.dart

@@ -194,7 +194,7 @@ class SettingsProvider extends ChangeNotifier {
       premiumLogin: map["premium_login"],
       lastAccountId: map["last_account_id"],
       renameSubjectsEnabled: map["renamed_subjects_enabled"] == 1,
-      renameSubjectsItalics: map["renamed_subjects_italics"] == 0,
+      renameSubjectsItalics: map["renamed_subjects_italics"] == 1,
     );
   }
 

filcnaplo/pubspec.yaml

@@ -3,7 +3,7 @@ description: "Nem hivatalos e-napló alkalmazás az e-Kréta rendszerhez"
 homepage: https://refilc.hu
 publish_to: "none"
 
-version: 4.1.0+213
+version: 4.1.1+215
 
 environment:
   sdk: ">=2.17.0 <3.0.0"
@@ -65,6 +65,7 @@ dependencies:
   background_fetch: ^1.1.5
   flutter_local_notifications: ^14.1.0
   package_info_plus: ^4.0.2
+  screenshot: ^2.1.0
 
 dev_dependencies:
   flutter_lints: ^2.0.1

filcnaplo_mobile_ui/lib/common/empty.dart

@@ -23,7 +23,6 @@ class Empty extends StatelessWidget {
 
   @override
   Widget build(BuildContext context) {
-    // make the face randomness a bit more constant (to avoid strokes)
     int index = Random(DateTime.now().minute).nextInt(faces.length);
 
     return Center(
@@ -32,9 +31,19 @@ class Empty extends StatelessWidget {
         child: Text.rich(
           TextSpan(
             text: faces[index],
-            style: TextStyle(fontSize: 32.0, fontWeight: FontWeight.w500, color: AppColors.of(context).text.withOpacity(.75)),
+            style: TextStyle(
+                fontSize: 32.0,
+                fontWeight: FontWeight.w500,
+                color: AppColors.of(context).text.withOpacity(.75)),
             children: subtitle != null
-                ? [TextSpan(text: "\n" + subtitle!, style: TextStyle(fontSize: 18.0, height: 2.0, color: AppColors.of(context).text.withOpacity(.5)))]
+                ? [
+                    TextSpan(
+                        text: "\n" + subtitle!,
+                        style: TextStyle(
+                            fontSize: 18.0,
+                            height: 2.0,
+                            color: AppColors.of(context).text.withOpacity(.5)))
+                  ]
                 : [],
           ),
           textAlign: TextAlign.center,

filcnaplo_mobile_ui/lib/common/personality_card/empty_card.dart

@@ -0,0 +1,68 @@
+import 'package:dotted_border/dotted_border.dart';
+import 'package:flutter/material.dart';
+
+class EmptyCard extends StatefulWidget {
+  const EmptyCard({
+    Key? key,
+    required this.text,
+  }) : super(key: key);
+
+  final String text;
+
+  @override
+  State<EmptyCard> createState() => _EmptyCardState();
+}
+
+class _EmptyCardState extends State<EmptyCard> {
+  bool hold = false;
+
+  @override
+  void initState() {
+    super.initState();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return GestureDetector(
+      onLongPressDown: (_) => setState(() => hold = true),
+      onLongPressEnd: (_) => setState(() => hold = false),
+      onLongPressCancel: () => setState(() => hold = false),
+      child: AnimatedScale(
+        scale: hold ? 1.018 : 1.0,
+        curve: Curves.easeInOutBack,
+        duration: const Duration(milliseconds: 300),
+        child: Container(
+          height: 444,
+          padding:
+              const EdgeInsets.only(top: 12, bottom: 12, left: 12, right: 12),
+          decoration: BoxDecoration(
+            color: const Color(0x280008FF),
+            borderRadius: const BorderRadius.all(Radius.circular(5)),
+            boxShadow: [
+              BoxShadow(
+                color: Colors.black.withOpacity(0.08),
+                offset: const Offset(0, 5),
+                blurRadius: 20,
+                spreadRadius: 10,
+              ),
+            ],
+          ),
+          child: DottedBorder(
+            color: Colors.black.withOpacity(0.9),
+            dashPattern: const [12, 12],
+            padding:
+                const EdgeInsets.only(top: 20, bottom: 20, left: 20, right: 20),
+            child: Center(
+              child: Text(
+                widget.text,
+                style: TextStyle(
+                  color: Colors.white.withOpacity(0.9),
+                ),
+              ),
+            ),
+          ),
+        ),
+      ),
+    );
+  }
+}

filcnaplo_mobile_ui/lib/common/personality_card/personality_card.dart

@@ -0,0 +1,374 @@
+import 'package:dotted_border/dotted_border.dart';
+import 'package:filcnaplo/api/providers/user_provider.dart';
+import 'package:filcnaplo/helpers/average_helper.dart';
+import 'package:filcnaplo/models/settings.dart';
+import 'package:filcnaplo/models/personality.dart';
+import 'package:filcnaplo_kreta_api/models/absence.dart';
+import 'package:filcnaplo_kreta_api/models/grade.dart';
+import 'package:filcnaplo_kreta_api/models/lesson.dart';
+import 'package:filcnaplo_kreta_api/models/subject.dart';
+import 'package:filcnaplo_kreta_api/models/week.dart';
+import 'package:filcnaplo_kreta_api/providers/absence_provider.dart';
+import 'package:filcnaplo_kreta_api/providers/grade_provider.dart';
+import 'package:filcnaplo_kreta_api/providers/timetable_provider.dart';
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+
+import 'personality_card.i18n.dart';
+
+class PersonalityCard extends StatefulWidget {
+  const PersonalityCard({
+    Key? key,
+    required this.user,
+  }) : super(key: key);
+
+  final UserProvider user;
+
+  @override
+  State<PersonalityCard> createState() => _PersonalityCardState();
+}
+
+class _PersonalityCardState extends State<PersonalityCard> {
+  late GradeProvider gradeProvider;
+  late AbsenceProvider absenceProvider;
+  late TimetableProvider timetableProvider;
+  late SettingsProvider settings;
+
+  late List<int> subjectAvgsList = [];
+  late Map<Subject, double> subjectAvgs = {};
+  late double subjectAvg;
+  late List<Grade> classWorkGrades;
+  late Map<int, int> mostCommonGrade;
+  late List<Absence> absences = [];
+  final Map<Subject, Lesson> _lessonCount = {};
+  late int totalDelays;
+  late int unexcusedAbsences;
+
+  late PersonalityType finalPersonality;
+
+  bool hold = false;
+
+  List<Grade> getSubjectGrades(Subject subject, {int days = 0}) => gradeProvider
+      .grades
+      .where((e) =>
+          e.subject == subject &&
+          e.type == GradeType.midYear &&
+          (days == 0 ||
+              e.date.isBefore(DateTime.now().subtract(Duration(days: days)))))
+      .toList();
+
+  @override
+  void initState() {
+    super.initState();
+
+    gradeProvider = Provider.of<GradeProvider>(context, listen: false);
+    absenceProvider = Provider.of<AbsenceProvider>(context, listen: false);
+    timetableProvider = Provider.of<TimetableProvider>(context, listen: false);
+    settings = Provider.of<SettingsProvider>(context, listen: false);
+
+    WidgetsBinding.instance.addPostFrameCallback((timeStamp) async {
+      for (final lesson in timetableProvider.getWeek(Week.current()) ?? []) {
+        if (!lesson.isEmpty &&
+            lesson.subject.id != '' &&
+            lesson.lessonYearIndex != null) {
+          _lessonCount.update(
+            lesson.subject,
+            (value) {
+              if (lesson.lessonYearIndex! > value.lessonYearIndex!) {
+                return lesson;
+              } else {
+                return value;
+              }
+            },
+            ifAbsent: () => lesson,
+          );
+        }
+      }
+      setState(() {});
+    });
+  }
+
+  void getGrades() {
+    List<Subject> subjects = gradeProvider.grades
+        .map((e) => e.subject)
+        .toSet()
+        .toList()
+      ..sort((a, b) => a.name.compareTo(b.name));
+
+    for (Subject subject in subjects) {
+      List<Grade> subjectGrades = getSubjectGrades(subject);
+
+      double avg = AverageHelper.averageEvals(subjectGrades);
+      if (avg != 0) subjectAvgs[subject] = avg;
+
+      subjectAvgsList.add(avg.round());
+    }
+
+    subjectAvg = subjectAvgs.isNotEmpty
+        ? subjectAvgs.values.fold(0.0, (double a, double b) => a + b) /
+            subjectAvgs.length
+        : 0.0;
+
+    classWorkGrades =
+        gradeProvider.grades.where((a) => a.value.weight <= 75).toList();
+  }
+
+  void getMostCommonGrade() {
+    Map<int, int> counts = {};
+
+    subjectAvgsList.map((e) {
+      if (counts.containsKey(e)) {
+        counts.update(e, (value) => value++);
+      } else {
+        counts[e] = 1;
+      }
+    });
+
+    var maxValue = 0;
+    var maxKey = 0;
+
+    counts.forEach((k, v) {
+      if (v > maxValue) {
+        maxValue = v;
+        maxKey = k;
+      }
+    });
+
+    mostCommonGrade = {maxKey: maxValue};
+  }
+
+  void getAbsences() {
+    absences = absenceProvider.absences.where((a) => a.delay == 0).toList();
+
+    unexcusedAbsences = absences
+        .where((a) => a.state == Justification.unexcused && a.delay == 0)
+        .length;
+  }
+
+  void getAndSortDelays() {
+    Iterable<int> unexcusedDelays = absences
+        .where((a) => a.state == Justification.unexcused && a.delay > 0)
+        .map((e) => e.delay);
+    totalDelays = unexcusedDelays.isNotEmpty
+        ? unexcusedDelays.reduce((a, b) => a + b)
+        : 0;
+  }
+
+  void doEverything() {
+    getGrades();
+    getMostCommonGrade();
+    getAbsences();
+    getAndSortDelays();
+  }
+
+  void getPersonality() {
+    if (settings.goodStudent) {
+      finalPersonality = PersonalityType.cheater;
+    } else if (subjectAvg > 4.7) {
+      finalPersonality = PersonalityType.geek;
+    } else if (mostCommonGrade.keys.toList()[0] == 1 &&
+        mostCommonGrade.values.toList()[0] > 1) {
+      finalPersonality = PersonalityType.fallible;
+    } else if (absences.length < 10) {
+      finalPersonality = PersonalityType.healthy;
+    } else if (unexcusedAbsences >= 10) {
+      finalPersonality = PersonalityType.quitter;
+    } else if (totalDelays > 50) {
+      finalPersonality = PersonalityType.late;
+    } else if (absences.length >= 100) {
+      finalPersonality = PersonalityType.sick;
+    } else if (mostCommonGrade.keys.toList()[0] == 2) {
+      finalPersonality = PersonalityType.acceptable;
+    } else if (mostCommonGrade.keys.toList()[0] == 3) {
+      finalPersonality = PersonalityType.average;
+    } else if (classWorkGrades.length >= 5) {
+      finalPersonality = PersonalityType.diligent;
+    } else {
+      finalPersonality = PersonalityType.npc;
+    }
+  }
+
+  Widget cardInnerBuilder() {
+    Map<PersonalityType, Map<String, String>> personality = {
+      PersonalityType.geek: {
+        'emoji': '🤓',
+        'title': 't_geek',
+        'description': 'd_geek',
+        'subtitle': 's_geek',
+        'subvalue': subjectAvg.toStringAsFixed(2),
+      },
+      PersonalityType.sick: {
+        'emoji': '🤒',
+        'title': 't_sick',
+        'description': 'd_sick',
+        'subtitle': 's_sick',
+        'subvalue': absences.length.toString(),
+      },
+      PersonalityType.late: {
+        'emoji': '⌛',
+        'title': 't_late',
+        'description': 'd_late',
+        'subtitle': 's_late',
+        'subvalue': totalDelays.toString(),
+      },
+      PersonalityType.quitter: {
+        'emoji': '❓',
+        'title': 't_quitter',
+        'description': 'd_quitter',
+        'subtitle': 's_quitter',
+        'subvalue': unexcusedAbsences.toString(),
+      },
+      PersonalityType.healthy: {
+        'emoji': '😷',
+        'title': 't_healthy',
+        'description': 'd_healthy',
+        'subtitle': 's_healthy',
+        'subvalue': absences.length.toString(),
+      },
+      PersonalityType.acceptable: {
+        'emoji': '🤏',
+        'title': 't_acceptable',
+        'description': 'd_acceptable',
+        'subtitle': 's_acceptable',
+        'subvalue': mostCommonGrade.values.toList()[0].toString(),
+      },
+      PersonalityType.fallible: {
+        'emoji': '📉',
+        'title': 't_fallible',
+        'description': 'd_fallible',
+        'subtitle': 's_fallible',
+        'subvalue': mostCommonGrade.values.toList()[0].toString(),
+      },
+      PersonalityType.average: {
+        'emoji': '👌',
+        'title': 't_average',
+        'description': 'd_average',
+        'subtitle': 's_average',
+        'subvalue': mostCommonGrade.values.toList()[0].toString(),
+      },
+      PersonalityType.diligent: {
+        'emoji': '💫',
+        'title': 't_diligent',
+        'description': 'd_diligent',
+        'subtitle': 's_diligent',
+        'subvalue': classWorkGrades.length.toString(),
+      },
+      PersonalityType.cheater: {
+        'emoji': '‍🧑‍💻',
+        'title': 't_cheater',
+        'description': 'd_cheater',
+        'subtitle': 's_cheater',
+        'subvalue': '0',
+      },
+      PersonalityType.npc: {
+        'emoji': '⛰️',
+        'title': 't_npc',
+        'description': 'd_npc',
+        'subtitle': 's_npc',
+        'subvalue': '69420',
+      }
+    };
+
+    Map<PersonalityType, Widget> personalityWidgets = {};
+
+    for (var i in personality.keys) {
+      Widget w = Column(
+        mainAxisAlignment: MainAxisAlignment.center,
+        crossAxisAlignment: CrossAxisAlignment.center,
+        children: [
+          Text(
+            personality[i]?['emoji'] ?? '❓',
+            textAlign: TextAlign.center,
+            style: const TextStyle(
+              fontSize: 128.0,
+              height: 1.2,
+            ),
+          ),
+          Text(
+            (personality[i]?['title'] ?? 'unknown').i18n,
+            textAlign: TextAlign.center,
+            style: const TextStyle(
+              fontSize: 38.0,
+              color: Colors.white,
+              fontWeight: FontWeight.w800,
+            ),
+          ),
+          const SizedBox(height: 5),
+          Text(
+            (personality[i]?['description'] ?? 'unknown_personality').i18n,
+            textAlign: TextAlign.start,
+            style: TextStyle(
+              fontSize: 16,
+              height: 1.2,
+              color: Colors.white.withOpacity(0.8),
+            ),
+          ),
+          const SizedBox(height: 25),
+          Text(
+            (personality[i]?['subtitle'] ?? 'unknown').i18n,
+            textAlign: TextAlign.center,
+            style: const TextStyle(
+              fontSize: 20.0,
+              color: Colors.white,
+              fontWeight: FontWeight.bold,
+            ),
+          ),
+          Text(
+            personality[i]?['subvalue'] ?? '0',
+            textAlign: TextAlign.center,
+            style: const TextStyle(
+              fontSize: 69.0,
+              height: 1.15,
+              color: Colors.white,
+              fontWeight: FontWeight.w800,
+            ),
+          ),
+        ],
+      );
+
+      personalityWidgets.addAll({i: w});
+    }
+
+    return personalityWidgets[finalPersonality] ?? Container();
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    doEverything();
+    getPersonality();
+
+    return GestureDetector(
+      onLongPressDown: (_) => setState(() => hold = true),
+      onLongPressEnd: (_) => setState(() => hold = false),
+      onLongPressCancel: () => setState(() => hold = false),
+      child: AnimatedScale(
+        scale: hold ? 1.018 : 1.0,
+        curve: Curves.easeInOutBack,
+        duration: const Duration(milliseconds: 300),
+        child: Container(
+          padding:
+              const EdgeInsets.only(top: 12, bottom: 12, left: 12, right: 12),
+          decoration: BoxDecoration(
+            color: const Color(0x280008FF),
+            borderRadius: const BorderRadius.all(Radius.circular(5)),
+            boxShadow: [
+              BoxShadow(
+                color: Colors.black.withOpacity(0.08),
+                offset: const Offset(0, 5),
+                blurRadius: 20,
+                spreadRadius: 10,
+              ),
+            ],
+          ),
+          child: DottedBorder(
+            color: Colors.black.withOpacity(0.9),
+            dashPattern: const [12, 12],
+            padding:
+                const EdgeInsets.only(top: 20, bottom: 20, left: 20, right: 20),
+            child: cardInnerBuilder(),
+          ),
+        ),
+      ),
+    );
+  }
+}

filcnaplo_mobile_ui/lib/common/personality_card/personality_card.i18n.dart

@@ -0,0 +1,154 @@
+import 'package:i18n_extension/i18n_extension.dart';
+
+extension Localization on String {
+  static final _t = Translations.byLocale("hu_hu") +
+      {
+        "en_en": {
+          // main
+          "unknown": "???",
+          "unknown_personality": "Unknown personality...",
+          // personalities
+          "t_geek": "Know-It-All",
+          "d_geek":
+              "You learn a lot, but don't worry - Being a know-it-all is a blessing in disguise. You'll be successful in life.",
+          "s_geek": "Year-end average",
+          "t_sick": "Sick",
+          "d_sick":
+              "Get well soon, bro. Even if you lied about being sick to skip school.",
+          "s_sick": "Absences",
+          "t_late": "Late",
+          "d_late":
+              "The tram's wheel got punctured. The airplane was derailed. Your dog ate your shoe. We believe you.",
+          "s_late": "Delays (minutes)",
+          "t_quitter": "Skipper",
+          "d_quitter": "Supplementary exam incoming.",
+          "s_quitter": "Igazolatlan hiányzások",
+          "t_healthy": "Healthy",
+          "d_healthy":
+              "As cool as a cucumber! You almost never missed a class.",
+          "s_healthy": "Absences",
+          "t_acceptable": "Acceptable",
+          "d_acceptable":
+              "Final exams are D. But who cares? It's still a grade. Not a good one, but it's definitely a grade.",
+          "s_acceptable": "D's",
+          "t_fallible": "Failed",
+          "d_fallible": "Good luck next year.",
+          "s_fallible": "F's",
+          "t_average": "It's okay",
+          "d_average": "Not good, not bad. The golden mean, if you will...",
+          "s_average": "C's",
+          "t_diligent": "Hard-worker",
+          "d_diligent":
+              "You noted everything, you made that presentation, and you lead the group project.",
+          "s_diligent": "Class work A's",
+          "t_cheater": "Cheater",
+          "d_cheater":
+              "You enabled the \"Good Student\" mode. Wow. You may have outsmarted me, but I have outsmarted your outsmarting.",
+          "s_cheater": "Bitches",
+          "t_npc": "NPC",
+          "d_npc":
+              "You're such a non-player character, we couldn't give you a personality.",
+          "s_npc": "In-game playtime (hours)",
+        },
+        "hu_hu": {
+          // main
+          "unknown": "???",
+          "unknown_personality": "Ismeretlen személyiség...",
+          // personalities
+          "t_geek": "Stréber",
+          "d_geek":
+              "Sokat tanulsz, de ezzel semmi baj! Ez egyben áldás és átok, de legalább az életben sikeres leszel.",
+          "s_geek": "Év végi átlagod",
+          "t_sick": "Beteges",
+          "d_sick":
+              "Jobbulást, tesó. Még akkor is, ha hazudtál arról, hogy beteg vagy, hogy ne kelljen suliba menned.",
+          "s_sick": "Hiányzásaid",
+          "t_late": "Késős",
+          "d_late":
+              "Kilyukadt a villamos kereke. Kisiklott a repülő. A kutyád megette a cipőd. Elhisszük.",
+          "s_late": "Késések (perc)",
+          "t_quitter": "Lógós",
+          "d_quitter": "Osztályzóvizsga incoming.",
+          "s_quitter": "Igazolatlan hiányzások",
+          "t_healthy": "Makk",
+          "d_healthy":
+              "...egészséges vagy! Egész évben alig hiányoztál az iskolából.",
+          "s_healthy": "Hiányzásaid",
+          "t_acceptable": "Elmegy",
+          "d_acceptable":
+              "A kettes érettségi is érettségi. Nem egy jó érettségi, de biztos, hogy egy érettségi.",
+          "s_acceptable": "Kettesek",
+          "t_fallible": "Bukós",
+          "d_fallible": "Jövőre több sikerrel jársz.",
+          "s_fallible": "Karók",
+          "t_average": "Közepes",
+          "d_average": "Se jó, se rossz. Az arany középút, ha akarsz...",
+          "s_average": "Hármasok",
+          "t_diligent": "Szorgalmas",
+          "d_diligent":
+              "Leírtad a jegyzetet, megcsináltad a prezentációt, és te vezetted a projektmunkát.",
+          "s_diligent": "Órai munka ötösök",
+          "t_cheater": "Csaló",
+          "d_cheater":
+              "Bekapcsoltad a “Jó Tanuló” módot. Wow. Azt hitted, túl járhatsz az eszemen, de kijátszottam a kijátszásod.",
+          "s_cheater": "Bitches",
+          "t_npc": "NPC",
+          "d_npc":
+              "Egy akkora nagy non-player character vagy, hogy neked semmilyen személyiség nem jutott ezen kívül.",
+          "s_npc": "In-game playtime (óra)",
+        },
+        "de_de": {
+          // main
+          "unknown": "???",
+          "unknown_personality": "Unbekannte Persönlichkeit...",
+          // personalities
+          "t_geek": "Besserwisser",
+          "d_geek":
+              "Du lernst eine Menge, aber sorge dich nicht - ein Besserwisser zu sein wird sich letzten Endes doch als Segen erweisen. Du wirst erfolgreich sein im Leben.",
+          "s_geek": "Durchschnittsschüler",
+          "t_sick": "Krank",
+          "d_sick":
+              "Werd schnell wieder gesund, Brudi. Selbst wenn du gelogen hast, nur um Schule zu schwänzen zu können.",
+          "s_sick": "Abwesenheiten",
+          "t_late": "Verspätet",
+          "d_late":
+              "Die Straßenbahn hat eine Reifenpanne. Das Flugzeug ist entgleist. Dein Hund hat deinen Schuh gefressen. Klar, wir glauben dir.",
+          "s_late": "Verspätung (Minuten)",
+          "t_quitter": "Schulschwänzer",
+          "d_quitter": "Ein zusätzlicher Test wird anstehen.",
+          "s_quitter": "Unentschuldigte Abwesenheiten",
+          "t_healthy": "Gesund",
+          "d_healthy":
+              "Du bist die Ruhe selbst! Du hast fast nie eine Unterrichtsstunde verpasst.",
+          "s_healthy": "Abwesenheiten",
+          "t_acceptable": "Akzeptabel",
+          "d_acceptable":
+              "Die Abschlussprüfungen waren gerade einmal eine 4. Aber wen juckt's? Es ist immer noch positiv. Nicht allzu gut, aber definitiv positiv.",
+          "s_acceptable": "4er",
+          "t_fallible": "Durchgefallen",
+          "d_fallible": "Viel Glück im nächsten Jahr.",
+          "s_fallible": "5er",
+          "t_average": "Es ist in Ordnung",
+          "d_average":
+              "Nicht gut, nicht schlecht. Der goldene Durchschnitt, wenn du so willst...",
+          "s_average": "3er",
+          "t_diligent": "Ein Fleißiger",
+          "d_diligent":
+              "Du hast bei allem mitgeschrieben, du hast den Vortrag gehalten, und du hast die Gruppenarbeit geleitet.",
+          "s_diligent": "1er Schüler",
+          "t_cheater": "Geschummelt",
+          "d_cheater":
+              "Du hast den „Guter Schüler“ Modus aktiviert. Wow. Du magst mich zwar vielleicht überlistet haben, aber ich habe deine Überlistung überlistet.",
+          "s_cheater": "Bitches",
+          "t_npc": "COM",
+          "d_npc":
+              "Du bist einfach so sehr wie ein Computer, dass wir dir nicht einmal eine Persönlichkeit geben konnten.",
+          "s_npc": "Spielzeit (Stunden)",
+        }
+      };
+
+  String get i18n => localize(this, _t);
+  String fill(List<Object> params) => localizeFill(this, params);
+  String plural(int value) => localizePlural(value, this, _t);
+  String version(Object modifier) => localizeVersion(modifier, this, _t);
+}

filcnaplo_mobile_ui/lib/pages/home/live_card/live_card.dart

@@ -56,16 +56,43 @@ class _LiveCardState extends State<LiveCard> {
       case LiveCardState.summary:
         child = LiveCardWidget(
           key: const Key('livecard.summary'),
-          title: '',
+          title: 'Vége a tanévnek! 🥳',
           icon: FeatherIcons.arrowRight,
-          description: const Text(''),
-          onTap: () => Navigator.of(context).push(
-            MaterialPageRoute(
-              builder: (BuildContext context) => const SummaryScreen(
-                currentPage: 'grades',
-              ),
+          description: Text(
+            'Irány az összefoglaláshoz',
+            style: TextStyle(
+              fontWeight: FontWeight.w500,
+              fontSize: 18.0,
+              color: Theme.of(context).textTheme.bodyMedium?.color,
             ),
           ),
+          onTap: () {
+            // showSlidingBottomSheet(
+            //   context,
+            //   useRootNavigator: true,
+            //   builder: (context) => SlidingSheetDialog(
+            //     color: Colors.black.withOpacity(0.99),
+            //     duration: const Duration(milliseconds: 400),
+            //     scrollSpec: const ScrollSpec.bouncingScroll(),
+            //     snapSpec: const SnapSpec(
+            //       snap: true,
+            //       snappings: [1.0],
+            //       initialSnap: 1.0,
+            //       positioning: SnapPositioning.relativeToAvailableSpace,
+            //     ),
+            //     minHeight: MediaQuery.of(context).size.height,
+            //     cornerRadius: 16,
+            //     cornerRadiusOnFullscreen: 0,
+            //     builder: (context, state) => const Material(
+            //       color: Colors.black,
+            //       child: SummaryScreen(
+            //         currentPage: 'start',
+            //       ),
+            //     ),
+            //   ),
+            // );
+            SummaryScreen.show(context: context, currentPage: 'start');
+          },
         );
         break;
       case LiveCardState.morning:

filcnaplo_mobile_ui/lib/pages/home/live_card/live_card_widget.dart

@@ -81,22 +81,35 @@ class _LiveCardWidgetState extends State<LiveCardWidget> {
               child: widget.isEvent
                   ? Column(
                       crossAxisAlignment: CrossAxisAlignment.center,
-                      mainAxisAlignment: MainAxisAlignment.spaceAround,
+                      mainAxisAlignment: MainAxisAlignment.center,
                       children: [
                         Text(
                           widget.title ?? 'Esemény',
                           style: TextStyle(
-                            fontSize: 32,
+                            fontWeight: FontWeight.bold,
+                            fontSize: 24.0,
+                            color:
+                                Theme.of(context).textTheme.bodyMedium?.color,
                             fontStyle:
                                 widget.titleItalic ? FontStyle.italic : null,
                           ),
                         ),
                         Row(
                           crossAxisAlignment: CrossAxisAlignment.center,
-                          mainAxisAlignment: MainAxisAlignment.spaceAround,
+                          mainAxisAlignment: MainAxisAlignment.center,
                           children: [
                             widget.description ??
-                                const Text('Nincs leírás megadva.'),
+                                Text(
+                                  'Nincs leírás megadva.',
+                                  style: TextStyle(
+                                    fontWeight: FontWeight.w500,
+                                    fontSize: 18.0,
+                                    color: Theme.of(context)
+                                        .textTheme
+                                        .bodyMedium
+                                        ?.color,
+                                  ),
+                                ),
                             SizedBox(
                               height: 15,
                               child: Container(

filcnaplo_mobile_ui/lib/screens/summary/pages/allsum_page.dart

@@ -0,0 +1,227 @@
+import 'package:filcnaplo/api/providers/user_provider.dart';
+import 'package:filcnaplo_kreta_api/models/absence.dart';
+import 'package:filcnaplo_kreta_api/models/grade.dart';
+import 'package:filcnaplo_kreta_api/models/subject.dart';
+import 'package:filcnaplo_kreta_api/providers/absence_provider.dart';
+import 'package:filcnaplo_kreta_api/providers/grade_provider.dart';
+import 'package:filcnaplo_kreta_api/providers/homework_provider.dart';
+import 'package:filcnaplo_mobile_ui/screens/summary/summary_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+
+class AllSumBody extends StatefulWidget {
+  const AllSumBody({Key? key}) : super(key: key);
+
+  @override
+  _AllSumBodyState createState() => _AllSumBodyState();
+}
+
+class _AllSumBodyState extends State<AllSumBody> {
+  late UserProvider user;
+  late GradeProvider gradeProvider;
+  late HomeworkProvider homeworkProvider;
+  late AbsenceProvider absenceProvider;
+  //late TimetableProvider timetableProvider;
+
+  late Map<String, Map<String, dynamic>> things = {};
+  late List<Widget> firstSixTiles = [];
+  late List<Widget> lastSixTiles = [];
+
+  int avgDropValue = 0;
+  bool animation = false;
+
+  List<Grade> getSubjectGrades(Subject subject, {int days = 0}) => gradeProvider
+      .grades
+      .where((e) =>
+          e.subject == subject &&
+          e.type == GradeType.midYear &&
+          (days == 0 ||
+              e.date.isBefore(DateTime.now().subtract(Duration(days: days)))))
+      .toList();
+
+  @override
+  void initState() {
+    super.initState();
+
+    gradeProvider = Provider.of<GradeProvider>(context, listen: false);
+    homeworkProvider = Provider.of<HomeworkProvider>(context, listen: false);
+    absenceProvider = Provider.of<AbsenceProvider>(context, listen: false);
+    //timetableProvider = Provider.of<TimetableProvider>(context, listen: false);
+
+    WidgetsBinding.instance.addPostFrameCallback((timeStamp) {
+      setState(() {
+        animation = true;
+      });
+    });
+  }
+
+  void getGrades() {
+    var allGrades = gradeProvider.grades;
+    var testsGrades = gradeProvider.grades.where((a) => a.value.weight == 100);
+    var closingTestsGrades =
+        gradeProvider.grades.where((a) => a.value.weight >= 200);
+
+    things.addAll({
+      'tests': {'name': 'test'.i18n, 'value': testsGrades.length},
+      'closingTests': {
+        'name': 'closingtest'.i18n,
+        'value': closingTestsGrades.length
+      },
+      'grades': {'name': 'grade'.i18n, 'value': allGrades.length}
+    });
+  }
+
+  void getHomework() {
+    var allHomework = homeworkProvider.homework;
+
+    things.addAll({
+      'homework': {'name': 'hw'.i18n, 'value': allHomework.length}
+    });
+  }
+
+  void getSubjects() {
+    var allSubjects = gradeProvider.grades
+        .map((e) => e.subject)
+        .toSet()
+        .toList()
+      ..sort((a, b) => a.name.compareTo(b.name));
+    //var totalLessons;
+    var totalLessons = 0;
+
+    things.addAll({
+      'subjects': {'name': 'subject'.i18n, 'value': allSubjects.length},
+      'lessons': {'name': 'lesson'.i18n, 'value': totalLessons}
+    });
+  }
+
+  void getAbsences() {
+    var allAbsences = absenceProvider.absences.where((a) => a.delay == 0);
+    var excusedAbsences = absenceProvider.absences
+        .where((a) => a.state == Justification.excused && a.delay == 0);
+    var unexcusedAbsences = absenceProvider.absences.where((a) =>
+        (a.state == Justification.unexcused ||
+            a.state == Justification.pending) &&
+        a.delay == 0);
+
+    things.addAll({
+      'absences': {'name': 'absence_sum'.i18n, 'value': allAbsences.length},
+      'excusedAbsences': {
+        'name': 'excused'.i18n,
+        'value': excusedAbsences.length
+      },
+      'unexcusedAbsences': {
+        'name': 'unexcused'.i18n,
+        'value': unexcusedAbsences.length
+      }
+    });
+  }
+
+  void getDelays() {
+    var allDelays = absenceProvider.absences.where((a) => a.delay > 0);
+    var totalDelayTime = (allDelays.map((a) {
+      return a.delay;
+    }).toList())
+        .reduce((a, b) => a + b);
+    var unexcusedDelays = absenceProvider.absences
+        .where((a) => a.state == Justification.unexcused && a.delay > 0);
+
+    things.addAll({
+      'delays': {'name': 'delay_sum'.i18n, 'value': allDelays.length},
+      'totalDelay': {'name': 'min'.i18n, 'value': totalDelayTime},
+      'unexcusedDelays': {
+        'name': 'unexcused'.i18n,
+        'value': unexcusedDelays.length
+      }
+    });
+  }
+
+  void getEverything() {
+    getGrades();
+    getHomework();
+    getSubjects();
+    getAbsences();
+    getDelays();
+  }
+
+  void generateTiles() {
+    for (var i in things.values) {
+      Widget w = Column(
+        mainAxisAlignment: MainAxisAlignment.center,
+        crossAxisAlignment: CrossAxisAlignment.center,
+        children: [
+          Text(
+            i.values.toList()[1].toString(),
+            textAlign: TextAlign.center,
+            style: const TextStyle(
+              fontWeight: FontWeight.w800,
+              fontSize: 36.0,
+              color: Colors.white,
+            ),
+          ),
+          Text(
+            i.values.toList()[0],
+            textAlign: TextAlign.center,
+            style: const TextStyle(
+              fontSize: 18.0,
+              color: Colors.white,
+            ),
+          ),
+        ],
+      );
+
+      // TODO: az orakat es a hazikat szarul keri le, de majd meg lesz csinalva
+      if (firstSixTiles.length < 6) {
+        firstSixTiles.add(w);
+      } else if (lastSixTiles.length < 6) {
+        lastSixTiles.add(w);
+      } else {
+        break;
+      }
+    }
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    getEverything();
+    generateTiles();
+
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.center,
+      mainAxisAlignment: MainAxisAlignment.center,
+      children: [
+        const SizedBox(
+          height: 45,
+        ),
+        AnimatedContainer(
+          curve: Curves.easeInOut,
+          duration: const Duration(milliseconds: 420),
+          transform: Matrix4.translationValues(
+              animation ? 0 : MediaQuery.of(context).size.width, 0, 0),
+          height: 250,
+          child: GridView.count(
+            crossAxisCount: 3,
+            mainAxisSpacing: 0,
+            crossAxisSpacing: 5,
+            children: firstSixTiles,
+          ),
+        ),
+        const SizedBox(
+          height: 30,
+        ),
+        AnimatedContainer(
+          curve: Curves.easeInOut,
+          duration: const Duration(milliseconds: 420),
+          transform: Matrix4.translationValues(
+              animation ? 0 : -MediaQuery.of(context).size.width, 0, 0),
+          height: 250,
+          child: GridView.count(
+            crossAxisCount: 3,
+            mainAxisSpacing: 0,
+            crossAxisSpacing: 5,
+            children: lastSixTiles,
+          ),
+        ),
+      ],
+    );
+  }
+}

filcnaplo_mobile_ui/lib/screens/summary/pages/grades_page.dart

@@ -1,10 +1,362 @@
-import 'package:flutter/material.dart';
+import 'dart:math';
 
-class GradesBody extends StatelessWidget {
+import 'package:filcnaplo/api/providers/user_provider.dart';
+import 'package:filcnaplo/helpers/average_helper.dart';
+import 'package:filcnaplo/models/settings.dart';
+import 'package:filcnaplo/ui/widgets/grade/grade_tile.dart';
+import 'package:filcnaplo/utils/format.dart';
+import 'package:filcnaplo_kreta_api/models/grade.dart';
+import 'package:filcnaplo_kreta_api/models/subject.dart';
+import 'package:filcnaplo_kreta_api/providers/grade_provider.dart';
+import 'package:filcnaplo_mobile_ui/screens/summary/summary_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+import 'package:auto_size_text/auto_size_text.dart';
+import 'package:i18n_extension/i18n_widget.dart';
+
+List<String> faces = [
+  "(·.·)",
+  "(≥o≤)",
+  "(·_·)",
+  "(˚Δ˚)b",
+  "(^-^*)",
+  "(='X'=)",
+  "(>_<)",
+  "(;-;)",
+  "\\(^Д^)/",
+  "\\(o_o)/",
+];
+
+class GradesBody extends StatefulWidget {
   const GradesBody({Key? key}) : super(key: key);
 
+  @override
+  _GradesBodyState createState() => _GradesBodyState();
+}
+
+class _GradesBodyState extends State<GradesBody> {
+  late UserProvider user;
+  late GradeProvider gradeProvider;
+  late SettingsProvider settings;
+
+  late double subjectAvg;
+  late double endYearAvg;
+  late String endYearAvgText;
+
+  List<Widget> subjectTiles5 = [];
+  List<Widget> subjectTiles3 = [];
+  List<Widget> subjectTiles1 = [];
+
+  int avgDropValue = 0;
+  bool animation = false;
+
+  List<Grade> getSubjectGrades(Subject subject, {int days = 0}) => gradeProvider
+      .grades
+      .where((e) =>
+          e.subject == subject &&
+          e.type == GradeType.midYear &&
+          (days == 0 ||
+              e.date.isBefore(DateTime.now().subtract(Duration(days: days)))))
+      .toList();
+
+  @override
+  void initState() {
+    super.initState();
+
+    gradeProvider = Provider.of<GradeProvider>(context, listen: false);
+    settings = Provider.of<SettingsProvider>(context, listen: false);
+
+    WidgetsBinding.instance.addPostFrameCallback((timeStamp) {
+      setState(() {
+        animation = true;
+      });
+    });
+  }
+
+  void generateTiles({required int filter}) {
+    List<Subject> subjects = gradeProvider.grades
+        .map((e) => e.subject)
+        .toSet()
+        .toList()
+      ..sort((a, b) => a.name.compareTo(b.name));
+    List<Widget> tiles = [];
+
+    Map<Subject, double> subjectAvgs = {};
+
+    var count = 1;
+
+    for (Subject subject in subjects) {
+      List<Grade> subjectGrades = getSubjectGrades(subject);
+
+      double avg = AverageHelper.averageEvals(subjectGrades);
+      if (avg != 0) subjectAvgs[subject] = avg;
+
+      Widget widget = AnimatedContainer(
+        curve: Curves.easeInOut,
+        duration: Duration(milliseconds: 300 + (count * 120)),
+        transform: Matrix4.translationValues(
+            animation ? 0 : MediaQuery.of(context).size.width, 0, 0),
+        child: Row(
+          children: [
+            GradeValueWidget(
+              GradeValue(avg.round(), '', '', 100),
+              fill: true,
+              size: 28.0,
+            ),
+            const SizedBox(width: 8),
+            Text(
+              subject.renamedTo ?? subject.name.capital(),
+              maxLines: 2,
+              overflow: TextOverflow.ellipsis,
+              style: TextStyle(
+                fontWeight: FontWeight.bold,
+                fontSize: 20.0,
+                color: Colors.white.withOpacity(0.98),
+                fontStyle: settings.renamedSubjectsItalics && subject.isRenamed
+                    ? FontStyle.italic
+                    : null,
+              ),
+            )
+          ],
+        ),
+      );
+
+      if (avg.round() == filter) {
+        tiles.add(widget);
+        count++;
+      }
+    }
+
+    if (tiles.isEmpty) {
+      int index = Random(DateTime.now().minute).nextInt(faces.length);
+      Widget faceWidget = Center(
+        child: Text.rich(
+          TextSpan(
+            text: faces[index],
+            style: const TextStyle(
+              fontSize: 32.0,
+              fontWeight: FontWeight.w500,
+              color: Colors.white,
+            ),
+            children: [
+              TextSpan(
+                text: "\n${'no_grades'.i18n}",
+                style: TextStyle(
+                    fontSize: 18.0,
+                    height: 2.0,
+                    color: Colors.white.withOpacity(0.5)),
+              ),
+            ],
+          ),
+          textAlign: TextAlign.center,
+        ),
+      );
+      tiles.insert(0, faceWidget);
+    }
+
+    subjectAvg = subjectAvgs.isNotEmpty
+        ? subjectAvgs.values.fold(0.0, (double a, double b) => a + b) /
+            subjectAvgs.length
+        : 0.0;
+
+    List<Grade> endYearGrades = gradeProvider.grades
+        .where((grade) => grade.type == GradeType.endYear)
+        .toList();
+    endYearAvg = AverageHelper.averageEvals(endYearGrades, finalAvg: true);
+    endYearAvgText = endYearAvg.toStringAsFixed(1);
+    if (I18n.of(context).locale.languageCode != "en") {
+      endYearAvgText = endYearAvgText.replaceAll(".", ",");
+    }
+
+    if (filter == 5) {
+      subjectTiles5 = List.castFrom(tiles);
+      if (subjectTiles5.length > 4) {
+        subjectTiles5.length = 4;
+      }
+    } else if (filter == 3) {
+      subjectTiles3 = List.castFrom(tiles);
+      if (subjectTiles3.length > 3) {
+        subjectTiles3.length = 3;
+      }
+    } else if (filter == 1) {
+      subjectTiles1 = List.castFrom(tiles);
+      if (subjectTiles1.length > 2) {
+        subjectTiles1.length = 2;
+      }
+    }
+  }
+
+  void getGrades() {
+    generateTiles(filter: 5);
+    generateTiles(filter: 3);
+    generateTiles(filter: 1);
+  }
+
   @override
   Widget build(BuildContext context) {
-    return const Column();
+    user = Provider.of<UserProvider>(context);
+    settings = Provider.of<SettingsProvider>(context);
+
+    getGrades();
+
+    return Expanded(
+      child: ListView(
+        children: [
+          SizedBox(
+            height: ((100 * subjectTiles5.length) /
+                    (subjectTiles5[0].runtimeType == AnimatedContainer
+                        ? 1.95
+                        : 1.2))
+                .toDouble(),
+            child: ListView.builder(
+              padding: const EdgeInsets.only(left: 5),
+              physics: const BouncingScrollPhysics(),
+              itemCount: max(subjectTiles5.length, 1),
+              itemBuilder: (context, index) {
+                if (subjectTiles5.isNotEmpty) {
+                  EdgeInsetsGeometry panelPadding =
+                      const EdgeInsets.symmetric(horizontal: 24.0);
+
+                  if (subjectTiles5[index].runtimeType == AnimatedContainer) {
+                    return Padding(
+                        padding: const EdgeInsets.only(top: 8),
+                        child: subjectTiles5[index]);
+                  } else {
+                    return Padding(
+                        padding: panelPadding, child: subjectTiles5[index]);
+                  }
+                } else {
+                  return Container();
+                }
+              },
+            ),
+          ),
+          const SizedBox(height: 12.0),
+          Text(
+            'tryagain'.i18n,
+            style: const TextStyle(
+              fontWeight: FontWeight.bold,
+              fontSize: 22.0,
+              color: Colors.white,
+            ),
+          ),
+          const SizedBox(height: 12.0),
+          SizedBox(
+            height: ((100 * subjectTiles3.length) /
+                    (subjectTiles3[0].runtimeType == AnimatedContainer
+                        ? 1.95
+                        : 1.2))
+                .toDouble(),
+            child: ListView.builder(
+              padding: const EdgeInsets.only(left: 5),
+              physics: const BouncingScrollPhysics(),
+              itemCount: max(subjectTiles3.length, 1),
+              itemBuilder: (context, index) {
+                if (subjectTiles3.isNotEmpty) {
+                  EdgeInsetsGeometry panelPadding =
+                      const EdgeInsets.symmetric(horizontal: 24.0);
+
+                  if (subjectTiles3[index].runtimeType == AnimatedContainer) {
+                    return Padding(
+                        padding: const EdgeInsets.only(top: 8),
+                        child: subjectTiles3[index]);
+                  } else {
+                    return Padding(
+                        padding: panelPadding, child: subjectTiles3[index]);
+                  }
+                } else {
+                  return Container();
+                }
+              },
+            ),
+          ),
+          const SizedBox(height: 12.0),
+          Text(
+            'oops'.i18n,
+            style: const TextStyle(
+              fontWeight: FontWeight.bold,
+              fontSize: 22.0,
+              color: Colors.white,
+            ),
+          ),
+          const SizedBox(height: 12.0),
+          SizedBox(
+            height: ((100 * subjectTiles1.length) /
+                    (subjectTiles1[0].runtimeType == AnimatedContainer
+                        ? 1.95
+                        : 1.2))
+                .toDouble(),
+            child: ListView.builder(
+              padding: const EdgeInsets.only(left: 5),
+              physics: const BouncingScrollPhysics(),
+              itemCount: max(subjectTiles1.length, 1),
+              itemBuilder: (context, index) {
+                if (subjectTiles1.isNotEmpty) {
+                  EdgeInsetsGeometry panelPadding =
+                      const EdgeInsets.symmetric(horizontal: 24.0);
+
+                  if (subjectTiles1[index].runtimeType == AnimatedContainer) {
+                    return Padding(
+                        padding: const EdgeInsets.only(top: 8),
+                        child: subjectTiles1[index]);
+                  } else {
+                    return Padding(
+                        padding: panelPadding, child: subjectTiles1[index]);
+                  }
+                } else {
+                  return Container();
+                }
+              },
+            ),
+          ),
+          const SizedBox(height: 30.0),
+          Center(
+            child: Column(
+              mainAxisAlignment: MainAxisAlignment.center,
+              crossAxisAlignment: CrossAxisAlignment.center,
+              children: [
+                Text(
+                  'endyear_avg'.i18n,
+                  textAlign: TextAlign.center,
+                  style: const TextStyle(
+                    fontWeight: FontWeight.bold,
+                    fontSize: 22.0,
+                    color: Colors.white,
+                  ),
+                ),
+                Container(
+                  margin: const EdgeInsets.only(top: 10.0),
+                  padding: const EdgeInsets.symmetric(
+                      horizontal: 16.0, vertical: 4.0),
+                  decoration: BoxDecoration(
+                    color: gradeColor(context: context, value: endYearAvg)
+                        .withOpacity(.2),
+                    border: Border.all(
+                      color: (gradeColor(context: context, value: endYearAvg))
+                          .withOpacity(0.0),
+                      width: 2.0,
+                    ),
+                    borderRadius: BorderRadius.circular(45.0),
+                  ),
+                  child: AutoSizeText.rich(
+                    TextSpan(
+                      text: endYearAvgText,
+                    ),
+                    maxLines: 1,
+                    minFontSize: 5,
+                    textAlign: TextAlign.center,
+                    style: TextStyle(
+                      color: gradeColor(context: context, value: endYearAvg),
+                      fontWeight: FontWeight.w800,
+                      fontSize: 32.0,
+                    ),
+                  ),
+                ),
+              ],
+            ),
+          ),
+        ],
+      ),
+    );
   }
 }

filcnaplo_mobile_ui/lib/screens/summary/pages/lessons_page.dart

@@ -0,0 +1,319 @@
+import 'dart:math';
+
+import 'package:filcnaplo/api/providers/user_provider.dart';
+import 'package:filcnaplo/helpers/subject.dart';
+import 'package:filcnaplo/models/settings.dart';
+import 'package:filcnaplo/utils/format.dart';
+import 'package:filcnaplo_kreta_api/models/absence.dart';
+import 'package:filcnaplo_kreta_api/models/lesson.dart';
+import 'package:filcnaplo_kreta_api/models/subject.dart';
+import 'package:filcnaplo_kreta_api/models/week.dart';
+import 'package:filcnaplo_kreta_api/providers/absence_provider.dart';
+import 'package:filcnaplo_kreta_api/providers/timetable_provider.dart';
+import 'package:filcnaplo_mobile_ui/screens/summary/summary_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:provider/provider.dart';
+
+List<String> faces = [
+  "(·.·)",
+  "(≥o≤)",
+  "(·_·)",
+  "(˚Δ˚)b",
+  "(^-^*)",
+  "(='X'=)",
+  "(>_<)",
+  "(;-;)",
+  "\\(^Д^)/",
+  "\\(o_o)/",
+];
+
+class SubjectAbsence {
+  Subject subject;
+  List<Absence> absences;
+  double percentage;
+
+  SubjectAbsence(
+      {required this.subject, this.absences = const [], this.percentage = 0.0});
+}
+
+class LessonsBody extends StatefulWidget {
+  const LessonsBody({Key? key}) : super(key: key);
+
+  @override
+  _LessonsBodyState createState() => _LessonsBodyState();
+}
+
+class _LessonsBodyState extends State<LessonsBody> {
+  late UserProvider user;
+  late AbsenceProvider absenceProvider;
+  late SettingsProvider settingsProvider;
+  late TimetableProvider timetableProvider;
+
+  late List<SubjectAbsence> absences = [];
+  late List<Widget> lessons = [];
+  late List<Absence> delays = [];
+  final Map<Subject, Lesson> _lessonCount = {};
+
+  @override
+  void initState() {
+    super.initState();
+
+    absenceProvider = Provider.of<AbsenceProvider>(context, listen: false);
+    settingsProvider = Provider.of<SettingsProvider>(context, listen: false);
+    timetableProvider = Provider.of<TimetableProvider>(context, listen: false);
+
+    WidgetsBinding.instance.addPostFrameCallback((timeStamp) async {
+      for (final lesson in timetableProvider.getWeek(Week.current()) ?? []) {
+        if (!lesson.isEmpty &&
+            lesson.subject.id != '' &&
+            lesson.lessonYearIndex != null) {
+          _lessonCount.update(
+            lesson.subject,
+            (value) {
+              if (lesson.lessonYearIndex! > value.lessonYearIndex!) {
+                return lesson;
+              } else {
+                return value;
+              }
+            },
+            ifAbsent: () => lesson,
+          );
+        }
+      }
+      setState(() {});
+    });
+  }
+
+  void buildSubjectAbsences() {
+    Map<Subject, SubjectAbsence> _absences = {};
+
+    for (final absence in absenceProvider.absences) {
+      if (absence.delay != 0) continue;
+
+      if (!_absences.containsKey(absence.subject)) {
+        _absences[absence.subject] =
+            SubjectAbsence(subject: absence.subject, absences: [absence]);
+      } else {
+        _absences[absence.subject]?.absences.add(absence);
+      }
+    }
+
+    _absences.forEach((subject, absence) {
+      final absentLessonsOfSubject = absenceProvider.absences
+          .where((e) => e.subject == subject && e.delay == 0)
+          .length;
+      final totalLessonsOfSubject = _lessonCount[subject]?.lessonYearIndex ?? 0;
+
+      double absentLessonsOfSubjectPercentage;
+
+      if (absentLessonsOfSubject <= totalLessonsOfSubject) {
+        absentLessonsOfSubjectPercentage =
+            absentLessonsOfSubject / totalLessonsOfSubject * 100;
+      } else {
+        absentLessonsOfSubjectPercentage = -1;
+      }
+
+      _absences[subject]?.percentage =
+          absentLessonsOfSubjectPercentage.clamp(-1, 100.0);
+    });
+
+    absences = _absences.values.toList();
+    absences.sort((a, b) => -a.percentage.compareTo(b.percentage));
+  }
+
+  void getAndSortDelays() {
+    delays = absenceProvider.absences;
+    delays.sort((a, b) => -a.delay.compareTo(b.delay));
+  }
+
+  void generateTiles() {
+    Widget leastAbsent = Center(
+      child: Column(
+        mainAxisAlignment: MainAxisAlignment.center,
+        crossAxisAlignment: CrossAxisAlignment.center,
+        children: [
+          Icon(
+            SubjectIcon.resolveVariant(
+                subject: absences.last.subject, context: context),
+            color: Colors.white,
+            size: 64,
+          ),
+          Text(
+            absences.last.subject.renamedTo ??
+                absences.last.subject.name.capital(),
+            maxLines: 2,
+            overflow: TextOverflow.ellipsis,
+            style: TextStyle(
+              fontWeight: FontWeight.w800,
+              fontSize: 36.0,
+              fontStyle: absences.last.subject.isRenamed &&
+                      settingsProvider.renamedSubjectsItalics
+                  ? FontStyle.italic
+                  : null,
+              color: Colors.white,
+            ),
+          ),
+          Text(
+            'absence'.i18n.fill([absences.last.absences.length]),
+            style: const TextStyle(
+              fontSize: 18.0,
+              color: Colors.white,
+            ),
+          )
+        ],
+      ),
+    );
+    if (absences.last.absences.isNotEmpty) {
+      lessons.add(leastAbsent);
+    } else {
+      lessons.add(buildFaceWidget());
+    }
+
+    Widget mostAbsent = Center(
+      child: Column(
+        mainAxisAlignment: MainAxisAlignment.center,
+        crossAxisAlignment: CrossAxisAlignment.center,
+        children: [
+          Icon(
+            SubjectIcon.resolveVariant(
+                subject: absences.first.subject, context: context),
+            color: Colors.white,
+            size: 64,
+          ),
+          Text(
+            absences.first.subject.renamedTo ??
+                absences.first.subject.name.capital(),
+            maxLines: 2,
+            overflow: TextOverflow.ellipsis,
+            style: TextStyle(
+              fontWeight: FontWeight.w800,
+              fontSize: 36.0,
+              fontStyle: absences.first.subject.isRenamed &&
+                      settingsProvider.renamedSubjectsItalics
+                  ? FontStyle.italic
+                  : null,
+              color: Colors.white,
+            ),
+          ),
+          Text(
+            'absence'.i18n.fill([absences.first.absences.length]),
+            style: const TextStyle(
+              fontSize: 18.0,
+              color: Colors.white,
+            ),
+          )
+        ],
+      ),
+    );
+    if (absences.first.absences.isNotEmpty) {
+      lessons.add(mostAbsent);
+    } else {
+      lessons.add(buildFaceWidget());
+    }
+
+    Widget mostDelays = Center(
+      child: Column(
+        mainAxisAlignment: MainAxisAlignment.center,
+        crossAxisAlignment: CrossAxisAlignment.center,
+        children: [
+          Icon(
+            SubjectIcon.resolveVariant(
+                subject: delays.first.subject, context: context),
+            color: Colors.white,
+            size: 64,
+          ),
+          Text(
+            delays.first.subject.renamedTo ??
+                delays.first.subject.name.capital(),
+            maxLines: 2,
+            overflow: TextOverflow.ellipsis,
+            style: TextStyle(
+              fontWeight: FontWeight.w800,
+              fontSize: 36.0,
+              fontStyle: delays.first.subject.isRenamed &&
+                      settingsProvider.renamedSubjectsItalics
+                  ? FontStyle.italic
+                  : null,
+              color: Colors.white,
+            ),
+          ),
+          Text(
+            'delay'.i18n.fill([delays.first.delay]),
+            style: const TextStyle(
+              fontSize: 18.0,
+              color: Colors.white,
+            ),
+          )
+        ],
+      ),
+    );
+    if (delays.first.delay != 0) {
+      lessons.add(mostDelays);
+    } else {
+      lessons.add(buildFaceWidget());
+    }
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    buildSubjectAbsences();
+    getAndSortDelays();
+    generateTiles();
+
+    return Expanded(
+      child: ListView(
+        children: [
+          lessons[0],
+          const SizedBox(height: 18.0),
+          Text(
+            'dontfelt'.i18n,
+            style: const TextStyle(
+              fontWeight: FontWeight.bold,
+              fontSize: 22.0,
+              color: Colors.white,
+            ),
+          ),
+          const SizedBox(height: 18.0),
+          lessons[1],
+          const SizedBox(height: 18.0),
+          Text(
+            'youlate'.i18n,
+            style: const TextStyle(
+              fontWeight: FontWeight.bold,
+              fontSize: 22.0,
+              color: Colors.white,
+            ),
+          ),
+          const SizedBox(height: 18.0),
+          lessons[2],
+        ],
+      ),
+    );
+  }
+
+  Widget buildFaceWidget() {
+    int index = Random(DateTime.now().minute).nextInt(faces.length);
+    return Center(
+      child: Text.rich(
+        TextSpan(
+          text: faces[index],
+          style: const TextStyle(
+            fontSize: 32.0,
+            fontWeight: FontWeight.w500,
+            color: Colors.white,
+          ),
+          children: [
+            TextSpan(
+              text: "\n${'no_lesson'.i18n}",
+              style: TextStyle(
+                  fontSize: 18.0,
+                  height: 2.0,
+                  color: Colors.white.withOpacity(0.5)),
+            ),
+          ],
+        ),
+        textAlign: TextAlign.center,
+      ),
+    );
+  }
+}

filcnaplo_mobile_ui/lib/screens/summary/pages/personality_page.dart

@@ -1,10 +1,128 @@
-import 'package:flutter/material.dart';
+import 'dart:io';
 
-class PersonalityBody extends StatelessWidget {
+import 'package:filcnaplo/api/providers/user_provider.dart';
+import 'package:filcnaplo_mobile_ui/common/personality_card/empty_card.dart';
+import 'package:filcnaplo_mobile_ui/common/personality_card/personality_card.dart';
+import 'package:filcnaplo_mobile_ui/screens/summary/summary_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'package:screenshot/screenshot.dart';
+import 'package:share_plus/share_plus.dart';
+import 'package:path_provider/path_provider.dart';
+import 'package:image_gallery_saver/image_gallery_saver.dart';
+
+class PersonalityBody extends StatefulWidget {
   const PersonalityBody({Key? key}) : super(key: key);
 
+  @override
+  _PersonalityBodyState createState() => _PersonalityBodyState();
+}
+
+class _PersonalityBodyState extends State<PersonalityBody> {
+  late UserProvider user;
+
+  bool isRevealed = false;
+
+  ScreenshotController screenshotController = ScreenshotController();
+
+  sharePersonality() async {
+    await screenshotController.capture().then((image) async {
+      if (image != null) {
+        final directory = await getApplicationDocumentsDirectory();
+        if (await File('${directory.path}/refilc_personality.png').exists()) {
+          await File('${directory.path}/refilc_personality.png').delete();
+        }
+        final imagePath =
+            await File('${directory.path}/refilc_personality.png').create();
+        await imagePath.writeAsBytes(image);
+
+        await Share.shareXFiles([XFile(imagePath.path)]);
+      }
+    }).catchError((err) {
+      throw err;
+    });
+  }
+
+  savePersonality() async {
+    await screenshotController.capture().then((image) async {
+      if (image != null) {
+        await ImageGallerySaver.saveImage(image, name: 'refilc_personality');
+      }
+    }).catchError((err) {
+      throw err;
+    });
+  }
+
   @override
   Widget build(BuildContext context) {
-    return const Column();
+    user = Provider.of<UserProvider>(context);
+
+    return Expanded(
+      child: ListView(
+        children: [
+          const SizedBox(height: 30),
+          AnimatedCrossFade(
+            duration: const Duration(milliseconds: 1000),
+            sizeCurve: Curves.easeInToLinear,
+            firstChild: Screenshot(
+              controller: screenshotController,
+              child: PersonalityCard(user: user),
+            ),
+            secondChild: GestureDetector(
+              onTap: () => setState(() {
+                isRevealed = true;
+              }),
+              child: EmptyCard(text: 'click_reveal'.i18n),
+            ),
+            crossFadeState: isRevealed
+                ? CrossFadeState.showFirst
+                : CrossFadeState.showSecond,
+          ),
+          const SizedBox(height: 30),
+          if (isRevealed)
+            Center(
+              child: Row(
+                mainAxisAlignment: MainAxisAlignment.center,
+                crossAxisAlignment: CrossAxisAlignment.center,
+                children: [
+                  IconButton(
+                    onPressed: () async {
+                      await sharePersonality();
+                    },
+                    icon: const Icon(
+                      FeatherIcons.share,
+                      color: Colors.white,
+                      size: 30,
+                    ),
+                    style: ButtonStyle(
+                      backgroundColor: MaterialStateProperty.all(
+                          Colors.white.withOpacity(0.2)),
+                    ),
+                  ),
+                  const SizedBox(
+                    width: 10,
+                  ),
+                  IconButton(
+                    onPressed: () async {
+                      await savePersonality();
+                    },
+                    icon: const Icon(
+                      FeatherIcons.bookmark,
+                      color: Colors.white,
+                      size: 30,
+                    ),
+                    style: ButtonStyle(
+                      backgroundColor: MaterialStateProperty.all(
+                          Colors.white.withOpacity(0.2)),
+                    ),
+                  ),
+                ],
+              ),
+            ),
+          const SizedBox(height: 60),
+        ],
+      ),
+    );
   }
 }

filcnaplo_mobile_ui/lib/screens/summary/pages/start_page.dart

@@ -0,0 +1,98 @@
+import 'package:filcnaplo/api/providers/user_provider.dart';
+import 'package:filcnaplo/models/settings.dart';
+import 'package:filcnaplo_kreta_api/providers/grade_provider.dart';
+import 'package:filcnaplo_mobile_ui/screens/summary/summary_screen.dart';
+import 'package:filcnaplo_mobile_ui/screens/summary/summary_screen.i18n.dart';
+import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'package:wtf_sliding_sheet/wtf_sliding_sheet.dart';
+
+class StartBody extends StatefulWidget {
+  const StartBody({Key? key}) : super(key: key);
+
+  @override
+  _StartBodyState createState() => _StartBodyState();
+}
+
+class _StartBodyState extends State<StartBody> {
+  late UserProvider user;
+  late GradeProvider gradeProvider;
+  late SettingsProvider settings;
+
+  late String firstName;
+
+  @override
+  void initState() {
+    super.initState();
+
+    gradeProvider = Provider.of<GradeProvider>(context, listen: false);
+    settings = Provider.of<SettingsProvider>(context, listen: false);
+  }
+
+  @override
+  Widget build(BuildContext context) {
+    return Column(
+      crossAxisAlignment: CrossAxisAlignment.center,
+      mainAxisAlignment: MainAxisAlignment.spaceBetween,
+      children: [
+        const SizedBox(height: 40.0),
+        GestureDetector(
+          onTap: () {
+            Navigator.of(context).pop();
+            showSlidingBottomSheet(
+              context,
+              useRootNavigator: true,
+              builder: (context) => SlidingSheetDialog(
+                color: Colors.black.withOpacity(0.99),
+                duration: const Duration(milliseconds: 400),
+                scrollSpec: const ScrollSpec.bouncingScroll(),
+                snapSpec: const SnapSpec(
+                  snap: true,
+                  snappings: [1.0],
+                  initialSnap: 1.0,
+                  positioning: SnapPositioning.relativeToAvailableSpace,
+                ),
+                minHeight: MediaQuery.of(context).size.height,
+                cornerRadius: 16,
+                cornerRadiusOnFullscreen: 0,
+                builder: (context, state) => const Material(
+                  color: Colors.black,
+                  child: SummaryScreen(
+                    currentPage: 'grades',
+                    isBottomSheet: true,
+                  ),
+                ),
+              ),
+            );
+          },
+          child: Center(
+            child: Column(
+              mainAxisAlignment: MainAxisAlignment.center,
+              crossAxisAlignment: CrossAxisAlignment.center,
+              children: [
+                const Icon(
+                  FeatherIcons.arrowRight,
+                  size: 145,
+                  color: Colors.white,
+                  grade: 0.001,
+                  weight: 0.001,
+                ),
+                Text(
+                  'start'.i18n,
+                  textAlign: TextAlign.center,
+                  style: TextStyle(
+                    fontWeight: FontWeight.w500,
+                    fontSize: 16.0,
+                    color: Colors.white.withOpacity(0.7),
+                  ),
+                ),
+              ],
+            ),
+          ),
+        ),
+        const SizedBox(height: 169.69),
+      ],
+    );
+  }
+}

filcnaplo_mobile_ui/lib/screens/summary/summary_screen.dart

@@ -1,17 +1,48 @@
+import 'package:confetti/confetti.dart';
+import 'package:filcnaplo/api/providers/user_provider.dart';
+import 'package:filcnaplo/models/settings.dart';
+import 'package:flutter/cupertino.dart';
 import 'package:flutter/material.dart';
+import 'package:flutter_feather_icons/flutter_feather_icons.dart';
+import 'package:provider/provider.dart';
+import 'package:wtf_sliding_sheet/wtf_sliding_sheet.dart';
+import 'summary_screen.i18n.dart';
+
+import 'pages/allsum_page.dart';
+import 'pages/start_page.dart';
 import 'pages/grades_page.dart';
+import 'pages/lessons_page.dart';
+import 'pages/personality_page.dart';
 
 class SummaryScreen extends StatefulWidget {
   final String currentPage;
+  final bool isBottomSheet;
 
-  const SummaryScreen({Key? key, this.currentPage = 'personality'})
-      : super(key: key);
+  const SummaryScreen({
+    Key? key,
+    this.currentPage = 'personality',
+    this.isBottomSheet = false,
+  }) : super(key: key);
 
   @override
   _SummaryScreenState createState() => _SummaryScreenState();
+
+  static show(
+          {required BuildContext context,
+          String currentPage = 'personality'}) =>
+      Navigator.of(context, rootNavigator: true).push(CupertinoPageRoute(
+          builder: (context) => SummaryScreen(currentPage: currentPage)));
 }
 
-class _SummaryScreenState extends State<SummaryScreen> {
+class _SummaryScreenState extends State<SummaryScreen>
+    with SingleTickerProviderStateMixin {
+  late UserProvider user;
+  late SettingsProvider settings;
+
+  ConfettiController? _confettiController;
+
+  late String firstName;
+
   final LinearGradient _backgroundGradient = const LinearGradient(
     colors: [
       Color(0xff1d56ac),
@@ -22,34 +53,170 @@ class _SummaryScreenState extends State<SummaryScreen> {
     stops: [-1.0, 1.0],
   );
 
+  @override
+  void initState() {
+    super.initState();
+  }
+
+  @override
+  void dispose() {
+    _confettiController?.dispose();
+
+    super.dispose();
+  }
+
   @override
   Widget build(BuildContext context) {
-    return Scaffold(
-      body: Container(
+    user = Provider.of<UserProvider>(context);
+    settings = Provider.of<SettingsProvider>(context);
+
+    List<String> nameParts = user.displayName?.split(" ") ?? ["?"];
+    if (!settings.presentationMode) {
+      firstName = nameParts.length > 1 ? nameParts[1] : nameParts[0];
+    } else {
+      firstName = "János";
+    }
+
+    return widget.isBottomSheet
+        ? buildContainer()
+        : Scaffold(
+            body: buildContainer(),
+          );
+  }
+
+  Widget buildContainer() {
+    return Container(
+      decoration: BoxDecoration(gradient: _backgroundGradient),
+      child: Container(
         decoration: BoxDecoration(gradient: _backgroundGradient),
-        child: Container(
-          decoration: BoxDecoration(gradient: _backgroundGradient),
-          width: MediaQuery.of(context).size.width,
-          height: MediaQuery.of(context).size.height,
-          child: SafeArea(
-            child: Padding(
-              padding: EdgeInsets.only(
-                left: 24.0,
-                right: 24.0,
-                top: 26.0 + MediaQuery.of(context).padding.top,
-                bottom: 52.0,
-              ),
-              child: widget.currentPage == 'grades'
-                  ? const GradesBody()
-                  : widget.currentPage == 'lessons'
-                      ? const GradesBody()
-                      : widget.currentPage == 'allsum'
-                          ? const GradesBody()
-                          : const GradesBody(),
+        width: MediaQuery.of(context).size.width,
+        height: MediaQuery.of(context).size.height,
+        child: SafeArea(
+          child: Padding(
+            padding: const EdgeInsets.only(
+              left: 24.0,
+              right: 24.0,
+              top: 15.0,
+              bottom: 40.0,
+            ),
+            child: Column(
+              crossAxisAlignment: widget.currentPage == 'start'
+                  ? CrossAxisAlignment.center
+                  : CrossAxisAlignment.start,
+              mainAxisAlignment: widget.currentPage == 'start'
+                  ? MainAxisAlignment.spaceBetween
+                  : MainAxisAlignment.start,
+              children: [
+                Row(
+                  mainAxisAlignment: MainAxisAlignment.spaceBetween,
+                  crossAxisAlignment: CrossAxisAlignment.center,
+                  children: [
+                    Expanded(
+                      child: Column(
+                        crossAxisAlignment: CrossAxisAlignment.start,
+                        children: [
+                          Text(
+                            'greeting'.i18n.fill([firstName]),
+                            textAlign: TextAlign.left,
+                            maxLines: 2,
+                            overflow: TextOverflow.ellipsis,
+                            softWrap: true,
+                            style: const TextStyle(
+                              fontWeight: FontWeight.w900,
+                              fontSize: 26.0,
+                              color: Colors.white,
+                            ),
+                          ),
+                          Text(
+                            widget.currentPage == 'start'
+                                ? 'title_start'.i18n
+                                : widget.currentPage == 'grades'
+                                    ? 'title_grades'.i18n
+                                    : widget.currentPage == 'lessons'
+                                        ? 'title_lessons'.i18n
+                                        : widget.currentPage == 'personality'
+                                            ? 'title_personality'.i18n
+                                            : '',
+                            maxLines: 1,
+                            overflow: TextOverflow.fade,
+                            softWrap: false,
+                            style: const TextStyle(
+                              fontWeight: FontWeight.bold,
+                              fontSize: 22.0,
+                              color: Colors.white,
+                            ),
+                          ),
+                        ],
+                      ),
+                    ),
+                    widget.currentPage != 'start'
+                        ? IconButton(
+                            onPressed: () async {
+                              Navigator.of(context).pop();
+                              if (widget.currentPage == 'grades') {
+                                openNewPage(page: 'lessons');
+                              } else if (widget.currentPage == 'lessons') {
+                                openNewPage(page: 'allsum');
+                              } else if (widget.currentPage == 'allsum') {
+                                openNewPage(page: 'personality');
+                              } else {
+                                Navigator.of(context).maybePop();
+                              }
+                            },
+                            icon: Icon(
+                              widget.currentPage == 'personality'
+                                  ? FeatherIcons.x
+                                  : FeatherIcons.arrowRight,
+                              color: Colors.white,
+                            ),
+                          )
+                        : Container()
+                  ],
+                ),
+                const SizedBox(height: 12.0),
+                widget.currentPage == 'start'
+                    ? const StartBody()
+                    : widget.currentPage == 'grades'
+                        ? const GradesBody()
+                        : widget.currentPage == 'lessons'
+                            ? const LessonsBody()
+                            : widget.currentPage == 'allsum'
+                                ? const AllSumBody()
+                                : const PersonalityBody(),
+              ],
             ),
           ),
         ),
       ),
     );
   }
+
+  void openNewPage({String page = 'personality'}) {
+    showSlidingBottomSheet(
+      context,
+      useRootNavigator: true,
+      builder: (context) => SlidingSheetDialog(
+        color: Colors.black.withOpacity(0.99),
+        duration: const Duration(milliseconds: 400),
+        scrollSpec: const ScrollSpec.bouncingScroll(),
+        snapSpec: const SnapSpec(
+          snap: true,
+          snappings: [1.0],
+          initialSnap: 1.0,
+          positioning: SnapPositioning.relativeToAvailableSpace,
+        ),
+        minHeight: MediaQuery.of(context).size.height,
+        cornerRadius: 16,
+        cornerRadiusOnFullscreen: 0,
+        builder: (context, state) => Material(
+          color: Colors.black,
+          child: SummaryScreen(
+            currentPage: page,
+            isBottomSheet: true,
+          ),
+        ),
+      ),
+    );
+    //SummaryScreen.show(context: context, currentPage: page);
+  }
 }

filcnaplo_mobile_ui/lib/screens/summary/summary_screen.i18n.dart

@@ -3,9 +3,111 @@ import 'package:i18n_extension/i18n_extension.dart';
 extension SettingsLocalization on String {
   static final _t = Translations.byLocale("hu_hu") +
       {
-        "en_en": {},
-        "hu_hu": {},
-        "de_de": {},
+        "en_en": {
+          // main thingies
+          "no_grades": "No grades found",
+          "no_lesson": "No lessons found",
+          "greeting": "You had a good year, %s!",
+          "title_start": "So let's summarize...",
+          "title_grades": "Let's look at your marks... 📖",
+          "title_lessons": "Your favorite lesson 💓",
+          "title_personality": "Your personality is...",
+          // start page
+          "start": "Start",
+          // grades page
+          "tryagain": "He puts the master to the test! 🔃",
+          "oops": "Ouch... 🥴",
+          "endyear_avg": "Year-end average",
+          // lessons page
+          "absence": "%s absence(s)",
+          "delay": "A total of %s minute(s) late",
+          "dontfelt": "You didn't like it...",
+          "youlate": "You're late!",
+          // allsum page
+          "test": "test(s)",
+          "closingtest": "module test(s)",
+          "grade": "grades",
+          "hw": "homework",
+          "subject": "subjects",
+          "lesson": "lessons",
+          "absence_sum": "absence(s)",
+          "excused": "excused",
+          "unexcused": "unexcused",
+          "delay_sum": "delay(s)",
+          "min": "minute(s)",
+          // personality page
+          "click_reveal": "Click to reveal...",
+        },
+        "hu_hu": {
+          // main thingies
+          "no_grades": "Nincsenek jegyek",
+          "no_lesson": "Nincsenek tanórák",
+          "greeting": "Jó éved volt, %s!",
+          "title_start": "Összegezzünk hát...",
+          "title_grades": "Nézzük a jegyeidet... 📖",
+          "title_lessons": "A kedvenc órád 💓",
+          "title_personality": "A te személyiséged...",
+          // start page
+          "start": "Kezdés",
+          // grades page
+          "tryagain": "Próba teszi a mestert! 🔃",
+          "oops": "Ajjaj... 🥴",
+          "endyear_avg": "Év végi átlagod",
+          // lessons page
+          "absence": "%s hiányzás",
+          "delay": "Összesen %s perc késés",
+          "dontfelt": "Nem volt kedved hozzá...",
+          "youlate": "Késtél!",
+          // allsum page
+          "test": "dolgozat",
+          "closingtest": "témazáró",
+          "grade": "jegy",
+          "hw": "házi",
+          "subject": "tantárgy",
+          "lesson": "óra",
+          "absence_sum": "hiányzás",
+          "excused": "igazolt",
+          "unexcused": "igazolatlan",
+          "delay_sum": "késés",
+          "min": "perc",
+          // personality page
+          "click_reveal": "Kattints a felfedéshez...",
+        },
+        "de_de": {
+          // main thingies
+          "no_grades": "Keine Grade gefunden",
+          "no_lesson": "Keine Lektionen gefunden",
+          "greeting": "Du hattest ein gutes Jahr, %s!",
+          "title_start": "Fassen wir also zusammen...",
+          "title_grades": "Schauen wir uns eure Tickets an... 📖",
+          "title_lessons": "Deine Lieblingsuhr 💓",
+          "title_personality": "Deine Persönlichkeit...",
+          // start page
+          "start": "Anfang",
+          // grades page
+          "tryagain": "Er stellt den Meister auf die Probe! 🔃",
+          "oops": "Autsch... 🥴",
+          "endyear_avg": "Ihr Jahresenddurchschnitt",
+          // lessons page
+          "absence": "%s Abwesenheit(en)",
+          "delay": "Insgesamt %s Minute(n) zu spät",
+          "dontfelt": "Es hat dir nicht gefallen...",
+          "youlate": "Du bist spät!",
+          // allsum page
+          "test": "These(n)",
+          "closingtest": "Modultest",
+          "grade": "Grad",
+          "hw": "Hausaufgaben",
+          "subject": "Themen",
+          "lesson": "Lektionen",
+          "absence_sum": "Abwesenheit(en)",
+          "excused": "bescheinigte",
+          "unexcused": "unentschuldigte",
+          "delay_sum": "Verzögerung(en)",
+          "min": "Minute(n)",
+          // personality page
+          "click_reveal": "Klicken Sie hier, um es anzuzeigen...",
+        },
       };
 
   String get i18n => localize(this, _t);

filcnaplo_mobile_ui/pubspec.yaml

@@ -40,6 +40,9 @@ dependencies:
   background_fetch: ^1.1.5
   wtf_sliding_sheet: ^1.0.0
   package_info_plus: ^4.0.2
+  dotted_border: ^2.0.0+3
+  screenshot: ^2.1.0
+  image_gallery_saver: ^2.0.2
   
 dev_dependencies:
   flutter_lints: ^1.0.0

filcnaplo_premium/lib/ui/mobile/settings/modify_subject_names.dart

@@ -293,13 +293,10 @@ class _ModifySubjectNamesState extends State<ModifySubjectNames> {
               crossAxisAlignment: CrossAxisAlignment.start,
               children: [
                 Panel(
-                  child: PanelButton(
+                  child: SwitchListTile(
                       title: Text("italics_toggle".i18n),
-                      trailing: Switch(
-                        value: settings.renamedSubjectsItalics,
-                        onChanged: (value) =>
-                            settings.update(renamedSubjectsItalics: value),
-                      )),
+                      onChanged: (value) => settings.update(renamedSubjectsItalics: value),
+                      value: settings.renamedSubjectsItalics,),
                 ),
                 const SizedBox(
                   height: 20,